Detailed information for compound 1220705
Basic information
Technical information
- Name: Unnamed compound
- MW: 455.457 | Formula: C24H25NO8
-
H donors: 5
H acceptors: 7
LogP: 0.82
Rotable bonds: 6
Rule of 5 violations (Lipinski): 1 - SMILES: O=C(Nc1c(O)ccc(c1O)C(=O)O)CC[C@]1(C)C(=O)C=C[C@]23[C@@H]1[C@@]14C[C@@]4(C2)[C@]([C@@H]3O)(O1)C
- InChi: 1S/C24H25NO8/c1-20(7-6-14(28)25-15-12(26)4-3-11(16(15)29)17(30)31)13(27)5-8-22-9-23-10-24(23,18(20)22)33-21(23,2)19(22)32/h3-5,8,18-19,26,29,32H,6-7,9-10H2,1-2H3,(H,25,28)(H,30,31)/t18-,19+,20-,21+,22-,23+,24-/m1/s1
- InChiKey: TUHIUIGYYSZKCN-ACYPNERUSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Staphylococcus aureus | 3-oxoacyl-[acyl-carrier-protein] synthase 2 | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus granulosus | intermediate filament protein | 0.003 | 0.0564 | 0.0511 |
| Plasmodium vivax | hypothetical protein, conserved | 0.0035 | 0.08 | 0.2908 |
| Mycobacterium tuberculosis | Probable esterase LipL | 0.0035 | 0.08 | 0.0384 |
| Echinococcus multilocularis | lysine specific demethylase 5A | 0.0064 | 0.1998 | 0.1953 |
| Brugia malayi | Heterochromatin protein 1 | 0.0068 | 0.2156 | 0.2156 |
| Plasmodium falciparum | ataxin-2 like protein, putative | 0.0028 | 0.0485 | 0.1676 |
| Trichomonas vaginalis | chromobox protein, putative | 0.0041 | 0.1042 | 0.3419 |
| Trypanosoma brucei | PAB1-binding protein , putative | 0.0028 | 0.0485 | 0.1676 |
| Schistosoma mansoni | jumonji/arid domain-containing protein | 0.0064 | 0.1998 | 0.7591 |
| Schistosoma mansoni | family S12 unassigned peptidase (S12 family) | 0.0035 | 0.08 | 0.2908 |
| Echinococcus multilocularis | Basic leucine zipper (bZIP) transcription | 0.0039 | 0.097 | 0.0919 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0045 | 0.1192 | 0.4441 |
| Chlamydia trachomatis | 3-oxoacyl-ACP synthase | 0.0079 | 0.2615 | 0.5 |
| Entamoeba histolytica | hypothetical protein | 0.0039 | 0.097 | 0.5 |
| Mycobacterium ulcerans | beta-lactamase | 0.0035 | 0.08 | 0.1467 |
| Mycobacterium tuberculosis | Conserved protein | 0.0035 | 0.08 | 0.0384 |
| Schistosoma mansoni | hypothetical protein | 0.0053 | 0.1522 | 0.5728 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 0.08 | 0.08 |
| Echinococcus granulosus | guanine nucleotide binding protein Gs subunit | 0.0045 | 0.1192 | 0.1143 |
| Brugia malayi | Hypothetical 52.5 kDa protein ZK945.1 in chromosome II, putative | 0.0035 | 0.08 | 0.08 |
| Schistosoma mansoni | survival motor neuron protein | 0.0053 | 0.1522 | 0.5728 |
| Brugia malayi | beta-lactamase family protein | 0.0035 | 0.08 | 0.08 |
| Brugia malayi | chromobox protein homolog 3 | 0.0038 | 0.0923 | 0.0923 |
| Entamoeba histolytica | hypothetical protein | 0.0039 | 0.097 | 0.5 |
| Echinococcus multilocularis | Transcription factor, JmjC domain containing protein | 0.0064 | 0.1998 | 0.1953 |
| Onchocerca volvulus | 0.0035 | 0.08 | 0.3018 | |
| Brugia malayi | beta-lactamase | 0.0035 | 0.08 | 0.08 |
| Trichomonas vaginalis | penicillin-binding protein, putative | 0.0035 | 0.08 | 0.1988 |
| Mycobacterium leprae | 3-oxoacyl-[acyl-carrier-protein] synthase 1 KasA (BETA-KETOACYL-ACP SYNTHASE) (KAS I) | 0.0052 | 0.1476 | 1 |
| Echinococcus multilocularis | lamin | 0.003 | 0.0564 | 0.0511 |
| Mycobacterium tuberculosis | 3-oxoacyl-[acyl-carrier protein] synthase 1 KasA (beta-ketoacyl-ACP synthase) (KAS I) | 0.0052 | 0.1476 | 0.1216 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0082 | 0.0082 |
| Mycobacterium ulcerans | hypothetical protein | 0.0035 | 0.08 | 0.1467 |
| Schistosoma mansoni | lamin | 0.003 | 0.0564 | 0.1986 |
| Loa Loa (eye worm) | beta-ketoacyl synthase domain-containing protein | 0.0079 | 0.2615 | 0.2615 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0035 | 0.08 | 0.2908 |
| Echinococcus granulosus | lamin | 0.003 | 0.0564 | 0.0511 |
| Echinococcus multilocularis | chromobox protein 1 | 0.0068 | 0.2156 | 0.2112 |
| Leishmania major | hypothetical protein, conserved | 0.0028 | 0.0485 | 0.1676 |
| Mycobacterium ulcerans | 3-oxoacyl-(acyl carrier protein) synthase II | 0.0079 | 0.2615 | 1 |
| Brugia malayi | intermediate filament protein | 0.003 | 0.0564 | 0.0564 |
| Brugia malayi | 3-hydroxyacyl-CoA dehydrogenase type II | 0.0063 | 0.1933 | 0.1933 |
| Onchocerca volvulus | Heterochromatin protein 1 homolog | 0.0041 | 0.1042 | 0.5363 |
| Schistosoma mansoni | intermediate filament proteins | 0.003 | 0.0564 | 0.1986 |
| Trichomonas vaginalis | penicillin-binding protein, putative | 0.0035 | 0.08 | 0.1988 |
| Brugia malayi | jmjC domain containing protein | 0.0017 | 0.0056 | 0.0056 |
| Entamoeba histolytica | hypothetical protein | 0.0039 | 0.097 | 0.5 |
| Mycobacterium ulcerans | esterase/lipase LipP | 0.0035 | 0.08 | 0.1467 |
| Brugia malayi | STAT protein, DNA binding domain containing protein | 0.0173 | 0.6458 | 0.6458 |
| Echinococcus granulosus | chromobox protein 1 | 0.0068 | 0.2156 | 0.2112 |
| Echinococcus granulosus | Basic leucine zipper bZIP transcription | 0.0039 | 0.097 | 0.0919 |
| Brugia malayi | Intermediate filament tail domain containing protein | 0.003 | 0.0564 | 0.0564 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0038 | 0.0923 | 0.2714 |
| Loa Loa (eye worm) | heterochromatin protein 1 | 0.0068 | 0.2156 | 0.2156 |
| Echinococcus multilocularis | musashi | 0.003 | 0.0564 | 0.0511 |
| Trichomonas vaginalis | esterase, putative | 0.0035 | 0.08 | 0.1988 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0056 | 0.0056 |
| Brugia malayi | jmjC domain containing protein | 0.0017 | 0.0056 | 0.0056 |
| Loa Loa (eye worm) | intermediate filament protein | 0.003 | 0.0564 | 0.0564 |
| Toxoplasma gondii | AMP-binding enzyme domain-containing protein | 0.0028 | 0.0488 | 0.1689 |
| Loa Loa (eye worm) | hypothetical protein | 0.0028 | 0.0485 | 0.0485 |
| Mycobacterium tuberculosis | Probable lipase LipD | 0.0035 | 0.08 | 0.0384 |
| Mycobacterium tuberculosis | Probable lipase LipE | 0.0035 | 0.08 | 0.0384 |
| Trichomonas vaginalis | D-aminoacylase, putative | 0.0035 | 0.08 | 0.1988 |
| Echinococcus granulosus | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0063 | 0.1933 | 0.1888 |
| Onchocerca volvulus | Heterochromatin protein 1 homolog | 0.0038 | 0.0923 | 0.4207 |
| Mycobacterium tuberculosis | Probable esterase/lipase LipP | 0.0035 | 0.08 | 0.0384 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 0.08 | 0.08 |
| Trypanosoma brucei | hypothetical protein, conserved | 0.0035 | 0.08 | 0.2908 |
| Loa Loa (eye worm) | beta-LACTamase domain containing family member | 0.0035 | 0.08 | 0.08 |
| Loa Loa (eye worm) | hypothetical protein | 0.003 | 0.0583 | 0.0583 |
| Mycobacterium tuberculosis | Conserved protein | 0.0035 | 0.08 | 0.0384 |
| Schistosoma mansoni | lamin | 0.003 | 0.0564 | 0.1986 |
| Brugia malayi | jmjC domain containing protein | 0.0064 | 0.1998 | 0.1998 |
| Entamoeba histolytica | hypothetical protein | 0.0039 | 0.097 | 0.5 |
| Schistosoma mansoni | chromobox protein | 0.0068 | 0.2156 | 0.8208 |
| Echinococcus multilocularis | survival motor neuron protein 1 | 0.0259 | 1 | 1 |
| Trypanosoma brucei | beta-ketoacyl-ACP synthase | 0.0079 | 0.2615 | 1 |
| Schistosoma mansoni | jumonji domain containing protein | 0.0064 | 0.1998 | 0.7591 |
| Echinococcus granulosus | beta LACTamase domain containing family member | 0.0035 | 0.08 | 0.0748 |
| Mycobacterium tuberculosis | Possible conserved lipoprotein LpqK | 0.0035 | 0.08 | 0.0384 |
| Loa Loa (eye worm) | GTP-binding regulatory protein Gs alpha-S chain | 0.0045 | 0.1192 | 0.1192 |
| Echinococcus multilocularis | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0063 | 0.1933 | 0.1888 |
| Trypanosoma cruzi | PAB1-binding protein , putative | 0.0028 | 0.0485 | 0.1676 |
| Echinococcus multilocularis | chromobox protein 1 | 0.0068 | 0.2156 | 0.2112 |
| Trypanosoma cruzi | beta-ketoacyl synthase family protein, putative | 0.0079 | 0.2615 | 1 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0017 | 0.0056 | 0.0056 |
| Mycobacterium tuberculosis | Probable hydrolase | 0.0035 | 0.08 | 0.0384 |
| Schistosoma mansoni | family S12 unassigned peptidase (S12 family) | 0.0035 | 0.08 | 0.2908 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0063 | 0.1933 | 0.6794 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0017 | 0.0056 | 0.0056 |
| Echinococcus granulosus | lamin dm0 | 0.003 | 0.0564 | 0.0511 |
| Echinococcus granulosus | guanine nucleotide binding protein Gs subunit | 0.0045 | 0.1192 | 0.1143 |
| Brugia malayi | hypothetical protein | 0.0039 | 0.097 | 0.097 |
| Brugia malayi | hypothetical protein | 0.0028 | 0.0485 | 0.0485 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 0.08 | 0.08 |
| Onchocerca volvulus | 0.003 | 0.0564 | 0.0735 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0056 | 0.0056 |
| Echinococcus granulosus | survival motor neuron protein 1 | 0.0259 | 1 | 1 |
| Onchocerca volvulus | 0.0053 | 0.1522 | 1 | |
| Mycobacterium tuberculosis | Possible penicillin-binding protein | 0.0225 | 0.8617 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 0.08 | 0.08 |
| Toxoplasma gondii | type I fatty acid synthase, putative | 0.0028 | 0.0488 | 0.1689 |
| Schistosoma mansoni | jumonji/arid domain-containing protein | 0.0064 | 0.1998 | 0.7591 |
| Leishmania major | beta-ketoacyl synthase family protein, putative,3-oxoacyl-acyl carrier protein synthase ii, putative | 0.0079 | 0.2615 | 1 |
| Onchocerca volvulus | 0.003 | 0.0564 | 0.0735 | |
| Loa Loa (eye worm) | STAT protein | 0.0173 | 0.6458 | 0.6458 |
| Loa Loa (eye worm) | hypothetical protein | 0.0029 | 0.0542 | 0.0542 |
| Trichomonas vaginalis | chromobox protein, putative | 0.0041 | 0.1042 | 0.3419 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0045 | 0.1192 | 0.4441 |
| Plasmodium vivax | ataxin-2 like protein, putative | 0.0028 | 0.0485 | 0.1676 |
| Echinococcus multilocularis | 3 oxoacyl (acyl carrier protein) synthase | 0.0079 | 0.2615 | 0.2574 |
| Toxoplasma gondii | type I fatty acid synthase, putative | 0.0028 | 0.0488 | 0.1689 |
| Toxoplasma gondii | 3-oxoacyl-acyl-carrier protein synthase I/II, putative | 0.0079 | 0.2615 | 1 |
| Onchocerca volvulus | 0.0035 | 0.08 | 0.3018 | |
| Echinococcus multilocularis | lamin dm0 | 0.003 | 0.0564 | 0.0511 |
| Loa Loa (eye worm) | beta-lactamase | 0.0035 | 0.08 | 0.08 |
| Plasmodium vivax | 3-oxoacyl-[acyl-carrier-protein] synthase i/ii, putative | 0.0079 | 0.2615 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0923 | 0.0923 |
| Echinococcus multilocularis | beta LACTamase domain containing family member | 0.0035 | 0.08 | 0.0748 |
| Schistosoma mansoni | hypothetical protein | 0.0039 | 0.097 | 0.3572 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0038 | 0.0923 | 0.2714 |
| Leishmania major | 3-oxoacyl-(acyl-carrier protein) reductase, putative | 0.0063 | 0.1933 | 0.7336 |
| Trypanosoma cruzi | beta-ketoacyl synthase family protein, putative | 0.0079 | 0.2615 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0063 | 0.1933 | 0.1778 |
| Echinococcus granulosus | lysine specific demethylase 5A | 0.0064 | 0.1998 | 0.1953 |
| Mycobacterium ulcerans | lipase LipD | 0.0035 | 0.08 | 0.1467 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 0.08 | 0.08 |
| Onchocerca volvulus | 0.0035 | 0.08 | 0.3018 | |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0035 | 0.08 | 0.2908 |
| Plasmodium falciparum | ataxin-2 like protein, putative | 0.0028 | 0.0485 | 0.1676 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Echinococcus granulosus | 3 oxoacyl acyl carrier protein synthase | 0.0079 | 0.2615 | 0.2574 |
| Echinococcus granulosus | chromobox protein 1 | 0.0068 | 0.2156 | 0.2112 |
| Loa Loa (eye worm) | hypothetical protein | 0.0028 | 0.0488 | 0.0488 |
| Schistosoma mansoni | 3-oxoacyl-[ACP] synthase | 0.0079 | 0.2615 | 1 |
| Brugia malayi | Beta-ketoacyl synthase, N-terminal domain containing protein | 0.0079 | 0.2615 | 0.2615 |
| Toxoplasma gondii | ABC1 family protein | 0.0035 | 0.08 | 0.2908 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0063 | 0.1933 | 0.6794 |
| Mycobacterium leprae | conserved hypothetical protein | 0.0035 | 0.08 | 0.3157 |
| Brugia malayi | GTP-binding regulatory protein Gs alpha-S chain, putative | 0.0045 | 0.1192 | 0.1192 |
| Trichomonas vaginalis | D-aminoacylase, putative | 0.0035 | 0.08 | 0.1988 |
| Loa Loa (eye worm) | hypothetical protein | 0.0028 | 0.0488 | 0.0488 |
| Onchocerca volvulus | 0.003 | 0.0583 | 0.0918 | |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0045 | 0.1192 | 0.4441 |
| Brugia malayi | beta-lactamase family protein | 0.0035 | 0.08 | 0.08 |
| Echinococcus multilocularis | guanine nucleotide binding protein G(s) subunit | 0.0045 | 0.1192 | 0.1143 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0064 | 0.1998 | 0.1998 |
| Mycobacterium leprae | 3-oxoacyl-[acyl-carrier-protein] synthase 2 KasB (BETA-KETOACYL-ACP SYNTHASE) (KAS I) | 0.0052 | 0.1476 | 1 |
| Brugia malayi | oxidoreductase, zinc-binding dehydrogenase family protein | 0.0028 | 0.0488 | 0.0488 |
| Plasmodium falciparum | 3-oxoacyl-acyl-carrier protein synthase I/II | 0.0079 | 0.2615 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0056 | 0.0056 |
| Brugia malayi | Iron-sulfur cluster assembly accessory protein | 0.0053 | 0.1522 | 0.1522 |
| Mycobacterium tuberculosis | Conserved protein | 0.0035 | 0.08 | 0.0384 |
| Mycobacterium ulcerans | 3-oxoacyl-(acyl carrier protein) synthase II | 0.0079 | 0.2615 | 1 |
| Trypanosoma cruzi | PAB1-binding protein , putative | 0.0028 | 0.0485 | 0.1676 |
| Schistosoma mansoni | transcription factor LCR-F1 | 0.0039 | 0.097 | 0.3572 |
| Mycobacterium tuberculosis | Probable conserved lipoprotein | 0.0035 | 0.08 | 0.0384 |
| Trichomonas vaginalis | chromobox protein, putative | 0.0068 | 0.2156 | 1 |
| Brugia malayi | Beta-ketoacyl synthase, N-terminal domain containing protein | 0.0028 | 0.0488 | 0.0488 |
| Mycobacterium leprae | Probable lipase LipE | 0.0035 | 0.08 | 0.3157 |
| Brugia malayi | jmjC domain containing protein | 0.0017 | 0.0056 | 0.0056 |
| Echinococcus multilocularis | guanine nucleotide binding protein G(s) subunit | 0.0045 | 0.1192 | 0.1143 |
| Trichomonas vaginalis | chromobox protein, putative | 0.0068 | 0.2156 | 1 |
| Brugia malayi | jmjC domain containing protein | 0.0017 | 0.0056 | 0.0056 |
| Echinococcus granulosus | Transcription factor JmjC domain containing protein | 0.0064 | 0.1998 | 0.1953 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0227 | 0.8681 | 0.8681 |
| Wolbachia endosymbiont of Brugia malayi | 3-oxoacyl-ACP synthase | 0.0079 | 0.2615 | 0.5 |
| Brugia malayi | jmjC domain containing protein | 0.0064 | 0.1998 | 0.1998 |
| Loa Loa (eye worm) | 3-hydroxyacyl-CoA dehydrogenase type II | 0.0059 | 0.1759 | 0.1759 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 0.08 | 0.08 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0017 | 0.0056 | 0.0056 |
| Toxoplasma gondii | beta-ketoacyl synthase, N-terminal domain-containing protein | 0.0028 | 0.0488 | 0.1689 |
| Mycobacterium ulcerans | fusion of enoyl-CoA hydratase, EchA21 and lipase, LipE | 0.0035 | 0.08 | 0.1467 |
| Leishmania major | hypothetical protein, conserved | 0.0035 | 0.08 | 0.2908 |
| Toxoplasma gondii | LsmAD domain-containing protein | 0.0028 | 0.0485 | 0.1676 |
| Trichomonas vaginalis | D-aminoacylase, putative | 0.0035 | 0.08 | 0.1988 |
| Schistosoma mansoni | 3-hydroxyacyl-CoA dehydrogenase | 0.0063 | 0.1933 | 0.7336 |
| Loa Loa (eye worm) | intermediate filament tail domain-containing protein | 0.003 | 0.0564 | 0.0564 |
| Loa Loa (eye worm) | hypothetical protein | 0.003 | 0.0564 | 0.0564 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0227 | 0.8681 | 0.8681 |
| Mycobacterium tuberculosis | 3-oxoacyl-[acyl-carrier protein] synthase 2 KasB (beta-ketoacyl-ACP synthase) (KAS I) | 0.0052 | 0.1476 | 0.1216 |
| Schistosoma mansoni | chromobox protein | 0.0068 | 0.2156 | 0.8208 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Activity (functional) | Antibacterial activity against Escherichia coli at 64 ug/ml after 20 hrs | ChEMBL. | 21214253 | |
| IC50 (binding) | = 1.25 ug ml-1 | Inhibition of Staphylococcus aureus FASF assessed as [2-14C]-malonyl CoA incorporation after 90 mins by cell free-based scintillation counting | ChEMBL. | 21214253 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1230599
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.