Detailed information for compound 1398027
Basic information
Technical information
- TDR Targets ID: 1398027
- Name: N-(3-ethylphenyl)-1-[(4-fluorophenyl)methyl]- 2,3-dimethylindole-5-carboxamide
- MW: 400.488 | Formula: C26H25FN2O
-
H donors: 1
H acceptors: 1
LogP: 6.09
Rotable bonds: 6
Rule of 5 violations (Lipinski): 1 - SMILES: CCc1cccc(c1)NC(=O)c1ccc2c(c1)c(C)c(n2Cc1ccc(cc1)F)C
- InChi: 1S/C26H25FN2O/c1-4-19-6-5-7-23(14-19)28-26(30)21-10-13-25-24(15-21)17(2)18(3)29(25)16-20-8-11-22(27)12-9-20/h5-15H,4,16H2,1-3H3,(H,28,30)
- InChiKey: KBVOTEBRFVZIEA-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- N-(3-ethylphenyl)-1-[(4-fluorophenyl)methyl]-2,3-dimethyl-indole-5-carboxamide
- N-(3-ethylphenyl)-1-[(4-fluorophenyl)methyl]-2,3-dimethyl-5-indolecarboxamide
- N-(3-ethylphenyl)-1-(4-fluorobenzyl)-2,3-dimethyl-indole-5-carboxamide
- G119-1328
- NCGC00128992-01
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | glucagon-like peptide 1 receptor | Starlite/ChEMBL | No references |
| Trypanosoma cruzi | cysteine peptidase, putative | Starlite/ChEMBL | No references |
| Homo sapiens | SMAD family member 2 | Starlite/ChEMBL | No references |
| Homo sapiens | TAR DNA binding protein | Starlite/ChEMBL | No references |
| Bacillus subtilis (strain 168) | ATP-dependent Clp protease proteolytic subunit | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Onchocerca volvulus | Cathepsin L homolog | 0.002 | 0.0733 | 1 |
| Brugia malayi | Corticotropin releasing factor receptor 2 precursor, putative | 0.006 | 0.3722 | 0.3722 |
| Toxoplasma gondii | ATP-dependent Clp endopeptidase, proteolytic subunit ClpP domain-containing protein | 0.0094 | 0.6282 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0019 | 0.0645 | 0.1027 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Treponema pallidum | ATP-dependent Clp protease proteolytic subunit | 0.0094 | 0.6282 | 1 |
| Entamoeba histolytica | cysteine protease, putative | 0.002 | 0.0733 | 1 |
| Onchocerca volvulus | 0.002 | 0.0733 | 1 | |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0077 | 0.4981 | 1 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.002 | 0.0733 | 0.0733 |
| Loa Loa (eye worm) | latrophilin receptor protein 2 | 0.0019 | 0.0645 | 0.0422 |
| Brugia malayi | Calcitonin receptor-like protein seb-1 | 0.006 | 0.3722 | 0.3722 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Onchocerca volvulus | 0.002 | 0.0733 | 1 | |
| Plasmodium falciparum | ATP-dependent Clp protease proteolytic subunit | 0.0033 | 0.1654 | 0.2633 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Mycobacterium ulcerans | ATP-dependent Clp protease proteolytic subunit | 0.0094 | 0.6282 | 0.5 |
| Schistosoma mansoni | peptidase Clp (S14 family) | 0.0094 | 0.6282 | 1 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0076 | 0.494 | 0.7865 |
| Loa Loa (eye worm) | ctsf protein | 0.002 | 0.0733 | 0.0512 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.4981 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.4981 | 1 |
| Toxoplasma gondii | ATP-dependent Clp endopeptidase, proteolytic subunit ClpP domain-containing protein | 0.0094 | 0.6282 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.0733 | 0.0733 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0014 | 0.0233 | 0.3182 |
| Loa Loa (eye worm) | TAR-binding protein | 0.0076 | 0.494 | 0.482 |
| Loa Loa (eye worm) | hypothetical protein | 0.006 | 0.3722 | 0.3572 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0014 | 0.0233 | 0.3182 |
| Echinococcus multilocularis | cysteine protease | 0.002 | 0.0733 | 0.1167 |
| Echinococcus multilocularis | cadherin EGF LAG seven pass G type receptor | 0.0019 | 0.0645 | 0.1027 |
| Plasmodium falciparum | cysteine proteinase falcipain 3 | 0.002 | 0.0733 | 0.1167 |
| Echinococcus multilocularis | GPCR, family 2 | 0.0019 | 0.0645 | 0.1027 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.4981 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.4981 | 1 |
| Onchocerca volvulus | 0.002 | 0.0733 | 1 | |
| Schistosoma mansoni | hypothetical protein | 0.0019 | 0.0645 | 0.1027 |
| Plasmodium vivax | vivapain-2 | 0.002 | 0.0733 | 0.1167 |
| Onchocerca volvulus | 0.002 | 0.0733 | 1 | |
| Schistosoma mansoni | hypothetical protein | 0.0041 | 0.2298 | 0.3658 |
| Loa Loa (eye worm) | hypothetical protein | 0.0094 | 0.6282 | 0.6193 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.002 | 0.0733 | 0.0512 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.002 | 0.0733 | 0.1472 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.0733 | 0.0733 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0077 | 0.4981 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Brugia malayi | latrophilin 2 splice variant baaae | 0.0041 | 0.2298 | 0.2298 |
| Brugia malayi | Latrophilin receptor protein 2 | 0.0019 | 0.0645 | 0.0645 |
| Brugia malayi | Cathepsin L-like cysteine proteinase | 0.0014 | 0.0233 | 0.0233 |
| Loa Loa (eye worm) | hypothetical protein | 0.002 | 0.0733 | 0.0512 |
| Trypanosoma cruzi | cruzipain precursor, putative | 0.0077 | 0.4981 | 1 |
| Chlamydia trachomatis | ATP-dependent Clp protease proteolytic subunit | 0.0094 | 0.6282 | 0.5 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0076 | 0.494 | 0.7865 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0077 | 0.4981 | 1 |
| Onchocerca volvulus | 0.002 | 0.0733 | 1 | |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.0733 | 0.0733 |
| Loa Loa (eye worm) | Papain cysteine protease/cathepsin propeptide inhibitor-containing protein | 0.002 | 0.0733 | 0.0512 |
| Echinococcus granulosus | cathepsin L cysteine proteinase | 0.002 | 0.0733 | 0.1167 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0076 | 0.494 | 0.7865 |
| Echinococcus multilocularis | peptidase Clp (S14 family) | 0.0062 | 0.3849 | 0.6128 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.002 | 0.0733 | 0.1167 |
| Plasmodium vivax | ATP-dependent Clp protease proteolytic subunit, putative | 0.0094 | 0.6282 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.0733 | 0.0733 |
| Mycobacterium leprae | PROBABLE ATP-DEPENDENT CLP PROTEASE PROTEOLYTIC SUBUNIT 2 CLPP2 (ENDOPEPTIDASE CLP 2) | 0.0094 | 0.6282 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.4981 | 1 |
| Loa Loa (eye worm) | cysteine protease | 0.002 | 0.0733 | 0.0512 |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 0.2298 | 0.2114 |
| Echinococcus multilocularis | tar DNA binding protein | 0.0076 | 0.494 | 0.7865 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0019 | 0.0645 | 0.0422 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0014 | 0.0233 | 0.0371 |
| Echinococcus multilocularis | cysteine protease | 0.002 | 0.0733 | 0.1167 |
| Echinococcus multilocularis | diuretic hormone 44 receptor GPRdih2 | 0.0019 | 0.0645 | 0.1027 |
| Echinococcus granulosus | ATP dependent Clp protease proteolytic subunit | 0.0094 | 0.6282 | 1 |
| Onchocerca volvulus | 0.002 | 0.0733 | 1 | |
| Brugia malayi | RNA binding protein | 0.0076 | 0.494 | 0.494 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0076 | 0.494 | 0.7865 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.002 | 0.0733 | 1 |
| Plasmodium falciparum | cysteine proteinase falcipain 2b | 0.002 | 0.0733 | 0.1167 |
| Onchocerca volvulus | Cathepsin L homolog | 0.002 | 0.0733 | 1 |
| Echinococcus granulosus | diuretic hormone 44 receptor GPRdih2 | 0.0019 | 0.0645 | 0.1027 |
| Loa Loa (eye worm) | RNA recognition domain-containing protein domain-containing protein | 0.0076 | 0.494 | 0.482 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.0733 | 0.0733 |
| Brugia malayi | Probable ClpP-like protease | 0.0094 | 0.6282 | 0.6282 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.002 | 0.0733 | 1 |
| Echinococcus granulosus | GPCR family 2 | 0.0019 | 0.0645 | 0.1027 |
| Leishmania major | cathepsin L-like protease | 0.0077 | 0.4981 | 1 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.002 | 0.0733 | 0.1167 |
| Schistosoma mansoni | hypothetical protein | 0.0019 | 0.0645 | 0.1027 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Trypanosoma cruzi | major cysteine proteinase, putative | 0.0061 | 0.3748 | 0.7525 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0077 | 0.4981 | 1 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.002 | 0.0733 | 0.1167 |
| Plasmodium vivax | vivapain-2 | 0.002 | 0.0733 | 0.1167 |
| Toxoplasma gondii | hypothetical protein | 0.0033 | 0.1654 | 0.1659 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.4981 | 1 |
| Loa Loa (eye worm) | fibroinase | 0.002 | 0.0733 | 0.0512 |
| Echinococcus granulosus | tar DNA binding protein | 0.0076 | 0.494 | 0.7865 |
| Mycobacterium ulcerans | ATP-dependent Clp protease proteolytic subunit | 0.0094 | 0.6282 | 0.5 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Mycobacterium tuberculosis | Probable ATP-dependent CLP protease proteolytic subunit 2 ClpP2 (endopeptidase CLP 2) | 0.0062 | 0.3849 | 0.5 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.4981 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.4981 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0077 | 0.4981 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.4981 | 1 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0076 | 0.494 | 0.7865 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Echinococcus multilocularis | ATP dependent Clp protease proteolytic subunit | 0.0094 | 0.6282 | 1 |
| Brugia malayi | cathepsin L-like precursor | 0.0014 | 0.0233 | 0.0233 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0014 | 0.0233 | 0.3182 |
| Chlamydia trachomatis | ATP-dependent Clp protease proteolytic subunit | 0.0094 | 0.6282 | 0.5 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Loa Loa (eye worm) | RNA binding protein | 0.0076 | 0.494 | 0.482 |
| Echinococcus granulosus | peptidase Clp S14 family | 0.0062 | 0.3849 | 0.6128 |
| Echinococcus granulosus | cathepsin l1 | 0.0014 | 0.0233 | 0.0371 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Loa Loa (eye worm) | pigment dispersing factor receptor c | 0.006 | 0.3722 | 0.3572 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Echinococcus granulosus | cathepsin l cysteine peptidase | 0.002 | 0.0733 | 0.1167 |
| Wolbachia endosymbiont of Brugia malayi | ATP-dependent Clp protease proteolytic subunit | 0.0094 | 0.6282 | 0.5 |
| Brugia malayi | Cathepsin L-like precursor | 0.0014 | 0.0233 | 0.0233 |
| Brugia malayi | TAR-binding protein | 0.0076 | 0.494 | 0.494 |
| Plasmodium falciparum | cysteine proteinase falcipain 2a | 0.002 | 0.0733 | 0.1167 |
| Mycobacterium leprae | PROBABLE ATP-DEPENDENT CLP PROTEASE PROTEOLYTIC SUBUNIT 1 CLPP1 (ENDOPEPTIDASE CLP) | 0.0062 | 0.3849 | 0.4744 |
| Plasmodium vivax | ATP-dependent Clp protease proteolytic subunit, putative | 0.0033 | 0.1654 | 0.2633 |
| Echinococcus granulosus | cathepsin l1 | 0.002 | 0.0733 | 0.1167 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.4981 | 1 |
| Onchocerca volvulus | 0.002 | 0.0733 | 1 | |
| Onchocerca volvulus | Cathepsin F homolog | 0.002 | 0.0733 | 1 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.002 | 0.0733 | 0.1167 |
| Brugia malayi | Cathepsin L-like precursor | 0.0014 | 0.0233 | 0.0233 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.4981 | 1 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.002 | 0.0733 | 0.1167 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Brugia malayi | RNA recognition motif domain containing protein | 0.0076 | 0.494 | 0.494 |
| Trypanosoma cruzi | cysteine peptidase, clan CA, family C1, cathepsin L-like, putative | 0.007 | 0.4481 | 0.8997 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.002 | 0.0733 | 0.1167 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0733 | 1 |
| Brugia malayi | calcium-independent alpha-latrotoxin receptor 2, putative | 0.0019 | 0.0645 | 0.0645 |
| Plasmodium falciparum | ATP-dependent Clp protease proteolytic subunit | 0.0094 | 0.6282 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0019 | 0.0645 | 0.1027 |
| Mycobacterium tuberculosis | Probable ATP-dependent CLP protease proteolytic subunit 1 ClpP1 (endopeptidase CLP) | 0.0062 | 0.3849 | 0.5 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.0733 | 0.0733 |
| Echinococcus granulosus | cadherin EGF LAG seven pass G type receptor | 0.0019 | 0.0645 | 0.1027 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Potency (functional) | 0.0891 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of TGF-b. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588856, AID588860] | ChEMBL. | No reference |
| Potency (functional) | 3.5481 uM | PubChem BioAssay. qHTS of TDP-43 Inhibitors. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 10 uM | PubChem BioAssay. qHTS of GLP-1 Receptor Inverse Agonists (Inhibition Mode). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 15.8489 um | PUBCHEM_BIOASSAY: qHTS Assay for Promiscuous and Specific Inhibitors of Cruzain (without detergent). (Class of assay: confirmatory) [Related pubchem assays: 2158 (Confirmation qHTS Assay for Inhibitors of Cruzain), 2249 (Probe Development Summary of Promiscuous Inhibitors (Artifacts) of Cruzain), 2161 (qHTS Assay for Inhibitors of Papain: Counterscreen for Cruzain Assay), 1478 (qHTS Assay for Promiscuous and Specific Inhibitors of Cruzain (with detergent))] | ChEMBL. | No reference |
| Potency (functional) | 17.7828 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of TGF-b: Cytotox Counterscreen. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588855, AID588860] | ChEMBL. | No reference |
| Potency (functional) | 19.9526 uM | PubChem BioAssay. qHTS Assay for Activators of ClpP. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (binding) | = 50.1187 um | PUBCHEM_BIOASSAY: qHTS Assay for Identification of Novel General Anesthetics. In this assay, a GABAergic mimetic model system, apoferritin and a profluorescent 1-aminoanthracene ligand (1-AMA), was used to construct a competitive binding assay for identification of novel general anesthetics (Class of assay: confirmatory) [Related pubchem assays: 2385 (Probe Development Summary for Identification of Novel General Anesthetics), 2323 (Validation apoferritin assay run on SigmaAldrich LOPAC1280 collection)] | ChEMBL. | No reference |
| Potency (functional) | 89.1251 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Polymerase Kappa. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588638] | ChEMBL. | No reference |
| Potency (functional) | 89.1251 uM | PubChem BioAssay. qHTS Assay to Find Inhibitors of Pin1. (Class of assay: confirmatory) | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Homo sapiens | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1533301
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.