Detailed information for compound 104736
Basic information
Technical information
- Name: Unnamed compound
- MW: 301.125 | Formula: C12H10Cl2N2O3
-
H donors: 3
H acceptors: 3
LogP: 2.27
Rotable bonds: 4
Rule of 5 violations (Lipinski): 1 - SMILES: OC(=O)CCc1c([nH]c2c1c(Cl)cc(c2)Cl)C(=O)N
- InChi: 1S/C12H10Cl2N2O3/c13-5-3-7(14)10-6(1-2-9(17)18)11(12(15)19)16-8(10)4-5/h3-4,16H,1-2H2,(H2,15,19)(H,17,18)
- InChiKey: XSJZVPAWNLJWHO-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Onchocerca volvulus | 0.011 | 1 | 0.5 | |
| Onchocerca volvulus | 0.011 | 1 | 0.5 | |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.011 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.011 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.011 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.011 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.011 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.011 | 1 | 1 |
| Onchocerca volvulus | 0.011 | 1 | 0.5 | |
| Echinococcus multilocularis | fmrfamide receptor | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.011 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.011 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.011 | 1 | 1 |
| Onchocerca volvulus | 0.011 | 1 | 0.5 | |
| Brugia malayi | larval opioid receptor | 0.011 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.011 | 1 | 1 |
| Brugia malayi | RE15519p | 0.011 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.011 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.011 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.011 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.011 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.011 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.011 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.011 | 1 | 1 |
| Plasmodium vivax | mannose-6-phosphate isomerase, putative | 0.0098 | 0.7866 | 0.5 |
| Brugia malayi | AKH receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.011 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.011 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.011 | 1 | 0.5 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.011 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.011 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.011 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.011 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.011 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.011 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.011 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.011 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.011 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.011 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.011 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Mycobacterium leprae | probable mannose-6-phosphate isomerase ManA (PHOSPHOMANNOSE ISOMERASE) (PHOSPHOMANNOISOMERASE) (PMI) (PHOSPHOHEXOISOMERASE) (PHO | 0.0053 | 0 | 0.5 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Trypanosoma cruzi | Putative Phosphatase/Protein of unknown function DUF89, putative | 0.0098 | 0.7883 | 1 |
| Brugia malayi | hypothetical protein | 0.011 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.011 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.011 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.011 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.011 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.011 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.011 | 1 | 1 |
| Toxoplasma gondii | phosphomannose isomerase type I protein | 0.0098 | 0.7866 | 0.5 |
| Brugia malayi | putative neuropeptide receptor | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.011 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.011 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.011 | 1 | 1 |
| Onchocerca volvulus | 0.011 | 1 | 0.5 | |
| Schistosoma mansoni | myosin xvIII | 0.011 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.011 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.011 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.011 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.011 | 1 | 1 |
| Onchocerca volvulus | 0.011 | 1 | 0.5 | |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.011 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.011 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.011 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Trypanosoma brucei | Putative Phosphatase/Protein of unknown function DUF89, putative | 0.0098 | 0.7883 | 1 |
| Brugia malayi | hypothetical protein | 0.011 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.011 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.011 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.011 | 1 | 1 |
| Onchocerca volvulus | 0.011 | 1 | 0.5 | |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.011 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.011 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.011 | 1 | 1 |
| Onchocerca volvulus | 0.011 | 1 | 0.5 | |
| Onchocerca volvulus | 0.011 | 1 | 0.5 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.011 | 1 | 1 |
| Onchocerca volvulus | 0.011 | 1 | 0.5 | |
| Plasmodium falciparum | mannose-6-phosphate isomerase, putative | 0.0098 | 0.7866 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.011 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.011 | 1 | 1 |
| Entamoeba histolytica | phosphomannose isomerase, putative | 0.0098 | 0.7866 | 0.5 |
| Onchocerca volvulus | 0.011 | 1 | 0.5 | |
| Trypanosoma cruzi | Putative Phosphatase/Protein of unknown function DUF89, putative | 0.0098 | 0.7883 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Trichomonas vaginalis | mannose-6-phosphate isomerase, putative | 0.0098 | 0.7866 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.011 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.011 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.011 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.011 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.011 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.011 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.011 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.011 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.011 | 1 | 1 |
| Onchocerca volvulus | 0.011 | 1 | 0.5 | |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.011 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.011 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.011 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.011 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.011 | 1 | 1 |
| Mycobacterium tuberculosis | Probable mannose-6-phosphate isomerase ManA (phosphomannose isomerase) (phosphomannoisomerase) (PMI) (phosphohexoisomerase) (pho | 0.0053 | 0 | 0.5 |
| Mycobacterium ulcerans | mannose-6-phosphate isomerase ManA | 0.0098 | 0.7866 | 0.5 |
| Brugia malayi | hypothetical protein | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.011 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.011 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.011 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.011 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.011 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.011 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.011 | 1 | 1 |
| Onchocerca volvulus | 0.011 | 1 | 0.5 | |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.011 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.011 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.011 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.011 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.011 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.011 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.011 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.011 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0098 | 0.7883 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.011 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.011 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.011 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Onchocerca volvulus | 0.011 | 1 | 0.5 | |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.011 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.011 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.011 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.011 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.011 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.011 | 1 | 0.5 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.011 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.011 | 1 | 1 |
| Onchocerca volvulus | 0.011 | 1 | 0.5 | |
| Echinococcus multilocularis | somatostatin receptor | 0.011 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.011 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.011 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.011 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.011 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.011 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.011 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.011 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.011 | 1 | 1 |
| Onchocerca volvulus | 0.011 | 1 | 0.5 | |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.011 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.011 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.011 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.011 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.011 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.011 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.011 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.011 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Onchocerca volvulus | 0.011 | 1 | 0.5 | |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.011 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | >> 10 uM | Inhibitory activity against Fructose-1,6-bisphosphatase (F16BPase) in human liver | ChEMBL. | 12781194 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
No external resources registered for this compound
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.