Detailed information for compound 1325286
Basic information
Technical information
- TDR Targets ID: 1325286
- Name: 2-(3,4-dimethoxyphenyl)-N-[5-[2-(furan-2-ylme thylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiaz ol-2-yl]acetamide
- MW: 448.516 | Formula: C19H20N4O5S2
-
H donors: 2
H acceptors: 4
LogP: 2.2
Rotable bonds: 12
Rule of 5 violations (Lipinski): 1 - SMILES: COc1cc(ccc1OC)CC(=O)Nc1nnc(s1)SCC(=O)NCc1ccco1
- InChi: 1S/C19H20N4O5S2/c1-26-14-6-5-12(8-15(14)27-2)9-16(24)21-18-22-23-19(30-18)29-11-17(25)20-10-13-4-3-7-28-13/h3-8H,9-11H2,1-2H3,(H,20,25)(H,21,22,24)
- InChiKey: RGNHGRYAOQVMQZ-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 2-(3,4-dimethoxyphenyl)-N-[5-[2-(2-furylmethylamino)-2-oxo-ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide
- 2-(3,4-dimethoxyphenyl)-N-[5-[[2-(2-furylmethylamino)-2-oxoethyl]thio]-1,3,4-thiadiazol-2-yl]acetamide
- 2-(3,4-dimethoxyphenyl)-N-[5-[[2-(2-furylmethylamino)-2-keto-ethyl]thio]-1,3,4-thiadiazol-2-yl]acetamide
- 2-(3,4-dimethoxyphenyl)-N-[5-[2-(furan-2-ylmethylamino)-2-oxo-ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]ethanamide
- MLS000624307
- SMR000323624
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | lamin A/C | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | intermediate filament protein | 0.0033 | 0.5614 | 0.5614 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0044 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 1 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 1 | |
| Brugia malayi | Dopamine receptor protein 2 | 0.0044 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 1 | |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0044 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0044 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0044 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0044 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 1 | |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0044 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0044 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0044 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 1 | |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0044 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0044 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0044 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0044 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 1 | |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0044 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0044 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0044 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0044 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 1 | |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 0.5392 | 0.5392 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0044 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0044 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0044 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 1 | |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0044 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0044 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0044 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0044 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0044 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0044 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0044 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | intermediate filament tail domain-containing protein | 0.0033 | 0.5614 | 0.5614 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0044 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0044 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0044 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 1 | |
| Echinococcus multilocularis | somatostatin receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0044 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 1 | |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0044 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0044 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0044 | 1 | 1 |
| Brugia malayi | intermediate filament protein | 0.0033 | 0.5614 | 0.5614 |
| Onchocerca volvulus | 0.0044 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0033 | 0.5614 | 0.5614 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 1 | |
| Onchocerca volvulus | 0.0044 | 1 | 1 | |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0044 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0044 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0044 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 1 | |
| Brugia malayi | hypothetical protein | 0.0044 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0044 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0044 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0044 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0044 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0044 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0044 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0044 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 1 | |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0044 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0044 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0044 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0044 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0044 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0044 | 1 | 1 |
| Brugia malayi | Intermediate filament tail domain containing protein | 0.0033 | 0.5614 | 0.5614 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0044 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0044 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Potency (functional) | = 2.5119 um | PUBCHEM_BIOASSAY: qHTS Assay for Modulators of Lamin A Splicing. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 6.5733 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 96 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488745, AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
| Potency (functional) | = 28.1838 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of DNA Polymerase Beta. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 31.6228 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Polymerase Iota. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588623] | ChEMBL. | No reference |
| Potency (binding) | 35.4813 uM | PubChem BioAssay. qHTS Assay for Inhibitors of MBNL1-poly(CUG) RNA binding. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 39.8107 uM | PubChem BioAssay. qHTS Assay for Inhibitors of the Human Apurinic/apyrimidinic Endonuclease 1 (APE1). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 75.6863 uM | PubChem BioAssay. qHTS Assay to Find Inhibitors of Pin1. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 89.1251 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BAZ2B. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504391] | ChEMBL. | No reference |
| Potency (functional) | 100 uM | PUBCHEM_BIOASSAY: Inhibitors of TCP-1 ring complex (TRiC) of Methanococcus maripaludis (MmCpn): qHTS. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488991] | ChEMBL. | No reference |
| Potency (functional) | 100 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Rango (Ran-regulated importin-beta cargo) - Importin beta complex formation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID540273] | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Plasmodium falciparum | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1455917
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.