Detailed information for compound 1233424
Basic information
Technical information
- TDR Targets ID: 1233424
- Name: N-[2-chloro-5-([1,3]oxazolo[4,5-b]pyridin-2-y l)phenyl]-2-(4-chlorophenyl)sulfanylacetamide
- MW: 430.307 | Formula: C20H13Cl2N3O2S
-
H donors: 1
H acceptors: 3
LogP: 5.36
Rotable bonds: 6
Rule of 5 violations (Lipinski): 1 - SMILES: O=C(Nc1cc(ccc1Cl)c1nc2c(o1)cccn2)CSc1ccc(cc1)Cl
- InChi: 1S/C20H13Cl2N3O2S/c21-13-4-6-14(7-5-13)28-11-18(26)24-16-10-12(3-8-15(16)22)20-25-19-17(27-20)2-1-9-23-19/h1-10H,11H2,(H,24,26)
- InChiKey: LABCXBXQZWMEPM-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- N-(2-chloro-5-oxazolo[4,5-b]pyridin-2-yl-phenyl)-2-(4-chlorophenyl)sulfanyl-acetamide
- N-[2-chloro-5-(2-oxazolo[4,5-b]pyridinyl)phenyl]-2-[(4-chlorophenyl)thio]acetamide
- N-(2-chloro-5-oxazolo[4,5-b]pyridin-2-yl-phenyl)-2-[(4-chlorophenyl)thio]acetamide
- N-[2-chloro-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-2-(4-chlorophenyl)sulfanyl-ethanamide
- MLS000331919
- N-(2-Chloro-5-oxazolo[4,5-b]pyridin-2-yl-phenyl)-2-(4-chloro-phenylsulfanyl)-acetamide
- SMR000221421
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | muscleblind-like splicing regulator 1 | Starlite/ChEMBL | No references |
| Mus musculus | RAR-related orphan receptor gamma | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
| Species | Potential target | Known druggable target/s | Ortholog Group |
|---|---|---|---|
| Echinococcus multilocularis | muscleblind protein 1 | Get druggable targets OG5_132352 | All targets in OG5_132352 |
| Loa Loa (eye worm) | hypothetical protein | Get druggable targets OG5_132352 | All targets in OG5_132352 |
| Brugia malayi | Muscleblind-like protein | Get druggable targets OG5_132352 | All targets in OG5_132352 |
| Echinococcus multilocularis | muscleblind protein | Get druggable targets OG5_132352 | All targets in OG5_132352 |
| Echinococcus granulosus | muscleblind protein | Get druggable targets OG5_132352 | All targets in OG5_132352 |
| Loa Loa (eye worm) | hypothetical protein | Get druggable targets OG5_132352 | All targets in OG5_132352 |
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Mycobacterium leprae | SECRETED ANTIGEN 85-C FBPC (85C) (ANTIGEN 85 COMPLEX C) (AG58C) (MYCOLYL TRANSFERASE 85C) (FIBRONECTIN-BINDING PROTEIN C) | 0.0861 | 0.9524 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0902 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0902 | 1 | 1 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | muscleblind protein | 0.018 | 0.1661 | 0.1661 |
| Schistosoma mansoni | opsin-like receptor | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | serotonin receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0902 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0902 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0902 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0902 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0902 | 1 | 0.5 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Brugia malayi | GnHR receptor homolog | 0.0902 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0902 | 1 | 1 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0902 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0902 | 1 | 0.5 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0902 | 1 | 0.5 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0902 | 1 | 0.5 |
| Brugia malayi | Serotonin receptor | 0.0902 | 1 | 1 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Brugia malayi | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0902 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0902 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0902 | 1 | 0.5 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0902 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0902 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0902 | 1 | 0.5 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Echinococcus multilocularis | serotonin receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0902 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0902 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0902 | 1 | 0.5 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0902 | 1 | 1 |
| Mycobacterium ulcerans | secreted antigen 85-C FbpC | 0.0861 | 0.9524 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0902 | 1 | 0.5 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0902 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0902 | 1 | 1 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0902 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0902 | 1 | 0.5 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0902 | 1 | 1 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0902 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0902 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0902 | 1 | 0.5 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0902 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0902 | 1 | 0.5 |
| Schistosoma mansoni | amine GPCR | 0.0902 | 1 | 0.5 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0902 | 1 | 0.5 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0902 | 1 | 0.5 |
| Brugia malayi | G-protein coupled receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0902 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0902 | 1 | 1 |
| Entamoeba histolytica | endo-1,4-beta-xylanase, putative | 0.0037 | 0 | 0.5 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0902 | 1 | 0.5 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0902 | 1 | 0.5 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0902 | 1 | 0.5 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0902 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0902 | 1 | 0.5 |
| Brugia malayi | Melatonin receptor type 1A | 0.0902 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0902 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0902 | 1 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0902 | 1 | 0.5 |
| Schistosoma mansoni | neuropeptide receptor | 0.0902 | 1 | 0.5 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0902 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0902 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0902 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | muscleblind protein | 0.018 | 0.1661 | 0.1661 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.018 | 0.1661 | 0.1661 |
| Echinococcus multilocularis | muscleblind protein 1 | 0.018 | 0.1661 | 0.1661 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0902 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0902 | 1 | 1 |
| Brugia malayi | Muscleblind-like protein | 0.018 | 0.1661 | 0.1661 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0902 | 1 | 0.5 |
| Brugia malayi | neuropeptide F receptor | 0.0902 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0902 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0902 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0902 | 1 | 0.5 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0902 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0902 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | allatostatin A receptor | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0902 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.018 | 0.1661 | 0.1661 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0902 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Onchocerca volvulus | 0.0902 | 1 | 0.5 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0902 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0902 | 1 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0902 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0902 | 1 | 0.5 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0902 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0902 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0902 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0902 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0902 | 1 | 1 |
| Mycobacterium tuberculosis | Secreted antigen 85-C FbpC (85C) (antigen 85 complex C) (AG58C) (mycolyl transferase 85C) (fibronectin-binding protein C) | 0.0861 | 0.9524 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0902 | 1 | 0.5 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0902 | 1 | 0.5 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0902 | 1 | 0.5 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0902 | 1 | 0.5 |
| Echinococcus multilocularis | sex peptide receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0902 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0902 | 1 | 0.5 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0902 | 1 | 0.5 |
| Echinococcus granulosus | hypothetical protein | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0902 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0902 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0902 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0902 | 1 | 0.5 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0902 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0902 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0902 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Potency (binding) | 0.7943 uM | PubChem BioAssay. qHTS Assay for Inhibitors of MBNL1-poly(CUG) RNA binding. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 4.6535 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 96 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488745, AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
| Potency (functional) | 10.4179 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 48 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
| Potency (functional) | = 15.8489 um | PUBCHEM_BIOASSAY: VP16 counterscreen qHTS for inhibitors of ROR gamma transcriptional activity. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 25.1189 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Aldehyde Dehydrogenase 1 (ALDH1A1). (Class of assay: confirmatory) [Related pubchem assays: 1030 (qHTS Validation Assay for Inhibitors of aldehyde dehydrogenase 1 (ALDH1A1))] | ChEMBL. | No reference |
| Potency (functional) | = 35.4813 um | PUBCHEM_BIOASSAY: qHTS for inhibitors of ROR gamma transcriptional activity. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 39.8107 um | PUBCHEM_BIOASSAY: qHTS Assay for Promiscuous and Specific Inhibitors of Cruzain (without detergent). (Class of assay: confirmatory) [Related pubchem assays: 2158 (Confirmation qHTS Assay for Inhibitors of Cruzain), 2249 (Probe Development Summary of Promiscuous Inhibitors (Artifacts) of Cruzain), 2161 (qHTS Assay for Inhibitors of Papain: Counterscreen for Cruzain Assay), 1478 (qHTS Assay for Promiscuous and Specific Inhibitors of Cruzain (with detergent))] | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Plasmodium falciparum | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1311858
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.