Detailed information for compound 1402992
Basic information
Technical information
- Name: Unnamed compound
- MW: 428.483 | Formula: C25H24N4O3
-
H donors: 2
H acceptors: 4
LogP: 4.07
Rotable bonds: 8
Rule of 5 violations (Lipinski): 1 - SMILES: COc1ccccc1CN(C(=O)Nc1cccc(c1)C)Cc1nc(O)c2c(n1)cccc2
- InChi: 1S/C25H24N4O3/c1-17-8-7-10-19(14-17)26-25(31)29(15-18-9-3-6-13-22(18)32-2)16-23-27-21-12-5-4-11-20(21)24(30)28-23/h3-14H,15-16H2,1-2H3,(H,26,31)(H,27,28,30)
- InChiKey: OIXMUOYWISUWBT-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | isocitrate dehydrogenase 1 (NADP+), soluble | Starlite/ChEMBL | No references |
| Rattus norvegicus | Thioredoxin reductase 1, cytoplasmic | Starlite/ChEMBL | No references |
| Influenza A virus | Nonstructural protein 1 | Starlite/ChEMBL | No references |
| Homo sapiens | tyrosyl-DNA phosphodiesterase 1 | Starlite/ChEMBL | No references |
| Homo sapiens | SMAD family member 2 | Starlite/ChEMBL | No references |
| Mus musculus | RAR-related orphan receptor gamma | Starlite/ChEMBL | No references |
| Homo sapiens | glucagon-like peptide 1 receptor | Starlite/ChEMBL | No references |
| Homo sapiens | APEX nuclease (multifunctional DNA repair enzyme) 1 | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Brugia malayi | hypothetical protein | 0.0064 | 0.2766 | 0.3605 |
| Loa Loa (eye worm) | hypothetical protein | 0.0048 | 0.1761 | 0.2294 |
| Entamoeba histolytica | tyrosyl-DNA phosphodiesterase, putative | 0.008 | 0.3721 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0048 | 0.1761 | 0.2294 |
| Plasmodium falciparum | glutathione reductase | 0.002 | 0.0045 | 0.0186 |
| Onchocerca volvulus | 0.0112 | 0.5695 | 1 | |
| Mycobacterium tuberculosis | Dihydrolipoamide dehydrogenase LpdC (lipoamide reductase (NADH)) (lipoyl dehydrogenase) (dihydrolipoyl dehydrogenase) (diaphoras | 0.0145 | 0.7712 | 1 |
| Brugia malayi | hypothetical protein | 0.0048 | 0.1761 | 0.2294 |
| Brugia malayi | LBP/BPI | 0.0048 | 0.1761 | 0.2294 |
| Mycobacterium tuberculosis | Probable dehydrogenase | 0.013 | 0.682 | 0.8844 |
| Onchocerca volvulus | 0.0064 | 0.2766 | 0.2556 | |
| Brugia malayi | Thioredoxin reductase | 0.0057 | 0.2334 | 0.3041 |
| Brugia malayi | LBP / BPI / CETP family, C-terminal domain containing protein | 0.0064 | 0.2766 | 0.3605 |
| Toxoplasma gondii | pyruvate dehydrogenase complex subunit PDH-E3II | 0.002 | 0.0045 | 0.0186 |
| Schistosoma mansoni | ap endonuclease | 0.0023 | 0.0225 | 0.0225 |
| Mycobacterium tuberculosis | Probable NADH dehydrogenase Ndh | 0.013 | 0.682 | 0.8844 |
| Trypanosoma cruzi | tyrosyl-DNA Phosphodiesterase (Tdp1), putative | 0.008 | 0.3721 | 1 |
| Plasmodium vivax | thioredoxin reductase, putative | 0.0057 | 0.2334 | 1 |
| Toxoplasma gondii | thioredoxin reductase | 0.0057 | 0.2334 | 1 |
| Echinococcus granulosus | DNA apurinic or apyrimidinic site lyase | 0.0023 | 0.0225 | 0.0604 |
| Onchocerca volvulus | 0.0112 | 0.5695 | 1 | |
| Plasmodium vivax | AP endonuclease (DNA-[apurinic or apyrimidinic site] lyase), putative | 0.0023 | 0.0225 | 0.0955 |
| Brugia malayi | Corticotropin releasing factor receptor 2 precursor, putative | 0.006 | 0.2524 | 0.3289 |
| Plasmodium falciparum | thioredoxin reductase | 0.0057 | 0.2334 | 1 |
| Loa Loa (eye worm) | LBP/BPI/CETP family domain-containing protein | 0.0064 | 0.2766 | 0.3605 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.002 | 0.0045 | 0.0117 |
| Trichomonas vaginalis | ap endonuclease, putative | 0.0023 | 0.0225 | 0.1045 |
| Brugia malayi | LBP / BPI / CETP family, C-terminal domain containing protein | 0.0064 | 0.2766 | 0.3605 |
| Brugia malayi | Isocitrate dehydrogenase | 0.0019 | 0.0002 | 0.0002 |
| Leishmania major | apurinic/apyrimidinic endonuclease-redox protein | 0.0023 | 0.0225 | 0.0599 |
| Echinococcus multilocularis | thioredoxin glutathione reductase | 0.0057 | 0.2334 | 0.6272 |
| Schistosoma mansoni | hypothetical protein | 0.0041 | 0.1356 | 0.1356 |
| Echinococcus multilocularis | tyrosyl DNA phosphodiesterase 1 | 0.008 | 0.3721 | 1 |
| Chlamydia trachomatis | dihydrolipoyl dehydrogenase | 0.002 | 0.0045 | 0.5 |
| Plasmodium falciparum | thioredoxin reductase | 0.002 | 0.0045 | 0.0186 |
| Loa Loa (eye worm) | LBP/BPI/CETP family domain-containing protein | 0.0112 | 0.5695 | 0.7422 |
| Loa Loa (eye worm) | hypothetical protein | 0.0064 | 0.2766 | 0.3605 |
| Leishmania major | acetoin dehydrogenase e3 component-like protein | 0.002 | 0.0045 | 0.0117 |
| Schistosoma mansoni | NADP-specific isocitrate dehydrogenase | 0.0019 | 0.0002 | 0.0002 |
| Treponema pallidum | exodeoxyribonuclease (exoA) | 0.0023 | 0.0225 | 1 |
| Loa Loa (eye worm) | MH2 domain-containing protein | 0.0144 | 0.7674 | 1 |
| Echinococcus multilocularis | isocitrate dehydrogenase 2 (NADP+) | 0.0019 | 0.0002 | 0.0005 |
| Loa Loa (eye worm) | hypothetical protein | 0.0064 | 0.2766 | 0.3605 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.002 | 0.0045 | 0.0117 |
| Loa Loa (eye worm) | LBP/BPI/CETP family domain-containing protein | 0.0064 | 0.2766 | 0.3605 |
| Trypanosoma cruzi | apurinic/apyrimidinic endonuclease | 0.0023 | 0.0225 | 0.0599 |
| Echinococcus multilocularis | DNA (apurinic or apyrimidinic site) lyase | 0.0023 | 0.0225 | 0.0604 |
| Loa Loa (eye worm) | isocitrate dehydrogenase | 0.0019 | 0.0002 | 0.0002 |
| Loa Loa (eye worm) | hypothetical protein | 0.0064 | 0.2766 | 0.3605 |
| Leishmania major | dihydrolipoamide dehydrogenase, putative | 0.002 | 0.0045 | 0.0117 |
| Brugia malayi | dihydrolipoyl dehydrogenase, mitochondrial precursor, putative | 0.002 | 0.0045 | 0.0059 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.002 | 0.0045 | 0.0117 |
| Onchocerca volvulus | 0.0112 | 0.5695 | 1 | |
| Trypanosoma brucei | dihydrolipoyl dehydrogenase | 0.002 | 0.0045 | 0.0117 |
| Loa Loa (eye worm) | tyrosyl-DNA phosphodiesterase | 0.008 | 0.3721 | 0.4849 |
| Brugia malayi | LBP / BPI / CETP family, C-terminal domain containing protein | 0.0112 | 0.5695 | 0.7422 |
| Trypanosoma brucei | dihydrolipoamide dehydrogenase | 0.002 | 0.0045 | 0.0117 |
| Brugia malayi | isocitrate dehydrogenase | 0.0019 | 0.0002 | 0.0002 |
| Giardia lamblia | Endonuclease/Exonuclease/phosphatase | 0.0023 | 0.0225 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 0.1356 | 0.1767 |
| Brugia malayi | Calcitonin receptor-like protein seb-1 | 0.006 | 0.2524 | 0.3289 |
| Onchocerca volvulus | 0.0112 | 0.5695 | 1 | |
| Trypanosoma cruzi | trypanothione reductase, putative | 0.002 | 0.0045 | 0.0117 |
| Leishmania major | trypanothione reductase | 0.0057 | 0.2334 | 0.627 |
| Trypanosoma brucei | tyrosyl-DNA Phosphodiesterase (Tdp1), putative | 0.008 | 0.3721 | 1 |
| Leishmania major | tyrosyl-DNA phosphodiesterase 1 | 0.008 | 0.3721 | 1 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.002 | 0.0045 | 0.0117 |
| Loa Loa (eye worm) | hypothetical protein | 0.0048 | 0.1761 | 0.2294 |
| Toxoplasma gondii | NADPH-glutathione reductase | 0.002 | 0.0045 | 0.0186 |
| Trypanosoma brucei | apurinic/apyrimidinic endonuclease, putative | 0.0023 | 0.0225 | 0.0599 |
| Loa Loa (eye worm) | transcription factor SMAD2 | 0.0144 | 0.7674 | 1 |
| Brugia malayi | hypothetical protein | 0.0064 | 0.2766 | 0.3605 |
| Loa Loa (eye worm) | hypothetical protein | 0.006 | 0.2524 | 0.3289 |
| Echinococcus granulosus | transcription factor Dp 1 | 0.0046 | 0.1662 | 0.4466 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.002 | 0.0045 | 0.0117 |
| Brugia malayi | latrophilin 2 splice variant baaae | 0.0041 | 0.1356 | 0.1767 |
| Trypanosoma brucei | dihydrolipoamide dehydrogenase, point mutation | 0.002 | 0.0045 | 0.0117 |
| Onchocerca volvulus | 0.0112 | 0.5695 | 1 | |
| Mycobacterium tuberculosis | NADPH-dependent mycothiol reductase Mtr | 0.0057 | 0.2334 | 0.3025 |
| Loa Loa (eye worm) | hypothetical protein | 0.0048 | 0.1761 | 0.2294 |
| Echinococcus multilocularis | NADP dependent isocitrate dehydrogenase | 0.0019 | 0.0002 | 0.0005 |
| Mycobacterium tuberculosis | Putative ferredoxin reductase | 0.013 | 0.682 | 0.8844 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0048 | 0.1761 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0112 | 0.5695 | 0.7422 |
| Brugia malayi | Tyrosyl-DNA phosphodiesterase family protein | 0.008 | 0.3721 | 0.4849 |
| Leishmania major | dihydrolipoamide dehydrogenase, putative | 0.002 | 0.0045 | 0.0117 |
| Loa Loa (eye worm) | thioredoxin reductase | 0.0057 | 0.2334 | 0.3041 |
| Wolbachia endosymbiont of Brugia malayi | exonuclease III | 0.0023 | 0.0225 | 1 |
| Onchocerca volvulus | 0.0064 | 0.2766 | 0.2556 | |
| Trypanosoma cruzi | trypanothione reductase, putative | 0.0057 | 0.2334 | 0.627 |
| Echinococcus granulosus | dihydrolipoamide dehydrogenase | 0.002 | 0.0045 | 0.0122 |
| Loa Loa (eye worm) | pigment dispersing factor receptor c | 0.006 | 0.2524 | 0.3289 |
| Schistosoma mansoni | ap endonuclease | 0.0023 | 0.0225 | 0.0225 |
| Mycobacterium tuberculosis | Probable membrane NADH dehydrogenase NdhA | 0.013 | 0.682 | 0.8844 |
| Trypanosoma brucei | dihydrolipoamide dehydrogenase | 0.002 | 0.0045 | 0.0117 |
| Plasmodium falciparum | dihydrolipoyl dehydrogenase, apicoplast | 0.002 | 0.0045 | 0.0186 |
| Loa Loa (eye worm) | hypothetical protein | 0.0064 | 0.2766 | 0.3605 |
| Brugia malayi | MH2 domain containing protein | 0.0144 | 0.7674 | 1 |
| Leishmania major | 2-oxoglutarate dehydrogenase, e3 component, lipoamidedehydrogenase-like protein | 0.002 | 0.0045 | 0.0117 |
| Mycobacterium ulcerans | exodeoxyribonuclease III protein XthA | 0.0023 | 0.0225 | 1 |
| Trypanosoma cruzi | tyrosyl-DNA Phosphodiesterase (Tdp1), putative | 0.008 | 0.3721 | 1 |
| Echinococcus granulosus | thioredoxin glutathione reductase | 0.0057 | 0.2334 | 0.6272 |
| Schistosoma mansoni | tyrosyl-DNA phosphodiesterase | 0.008 | 0.3721 | 0.3721 |
| Echinococcus multilocularis | transcription factor Dp 1 | 0.0046 | 0.1662 | 0.4466 |
| Echinococcus multilocularis | isocitrate dehydrogenase | 0.0019 | 0.0002 | 0.0005 |
| Echinococcus granulosus | NADP dependent isocitrate dehydrogenase | 0.0019 | 0.0002 | 0.0005 |
| Schistosoma mansoni | dihydrolipoamide dehydrogenase | 0.002 | 0.0045 | 0.0045 |
| Plasmodium falciparum | AP endonuclease (DNA-[apurinic or apyrimidinic site] lyase), putative | 0.0023 | 0.0225 | 0.0955 |
| Plasmodium falciparum | glutathione reductase | 0.0057 | 0.2334 | 1 |
| Mycobacterium tuberculosis | NAD(P)H quinone reductase LpdA | 0.0145 | 0.7712 | 1 |
| Plasmodium falciparum | dihydrolipoyl dehydrogenase, mitochondrial | 0.002 | 0.0045 | 0.0186 |
| Mycobacterium tuberculosis | Probable soluble pyridine nucleotide transhydrogenase SthA (STH) (NAD(P)(+) transhydrogenase [B-specific]) (nicotinamide nucleot | 0.002 | 0.0045 | 0.0056 |
| Brugia malayi | exodeoxyribonuclease III family protein | 0.0023 | 0.0225 | 0.0293 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0145 | 0.7712 | 1 |
| Trypanosoma brucei | trypanothione reductase | 0.0057 | 0.2334 | 0.627 |
| Plasmodium vivax | dihydrolipoyl dehydrogenase, mitochondrial, putative | 0.002 | 0.0045 | 0.0186 |
| Brugia malayi | LBP / BPI / CETP family, N-terminal domain containing protein | 0.0112 | 0.5695 | 0.7422 |
| Trypanosoma cruzi | dihydrolipoyl dehydrogenase, putative | 0.002 | 0.0045 | 0.0117 |
| Onchocerca volvulus | 0.0112 | 0.5695 | 1 | |
| Mycobacterium tuberculosis | Probable reductase | 0.013 | 0.682 | 0.8844 |
| Mycobacterium tuberculosis | Probable exodeoxyribonuclease III protein XthA (exonuclease III) (EXO III) (AP endonuclease VI) | 0.0023 | 0.0225 | 0.0289 |
| Loa Loa (eye worm) | hypothetical protein | 0.0064 | 0.2766 | 0.3605 |
| Trichomonas vaginalis | ap endonuclease, putative | 0.0023 | 0.0225 | 0.1045 |
| Loa Loa (eye worm) | glutathione reductase | 0.0057 | 0.2334 | 0.3041 |
| Plasmodium vivax | dihydrolipoyl dehydrogenase, apicoplast, putative | 0.002 | 0.0045 | 0.0186 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.002 | 0.0045 | 0.0117 |
| Mycobacterium tuberculosis | Probable nitrite reductase [NAD(P)H] large subunit [FAD flavoprotein] NirB | 0.013 | 0.682 | 0.8844 |
| Brugia malayi | LBP / BPI / CETP family, C-terminal domain containing protein | 0.0064 | 0.2766 | 0.3605 |
| Onchocerca volvulus | 0.0112 | 0.5695 | 1 | |
| Echinococcus granulosus | tyrosyl DNA phosphodiesterase 1 | 0.008 | 0.3721 | 1 |
| Plasmodium vivax | glutathione reductase, putative | 0.0057 | 0.2334 | 1 |
| Echinococcus multilocularis | dihydrolipoamide dehydrogenase | 0.002 | 0.0045 | 0.0122 |
| Echinococcus multilocularis | NADP dependent isocitrate dehydrogenase | 0.0019 | 0.0002 | 0.0005 |
| Echinococcus multilocularis | NADP dependent isocitrate dehydrogenase | 0.0019 | 0.0002 | 0.0005 |
| Brugia malayi | LBP / BPI / CETP family, N-terminal domain containing protein | 0.0112 | 0.5695 | 0.7422 |
| Toxoplasma gondii | exonuclease III APE | 0.0023 | 0.0225 | 0.0955 |
| Trypanosoma cruzi | apurinic/apyrimidinic endonuclease, putative | 0.0023 | 0.0225 | 0.0599 |
| Trypanosoma cruzi | dihydrolipoyl dehydrogenase, putative | 0.002 | 0.0045 | 0.0117 |
| Brugia malayi | glutathione reductase | 0.0057 | 0.2334 | 0.3041 |
| Mycobacterium leprae | DIHYDROLIPOAMIDE DEHYDROGENASE LPD (LIPOAMIDE REDUCTASE (NADH)) (LIPOYL DEHYDROGENASE) (DIHYDROLIPOYL DEHYDROGENASE) (DIAPHORASE | 0.0145 | 0.7712 | 1 |
| Onchocerca volvulus | 0.0112 | 0.5695 | 1 | |
| Loa Loa (eye worm) | exodeoxyribonuclease III family protein | 0.0023 | 0.0225 | 0.0293 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Potency (functional) | 3.9811 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Mammalian Selenoprotein Thioredoxin Reductase 1 (TrxR1): qHTS. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488771] | ChEMBL. | No reference |
| Potency (functional) | = 7.0795 um | PUBCHEM_BIOASSAY: qHTS for inhibitors of ROR gamma transcriptional activity. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 7.0795 uM | PubChem BioAssay. qHTS for induction of synthetic lethality in tumor cells producing 2HG: qHTS for the HT-1080-NT fibrosarcoma cell line. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (binding) | = 7.9433 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Tyrosyl-DNA Phosphodiesterase (TDP1). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 8.9125 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of TGF-b: Cytotox Counterscreen. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588855, AID588860] | ChEMBL. | No reference |
| Potency (functional) | 9.285 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 96 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488745, AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
| Potency (functional) | = 12.5893 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Influenza NS1 Protein Function. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 14.1254 uM | PubChem BioAssay. qHTS of GLP-1 Receptor Inverse Agonists (Inhibition Mode). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 15.8489 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of TGF-b. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588856, AID588860] | ChEMBL. | No reference |
| Potency (functional) | 17.7828 uM | PubChem BioAssay. qHTS Assay for Inhibitors of the Human Apurinic/apyrimidinic Endonuclease 1 (APE1). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 23.1093 uM | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493153, AID493163, AID504648] | ChEMBL. | No reference |
| Potency (functional) | 26.8545 uM | PUBCHEM_BIOASSAY: qHTS profiling assay for firefly luciferase inhibitor/activator using purified enzyme and Km concentrations of substrates (counterscreen for miR-21 project). (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2288, AID2289, AID2598, AID411] | ChEMBL. | No reference |
| Potency (functional) | = 28.1838 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Aldehyde Dehydrogenase 1 (ALDH1A1). (Class of assay: confirmatory) [Related pubchem assays: 1030 (qHTS Validation Assay for Inhibitors of aldehyde dehydrogenase 1 (ALDH1A1))] | ChEMBL. | No reference |
| Potency (functional) | 29.0929 uM | PUBCHEM_BIOASSAY: qHTS screen for small molecules that inhibit ELG1-dependent DNA repair in human embryonic kidney (HEK293T) cells expressing luciferase-tagged ELG1. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493107, AID493125] | ChEMBL. | No reference |
| Potency (functional) | = 31.6228 um | PUBCHEM_BIOASSAY: qHTS Assay for Antagonists of the Neuropeptide S Receptor: cAMP Signal Transduction. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 35.4813 um | PUBCHEM_BIOASSAY: Counterscreen qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. This assay monitors tau fibrillation by fluorescence polarization (FP) of Alexa 594-labeled K18 P301L, which does not fibrillize readily but incorporates into growing filaments of unlabeled tau. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | ChEMBL. | No reference |
| Potency (binding) | = 39.8107 um | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Thioflavin T Binding. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | ChEMBL. | No reference |
| Potency (functional) | 89.1251 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BAZ2B. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504391] | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Plasmodium falciparum | ChEMBL23 | ||
| Homo sapiens | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1541341
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.