Detailed information for compound 1233424
Basic information
Technical information
- TDR Targets ID: 1233424
- Name: N-[2-chloro-5-([1,3]oxazolo[4,5-b]pyridin-2-y l)phenyl]-2-(4-chlorophenyl)sulfanylacetamide
- MW: 430.307 | Formula: C20H13Cl2N3O2S
-
H donors: 1
H acceptors: 3
LogP: 5.36
Rotable bonds: 6
Rule of 5 violations (Lipinski): 1 - SMILES: O=C(Nc1cc(ccc1Cl)c1nc2c(o1)cccn2)CSc1ccc(cc1)Cl
- InChi: 1S/C20H13Cl2N3O2S/c21-13-4-6-14(7-5-13)28-11-18(26)24-16-10-12(3-8-15(16)22)20-25-19-17(27-20)2-1-9-23-19/h1-10H,11H2,(H,24,26)
- InChiKey: LABCXBXQZWMEPM-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- N-(2-chloro-5-oxazolo[4,5-b]pyridin-2-yl-phenyl)-2-(4-chlorophenyl)sulfanyl-acetamide
- N-[2-chloro-5-(2-oxazolo[4,5-b]pyridinyl)phenyl]-2-[(4-chlorophenyl)thio]acetamide
- N-(2-chloro-5-oxazolo[4,5-b]pyridin-2-yl-phenyl)-2-[(4-chlorophenyl)thio]acetamide
- N-[2-chloro-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-2-(4-chlorophenyl)sulfanyl-ethanamide
- MLS000331919
- N-(2-Chloro-5-oxazolo[4,5-b]pyridin-2-yl-phenyl)-2-(4-chloro-phenylsulfanyl)-acetamide
- SMR000221421
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Mus musculus | RAR-related orphan receptor gamma | Starlite/ChEMBL | No references |
| Homo sapiens | muscleblind-like splicing regulator 1 | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
| Species | Potential target | Known druggable target/s | Ortholog Group |
|---|---|---|---|
| Brugia malayi | Muscleblind-like protein | Get druggable targets OG5_132352 | All targets in OG5_132352 |
| Echinococcus multilocularis | muscleblind protein 1 | Get druggable targets OG5_132352 | All targets in OG5_132352 |
| Loa Loa (eye worm) | hypothetical protein | Get druggable targets OG5_132352 | All targets in OG5_132352 |
| Echinococcus granulosus | muscleblind protein | Get druggable targets OG5_132352 | All targets in OG5_132352 |
| Loa Loa (eye worm) | hypothetical protein | Get druggable targets OG5_132352 | All targets in OG5_132352 |
| Echinococcus multilocularis | muscleblind protein | Get druggable targets OG5_132352 | All targets in OG5_132352 |
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0902 | 1 | 1 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Brugia malayi | putative neuropeptide receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0902 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0902 | 1 | 0.5 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0902 | 1 | 1 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0902 | 1 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0902 | 1 | 0.5 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0902 | 1 | 0.5 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | muscleblind protein | 0.018 | 0.1661 | 0.1661 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0902 | 1 | 0.5 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0902 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0902 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0902 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0902 | 1 | 0.5 |
| Schistosoma mansoni | neuropeptide receptor | 0.0902 | 1 | 0.5 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0902 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0902 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0902 | 1 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0902 | 1 | 0.5 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0902 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0902 | 1 | 0.5 |
| Brugia malayi | GnHR receptor homolog | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0902 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.018 | 0.1661 | 0.1661 |
| Schistosoma mansoni | amine GPCR | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Echinococcus multilocularis | serotonin receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.018 | 0.1661 | 0.1661 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0902 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0902 | 1 | 1 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0902 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0902 | 1 | 0.5 |
| Brugia malayi | Serotonin receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0902 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0902 | 1 | 0.5 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0902 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0902 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0902 | 1 | 0.5 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0902 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0902 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | allatostatin A receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0902 | 1 | 0.5 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0902 | 1 | 0.5 |
| Schistosoma mansoni | biogenic amine receptor | 0.0902 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0902 | 1 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | fmrfamide receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0902 | 1 | 0.5 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0902 | 1 | 0.5 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0902 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0902 | 1 | 0.5 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptide receptor | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0902 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0902 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0902 | 1 | 0.5 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0902 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0902 | 1 | 1 |
| Mycobacterium tuberculosis | Secreted antigen 85-C FbpC (85C) (antigen 85 complex C) (AG58C) (mycolyl transferase 85C) (fibronectin-binding protein C) | 0.0861 | 0.9524 | 1 |
| Brugia malayi | Serotonin receptor | 0.0902 | 1 | 1 |
| Brugia malayi | Muscleblind-like protein | 0.018 | 0.1661 | 0.1661 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0902 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0902 | 1 | 0.5 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0902 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0902 | 1 | 1 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0902 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0902 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0902 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0902 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0902 | 1 | 0.5 |
| Brugia malayi | larval opioid receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | muscleblind protein | 0.018 | 0.1661 | 0.1661 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0902 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0902 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | muscleblind protein 1 | 0.018 | 0.1661 | 0.1661 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Entamoeba histolytica | endo-1,4-beta-xylanase, putative | 0.0037 | 0 | 0.5 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0902 | 1 | 0.5 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0902 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0902 | 1 | 0.5 |
| Brugia malayi | sulfakinin receptor protein | 0.0902 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0902 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0902 | 1 | 1 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0902 | 1 | 0.5 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0902 | 1 | 1 |
| Mycobacterium ulcerans | secreted antigen 85-C FbpC | 0.0861 | 0.9524 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0902 | 1 | 0.5 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0902 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0902 | 1 | 0.5 |
| Brugia malayi | AKH receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0902 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0902 | 1 | 1 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0902 | 1 | 0.5 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0902 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0902 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0902 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0902 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0902 | 1 | 0.5 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0902 | 1 | 1 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0902 | 1 | 0.5 |
| Echinococcus multilocularis | sex peptide receptor | 0.0902 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0902 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0902 | 1 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0902 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Mycobacterium leprae | SECRETED ANTIGEN 85-C FBPC (85C) (ANTIGEN 85 COMPLEX C) (AG58C) (MYCOLYL TRANSFERASE 85C) (FIBRONECTIN-BINDING PROTEIN C) | 0.0861 | 0.9524 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0902 | 1 | 0.5 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0902 | 1 | 0.5 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Potency (binding) | 0.7943 uM | PubChem BioAssay. qHTS Assay for Inhibitors of MBNL1-poly(CUG) RNA binding. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 4.6535 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 96 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488745, AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
| Potency (functional) | 10.4179 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 48 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
| Potency (functional) | = 15.8489 um | PUBCHEM_BIOASSAY: VP16 counterscreen qHTS for inhibitors of ROR gamma transcriptional activity. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 25.1189 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Aldehyde Dehydrogenase 1 (ALDH1A1). (Class of assay: confirmatory) [Related pubchem assays: 1030 (qHTS Validation Assay for Inhibitors of aldehyde dehydrogenase 1 (ALDH1A1))] | ChEMBL. | No reference |
| Potency (functional) | = 35.4813 um | PUBCHEM_BIOASSAY: qHTS for inhibitors of ROR gamma transcriptional activity. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 39.8107 um | PUBCHEM_BIOASSAY: qHTS Assay for Promiscuous and Specific Inhibitors of Cruzain (without detergent). (Class of assay: confirmatory) [Related pubchem assays: 2158 (Confirmation qHTS Assay for Inhibitors of Cruzain), 2249 (Probe Development Summary of Promiscuous Inhibitors (Artifacts) of Cruzain), 2161 (qHTS Assay for Inhibitors of Papain: Counterscreen for Cruzain Assay), 1478 (qHTS Assay for Promiscuous and Specific Inhibitors of Cruzain (with detergent))] | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Plasmodium falciparum | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1311858
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.