Detailed information for compound 1068196
Basic information
Technical information
- Name: Unnamed compound
- MW: 361.336 | Formula: C13H11N7O4S
-
H donors: 3
H acceptors: 7
LogP: 1.56
Rotable bonds: 5
Rule of 5 violations (Lipinski): 1 - SMILES: [O-][N+](=O)c1cnc(n1C)c1nnc(s1)N/N=C\c1ccc(c(c1)O)O
- InChi: 1S/C13H11N7O4S/c1-19-10(20(23)24)6-14-11(19)12-16-18-13(25-12)17-15-5-7-2-3-8(21)9(22)4-7/h2-6,21-22H,1H3,(H,17,18)/b15-5-
- InChiKey: OKVVEBHVTYYSSJ-WCSRMQSCSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Trypanosoma cruzi | S-adenosylhomocysteine hydrolase, putative | 0.0327147 | 0.452889 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0565138 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0565138 | 1 | 1 |
| Giardia lamblia | Kinase, AGC PKA | 0.0279535 | 0.343435 | 0.5 |
| Echinococcus granulosus | cAMP dependent protein kinase catalytic subunit | 0.0279535 | 0.343435 | 0.343435 |
| Schistosoma mansoni | hypothetical protein | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0565138 | 1 | 1 |
| Onchocerca volvulus | 0.0565138 | 1 | 1 | |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0565138 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0565138 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | adenosylhomocysteinase | 0.0327147 | 0.452889 | 0.452889 |
| Trypanosoma brucei | S-adenosylhomocysteine hydrolase, putative | 0.0327147 | 0.452889 | 1 |
| Entamoeba histolytica | adenosylhomocysteinase, putative | 0.0327147 | 0.452889 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0565138 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0565138 | 1 | 1 |
| Onchocerca volvulus | 0.0565138 | 1 | 1 | |
| Onchocerca volvulus | 0.0565138 | 1 | 1 | |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0565138 | 1 | 1 |
| Onchocerca volvulus | 0.0565138 | 1 | 1 | |
| Echinococcus granulosus | enhancer of mRNA decapping protein 4 | 0.027599 | 0.335287 | 0.335287 |
| Echinococcus granulosus | sex peptide receptor | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0565138 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0565138 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0426379 | 0.681012 | 0.514156 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0565138 | 1 | 1 |
| Toxoplasma gondii | S-Adenosyl homocysteine hydrolase | 0.0327147 | 0.452889 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0565138 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | adenosylhomocysteinase | 0.0202263 | 0.165797 | 0.165797 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0565138 | 1 | 1 |
| Onchocerca volvulus | 0.0565138 | 1 | 1 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0565138 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0565138 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0279535 | 0.343435 | 0.343435 |
| Onchocerca volvulus | 0.0565138 | 1 | 1 | |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0565138 | 1 | 1 |
| Onchocerca volvulus | 0.0565138 | 1 | 1 | |
| Echinococcus granulosus | neuropeptide receptor | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | cAMP dependent protein kinase catalytic subunit | 0.0279535 | 0.343435 | 0.343435 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0565138 | 1 | 1 |
| Mycobacterium tuberculosis | Probable adenosylhomocysteinase SahH (S-adenosyl-L-homocysteine hydrolase) (adohcyase) | 0.0327147 | 0.452889 | 0.5 |
| Toxoplasma gondii | adenosylhomocysteinase, putative | 0.0327147 | 0.452889 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0565138 | 1 | 1 |
| Onchocerca volvulus | 0.0565138 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0565138 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | adenosylhomocysteinase | 0.0202263 | 0.165797 | 0.165797 |
| Brugia malayi | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | cAMP dependent protein kinase catalytic subunit | 0.0279535 | 0.343435 | 0.343435 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0565138 | 1 | 1 |
| Onchocerca volvulus | 0.0565138 | 1 | 1 | |
| Brugia malayi | Serotonin receptor | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0565138 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0565138 | 1 | 1 |
| Plasmodium vivax | adenosylhomocysteinase(S-adenosyl-L-homocystein e hydrolase), putative | 0.0327147 | 0.452889 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0565138 | 1 | 1 |
| Trichomonas vaginalis | adenosylhomocysteinase, putative | 0.0327147 | 0.452889 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0565138 | 1 | 1 |
| Brugia malayi | Adenosylhomocysteinase | 0.0327147 | 0.452889 | 0.166707 |
| Onchocerca volvulus | 0.0565138 | 1 | 1 | |
| Schistosoma mansoni | amine GPCR | 0.0565138 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0565138 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0565138 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | cAMP dependent protein kinase catalytic subunit | 0.0279535 | 0.343435 | 0.343435 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0565138 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0565138 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0565138 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0565138 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0565138 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0565138 | 1 | 1 |
| Plasmodium falciparum | adenosylhomocysteinase | 0.0327147 | 0.452889 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0565138 | 1 | 1 |
| Onchocerca volvulus | 0.0565138 | 1 | 1 | |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | cAMP dependent protein kinase catalytic subunit | 0.0279535 | 0.343435 | 0.343435 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | cAMP dependent protein kinase catalytic subunit | 0.0279535 | 0.343435 | 0.343435 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0565138 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0565138 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | enhancer of mRNA decapping protein 4 | 0.027599 | 0.335287 | 0.335287 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | adenosylhomocysteinase | 0.0202263 | 0.165797 | 0.165797 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0565138 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Leishmania major | S-adenosylhomocysteine hydrolase | 0.0327147 | 0.452889 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0565138 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | AGC/DMPK/ROCK protein kinase | 0.0426379 | 0.681012 | 0.514156 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | adenosylhomocysteinase | 0.0202263 | 0.165797 | 0.165797 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0565138 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0565138 | 1 | 1 |
| Mycobacterium ulcerans | S-adenosyl-L-homocysteine hydrolase | 0.0327147 | 0.452889 | 0.5 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0565138 | 1 | 1 |
| Trichomonas vaginalis | adenosylhomocysteinase, putative | 0.0327147 | 0.452889 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0565138 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0279535 | 0.343435 | 0.343435 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | adenosylhomocysteinase | 0.0327147 | 0.452889 | 0.166707 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0565138 | 1 | 1 |
| Mycobacterium leprae | putative S-adenosyl-L-homocysteine hydrolase SahH | 0.0327147 | 0.452889 | 0.5 |
| Onchocerca volvulus | 0.0565138 | 1 | 1 | |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0565138 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0565138 | 1 | 1 |
| Onchocerca volvulus | 0.0565138 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0279535 | 0.343435 | 0.343435 |
| Schistosoma mansoni | biogenic amine receptor | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0565138 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0565138 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0565138 | 1 | 1 |
| Onchocerca volvulus | 0.0565138 | 1 | 1 | |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0565138 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0565138 | 1 | 1 |
| Onchocerca volvulus | 0.0565138 | 1 | 1 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0565138 | 1 | 1 |
| Onchocerca volvulus | 0.0565138 | 1 | 1 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | adenosylhomocysteinase | 0.0327147 | 0.452889 | 0.452889 |
| Trypanosoma cruzi | S-adenosylhomocysteine hydrolase, putative | 0.0327147 | 0.452889 | 1 |
| Onchocerca volvulus | 0.0565138 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | adenosylhomocysteinase | 0.0327147 | 0.452889 | 0.452889 |
| Loa Loa (eye worm) | hypothetical protein | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0565138 | 1 | 1 |
| Echinococcus multilocularis | cAMP dependent protein kinase catalytic subunit | 0.0279535 | 0.343435 | 0.343435 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0565138 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Activity (functional) | = 50 % | Antitrypanosomal activity against Trypanosoma cruzi Y infected in mouse assessed as decrease in mouse mortality at 200 mg/kg, po after 16 days post infection | ChEMBL. | 20231395 |
| Activity (ADMET) | = 25.8 g | Toxicity in mouse assessed as body weight at 400 mg/kg, po after 4 days | ChEMBL. | 20231395 |
| Activity (ADMET) | = 51.6 mg/dl | Toxicity in mouse assessed as urea level in blood at 400 mg/kg, po after 4 days | ChEMBL. | 20231395 |
| Activity (ADMET) | = 22.7 U/L | Toxicity in mouse assessed as GPT level in blood at 400 mg/kg, po after 4 days | ChEMBL. | 20231395 |
| Activity (ADMET) | = 62.4 U/L | Toxicity in mouse assessed as GOT level in blood at 400 mg/kg, po after 4 days | ChEMBL. | 20231395 |
| IC50 (functional) | = 1.4 uM | Antitrypanosomal activity against Trypanosoma cruzi amastigotes infected in mouse peritoneal macrophages assessed as endocytic index after 3 day | ChEMBL. | 20231395 |
| IC50 (functional) | = 1.7 uM | Antitrypanosomal activity against Trypanosoma cruzi amastigotes infected in mouse peritoneal macrophages assessed as inhibition of infection after 4 day | ChEMBL. | 20231395 |
| IC50 (functional) | = 1.9 uM | Antitrypanosomal activity against Trypanosoma cruzi amastigotes infected in mouse peritoneal macrophages assessed as endocytic index after 4 day | ChEMBL. | 20231395 |
| IC50 (functional) | = 2 uM | Antitrypanosomal activity against Trypanosoma cruzi amastigotes infected in mouse peritoneal macrophages assessed as endocytic index after 1 day | ChEMBL. | 20231395 |
| IC50 (functional) | = 2.1 uM | Antitrypanosomal activity against Trypanosoma cruzi amastigotes infected in mouse peritoneal macrophages assessed as inhibition of infection after 1 day | ChEMBL. | 20231395 |
| IC50 (functional) | = 2.2 uM | Antitrypanosomal activity against Trypanosoma cruzi amastigotes infected in mouse peritoneal macrophages assessed as endocytic index after 2 day | ChEMBL. | 20231395 |
| IC50 (functional) | = 2.6 uM | Antitrypanosomal activity against Trypanosoma cruzi amastigotes infected in mouse peritoneal macrophages assessed as inhibition of infection after 3 day | ChEMBL. | 20231395 |
| IC50 (functional) | = 4.4 uM | Antitrypanosomal activity against Trypanosoma cruzi amastigotes infected in mouse peritoneal macrophages assessed as inhibition of infection after 2 day | ChEMBL. | 20231395 |
| IC50 (functional) | = 5.3 uM | Ability of the compound to cause lysis of trypomastigote form of Trypanosoma cruzi was determined | ChEMBL. | 15546709 |
| IC50 (functional) | = 5.3 uM | Trypanocidal activity against Trypanosoma cruzi Y trypomastigotes assessed as parasite lysis | ChEMBL. | 17904851 |
| IC50 (functional) | = 5.3 uM | Antitrypanosomal activity against Trypanosoma cruzi trypomastigotes after 24 hrs by whole-parasite-based assay | ChEMBL. | 19606868 |
| IC50 (functional) | = 7.6 uM | Antitrypanosomal activity against Trypanosoma cruzi amastigotes infected in mouse embryo heart muscle cells assessed as endocytic index | ChEMBL. | 20231395 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Trypanosoma cruzi | ChEMBL23 | 15546709 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL568075
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.