Detailed information for compound 1264286
Basic information
Technical information
- TDR Targets ID: 1264286
- Name: ethyl 1-[(3-fluorophenyl)-(6-hydroxy-2-methyl -[1,3]thiazolo[2,3-e][1,2,4]triazol-5-yl)meth yl]piperidine-4-carboxylate
- MW: 418.485 | Formula: C20H23FN4O3S
-
H donors: 1
H acceptors: 4
LogP: 3.61
Rotable bonds: 6
Rule of 5 violations (Lipinski): 1 - SMILES: CCOC(=O)C1CCN(CC1)C(c1sc2n(c1O)nc(n2)C)c1cccc(c1)F
- InChi: 1S/C20H23FN4O3S/c1-3-28-19(27)13-7-9-24(10-8-13)16(14-5-4-6-15(21)11-14)17-18(26)25-20(29-17)22-12(2)23-25/h4-6,11,13,16,26H,3,7-10H2,1-2H3
- InChiKey: IGVWYKZISHMJAE-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- ethyl 1-[(3-fluorophenyl)-(6-hydroxy-2-methyl-thiazolo[2,3-e][1,2,4]triazol-5-yl)methyl]piperidine-4-carboxylate
- 1-[(3-fluorophenyl)-(6-hydroxy-2-methyl-5-thiazolo[2,3-e][1,2,4]triazolyl)methyl]-4-piperidinecarboxylic acid ethyl ester
- 1-[(3-fluorophenyl)-(6-hydroxy-2-methyl-thiazolo[2,3-e][1,2,4]triazol-5-yl)methyl]isonipecotic acid ethyl ester
- MLS000101783
- SMR000017260
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | polymerase (DNA directed) iota | Starlite/ChEMBL | No references |
| Homo sapiens | hydroxysteroid (17-beta) dehydrogenase 10 | Starlite/ChEMBL | No references |
| Influenza A virus | Nonstructural protein 1 | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Mycobacterium tuberculosis | Hypothetical protein | Nonstructural protein 1 | 230 aa | 202 aa | 23.8 % |
| Plasmodium falciparum | 3-oxoacyl-[acyl-carrier-protein] reductase | hydroxysteroid (17-beta) dehydrogenase 10 | 252 aa | 251 aa | 24.7 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | 0.0104 | 0.4092 | 0.4092 |
| Loa Loa (eye worm) | nuclear hormone receptor-like 1 | 0.0116 | 0.4724 | 0.4724 |
| Echinococcus granulosus | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0069 | 0.2335 | 0.2335 |
| Leishmania major | cytochrome p450-like protein | 0.004 | 0.0829 | 0.355 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-49 | 0.022 | 1 | 1 |
| Onchocerca volvulus | 0.022 | 1 | 1 | |
| Echinococcus multilocularis | cyclic nucleotide gated cation channel | 0.0033 | 0.0478 | 0.0478 |
| Trichomonas vaginalis | voltage and ligand gated potassium channel, putative | 0.0155 | 0.6665 | 1 |
| Schistosoma mansoni | nuclear receptor nhr-48 | 0.0104 | 0.4092 | 0.4092 |
| Loa Loa (eye worm) | hypothetical protein | 0.0104 | 0.4092 | 0.4092 |
| Brugia malayi | nuclear hormone receptor | 0.022 | 1 | 1 |
| Schistosoma mansoni | FTZ-F1 nuclear receptor-like protein | 0.022 | 1 | 1 |
| Brugia malayi | nuclear hormone receptor | 0.0104 | 0.4092 | 0.4092 |
| Brugia malayi | Voltage-gated potassium channel, EAG (KCNH1)-related. C. elegans egl-2 ortholog | 0.0048 | 0.125 | 0.125 |
| Echinococcus multilocularis | Nuclear hormone receptor HR96 | 0.0104 | 0.4092 | 0.4092 |
| Brugia malayi | Cytochrome P450 family protein | 0.004 | 0.0829 | 0.0829 |
| Echinococcus granulosus | nuclear receptor subfamily 1 group D | 0.0116 | 0.4724 | 0.4724 |
| Loa Loa (eye worm) | hypothetical protein | 0.022 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor E75 | 0.0104 | 0.4092 | 0.4092 |
| Mycobacterium ulcerans | cytochrome P450 185A4 Cyp185A4 | 0.004 | 0.0829 | 0.355 |
| Loa Loa (eye worm) | nuclear receptor nhr-7B | 0.0104 | 0.4092 | 0.4092 |
| Brugia malayi | hypothetical protein | 0.0104 | 0.4092 | 0.4092 |
| Trichomonas vaginalis | voltage and ligand gated potassium channel, putative | 0.0155 | 0.6665 | 1 |
| Schistosoma mansoni | nuclear receptor | 0.0104 | 0.4092 | 0.4092 |
| Echinococcus granulosus | nuclear receptor subfamily 4 group A | 0.0104 | 0.4092 | 0.4092 |
| Brugia malayi | Cyclic-nucleotide gated cation channel | 0.0033 | 0.0478 | 0.0478 |
| Schistosoma mansoni | cyclic-nucleotide-gated cation channel | 0.0033 | 0.0478 | 0.0478 |
| Loa Loa (eye worm) | hypothetical protein | 0.0104 | 0.4092 | 0.4092 |
| Schistosoma mansoni | nuclear hormone receptor nor-1/nor-2 | 0.022 | 1 | 1 |
| Echinococcus multilocularis | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0069 | 0.2335 | 0.2335 |
| Schistosoma mansoni | 3-hydroxyacyl-CoA dehydrogenase | 0.0069 | 0.2335 | 0.2335 |
| Brugia malayi | conserved hypotetical protein | 0.0104 | 0.4092 | 0.4092 |
| Loa Loa (eye worm) | hypothetical protein | 0.022 | 1 | 1 |
| Echinococcus multilocularis | nuclear receptor subfamily 1 group D | 0.0116 | 0.4724 | 0.4724 |
| Echinococcus multilocularis | FTZ F1 alpha | 0.022 | 1 | 1 |
| Entamoeba histolytica | deoxycytidyl transferase, putative | 0.0023 | 0 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0116 | 0.4724 | 0.4724 |
| Echinococcus multilocularis | FTZ F1 nuclear receptor protein | 0.022 | 1 | 1 |
| Schistosoma mansoni | nuclear hormone receptor | 0.022 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-49 | 0.022 | 1 | 1 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.022 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.022 | 1 | 1 |
| Schistosoma mansoni | ecdysone-induced protein 78c (dr-78) | 0.0116 | 0.4724 | 0.4724 |
| Echinococcus granulosus | potassium voltage gated channel subfamily H | 0.0165 | 0.7217 | 0.7217 |
| Loa Loa (eye worm) | nuclear hormone receptor | 0.0104 | 0.4092 | 0.4092 |
| Loa Loa (eye worm) | hypothetical protein | 0.022 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-3 | 0.022 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0104 | 0.4092 | 0.4092 |
| Echinococcus multilocularis | ecdysone induced protein 78C | 0.022 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.022 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-14 | 0.022 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-41 | 0.022 | 1 | 1 |
| Brugia malayi | Voltage-gated potassium channel, HERG (KCNH2)-related. C. elegans unc-103 ortholog | 0.0165 | 0.7217 | 0.7217 |
| Echinococcus granulosus | cyclic nucleotide gated cation channel | 0.0033 | 0.0478 | 0.0478 |
| Loa Loa (eye worm) | hypothetical protein | 0.0104 | 0.4092 | 0.4092 |
| Loa Loa (eye worm) | DR-78 | 0.0104 | 0.4092 | 0.4092 |
| Brugia malayi | hypothetical protein | 0.0116 | 0.4724 | 0.4724 |
| Schistosoma mansoni | nuclear receptor 2DBD-gamma | 0.022 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0069 | 0.2335 | 1 |
| Schistosoma mansoni | nuclear receptor | 0.0104 | 0.4092 | 0.4092 |
| Schistosoma mansoni | 60S ribosomal protein L21 | 0.0026 | 0.0141 | 0.0141 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.022 | 1 | 1 |
| Echinococcus multilocularis | Nuclear hormone receptor family member nhr 41 | 0.022 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0069 | 0.2335 | 1 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.022 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0104 | 0.4092 | 0.4092 |
| Echinococcus granulosus | potassium voltage gated channel subfamily H | 0.0048 | 0.125 | 0.125 |
| Schistosoma mansoni | photoreceptor-specific nuclear receptor related | 0.022 | 1 | 1 |
| Echinococcus granulosus | COUP TF:Svp nuclear hormone receptor | 0.022 | 1 | 1 |
| Loa Loa (eye worm) | steroid hormone receptor | 0.022 | 1 | 1 |
| Loa Loa (eye worm) | cytochrome P450 family protein | 0.004 | 0.0829 | 0.0829 |
| Loa Loa (eye worm) | hypothetical protein | 0.0144 | 0.6108 | 0.6108 |
| Loa Loa (eye worm) | hypothetical protein | 0.0116 | 0.4724 | 0.4724 |
| Schistosoma mansoni | hepatocyte nuclear factor 4-alpha (hnf-4-alpha) | 0.0104 | 0.4092 | 0.4092 |
| Echinococcus granulosus | potassium:sodium hyperpolarization activated | 0.0033 | 0.0478 | 0.0478 |
| Loa Loa (eye worm) | hypothetical protein | 0.0104 | 0.4092 | 0.4092 |
| Loa Loa (eye worm) | hypothetical protein | 0.022 | 1 | 1 |
| Echinococcus multilocularis | thyroid hormone receptor alpha | 0.022 | 1 | 1 |
| Brugia malayi | nuclear receptor NHR-88 | 0.0104 | 0.4092 | 0.4092 |
| Loa Loa (eye worm) | hypothetical protein | 0.022 | 1 | 1 |
| Brugia malayi | nuclear hormone receptor family member nhr-6 | 0.0104 | 0.4092 | 0.4092 |
| Schistosoma mansoni | cyclic-nucleotide-gated cation channel | 0.0033 | 0.0478 | 0.0478 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-31 | 0.022 | 1 | 1 |
| Echinococcus granulosus | Nuclear hormone receptor family member nhr 41 | 0.022 | 1 | 1 |
| Schistosoma mansoni | voltage-gated potassium channel | 0.0048 | 0.125 | 0.125 |
| Loa Loa (eye worm) | cytochrome P450 family protein | 0.0079 | 0.2822 | 0.2822 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.022 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0116 | 0.4724 | 0.4724 |
| Onchocerca volvulus | Protein ultraspiracle homolog | 0.022 | 1 | 1 |
| Loa Loa (eye worm) | nuclear Hormone Receptor family member | 0.022 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.022 | 1 | 1 |
| Schistosoma mansoni | retinoic acid receptor RXR | 0.022 | 1 | 1 |
| Echinococcus multilocularis | nuclear receptor nhr 48 | 0.0104 | 0.4092 | 0.4092 |
| Giardia lamblia | DINP protein human, muc B family | 0.0023 | 0 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0104 | 0.4092 | 0.4092 |
| Brugia malayi | Nuclear hormone receptor family member nhr-1 | 0.022 | 1 | 1 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.022 | 1 | 1 |
| Echinococcus granulosus | Nuclear hormone receptor HR96 | 0.0104 | 0.4092 | 0.4092 |
| Brugia malayi | ecdysone receptor | 0.0104 | 0.4092 | 0.4092 |
| Loa Loa (eye worm) | cyclic-nucleotide gated cation channel | 0.0033 | 0.0478 | 0.0478 |
| Echinococcus multilocularis | COUP TF:Svp nuclear hormone receptor | 0.022 | 1 | 1 |
| Brugia malayi | orphan nuclear receptor NR2E1 | 0.0104 | 0.4092 | 0.4092 |
| Echinococcus multilocularis | Nuclear hormone receptor HR96 | 0.0104 | 0.4092 | 0.4092 |
| Echinococcus granulosus | nuclear receptor nhr 48 | 0.0104 | 0.4092 | 0.4092 |
| Schistosoma mansoni | cyclic-nucleotide-gated cation channel | 0.0033 | 0.0478 | 0.0478 |
| Brugia malayi | nuclear receptor NHR-88 | 0.022 | 1 | 1 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0104 | 0.4092 | 0.4092 |
| Loa Loa (eye worm) | 3-hydroxyacyl-CoA dehydrogenase type II | 0.0065 | 0.2098 | 0.2098 |
| Echinococcus granulosus | FTZ F1 alpha | 0.022 | 1 | 1 |
| Brugia malayi | nuclear receptor RXR | 0.0104 | 0.4092 | 0.4092 |
| Echinococcus multilocularis | nuclear receptor subfamily 4 group A | 0.0104 | 0.4092 | 0.4092 |
| Schistosoma mansoni | Tr4/Tr2 (homologue) | 0.022 | 1 | 1 |
| Echinococcus granulosus | hyperpolarization activated cyclic | 0.0033 | 0.0478 | 0.0478 |
| Echinococcus granulosus | thyroid hormone receptor alpha | 0.0104 | 0.4092 | 0.4092 |
| Schistosoma mansoni | nuclear hormone receptor superfamily protein-related | 0.0104 | 0.4092 | 0.4092 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0104 | 0.4092 | 0.4092 |
| Schistosoma mansoni | voltage-gated potassium channel | 0.0181 | 0.7989 | 0.7989 |
| Onchocerca volvulus | Bile acid receptor homolog | 0.022 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-40 | 0.022 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor E75 | 0.0104 | 0.4092 | 0.4092 |
| Brugia malayi | Cytochrome P450 family protein | 0.0079 | 0.2822 | 0.2822 |
| Brugia malayi | nuclear receptor NHR-67 | 0.0104 | 0.4092 | 0.4092 |
| Trypanosoma cruzi | cytochrome P450, putative | 0.004 | 0.0829 | 1 |
| Schistosoma mansoni | voltage-gated potassium channel | 0.0033 | 0.0478 | 0.0478 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0104 | 0.4092 | 0.4092 |
| Trypanosoma brucei | cytochrome P450, putative | 0.004 | 0.0829 | 1 |
| Echinococcus granulosus | ecdysone induced protein 78C | 0.022 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0116 | 0.4724 | 0.4724 |
| Schistosoma mansoni | voltage-gated potassium channel | 0.0181 | 0.7989 | 0.7989 |
| Echinococcus granulosus | hepatocyte nuclear factor 4 alpha | 0.022 | 1 | 1 |
| Echinococcus multilocularis | hyperpolarization activated cyclic | 0.0033 | 0.0478 | 0.0478 |
| Trichomonas vaginalis | voltage and ligand gated potassium channel, putative | 0.0033 | 0.0478 | 0.0718 |
| Loa Loa (eye worm) | hypothetical protein | 0.0104 | 0.4092 | 0.4092 |
| Brugia malayi | Nuclear hormone receptor family member nhr-31 | 0.022 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0116 | 0.4724 | 0.4724 |
| Brugia malayi | nuclear receptor subfamily 1, group D, member 1, putative | 0.0104 | 0.4092 | 0.4092 |
| Echinococcus granulosus | retinoic acid receptor rxr beta a | 0.022 | 1 | 1 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0104 | 0.4092 | 0.4092 |
| Loa Loa (eye worm) | CYP4Cod1 | 0.004 | 0.0829 | 0.0829 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.022 | 1 | 1 |
| Trypanosoma cruzi | cytochrome P450, putative | 0.004 | 0.0829 | 1 |
| Brugia malayi | 3-hydroxyacyl-CoA dehydrogenase type II | 0.0069 | 0.2335 | 0.2335 |
| Echinococcus multilocularis | hepatocyte nuclear factor 4 alpha | 0.022 | 1 | 1 |
| Schistosoma mansoni | hyperpolarization activated cyclic nucleotide-gated potassium channel | 0.0033 | 0.0478 | 0.0478 |
| Brugia malayi | photoreceptor-specific nuclear receptor | 0.022 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0033 | 0.0478 | 0.0478 |
| Brugia malayi | Cytochrome P450 family protein | 0.004 | 0.0829 | 0.0829 |
| Echinococcus multilocularis | cyclic nucleotide gated cation channel alpha 3 | 0.0033 | 0.0478 | 0.0478 |
| Brugia malayi | steroid hormone receptor | 0.022 | 1 | 1 |
| Trichomonas vaginalis | voltage and ligand gated potassium channel, putative | 0.0033 | 0.0478 | 0.0718 |
| Echinococcus granulosus | voltage gated potassium channel | 0.0048 | 0.125 | 0.125 |
| Brugia malayi | nuclear receptor RXR | 0.0116 | 0.4724 | 0.4724 |
| Loa Loa (eye worm) | hypothetical protein | 0.0116 | 0.4724 | 0.4724 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.022 | 1 | 1 |
| Echinococcus multilocularis | retinoic acid receptor rxr beta a retinoic acid receptor rxr alpha a retinoic acid receptor rxr alpha | 0.0104 | 0.4092 | 0.4092 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-1 | 0.022 | 1 | 1 |
| Loa Loa (eye worm) | nuclear receptor NHR-67 | 0.0104 | 0.4092 | 0.4092 |
| Brugia malayi | tailless protein | 0.0104 | 0.4092 | 0.4092 |
| Loa Loa (eye worm) | hypothetical protein | 0.0104 | 0.4092 | 0.4092 |
| Echinococcus granulosus | Nuclear hormone receptor HR96 | 0.0104 | 0.4092 | 0.4092 |
| Schistosoma mansoni | thyroid hormone receptor | 0.022 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0104 | 0.4092 | 0.4092 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.022 | 1 | 1 |
| Echinococcus granulosus | FTZ F1 nuclear receptor protein | 0.022 | 1 | 1 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.022 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0104 | 0.4092 | 0.4092 |
| Echinococcus multilocularis | potassium voltage gated channel subfamily H | 0.0048 | 0.125 | 0.125 |
| Echinococcus granulosus | cyclic nucleotide gated cation channel alpha 3 | 0.0033 | 0.0478 | 0.0478 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.022 | 1 | 1 |
| Schistosoma mansoni | steroid hormone receptor ad4bp | 0.022 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-14 | 0.022 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0116 | 0.4724 | 0.4724 |
| Loa Loa (eye worm) | cyclic-nucleotide gated cation channel | 0.0033 | 0.0478 | 0.0478 |
| Schistosoma mansoni | hyperpolarization activated cyclic nucleotide-gated potassium channel | 0.0033 | 0.0478 | 0.0478 |
| Leishmania major | 3-oxoacyl-(acyl-carrier protein) reductase, putative | 0.0069 | 0.2335 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0048 | 0.125 | 0.125 |
| Schistosoma mansoni | RAR-like nuclear receptor | 0.022 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0116 | 0.4724 | 0.4724 |
| Brugia malayi | nuclear hormone receptor family member odr-7 | 0.0104 | 0.4092 | 0.4092 |
| Loa Loa (eye worm) | hypothetical protein | 0.0104 | 0.4092 | 0.4092 |
| Loa Loa (eye worm) | cytochrome P450 family protein | 0.004 | 0.0829 | 0.0829 |
| Echinococcus granulosus | hyperpolarization activated cyclic | 0.0033 | 0.0478 | 0.0478 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0069 | 0.2335 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.022 | 1 | 1 |
| Onchocerca volvulus | Steroid hormone receptor family member cnr14 homolog | 0.022 | 1 | 1 |
| Schistosoma mansoni | voltage-gated potassium channel | 0.0026 | 0.0141 | 0.0141 |
| Brugia malayi | Nuclear hormone receptor family member nhr-41 | 0.022 | 1 | 1 |
| Echinococcus multilocularis | hyperpolarization activated cyclic | 0.0033 | 0.0478 | 0.0478 |
| Schistosoma mansoni | zinc finger protein | 0.0104 | 0.4092 | 0.4092 |
| Brugia malayi | Steroid receptor seven-up type 2 | 0.022 | 1 | 1 |
| Loa Loa (eye worm) | voltage and ligand gated potassium channel | 0.0165 | 0.7217 | 0.7217 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0116 | 0.4724 | 0.4724 |
| Echinococcus granulosus | cyclic nucleotide gated cation channel | 0.0033 | 0.0478 | 0.0478 |
| Schistosoma mansoni | coup transcription factor | 0.022 | 1 | 1 |
| Schistosoma mansoni | thyroid hormone receptor | 0.022 | 1 | 1 |
| Echinococcus multilocularis | voltage gated potassium channel | 0.0048 | 0.125 | 0.125 |
| Brugia malayi | Nuclear hormone receptor family member nhr-40 | 0.022 | 1 | 1 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.022 | 1 | 1 |
| Echinococcus multilocularis | potassium:sodium hyperpolarization activated | 0.0033 | 0.0478 | 0.0478 |
| Echinococcus multilocularis | potassium voltage gated channel subfamily H | 0.0165 | 0.7217 | 0.7217 |
| Loa Loa (eye worm) | hypothetical protein | 0.0104 | 0.4092 | 0.4092 |
| Schistosoma mansoni | voltage-gated potassium channel | 0.0048 | 0.125 | 0.125 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Potency (functional) | 2.8184 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Polymerase Iota. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588623] | ChEMBL. | No reference |
| Potency (functional) | = 3.1623 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of HADH2 (Hydroxyacyl-Coenzyme A Dehydrogenase, Type II). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 5.0119 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Influenza NS1 Protein Function. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 13.1154 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 96 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488745, AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
| Potency (functional) | 14.7157 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 48 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
| Potency (functional) | = 31.6228 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of HSD17B4, hydroxysteroid (17-beta) dehydrogenase 4. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 31.6228 um | PUBCHEM_BIOASSAY: qHTS Assay for Promiscuous and Specific Inhibitors of Cruzain (without detergent). (Class of assay: confirmatory) [Related pubchem assays: 2158 (Confirmation qHTS Assay for Inhibitors of Cruzain), 2249 (Probe Development Summary of Promiscuous Inhibitors (Artifacts) of Cruzain), 2161 (qHTS Assay for Inhibitors of Papain: Counterscreen for Cruzain Assay), 1478 (qHTS Assay for Promiscuous and Specific Inhibitors of Cruzain (with detergent))] | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Plasmodium falciparum | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1363535
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.