Detailed information for compound 1026438
Basic information
Technical information
- Name: Unnamed compound
- MW: 430.489 | Formula: C22H21F3N4S
-
H donors: 3
H acceptors: 1
LogP: 4.35
Rotable bonds: 8
Rule of 5 violations (Lipinski): 1 - SMILES: CNCCNCc1ccc(cc1)c1ccc(s1)c1[nH]c2c(n1)cc(cc2)C(F)(F)F
- InChi: 1S/C22H21F3N4S/c1-26-10-11-27-13-14-2-4-15(5-3-14)19-8-9-20(30-19)21-28-17-7-6-16(22(23,24)25)12-18(17)29-21/h2-9,12,26-27H,10-11,13H2,1H3,(H,28,29)
- InChiKey: CCTFXHZKEREXMV-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0067 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0067 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0067 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0038 | 0.4399 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0067 | 1 | 1 |
| Mycobacterium tuberculosis | Probable exodeoxyribonuclease III protein XthA (exonuclease III) (EXO III) (AP endonuclease VI) | 0.002 | 0.0891 | 0.5 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Onchocerca volvulus | 0.0067 | 1 | 1 | |
| Echinococcus granulosus | orexin receptor type 2 | 0.0067 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0067 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0067 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0067 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0067 | 1 | 1 |
| Onchocerca volvulus | 0.0067 | 1 | 1 | |
| Brugia malayi | Serotonin receptor | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0067 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0067 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0038 | 0.4399 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0067 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0038 | 0.4399 | 1 |
| Onchocerca volvulus | 0.0067 | 1 | 1 | |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0067 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0067 | 1 | 1 |
| Trypanosoma cruzi | apurinic/apyrimidinic endonuclease, putative | 0.002 | 0.0891 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0067 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0038 | 0.4399 | 0.4399 |
| Schistosoma mansoni | intermediate filament proteins | 0.0029 | 0.2558 | 0.183 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0067 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0067 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0067 | 1 | 1 |
| Schistosoma mansoni | transcription factor LCR-F1 | 0.0038 | 0.4399 | 0.3851 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0067 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0067 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0067 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0067 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | intermediate filament protein | 0.0029 | 0.2558 | 0.2558 |
| Wolbachia endosymbiont of Brugia malayi | exonuclease III | 0.002 | 0.0891 | 0.5 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0067 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0067 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0067 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0067 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0067 | 1 | 1 |
| Onchocerca volvulus | 0.0067 | 1 | 1 | |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0067 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | lamin | 0.0029 | 0.2558 | 0.183 |
| Onchocerca volvulus | 0.0067 | 1 | 1 | |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0067 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0067 | 1 | 1 |
| Trichomonas vaginalis | ap endonuclease, putative | 0.002 | 0.0891 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0067 | 1 | 1 |
| Leishmania major | apurinic/apyrimidinic endonuclease-redox protein | 0.002 | 0.0891 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.0067 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0067 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0067 | 1 | 1 |
| Brugia malayi | exodeoxyribonuclease III family protein | 0.002 | 0.0891 | 0.0891 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0067 | 1 | 1 |
| Plasmodium falciparum | AP endonuclease (DNA-[apurinic or apyrimidinic site] lyase), putative | 0.002 | 0.0891 | 0.5 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0067 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0067 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0067 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0067 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0067 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | Basic leucine zipper (bZIP) transcription | 0.0038 | 0.4399 | 0.3851 |
| Brugia malayi | hypothetical protein | 0.0067 | 1 | 1 |
| Echinococcus granulosus | intermediate filament protein | 0.0029 | 0.2558 | 0.183 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0067 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0067 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0067 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Mycobacterium ulcerans | exodeoxyribonuclease III protein XthA | 0.002 | 0.0891 | 0.5 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | musashi | 0.0029 | 0.2558 | 0.183 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0067 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0067 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | intermediate filament tail domain-containing protein | 0.0029 | 0.2558 | 0.2558 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0067 | 1 | 1 |
| Brugia malayi | intermediate filament protein | 0.0029 | 0.2558 | 0.2558 |
| Brugia malayi | neuropeptide F receptor | 0.0067 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0067 | 1 | 1 |
| Giardia lamblia | Endonuclease/Exonuclease/phosphatase | 0.002 | 0.0891 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0067 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0067 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0067 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0067 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0067 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0067 | 1 | 1 |
| Onchocerca volvulus | 0.0067 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0067 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0067 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0067 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0067 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0067 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0067 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0067 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0067 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Trypanosoma cruzi | apurinic/apyrimidinic endonuclease | 0.002 | 0.0891 | 0.5 |
| Echinococcus multilocularis | serotonin receptor | 0.0067 | 1 | 1 |
| Onchocerca volvulus | 0.0067 | 1 | 1 | |
| Onchocerca volvulus | 0.0067 | 1 | 1 | |
| Echinococcus granulosus | Basic leucine zipper bZIP transcription | 0.0038 | 0.4399 | 0.3851 |
| Schistosoma mansoni | biogenic amine receptor | 0.0067 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0067 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0067 | 1 | 1 |
| Onchocerca volvulus | 0.0067 | 1 | 1 | |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0067 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0067 | 1 | 1 |
| Onchocerca volvulus | 0.0067 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0028 | 0.2457 | 0.2457 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0067 | 1 | 1 |
| Plasmodium vivax | AP endonuclease (DNA-[apurinic or apyrimidinic site] lyase), putative | 0.002 | 0.0891 | 0.5 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0067 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0067 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0067 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0067 | 1 | 1 |
| Onchocerca volvulus | 0.0067 | 1 | 1 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | lamin dm0 | 0.0029 | 0.2558 | 0.183 |
| Echinococcus granulosus | lamin dm0 | 0.0029 | 0.2558 | 0.183 |
| Brugia malayi | G-protein coupled receptor | 0.0067 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0067 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Onchocerca volvulus | 0.0067 | 1 | 1 | |
| Trypanosoma brucei | apurinic/apyrimidinic endonuclease, putative | 0.002 | 0.0891 | 0.5 |
| Brugia malayi | G protein-coupled receptor | 0.0067 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0067 | 1 | 1 |
| Trichomonas vaginalis | ap endonuclease, putative | 0.002 | 0.0891 | 0.5 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0067 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0067 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0067 | 1 | 1 |
| Schistosoma mansoni | lamin | 0.0029 | 0.2558 | 0.183 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0067 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0038 | 0.4399 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | exodeoxyribonuclease III family protein | 0.002 | 0.0891 | 0.0891 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Onchocerca volvulus | 0.0067 | 1 | 1 | |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0067 | 1 | 1 |
| Onchocerca volvulus | 0.0067 | 1 | 1 | |
| Echinococcus granulosus | serotonin receptor | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0067 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0067 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0067 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0067 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0067 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0067 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0067 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0029 | 0.2558 | 0.2558 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0067 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0067 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0067 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0067 | 1 | 1 |
| Toxoplasma gondii | exonuclease III APE | 0.002 | 0.0891 | 0.5 |
| Schistosoma mansoni | opsin-like receptor | 0.0067 | 1 | 1 |
| Onchocerca volvulus | 0.0067 | 1 | 1 | |
| Onchocerca volvulus | 0.0067 | 1 | 1 | |
| Echinococcus multilocularis | neuropeptide receptor | 0.0067 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0067 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0067 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0067 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0067 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0067 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0067 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0067 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0067 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0067 | 1 | 1 |
| Echinococcus granulosus | lamin | 0.0029 | 0.2558 | 0.183 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Brugia malayi | Intermediate filament tail domain containing protein | 0.0029 | 0.2558 | 0.2558 |
| Schistosoma mansoni | hypothetical protein | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Treponema pallidum | exodeoxyribonuclease (exoA) | 0.002 | 0.0891 | 0.5 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0067 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0067 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0067 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0067 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0067 | 1 | 1 |
| Onchocerca volvulus | 0.0067 | 1 | 1 | |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0067 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0067 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0038 | 0.4399 | 0.3851 |
| Schistosoma mansoni | lamin | 0.0029 | 0.2558 | 0.183 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0067 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0067 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0067 | 1 | 1 |
Activities
No activities found for this compound.
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL529634
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.