Detailed information for compound 1263556
Basic information
Technical information
- TDR Targets ID: 1263556
- Name: N-[4-(azepan-1-yl)phenyl]-2-[2-(1-cyclohexeny l)ethylamino]acetamide; oxalic acid
- MW: 445.552 | Formula: C24H35N3O5
-
H donors: 4
H acceptors: 5
LogP: 1.54
Rotable bonds: 9
Rule of 5 violations (Lipinski): 1 - SMILES: OC(=O)C(=O)O.O=C(Nc1ccc(cc1)N1CCCCCC1)CNCCC1=CCCCC1
- InChi: 1S/C22H33N3O.C2H2O4/c26-22(18-23-15-14-19-8-4-3-5-9-19)24-20-10-12-21(13-11-20)25-16-6-1-2-7-17-25;3-1(4)2(5)6/h8,10-13,23H,1-7,9,14-18H2,(H,24,26);(H,3,4)(H,5,6)
- InChiKey: PUOCBXUILBATHC-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- N-[4-(1-azepanyl)phenyl]-2-[2-(1-cyclohexenyl)ethylamino]acetamide; oxalic acid
- N-[4-(azepan-1-yl)phenyl]-2-[2-(1-cyclohexenyl)ethylamino]ethanamide; ethanedioic acid
- SMR000119642
- MLS000122283
- N-(4-Azepan-1-yl-phenyl)-2-(2-cyclohex-1-enyl-ethylamino)-acetamide
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | bromodomain adjacent to zinc finger domain, 2B | Starlite/ChEMBL | No references |
| Homo sapiens | glucosidase, alpha | Starlite/ChEMBL | No references |
| Homo sapiens | euchromatic histone-lysine N-methyltransferase 2 | Starlite/ChEMBL | No references |
| Bacillus subtilis | 4'-phosphopantetheinyl transferase ffp | Starlite/ChEMBL | No references |
| Homo sapiens | SMAD family member 2 | Starlite/ChEMBL | No references |
| Influenza A virus | Nonstructural protein 1 | Starlite/ChEMBL | No references |
| Homo sapiens | glucagon-like peptide 1 receptor | Starlite/ChEMBL | No references |
| Homo sapiens | isocitrate dehydrogenase 1 (NADP+), soluble | Starlite/ChEMBL | No references |
| Homo sapiens | lysine (K)-specific demethylase 4A | Starlite/ChEMBL | No references |
| Homo sapiens | APEX nuclease (multifunctional DNA repair enzyme) 1 | Starlite/ChEMBL | No references |
| Homo sapiens | geminin, DNA replication inhibitor | Starlite/ChEMBL | No references |
| Giardia intestinalis | Putative fructose-1,6-bisphosphate aldolase | Starlite/ChEMBL | No references |
| Homo sapiens | heat shock 70kDa protein 5 (glucose-regulated protein, 78kDa) | Starlite/ChEMBL | No references |
| Homo sapiens | chromobox homolog 1 | Starlite/ChEMBL | No references |
| Homo sapiens | glycoprotein hormones, alpha polypeptide | Starlite/ChEMBL | No references |
| Homo sapiens | neuropeptide S receptor 1 | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Schistosoma mansoni | histone-lysine n-methyltransferase suv9 | 0.005 | 0.0553 | 0.1385 |
| Trichomonas vaginalis | heat shock protein, putative | 0.0027 | 0.0131 | 0.0212 |
| Schistosoma mansoni | jumonji/arid domain-containing protein | 0.0112 | 0.1699 | 0.4259 |
| Trypanosoma brucei | heat shock protein, putative | 0.0047 | 0.0494 | 1 |
| Echinococcus granulosus | Jumonji AT rich interactive domain 1B | 0.0031 | 0.0211 | 0.0211 |
| Loa Loa (eye worm) | transcription factor SMAD2 | 0.0144 | 0.2305 | 0.5366 |
| Schistosoma mansoni | DNA polymerase eta | 0.0047 | 0.0492 | 0.1233 |
| Echinococcus granulosus | heat shock protein 90 | 0.0047 | 0.0494 | 0.0494 |
| Toxoplasma gondii | histone lysine methyltransferase SET/SUV39 | 0.0036 | 0.0297 | 0.0866 |
| Schistosoma mansoni | acetyl-CoA C-acetyltransferase | 0.0027 | 0.0133 | 0.0333 |
| Leishmania major | lipophosphoglycan biosynthetic protein, putative,heat shock protein 90, putative,glucose regulated protein 94, putative | 0.0044 | 0.044 | 0.8922 |
| Echinococcus multilocularis | diuretic hormone 44 receptor GPRdih2 | 0.0032 | 0.0224 | 0.0224 |
| Brugia malayi | Bromodomain containing protein | 0.0093 | 0.1357 | 0.2651 |
| Brugia malayi | Glycosyl hydrolases family 31 protein | 0.0197 | 0.3282 | 0.6413 |
| Leishmania major | heat shock protein 83-1 | 0.0047 | 0.0494 | 1 |
| Onchocerca volvulus | Heterochromatin protein 1 homolog | 0.0051 | 0.057 | 0.0775 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0192 | 0.3193 | 0.8003 |
| Treponema pallidum | heat shock protein 90 | 0.0044 | 0.044 | 0.0638 |
| Wolbachia endosymbiont of Brugia malayi | 4'-phosphopantetheinyl transferase | 0.0028 | 0.0152 | 0.2624 |
| Trypanosoma cruzi | heat shock protein 85, putative | 0.0047 | 0.0494 | 1 |
| Echinococcus granulosus | endoplasmin | 0.0044 | 0.044 | 0.044 |
| Toxoplasma gondii | heat shock protein HSP90 | 0.0047 | 0.0494 | 0.1553 |
| Trypanosoma cruzi | JmjC domain, hydroxylase, putative | 0.0029 | 0.0168 | 0.3411 |
| Loa Loa (eye worm) | hypothetical protein | 0.0102 | 0.1515 | 0.3526 |
| Plasmodium falciparum | phd finger protein, putative | 0.009 | 0.1304 | 0.4384 |
| Brugia malayi | Bromodomain containing protein | 0.0091 | 0.131 | 0.2559 |
| Trichomonas vaginalis | heat shock protein, putative | 0.004 | 0.0368 | 0.0596 |
| Toxoplasma gondii | 4'-phosphopantetheinyl transferase domain-containing protein | 0.0028 | 0.0152 | 0.0359 |
| Loa Loa (eye worm) | RNA recognition domain-containing protein domain-containing protein | 0.0192 | 0.3193 | 0.7432 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0138 | 0.2185 | 0.5477 |
| Echinococcus granulosus | bromodomain adjacent to zinc finger domain | 0.0043 | 0.0433 | 0.0433 |
| Brugia malayi | Calcitonin receptor-like protein seb-1 | 0.0102 | 0.1515 | 0.2959 |
| Leishmania major | heat shock protein 83-1 | 0.0047 | 0.0494 | 1 |
| Giardia lamblia | Fructose-bisphosphate aldolase | 0.0353 | 0.6183 | 1 |
| Trichomonas vaginalis | maltase-glucoamylase, putative | 0.0044 | 0.0438 | 0.0709 |
| Echinococcus granulosus | cadherin EGF LAG seven pass G type receptor | 0.0032 | 0.0224 | 0.0224 |
| Leishmania major | phosphopantetheinyl transferase-like protein | 0.0028 | 0.0152 | 0.3075 |
| Schistosoma mansoni | aminoadipate-semialdehyde dehydrogenase | 0.01 | 0.1492 | 0.374 |
| Schistosoma mansoni | histone-lysine n-methyltransferase setb1 | 0.0036 | 0.0297 | 0.0744 |
| Schistosoma mansoni | methyl-cpg binding protein mbd | 0.0021 | 0.001 | 0.0024 |
| Toxoplasma gondii | Hsp90 domain-containing protein | 0.0177 | 0.291 | 1 |
| Loa Loa (eye worm) | heat shock protein 75 | 0.0031 | 0.0203 | 0.0472 |
| Echinococcus multilocularis | phd:f box containing protein | 0.0029 | 0.0168 | 0.0168 |
| Schistosoma mansoni | protein phosphatase 2C | 0.0029 | 0.0168 | 0.0422 |
| Echinococcus granulosus | GA binding protein alpha chain | 0.0074 | 0.0996 | 0.0996 |
| Giardia lamblia | Endonuclease/Exonuclease/phosphatase | 0.0023 | 0.0049 | 0.0079 |
| Schistosoma mansoni | hypothetical protein | 0.0205 | 0.3428 | 0.8593 |
| Echinococcus granulosus | neutral alpha glucosidase AB | 0.0044 | 0.0438 | 0.0438 |
| Loa Loa (eye worm) | fli-1 protein | 0.0224 | 0.3784 | 0.8809 |
| Entamoeba histolytica | hypothetical protein | 0.0039 | 0.0349 | 0.0564 |
| Echinococcus granulosus | jumonji domain containing 1A | 0.0029 | 0.0168 | 0.0168 |
| Brugia malayi | jmjC domain containing protein | 0.0029 | 0.0168 | 0.0329 |
| Loa Loa (eye worm) | endoplasmin | 0.0047 | 0.0494 | 0.1149 |
| Echinococcus multilocularis | bromodomain adjacent to zinc finger domain | 0.0043 | 0.0433 | 0.0433 |
| Brugia malayi | jmjC domain containing protein | 0.0029 | 0.0168 | 0.0329 |
| Loa Loa (eye worm) | heterochromatin protein 1 | 0.0084 | 0.119 | 0.277 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0192 | 0.3193 | 0.8003 |
| Leishmania major | heat shock protein 83-1 | 0.0047 | 0.0494 | 1 |
| Plasmodium vivax | heat shock protein, putative | 0.0177 | 0.291 | 1 |
| Schistosoma mansoni | endoplasmin | 0.0047 | 0.0494 | 0.1237 |
| Echinococcus granulosus | lysine specific demethylase 6a | 0.0029 | 0.0168 | 0.0168 |
| Trypanosoma cruzi | apurinic/apyrimidinic endonuclease, putative | 0.0023 | 0.0049 | 0.0995 |
| Entamoeba histolytica | heat shock protein 90, putative | 0.0047 | 0.0494 | 0.0798 |
| Brugia malayi | Corticotropin releasing factor receptor 2 precursor, putative | 0.0102 | 0.1515 | 0.2959 |
| Toxoplasma gondii | histone lysine demethylase JMJD6a | 0.0029 | 0.0168 | 0.0417 |
| Mycobacterium leprae | PROBABLE CHAPERONE PROTEIN HTPG (HEAT SHOCK PROTEIN) (HSP90 FAMILY PROTEIN) (HIGH TEMPERATURE PROTEIN G) | 0.0044 | 0.044 | 0.1077 |
| Entamoeba histolytica | heat shock protein 90, putative | 0.0047 | 0.0494 | 0.0798 |
| Echinococcus multilocularis | jumonji domain containing protein | 0.0126 | 0.196 | 0.196 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0353 | 0.6183 | 1 |
| Trichomonas vaginalis | ap endonuclease, putative | 0.0023 | 0.0049 | 0.0079 |
| Onchocerca volvulus | 0.0154 | 0.2484 | 0.4815 | |
| Leishmania major | heat shock protein 83-1 | 0.0047 | 0.0494 | 1 |
| Brugia malayi | Pre-SET motif family protein | 0.0251 | 0.4296 | 0.8394 |
| Treponema pallidum | fructose-bisphosphate aldolase | 0.0353 | 0.6183 | 1 |
| Echinococcus multilocularis | zinc finger protein | 0.0024 | 0.0066 | 0.0066 |
| Entamoeba histolytica | hypothetical protein | 0.0039 | 0.0349 | 0.0564 |
| Mycobacterium tuberculosis | Probable fructose-bisphosphate aldolase Fba | 0.0172 | 0.283 | 1 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0186 | 0.3089 | 0.719 |
| Toxoplasma gondii | Ulp1 protease family, C-terminal catalytic domain-containing protein | 0.0047 | 0.0508 | 0.1604 |
| Leishmania major | heat shock protein 83-1 | 0.0047 | 0.0494 | 1 |
| Trichomonas vaginalis | endoplasmin, putative | 0.0034 | 0.0256 | 0.0414 |
| Plasmodium falciparum | conserved Plasmodium membrane protein, unknown function | 0.0029 | 0.0175 | 0.0441 |
| Leishmania major | heat shock protein 83-1 | 0.0047 | 0.0494 | 1 |
| Echinococcus granulosus | sentrin specific protease 1 | 0.0047 | 0.0508 | 0.0508 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0353 | 0.6183 | 1 |
| Echinococcus granulosus | PHD finger protein rhinoceros | 0.009 | 0.1304 | 0.1304 |
| Echinococcus granulosus | histone lysine methyltransferase setb | 0.0057 | 0.0679 | 0.0679 |
| Trypanosoma brucei | heat shock protein, putative | 0.0047 | 0.0494 | 1 |
| Plasmodium falciparum | holo-[acyl-carrier-protein] synthase, putative | 0.0028 | 0.0152 | 0.0359 |
| Plasmodium vivax | holo-[acyl-carrier-protein] synthase, putative | 0.0028 | 0.0152 | 0.0359 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0044 | 0.0438 | 0.0709 |
| Onchocerca volvulus | 0.01 | 0.1492 | 0.2722 | |
| Loa Loa (eye worm) | bromodomain containing protein | 0.0021 | 0.0024 | 0.0055 |
| Echinococcus granulosus | Basic leucine zipper bZIP transcription | 0.0039 | 0.0349 | 0.0349 |
| Echinococcus granulosus | DNA apurinic or apyrimidinic site lyase | 0.0023 | 0.0049 | 0.0049 |
| Leishmania major | heat shock protein 83-1 | 0.0047 | 0.0494 | 1 |
| Schistosoma mansoni | heat shock protein | 0.0047 | 0.0494 | 0.1237 |
| Entamoeba histolytica | exodeoxyribonuclease III, putative | 0.0023 | 0.0049 | 0.0079 |
| Loa Loa (eye worm) | latrophilin receptor protein 2 | 0.0032 | 0.0224 | 0.0522 |
| Onchocerca volvulus | 0.0286 | 0.4941 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0047 | 0.0508 | 0.1183 |
| Echinococcus granulosus | chromobox protein 1 | 0.0084 | 0.119 | 0.119 |
| Giardia lamblia | PHD finger protein 15 | 0.009 | 0.1304 | 0.2108 |
| Brugia malayi | latrophilin 2 splice variant baaae | 0.0069 | 0.0917 | 0.1793 |
| Echinococcus multilocularis | lysosomal alpha glucosidase | 0.0197 | 0.3282 | 0.3282 |
| Plasmodium vivax | SET domain protein, putative | 0.0036 | 0.0297 | 0.0866 |
| Toxoplasma gondii | histone lysine demethylase JMJC1/KDM5D/JARID1D | 0.0029 | 0.0168 | 0.0417 |
| Trichomonas vaginalis | neutral alpha-glucosidase ab precursor, putative | 0.0044 | 0.0438 | 0.0709 |
| Schistosoma mansoni | endoplasmin | 0.0047 | 0.0494 | 0.1237 |
| Loa Loa (eye worm) | hypothetical protein | 0.0052 | 0.0584 | 0.1359 |
| Trypanosoma cruzi | DNA polymerase eta, putative | 0.0033 | 0.0235 | 0.4761 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0044 | 0.0438 | 0.8878 |
| Schistosoma mansoni | heat shock protein | 0.0031 | 0.0203 | 0.0508 |
| Plasmodium vivax | hypothetical protein, conserved | 0.009 | 0.1304 | 0.4384 |
| Echinococcus multilocularis | dna polymerase eta | 0.0047 | 0.0492 | 0.0492 |
| Loa Loa (eye worm) | hypothetical protein | 0.0069 | 0.0917 | 0.2136 |
| Leishmania major | DNA polymerase eta, putative | 0.0033 | 0.0235 | 0.4761 |
| Trichomonas vaginalis | set domain proteins, putative | 0.0286 | 0.4941 | 0.799 |
| Mycobacterium tuberculosis | Probable chaperone protein HtpG (heat shock protein) (HSP90 family protein) (high temperature protein G) | 0.0044 | 0.044 | 0.1556 |
| Echinococcus multilocularis | heat shock protein 75 kDa, mitochondrial | 0.0031 | 0.0203 | 0.0203 |
| Echinococcus multilocularis | JmjC domain containing protein 4 | 0.0029 | 0.0168 | 0.0168 |
| Wolbachia endosymbiont of Brugia malayi | heat shock protein 90 | 0.0044 | 0.044 | 1 |
| Trypanosoma cruzi | Heat shock protein 83, putative | 0.0047 | 0.0494 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0558 | 1 | 1 |
| Leishmania major | alpha glucosidase II subunit, putative | 0.0044 | 0.0438 | 0.8878 |
| Echinococcus multilocularis | chromobox protein 1 | 0.0084 | 0.119 | 0.119 |
| Leishmania major | apurinic/apyrimidinic endonuclease-redox protein | 0.0023 | 0.0049 | 0.0995 |
| Mycobacterium ulcerans | phosphopantetheinyl transferase, PptII | 0.0028 | 0.0152 | 0.0536 |
| Echinococcus granulosus | dna polymerase eta | 0.0047 | 0.0492 | 0.0492 |
| Schistosoma mansoni | hypothetical protein | 0.0205 | 0.3428 | 0.8593 |
| Echinococcus granulosus | zinc finger protein | 0.0024 | 0.0066 | 0.0066 |
| Toxoplasma gondii | glycosyl hydrolase, family 31 protein | 0.0044 | 0.0438 | 0.136 |
| Leishmania major | heat shock protein 83-1 | 0.0047 | 0.0494 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0032 | 0.0224 | 0.0562 |
| Schistosoma mansoni | family C48 unassigned peptidase (C48 family) | 0.0047 | 0.0508 | 0.1274 |
| Giardia lamblia | Heat shock protein HSP 90-alpha | 0.004 | 0.0368 | 0.0596 |
| Echinococcus granulosus | lysosomal alpha glucosidase | 0.0197 | 0.3282 | 0.3282 |
| Trichomonas vaginalis | Clan CE, family C48, Ulp1-like cysteine peptidase | 0.0047 | 0.0508 | 0.0822 |
| Trichomonas vaginalis | chromobox protein, putative | 0.0084 | 0.119 | 0.1925 |
| Trypanosoma brucei | DNA polymerase eta, putative | 0.0047 | 0.0492 | 0.997 |
| Echinococcus granulosus | diuretic hormone 44 receptor GPRdih2 | 0.0032 | 0.0224 | 0.0224 |
| Loa Loa (eye worm) | hypothetical protein | 0.0085 | 0.1214 | 0.2825 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0044 | 0.0438 | 0.8878 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0033 | 0.0247 | 0.04 |
| Loa Loa (eye worm) | MH2 domain-containing protein | 0.0144 | 0.2305 | 0.5366 |
| Entamoeba histolytica | hypothetical protein | 0.0028 | 0.0152 | 0.0245 |
| Trypanosoma brucei | apurinic/apyrimidinic endonuclease, putative | 0.0023 | 0.0049 | 0.0995 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0138 | 0.2185 | 0.5477 |
| Echinococcus multilocularis | histone lysine methyltransferase setb histone lysine methyltransferase eggless | 0.0057 | 0.0679 | 0.0679 |
| Toxoplasma gondii | PHD-finger domain-containing protein | 0.0029 | 0.0175 | 0.0441 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0112 | 0.1699 | 0.3956 |
| Schistosoma mansoni | hypothetical protein | 0.0039 | 0.0349 | 0.0874 |
| Loa Loa (eye worm) | hypothetical protein | 0.0029 | 0.0168 | 0.0392 |
| Brugia malayi | RNA binding protein | 0.0192 | 0.3193 | 0.6238 |
| Loa Loa (eye worm) | glycosyl hydrolase family 31 protein | 0.0197 | 0.3282 | 0.764 |
| Echinococcus multilocularis | GA binding protein alpha chain | 0.0074 | 0.0996 | 0.0996 |
| Toxoplasma gondii | PHD-finger domain-containing protein | 0.009 | 0.1304 | 0.4384 |
| Schistosoma mansoni | family C48 unassigned peptidase (C48 family) | 0.0047 | 0.0508 | 0.1274 |
| Brugia malayi | Glycosyl hydrolases family 31 protein | 0.0044 | 0.0438 | 0.0856 |
| Brugia malayi | jmjC domain containing protein | 0.0029 | 0.0168 | 0.0329 |
| Echinococcus granulosus | GPCR family 2 | 0.0032 | 0.0224 | 0.0224 |
| Echinococcus granulosus | geminin | 0.0205 | 0.3428 | 0.3428 |
| Echinococcus multilocularis | bromodomain adjacent to zinc finger domain | 0.0072 | 0.0966 | 0.0966 |
| Schistosoma mansoni | bromodomain containing protein | 0.0076 | 0.1047 | 0.2624 |
| Schistosoma mansoni | gabp alpha | 0.0074 | 0.0996 | 0.2498 |
| Schistosoma mansoni | transcription factor LCR-F1 | 0.0039 | 0.0349 | 0.0874 |
| Brugia malayi | jmjC domain containing protein | 0.0112 | 0.1699 | 0.332 |
| Brugia malayi | hypothetical protein | 0.0039 | 0.0349 | 0.0681 |
| Brugia malayi | MH2 domain containing protein | 0.0144 | 0.2305 | 0.4504 |
| Echinococcus multilocularis | lysine specific demethylase 5A | 0.0109 | 0.1656 | 0.1656 |
| Echinococcus granulosus | heat shock protein | 0.0047 | 0.0494 | 0.0494 |
| Trichomonas vaginalis | heat shock protein, putative | 0.0034 | 0.0256 | 0.0414 |
| Trichomonas vaginalis | heat shock protein, putative | 0.0047 | 0.0494 | 0.0798 |
| Plasmodium falciparum | sentrin-specific protease 1 | 0.0047 | 0.0508 | 0.1604 |
| Echinococcus multilocularis | DNA (apurinic or apyrimidinic site) lyase | 0.0023 | 0.0049 | 0.0049 |
| Trypanosoma cruzi | heat shock protein 90, putative | 0.0047 | 0.0494 | 1 |
| Echinococcus granulosus | guanine nucleotide binding protein Gs subunit | 0.0138 | 0.2185 | 0.2185 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0047 | 0.0503 | 0.0814 |
| Trypanosoma brucei | Heat shock protein 83, putative | 0.0047 | 0.0494 | 1 |
| Trypanosoma brucei | hypothetical protein, conserved | 0.0028 | 0.0152 | 0.3075 |
| Plasmodium vivax | hypothetical protein, conserved | 0.0029 | 0.0175 | 0.0441 |
| Giardia lamblia | Heat shock protein HSP 90-alpha | 0.0047 | 0.0494 | 0.0798 |
| Schistosoma mansoni | hypothetical protein | 0.0069 | 0.0917 | 0.23 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0558 | 1 | 1 |
| Trypanosoma cruzi | apurinic/apyrimidinic endonuclease | 0.0023 | 0.0049 | 0.0995 |
| Echinococcus multilocularis | peregrin | 0.0093 | 0.1357 | 0.1357 |
| Trypanosoma brucei | heat shock protein, putative | 0.0047 | 0.0494 | 1 |
| Brugia malayi | Ulp1 protease family, C-terminal catalytic domain containing protein | 0.0047 | 0.0508 | 0.0993 |
| Echinococcus granulosus | jumonji domain containing protein | 0.0126 | 0.196 | 0.196 |
| Echinococcus multilocularis | geminin | 0.0205 | 0.3428 | 0.3428 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0353 | 0.6183 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 0.0488 | 0.1136 |
| Schistosoma mansoni | jumonji domain containing protein | 0.0235 | 0.3989 | 1 |
| Trypanosoma brucei | heat shock protein, putative | 0.0047 | 0.0494 | 1 |
| Brugia malayi | exodeoxyribonuclease III family protein | 0.0023 | 0.0049 | 0.0096 |
| Echinococcus multilocularis | guanine nucleotide binding protein G(s) subunit | 0.0138 | 0.2185 | 0.2185 |
| Entamoeba histolytica | fructose-1,6-bisphosphate aldolase, putative | 0.0353 | 0.6183 | 1 |
| Echinococcus multilocularis | sentrin specific protease 1 | 0.0047 | 0.0508 | 0.0508 |
| Leishmania major | heat shock protein 83-1 | 0.0047 | 0.0494 | 1 |
| Trichomonas vaginalis | chromobox protein, putative | 0.0051 | 0.057 | 0.0922 |
| Plasmodium falciparum | heat shock protein 90, putative | 0.0177 | 0.291 | 1 |
| Trypanosoma cruzi | heat shock protein 85, putative | 0.0047 | 0.0494 | 1 |
| Leishmania major | heat shock protein, putative | 0.0031 | 0.0203 | 0.4108 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0353 | 0.6183 | 1 |
| Plasmodium vivax | heat shock protein 86, putative | 0.0047 | 0.0494 | 0.1553 |
| Mycobacterium tuberculosis | Probable exodeoxyribonuclease III protein XthA (exonuclease III) (EXO III) (AP endonuclease VI) | 0.0023 | 0.0049 | 0.0173 |
| Schistosoma mansoni | mixed-lineage leukemia protein mll | 0.0031 | 0.02 | 0.0501 |
| Echinococcus granulosus | 5'partial|histone lysine N methyltransferase SETDB2 | 0.0035 | 0.0272 | 0.0272 |
| Toxoplasma gondii | PHD-finger domain-containing protein | 0.009 | 0.1304 | 0.4384 |
| Loa Loa (eye worm) | hypothetical protein | 0.01 | 0.1492 | 0.3474 |
| Brugia malayi | Heterochromatin protein 1 | 0.0084 | 0.119 | 0.2325 |
| Entamoeba histolytica | 90 kDa heat shock protein, putative | 0.0031 | 0.0203 | 0.0328 |
| Leishmania major | heat shock protein 83-1 | 0.0047 | 0.0494 | 1 |
| Leishmania major | heat shock protein 83-1 | 0.0047 | 0.0494 | 1 |
| Trypanosoma cruzi | heat shock protein 90, putative | 0.004 | 0.0368 | 0.7464 |
| Schistosoma mansoni | histone-lysine n-methyltransferase setb1 | 0.0057 | 0.0679 | 0.1703 |
| Trypanosoma brucei | heat shock protein 84, putative | 0.0031 | 0.0203 | 0.4108 |
| Brugia malayi | PHD-finger family protein | 0.009 | 0.1304 | 0.2547 |
| Leishmania major | heat shock protein 83-1 | 0.0047 | 0.0494 | 1 |
| Brugia malayi | Ets-domain containing protein | 0.0074 | 0.0996 | 0.1947 |
| Schistosoma mansoni | heat shock protein | 0.0047 | 0.0494 | 0.1237 |
| Schistosoma mansoni | hypothetical protein | 0.009 | 0.1304 | 0.3268 |
| Plasmodium falciparum | heat shock protein 90, putative | 0.0027 | 0.0131 | 0.0286 |
| Loa Loa (eye worm) | hypothetical protein | 0.0037 | 0.0314 | 0.0731 |
| Echinococcus granulosus | L aminoadipate semialdehyde | 0.01 | 0.1492 | 0.1492 |
| Echinococcus multilocularis | lysine specific demethylase 6a | 0.0029 | 0.0168 | 0.0168 |
| Schistosoma mansoni | chromobox protein | 0.0084 | 0.119 | 0.2983 |
| Mycobacterium ulcerans | heat shock protein 90 | 0.0044 | 0.044 | 0.1556 |
| Brugia malayi | Ets-domain containing protein | 0.0074 | 0.0996 | 0.1947 |
| Plasmodium falciparum | endoplasmin, putative | 0.0034 | 0.0256 | 0.0723 |
| Echinococcus granulosus | lysine specific demethylase 5A | 0.0112 | 0.1699 | 0.1699 |
| Mycobacterium ulcerans | fructose-bisphosphate aldolase | 0.0172 | 0.283 | 1 |
| Schistosoma mansoni | alpha-glucosidase | 0.0169 | 0.2773 | 0.6951 |
| Trypanosoma brucei | heat shock protein, putative | 0.0047 | 0.0494 | 1 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0044 | 0.0438 | 0.0709 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0044 | 0.0438 | 0.0709 |
| Loa Loa (eye worm) | PHD-finger family protein | 0.0025 | 0.009 | 0.021 |
| Loa Loa (eye worm) | PHD-finger family protein | 0.009 | 0.1304 | 0.3035 |
| Onchocerca volvulus | 0.0114 | 0.1741 | 0.3247 | |
| Brugia malayi | Bromodomain containing protein | 0.0046 | 0.0486 | 0.095 |
| Echinococcus granulosus | tar DNA binding protein | 0.0192 | 0.3193 | 0.3193 |
| Loa Loa (eye worm) | GTP-binding regulatory protein Gs alpha-S chain | 0.0138 | 0.2185 | 0.5087 |
| Brugia malayi | jmjC domain containing protein | 0.0029 | 0.0168 | 0.0329 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0029 | 0.0168 | 0.0392 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0353 | 0.6183 | 1 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0192 | 0.3193 | 0.8003 |
| Echinococcus multilocularis | methyl CpG binding domain protein 2 | 0.0021 | 0.001 | 0.001 |
| Echinococcus multilocularis | heat shock protein 90 | 0.004 | 0.0368 | 0.0368 |
| Echinococcus multilocularis | Basic leucine zipper (bZIP) transcription | 0.0039 | 0.0349 | 0.0349 |
| Toxoplasma gondii | heat shock protein 90, putative | 0.0047 | 0.0494 | 0.1553 |
| Trypanosoma cruzi | heat shock protein, putative | 0.0031 | 0.0203 | 0.4108 |
| Echinococcus granulosus | peregrin | 0.0093 | 0.1357 | 0.1357 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0353 | 0.6183 | 1 |
| Toxoplasma gondii | WD domain, G-beta repeat-containing protein | 0.0029 | 0.0175 | 0.0441 |
| Leishmania major | heat shock protein 83-1 | 0.0047 | 0.0494 | 1 |
| Trypanosoma brucei | heat shock protein, putative | 0.0047 | 0.0494 | 1 |
| Schistosoma mansoni | ubiquitously transcribed sex (X/Y) chromosome tetratricopeptide repeat protein-related | 0.0029 | 0.0168 | 0.0422 |
| Onchocerca volvulus | 0.005 | 0.0553 | 0.0738 | |
| Brugia malayi | Pre-SET motif family protein | 0.0036 | 0.0297 | 0.058 |
| Loa Loa (eye worm) | hypothetical protein | 0.0047 | 0.0503 | 0.1172 |
| Brugia malayi | Latrophilin receptor protein 2 | 0.0032 | 0.0224 | 0.0438 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0047 | 0.0503 | 0.0814 |
| Brugia malayi | F/Y-rich N-terminus family protein | 0.0033 | 0.0243 | 0.0474 |
| Plasmodium vivax | JmjC domain containing protein | 0.0029 | 0.0168 | 0.0417 |
| Entamoeba histolytica | glycosyl hydrolase, family 31 protein | 0.0044 | 0.0438 | 0.0709 |
| Schistosoma mansoni | ets-related | 0.0224 | 0.3784 | 0.9485 |
| Loa Loa (eye worm) | exodeoxyribonuclease III family protein | 0.0023 | 0.0049 | 0.0114 |
| Brugia malayi | AF-10 protein | 0.0029 | 0.0175 | 0.0342 |
| Echinococcus granulosus | fetal alzheimer antigen falz | 0.0027 | 0.0133 | 0.0133 |
| Brugia malayi | heat shock protein 90 | 0.0047 | 0.0494 | 0.0964 |
| Brugia malayi | calcium-independent alpha-latrotoxin receptor 2, putative | 0.0032 | 0.0224 | 0.0438 |
| Leishmania major | DNA polymerase eta, putative | 0.0047 | 0.0492 | 0.997 |
| Schistosoma mansoni | alpha glucosidase | 0.0044 | 0.0438 | 0.1098 |
| Entamoeba histolytica | hypothetical protein | 0.0039 | 0.0349 | 0.0564 |
| Echinococcus granulosus | methyl CpG binding domain protein 2 | 0.0021 | 0.001 | 0.001 |
| Giardia lamblia | Grp94/Hsp90 | 0.0044 | 0.044 | 0.0712 |
| Schistosoma mansoni | phosphatidylserine receptor | 0.0029 | 0.0168 | 0.0422 |
| Schistosoma mansoni | ap endonuclease | 0.0023 | 0.0049 | 0.0123 |
| Trypanosoma cruzi | heat shock protein 85, putative | 0.0047 | 0.0494 | 1 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0353 | 0.6183 | 1 |
| Schistosoma mansoni | histone-lysine n-methyltransferase setb1 | 0.0057 | 0.0679 | 0.1703 |
| Loa Loa (eye worm) | pre-SET domain-containing protein family protein | 0.0251 | 0.4296 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0033 | 0.0247 | 0.04 |
| Schistosoma mansoni | chromobox protein | 0.0084 | 0.119 | 0.2983 |
| Loa Loa (eye worm) | hypothetical protein | 0.009 | 0.1304 | 0.3035 |
| Echinococcus multilocularis | GPCR, family 2 | 0.0032 | 0.0224 | 0.0224 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 0.0218 | 0.0508 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0192 | 0.3193 | 0.8003 |
| Echinococcus granulosus | guanine nucleotide binding protein Gs subunit | 0.0138 | 0.2185 | 0.2185 |
| Echinococcus granulosus | heat shock protein 75 kDa mitochondrial | 0.0031 | 0.0203 | 0.0203 |
| Treponema pallidum | 4'-phosphopantetheinyl transferase | 0.0028 | 0.0152 | 0.0167 |
| Mycobacterium ulcerans | exodeoxyribonuclease III protein XthA | 0.0023 | 0.0049 | 0.0173 |
| Mycobacterium ulcerans | 4'-phosphopantetheinyl transferase | 0.0028 | 0.0152 | 0.0536 |
| Trypanosoma cruzi | DNA polymerase eta, putative | 0.0047 | 0.0492 | 0.997 |
| Brugia malayi | aminoadipate-semialdehyde dehydrogenase-phosphopantetheinyl transferase | 0.01 | 0.1492 | 0.2916 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0558 | 1 | 1 |
| Leishmania major | heat shock protein 83-1 | 0.0047 | 0.0494 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0155 | 0.2501 | 0.5823 |
| Loa Loa (eye worm) | RNA binding protein | 0.0192 | 0.3193 | 0.7432 |
| Schistosoma mansoni | methyl-cpg binding protein mbd | 0.0021 | 0.001 | 0.0024 |
| Toxoplasma gondii | 4'-phosphopantetheinyl transferase superfamily protein | 0.0028 | 0.0152 | 0.0359 |
| Echinococcus multilocularis | guanine nucleotide binding protein G(s) subunit | 0.0138 | 0.2185 | 0.2185 |
| Echinococcus multilocularis | heat shock protein | 0.0047 | 0.0494 | 0.0494 |
| Brugia malayi | chromobox protein homolog 3 | 0.0047 | 0.0503 | 0.0983 |
| Trichomonas vaginalis | chromobox protein, putative | 0.0051 | 0.057 | 0.0922 |
| Brugia malayi | PHD-finger family protein | 0.0032 | 0.0218 | 0.0426 |
| Echinococcus multilocularis | jumonji domain containing 1A | 0.0029 | 0.0168 | 0.0168 |
| Schistosoma mansoni | jumonji/arid domain-containing protein | 0.0112 | 0.1699 | 0.4259 |
| Trichomonas vaginalis | sucrase-isomaltase, putative | 0.0044 | 0.0438 | 0.0709 |
| Brugia malayi | jmjC domain containing protein | 0.0296 | 0.5118 | 1 |
| Mycobacterium tuberculosis | holo-[acyl-carrier protein] synthase AcpS (holo-ACP synthase) (CoA:APO-[ACP]pantetheinephosphotransferase) (CoA:APO-[acyl-carrie | 0.0028 | 0.0152 | 0.0536 |
| Echinococcus multilocularis | endoplasmin | 0.0044 | 0.044 | 0.044 |
| Brugia malayi | Hsp90 protein | 0.0031 | 0.0203 | 0.0396 |
| Plasmodium falciparum | heat shock protein 90 | 0.0047 | 0.0494 | 0.1553 |
| Onchocerca volvulus | Heterochromatin protein 1 homolog | 0.0047 | 0.0503 | 0.0634 |
| Brugia malayi | RNA recognition motif domain containing protein | 0.0192 | 0.3193 | 0.6238 |
| Entamoeba histolytica | hypothetical protein | 0.0039 | 0.0349 | 0.0564 |
| Plasmodium vivax | heat shock protein 90, putative | 0.0031 | 0.0203 | 0.0537 |
| Schistosoma mansoni | hypothetical protein | 0.0029 | 0.0175 | 0.0439 |
| Schistosoma mansoni | hypothetical protein | 0.0025 | 0.009 | 0.0226 |
| Echinococcus granulosus | chromobox protein 1 | 0.0084 | 0.119 | 0.119 |
| Brugia malayi | TAR-binding protein | 0.0192 | 0.3193 | 0.6238 |
| Trichomonas vaginalis | heat shock protein, putative | 0.0044 | 0.044 | 0.0712 |
| Echinococcus multilocularis | chromobox protein 1 | 0.0084 | 0.119 | 0.119 |
| Trichomonas vaginalis | neutral alpha-glucosidase ab precursor, putative | 0.0044 | 0.0438 | 0.0709 |
| Leishmania major | hypothetical protein, conserved | 0.0029 | 0.0168 | 0.3411 |
| Schistosoma mansoni | phd/f-box containing protein | 0.0029 | 0.0168 | 0.0422 |
| Echinococcus multilocularis | tar DNA binding protein | 0.0192 | 0.3193 | 0.3193 |
| Loa Loa (eye worm) | D-ets-4 DNA binding domain-containing protein | 0.0074 | 0.0996 | 0.2319 |
| Schistosoma mansoni | hypothetical protein | 0.0032 | 0.0224 | 0.0562 |
| Schistosoma mansoni | bromodomain-containing nuclear protein 1 brd1 | 0.009 | 0.1304 | 0.3268 |
| Trichomonas vaginalis | heat shock protein, putative | 0.0044 | 0.044 | 0.0712 |
| Toxoplasma gondii | ImpB/MucB/SamB family protein | 0.0033 | 0.0235 | 0.065 |
| Trypanosoma brucei | PHD-zinc-finger like domain containing protein, putative | 0.0029 | 0.0175 | 0.3549 |
| Echinococcus multilocularis | Jumonji, AT rich interactive domain 1B | 0.0031 | 0.0211 | 0.0211 |
| Brugia malayi | GTP-binding regulatory protein Gs alpha-S chain, putative | 0.0138 | 0.2185 | 0.427 |
| Echinococcus multilocularis | L aminoadipate semialdehyde | 0.01 | 0.1492 | 0.1492 |
| Echinococcus multilocularis | cadherin EGF LAG seven pass G type receptor | 0.0032 | 0.0224 | 0.0224 |
| Loa Loa (eye worm) | hypothetical protein | 0.0029 | 0.0168 | 0.0392 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0029 | 0.0168 | 0.0392 |
| Plasmodium vivax | endoplasmin, putative | 0.0047 | 0.0494 | 0.1553 |
| Trichomonas vaginalis | chromobox protein, putative | 0.0084 | 0.119 | 0.1925 |
| Trypanosoma brucei | heat shock protein, putative | 0.0047 | 0.0494 | 1 |
| Toxoplasma gondii | heat shock protein 75, putative | 0.0031 | 0.0203 | 0.0537 |
| Trypanosoma brucei | PHD-zinc-finger like domain containing protein, putative | 0.0029 | 0.0175 | 0.3549 |
| Echinococcus multilocularis | fetal alzheimer antigen, falz | 0.0027 | 0.0133 | 0.0133 |
| Entamoeba histolytica | glycosyl hydrolase, family 31 protein | 0.0044 | 0.0438 | 0.0709 |
| Entamoeba histolytica | Ulp1 protease family, C-terminal catalytic domain containing protein | 0.0047 | 0.0508 | 0.0822 |
| Brugia malayi | hypothetical protein | 0.0154 | 0.2484 | 0.4854 |
| Loa Loa (eye worm) | hypothetical protein | 0.0057 | 0.0679 | 0.1582 |
| Chlamydia trachomatis | holo [acyl-carrier protein] synthase | 0.0028 | 0.0152 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0063 | 0.0798 | 0.1857 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0044 | 0.0438 | 0.0709 |
| Schistosoma mansoni | hypothetical protein | 0.0032 | 0.0224 | 0.0562 |
| Trypanosoma cruzi | JmjC domain, hydroxylase, putative | 0.0029 | 0.0168 | 0.3411 |
| Schistosoma mansoni | zinc finger protein | 0.0024 | 0.0066 | 0.0166 |
| Leishmania major | heat shock protein 83-1 | 0.0047 | 0.0494 | 1 |
| Entamoeba histolytica | fructose-1,6-bisphosphate aldolase, putative | 0.0353 | 0.6183 | 1 |
| Echinococcus granulosus | Transcription factor JmjC domain containing protein | 0.0296 | 0.5118 | 0.5118 |
| Echinococcus multilocularis | heat shock protein 90 | 0.0047 | 0.0494 | 0.0494 |
| Trypanosoma brucei | heat shock protein, putative | 0.0047 | 0.0494 | 1 |
| Loa Loa (eye worm) | TAR-binding protein | 0.0192 | 0.3193 | 0.7432 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0353 | 0.6183 | 1 |
| Brugia malayi | ImpB/MucB/SamB family protein | 0.0047 | 0.0492 | 0.0961 |
| Echinococcus granulosus | bromodomain adjacent to zinc finger domain | 0.0072 | 0.0966 | 0.0966 |
| Loa Loa (eye worm) | hypothetical protein | 0.0049 | 0.0541 | 0.1259 |
| Echinococcus granulosus | heat shock protein heat shock protein 90 alpha | 0.004 | 0.0368 | 0.0368 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 0.2484 | 0.5783 |
| Echinococcus multilocularis | histone lysine N methyltransferase SETMAR | 0.0036 | 0.0297 | 0.0297 |
| Echinococcus multilocularis | Transcription factor, JmjC domain containing protein | 0.0296 | 0.5118 | 0.5118 |
| Trypanosoma brucei | heat shock protein 90, putative | 0.0047 | 0.0494 | 1 |
| Onchocerca volvulus | 0.0037 | 0.0314 | 0.0235 | |
| Trichomonas vaginalis | ap endonuclease, putative | 0.0023 | 0.0049 | 0.0079 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0192 | 0.3193 | 0.8003 |
| Trypanosoma brucei | heat shock protein 90, putative | 0.0047 | 0.0494 | 1 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0044 | 0.0438 | 0.0709 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 0.0224 | 0.0522 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0138 | 0.2185 | 0.5477 |
| Onchocerca volvulus | Alhambra homolog | 0.009 | 0.1304 | 0.2324 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0029 | 0.0168 | 0.0392 |
| Schistosoma mansoni | alpha-glucosidase | 0.0169 | 0.2773 | 0.6951 |
| Echinococcus multilocularis | neutral alpha glucosidase AB | 0.0044 | 0.0438 | 0.0438 |
| Echinococcus multilocularis | PHD finger protein rhinoceros | 0.009 | 0.1304 | 0.1304 |
| Brugia malayi | PHD-finger family protein | 0.003 | 0.0186 | 0.0363 |
| Echinococcus granulosus | phd:f box containing protein | 0.0029 | 0.0168 | 0.0168 |
| Plasmodium vivax | sentrin-specific protease 1, putative | 0.0047 | 0.0508 | 0.1604 |
| Brugia malayi | Fli-1 protein | 0.0224 | 0.3784 | 0.7394 |
| Trypanosoma brucei | JmjC domain, hydroxylase, putative | 0.0029 | 0.0168 | 0.3411 |
| Schistosoma mansoni | ap endonuclease | 0.0023 | 0.0049 | 0.0123 |
| Loa Loa (eye worm) | glycosyl hydrolase family 31 protein | 0.0044 | 0.0438 | 0.102 |
| Loa Loa (eye worm) | pigment dispersing factor receptor c | 0.0102 | 0.1515 | 0.3526 |
| Brugia malayi | Endoplasmin precursor | 0.0047 | 0.0494 | 0.0964 |
| Mycobacterium leprae | Probable fructose bisphosphate aldolase Fba | 0.0172 | 0.283 | 1 |
| Leishmania major | heat shock protein 83-1 | 0.0047 | 0.0494 | 1 |
| Schistosoma mansoni | jumonji domain containing protein | 0.0029 | 0.0168 | 0.0422 |
| Schistosoma mansoni | hypothetical protein | 0.0032 | 0.0224 | 0.0562 |
| Loa Loa (eye worm) | heat shock protein 90 | 0.0047 | 0.0494 | 0.1149 |
| Echinococcus granulosus | heat shock protein 90 | 0.004 | 0.0368 | 0.0368 |
| Trypanosoma cruzi | heat shock protein 85, putative | 0.004 | 0.0368 | 0.7464 |
| Trypanosoma brucei | glucosidase, putative | 0.0044 | 0.0438 | 0.8878 |
| Plasmodium falciparum | JmjC domain-containing protein, putative | 0.0029 | 0.0168 | 0.0417 |
| Echinococcus multilocularis | lysosomal alpha glucosidase | 0.0197 | 0.3282 | 0.3282 |
| Echinococcus granulosus | JmjC domain containing protein 4 | 0.0029 | 0.0168 | 0.0168 |
| Leishmania major | heat shock protein 83-1 | 0.0047 | 0.0494 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0047 | 0.0492 | 0.1145 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (functional) | 13.81 uM | PUBCHEM_BIOASSAY: Discovery of Small Molecule Probes for H1N1 Influenza NS1A. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504399] | ChEMBL. | No reference |
| Potency (functional) | 1.2589 uM | PubChem BioAssay. qHTS Assay for Inhibitors of the Human Apurinic/apyrimidinic Endonuclease 1 (APE1). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 2.8184 uM | PubChem BioAssay. qHTS for Activators of Integrin-Mediated Alleviation for Muscular Dystrophy. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 5.0119 uM | PubChem BioAssay. qHTS of GLP-1 Receptor Inverse Agonists (Inhibition Mode). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 10 uM | PUBCHEM_BIOASSAY: qHTS for Inducers of the Endoplasmic Reticulum Stress Response (ERSR) in Human Glioma: qHTS. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 11.2202 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Histone Lysine Methyltransferase G9a. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504404] | ChEMBL. | No reference |
| Potency (functional) | = 12.5893 um | PUBCHEM_BIOASSAY: qHTS Assay for Antagonists of the Neuropeptide S Receptor: cAMP Signal Transduction. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 12.5893 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BAZ2B. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504391] | ChEMBL. | No reference |
| Potency (functional) | = 15.8489 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Bacillus subtilis Sfp phosphopantetheinyl transferase (PPTase). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 15.8489 uM | PUBCHEM_BIOASSAY: HTS for Inhibitors of HP1-beta Chromodomain Interactions with Methylated Histone Tails. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488962] | ChEMBL. | No reference |
| Potency (functional) | 15.8489 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of TGF-b. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588856, AID588860] | ChEMBL. | No reference |
| Potency (functional) | = 17.7407 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Fructose-1,6-bisphosphate Aldolase from Giardia Lamblia. (Class of assay: confirmatory) [Related pubchem assays: 2472, 2464 ] | ChEMBL. | No reference |
| Potency (functional) | = 17.7828 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors and Activators of Human alpha-Glucosidase Cleavage of Glycogen. (Class of assay: confirmatory) [Related pubchem assays: 1473, 1466 ] | ChEMBL. | No reference |
| Potency (functional) | 18.3489 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of binding or entry into cells for Lassa Virus. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID463114, AID540249] | ChEMBL. | No reference |
| Potency (functional) | 18.3564 uM | PubChem BioAssay. A quantitative high throughput screen for small molecules that induce DNA re-replication in MCF 10a normal breast cells. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 18.3564 uM | PubChem BioAssay. qHTS for induction of synthetic lethality in tumor cells producing 2HG: qHTS for the HT-1080-NT fibrosarcoma cell line. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 18.526 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 48 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
| Potency (functional) | 19.9526 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of JMJD2A-Tudor Domain. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504402] | ChEMBL. | No reference |
| Potency (binding) | = 22.3872 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Tyrosyl-DNA Phosphodiesterase (TDP1). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (binding) | = 22.3872 um | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Thioflavin T Binding. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | ChEMBL. | No reference |
| Potency (functional) | = 25.1189 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Human Jumonji Domain Containing 2E (JMJD2E). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 25.1189 uM | PubChem BioAssay. qHTS for Inhibitors of ATXN expression. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 28.1838 um | PUBCHEM_BIOASSAY: qHTS Assay for the Inhibitors of L3MBTL1. (Class of assay: confirmatory) [Related pubchem assays: 485292 (Probe Development Summary for Inhibitors of L3MBTL1)] | ChEMBL. | No reference |
| Potency (functional) | 29.0929 uM | PubChem BioAssay. A quantitative high throughput screen for small molecules that induce DNA re-replication in SW480 colon adenocarcinoma cells. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 31.6228 um | PUBCHEM_BIOASSAY: qHTS Assay for Modulators of Lamin A Splicing. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (binding) | 31.6228 uM | PUBCHEM_BIOASSAY: qHTS Assay for Compounds Blocking the Interaction Between CBF-beta and RUNX1 for the Treatment of Acute Myeloid Leukemia. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID1484, AID504370, AID504374, AID504375] | ChEMBL. | No reference |
| Potency (functional) | = 35.4813 um | PUBCHEM_BIOASSAY: VP16 counterscreen qHTS for inhibitors of ROR gamma transcriptional activity. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 35.4813 um | PUBCHEM_BIOASSAY: qHTS for inhibitors of ROR gamma transcriptional activity. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 35.4813 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of TGF-b: Cytotox Counterscreen. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588855, AID588860] | ChEMBL. | No reference |
| Potency (functional) | = 39.8107 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Aldehyde Dehydrogenase 1 (ALDH1A1). (Class of assay: confirmatory) [Related pubchem assays: 1030 (qHTS Validation Assay for Inhibitors of aldehyde dehydrogenase 1 (ALDH1A1))] | ChEMBL. | No reference |
| Potency (binding) | = 39.8107 um | PUBCHEM_BIOASSAY: qHTS Assay for Identification of Novel General Anesthetics. In this assay, a GABAergic mimetic model system, apoferritin and a profluorescent 1-aminoanthracene ligand (1-AMA), was used to construct a competitive binding assay for identification of novel general anesthetics (Class of assay: confirmatory) [Related pubchem assays: 2385 (Probe Development Summary for Identification of Novel General Anesthetics), 2323 (Validation apoferritin assay run on SigmaAldrich LOPAC1280 collection)] | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Homo sapiens | ChEMBL23 | ||
| Plasmodium falciparum | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1339613
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.