Detailed information for compound 1279717
Basic information
Technical information
- TDR Targets ID: 1279717
- Name: [2-(2-methoxyethyl)-5-oxo-[1,3,4]thiadiazolo[ 3,2-a]pyrimidin-7-yl]methyl 4-tert-butylbenzo ate
- MW: 401.479 | Formula: C20H23N3O4S
-
H donors: 0
H acceptors: 2
LogP: 3.04
Rotable bonds: 8
Rule of 5 violations (Lipinski): 1 - SMILES: COCCc1nn2c(s1)nc(cc2=O)COC(=O)c1ccc(cc1)C(C)(C)C
- InChi: 1S/C20H23N3O4S/c1-20(2,3)14-7-5-13(6-8-14)18(25)27-12-15-11-17(24)23-19(21-15)28-16(22-23)9-10-26-4/h5-8,11H,9-10,12H2,1-4H3
- InChiKey: CQUTZQAXMQVJAZ-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 4-tert-butylbenzoic acid [2-(2-methoxyethyl)-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl]methyl ester
- 4-tert-butylbenzoic acid [5-keto-2-(2-methoxyethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl]methyl ester
- G265-0969
- NCGC00129775-01
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | nuclear factor, erythroid 2-like 2 | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus granulosus | potassium voltage gated channel subfamily H | 0.0012 | 0.0983 | 0.0983 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0046 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | Basic leucine zipper bZIP transcription | 0.0043 | 0.9291 | 0.9291 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0046 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0046 | 1 | 1 |
| Brugia malayi | Voltage-gated potassium channel, EAG (KCNH1)-related. C. elegans egl-2 ortholog | 0.0012 | 0.0983 | 0.0983 |
| Schistosoma mansoni | neuropeptide receptor | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Schistosoma mansoni | voltage-gated potassium channel | 0.0012 | 0.0983 | 0.0983 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0046 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0046 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0046 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | voltage gated potassium channel | 0.0012 | 0.0983 | 0.0983 |
| Brugia malayi | hypothetical protein | 0.0046 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0043 | 0.9291 | 0.5 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0046 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0046 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0046 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0046 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0043 | 0.9291 | 0.9291 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0046 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0046 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0046 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0046 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0046 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0046 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0046 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0046 | 1 | 1 |
| Schistosoma mansoni | voltage-gated potassium channel | 0.0012 | 0.0983 | 0.0983 |
| Schistosoma mansoni | myosin xvIII | 0.0046 | 1 | 1 |
| Schistosoma mansoni | voltage-gated potassium channel | 0.0044 | 0.9565 | 0.9565 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Brugia malayi | Voltage-gated potassium channel, HERG (KCNH2)-related. C. elegans unc-103 ortholog | 0.0041 | 0.8582 | 0.8582 |
| Entamoeba histolytica | hypothetical protein | 0.0043 | 0.9291 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0046 | 1 | 1 |
| Schistosoma mansoni | voltage-gated potassium channel | 0.0044 | 0.9565 | 0.9565 |
| Schistosoma mansoni | hypothetical protein | 0.0046 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0046 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0046 | 1 | 0.5 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0046 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0046 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0046 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0046 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0046 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0046 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Brugia malayi | neuropeptide F receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Schistosoma mansoni | transcription factor LCR-F1 | 0.0043 | 0.9291 | 0.9291 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | voltage gated potassium channel | 0.0012 | 0.0983 | 0.0983 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0046 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0043 | 0.9291 | 0.9291 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0046 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0043 | 0.9291 | 0.5 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0046 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0046 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0046 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Schistosoma mansoni | opsin-like receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | Basic leucine zipper (bZIP) transcription | 0.0043 | 0.9291 | 0.9291 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Brugia malayi | Dopamine receptor | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Schistosoma mansoni | biogenic amine receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0046 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0046 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | potassium voltage gated channel subfamily H | 0.0012 | 0.0983 | 0.0983 |
| Schistosoma mansoni | amine GPCR | 0.0046 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0043 | 0.9291 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | potassium voltage gated channel subfamily H | 0.0041 | 0.8582 | 0.8582 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0046 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 0.7169 | 0.7169 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0046 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0046 | 1 | 1 |
| Trichomonas vaginalis | voltage and ligand gated potassium channel, putative | 0.0038 | 0.7878 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | potassium voltage gated channel subfamily H | 0.0041 | 0.8582 | 0.8582 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0046 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0046 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0046 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0046 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0046 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | voltage and ligand gated potassium channel | 0.0041 | 0.8582 | 0.8582 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0046 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0046 | 1 | 1 |
| Trichomonas vaginalis | voltage and ligand gated potassium channel, putative | 0.0038 | 0.7878 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Echinococcus multilocularis | g protein coupled receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Echinococcus granulosus | g protein coupled receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0046 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0046 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0046 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0012 | 0.0983 | 0.0983 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0046 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0046 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0046 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0046 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Potency (functional) | 14.581 uM | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493153, AID493163, AID504648] | ChEMBL. | No reference |
| Potency (functional) | = 25.1189 um | PUBCHEM_BIOASSAY: qHTS Assay for Promiscuous and Specific Inhibitors of Cruzain (without detergent). (Class of assay: confirmatory) [Related pubchem assays: 2158 (Confirmation qHTS Assay for Inhibitors of Cruzain), 2249 (Probe Development Summary of Promiscuous Inhibitors (Artifacts) of Cruzain), 2161 (qHTS Assay for Inhibitors of Papain: Counterscreen for Cruzain Assay), 1478 (qHTS Assay for Promiscuous and Specific Inhibitors of Cruzain (with detergent))] | ChEMBL. | No reference |
| Potency (binding) | = 25.1189 um | PUBCHEM_BIOASSAY: qHTS Assay for Identification of Novel General Anesthetics. In this assay, a GABAergic mimetic model system, apoferritin and a profluorescent 1-aminoanthracene ligand (1-AMA), was used to construct a competitive binding assay for identification of novel general anesthetics (Class of assay: confirmatory) [Related pubchem assays: 2385 (Probe Development Summary for Identification of Novel General Anesthetics), 2323 (Validation apoferritin assay run on SigmaAldrich LOPAC1280 collection)] | ChEMBL. | No reference |
| Potency (functional) | 44.6684 uM | PubChem BioAssay. qHTS of PTHR Inhibitors: Primary Screen. (Class of assay: confirmatory) | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1394713
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.