Detailed information for compound 1355330
Basic information
Technical information
- TDR Targets ID: 1355330
- Name: MLS000591989
- MW: 461.963 | Formula: C25H20ClN3O2S
-
H donors: 0
H acceptors: 2
LogP: 5.94
Rotable bonds: 6
Rule of 5 violations (Lipinski): 1 - SMILES: CCOc1ccc2c(c1)cc(c(n2)Cl)C1CC(=NN1C(=O)c1cccs1)c1ccccc1
- InChi: 1S/C25H20ClN3O2S/c1-2-31-18-10-11-20-17(13-18)14-19(24(26)27-20)22-15-21(16-7-4-3-5-8-16)28-29(22)25(30)23-9-6-12-32-23/h3-14,22H,2,15H2,1H3
- InChiKey: ISDHNTLTLPEJQF-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- SMR000218605
- [5-(2-Chloro-6-ethoxy-quinolin-3-yl)-3-phenyl-4,5-dihydro-pyrazol-1-yl]-thiophen-2-yl-methanone
- STOCK3S-36264
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | APEX nuclease (multifunctional DNA repair enzyme) 1 | Starlite/ChEMBL | No references |
| Trypanosoma cruzi | cysteine peptidase, putative | Starlite/ChEMBL | No references |
| Homo sapiens | GNAS complex locus | Starlite/ChEMBL | No references |
| Bacillus subtilis | 4'-phosphopantetheinyl transferase ffp | Starlite/ChEMBL | No references |
| Homo sapiens | nuclear factor, erythroid 2-like 2 | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Candida albicans | aminoadipate-semialdehyde dehydrogenase small subunit | 4'-phosphopantetheinyl transferase ffp | 224 aa | 183 aa | 27.3 % |
| Entamoeba histolytica | hypothetical protein | 4'-phosphopantetheinyl transferase ffp | 224 aa | 198 aa | 28.3 % |
| Onchocerca volvulus | 4'-phosphopantetheinyl transferase ffp | 224 aa | 186 aa | 26.3 % | |
| Trichomonas vaginalis | conserved hypothetical protein | 4'-phosphopantetheinyl transferase ffp | 224 aa | 197 aa | 22.3 % |
| Candida albicans | aminoadipate-semialdehyde dehydrogenase small subunit | 4'-phosphopantetheinyl transferase ffp | 224 aa | 183 aa | 27.3 % |
| Schistosoma mansoni | GTP-binding protein alpha subunit gna | GNAS complex locus | 394 aa | 450 aa | 28.7 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Entamoeba histolytica | hypothetical protein | 0.0028 | 0.1981 | 0.5396 |
| Echinococcus multilocularis | DNA (apurinic or apyrimidinic site) lyase | 0.0023 | 0.1366 | 0.1366 |
| Plasmodium vivax | holo-[acyl-carrier-protein] synthase, putative | 0.0028 | 0.1981 | 1 |
| Echinococcus multilocularis | cysteine protease | 0.002 | 0.109 | 0.109 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Entamoeba histolytica | hypothetical protein | 0.0043 | 0.3671 | 1 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0014 | 0.0347 | 0.0347 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0077 | 0.7404 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0014 | 0.0347 | 0.0347 |
| Plasmodium falciparum | AP endonuclease (DNA-[apurinic or apyrimidinic site] lyase), putative | 0.0023 | 0.1366 | 0.6899 |
| Mycobacterium leprae | conserved hypothetical protein | 0.0028 | 0.1981 | 0.5 |
| Schistosoma mansoni | transcription factor LCR-F1 | 0.0043 | 0.3671 | 0.3671 |
| Brugia malayi | exodeoxyribonuclease III family protein | 0.0023 | 0.1366 | 0.1366 |
| Loa Loa (eye worm) | exodeoxyribonuclease III family protein | 0.0023 | 0.1366 | 0.1056 |
| Brugia malayi | GTP-binding regulatory protein Gs alpha-S chain, putative | 0.0055 | 0.4981 | 0.4981 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.7404 | 1 |
| Entamoeba histolytica | cysteine protease, putative | 0.002 | 0.109 | 0.2968 |
| Echinococcus granulosus | L aminoadipate semialdehyde | 0.01 | 1 | 1 |
| Toxoplasma gondii | exonuclease III APE | 0.0023 | 0.1366 | 0.3107 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Leishmania major | cathepsin L-like protease | 0.0077 | 0.7404 | 1 |
| Trypanosoma cruzi | cruzipain precursor, putative | 0.0077 | 0.7404 | 1 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.002 | 0.109 | 0.109 |
| Toxoplasma gondii | 4'-phosphopantetheinyl transferase superfamily protein | 0.0028 | 0.1981 | 1 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0014 | 0.0347 | 0.0944 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Onchocerca volvulus | 0.002 | 0.109 | 0.077 | |
| Trypanosoma cruzi | cysteine peptidase, clan CA, family C1, cathepsin L-like, putative | 0.007 | 0.6661 | 0.8997 |
| Trypanosoma brucei | hypothetical protein, conserved | 0.0028 | 0.1981 | 0.2675 |
| Echinococcus multilocularis | cysteine protease | 0.002 | 0.109 | 0.109 |
| Trypanosoma brucei | apurinic/apyrimidinic endonuclease, putative | 0.0023 | 0.1366 | 0.1845 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Entamoeba histolytica | hypothetical protein | 0.0043 | 0.3671 | 1 |
| Mycobacterium ulcerans | 4'-phosphopantetheinyl transferase | 0.0028 | 0.1981 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.109 | 0.109 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Onchocerca volvulus | 0.002 | 0.109 | 0.077 | |
| Echinococcus multilocularis | guanine nucleotide binding protein G(s) subunit | 0.0055 | 0.4981 | 0.4981 |
| Loa Loa (eye worm) | ctsf protein | 0.002 | 0.109 | 0.077 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.002 | 0.109 | 0.1472 |
| Loa Loa (eye worm) | hypothetical protein | 0.002 | 0.109 | 0.077 |
| Entamoeba histolytica | exodeoxyribonuclease III, putative | 0.0023 | 0.1366 | 0.3722 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.109 | 0.109 |
| Entamoeba histolytica | hypothetical protein | 0.0043 | 0.3671 | 1 |
| Chlamydia trachomatis | holo [acyl-carrier protein] synthase | 0.0028 | 0.1981 | 0.5 |
| Onchocerca volvulus | Cathepsin L homolog | 0.002 | 0.109 | 0.077 |
| Onchocerca volvulus | 0.002 | 0.109 | 0.077 | |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Echinococcus granulosus | cathepsin l1 | 0.002 | 0.109 | 0.109 |
| Echinococcus multilocularis | Basic leucine zipper (bZIP) transcription | 0.0043 | 0.3671 | 0.3671 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Echinococcus granulosus | cathepsin l cysteine peptidase | 0.002 | 0.109 | 0.109 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.7404 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Echinococcus granulosus | guanine nucleotide binding protein Gs subunit | 0.0055 | 0.4981 | 0.4981 |
| Trichomonas vaginalis | ap endonuclease, putative | 0.0023 | 0.1366 | 1 |
| Onchocerca volvulus | 0.002 | 0.109 | 0.077 | |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0055 | 0.4981 | 0.4981 |
| Plasmodium vivax | AP endonuclease (DNA-[apurinic or apyrimidinic site] lyase), putative | 0.0023 | 0.1366 | 0.6899 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.109 | 0.109 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0055 | 0.4981 | 0.4981 |
| Toxoplasma gondii | 4'-phosphopantetheinyl transferase domain-containing protein | 0.0028 | 0.1981 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.7404 | 1 |
| Onchocerca volvulus | Cathepsin F homolog | 0.002 | 0.109 | 0.077 |
| Entamoeba histolytica | hypothetical protein | 0.0043 | 0.3671 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.7404 | 1 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.002 | 0.109 | 0.109 |
| Loa Loa (eye worm) | GTP-binding regulatory protein Gs alpha-S chain | 0.0055 | 0.4981 | 0.4801 |
| Brugia malayi | cathepsin L-like precursor | 0.0014 | 0.0347 | 0.0347 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.002 | 0.109 | 0.109 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.7404 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Leishmania major | phosphopantetheinyl transferase-like protein | 0.0028 | 0.1981 | 0.1411 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Leishmania major | cathepsin L-like protease | 0.0077 | 0.7404 | 1 |
| Schistosoma mansoni | ap endonuclease | 0.0023 | 0.1366 | 0.1366 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.7404 | 1 |
| Echinococcus granulosus | guanine nucleotide binding protein Gs subunit | 0.0055 | 0.4981 | 0.4981 |
| Onchocerca volvulus | 0.002 | 0.109 | 0.077 | |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.002 | 0.109 | 0.109 |
| Trichomonas vaginalis | ap endonuclease, putative | 0.0023 | 0.1366 | 1 |
| Echinococcus granulosus | DNA apurinic or apyrimidinic site lyase | 0.0023 | 0.1366 | 0.1366 |
| Treponema pallidum | 4'-phosphopantetheinyl transferase | 0.0028 | 0.1981 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Plasmodium falciparum | cysteine proteinase falcipain 2b | 0.002 | 0.109 | 0.5501 |
| Plasmodium vivax | vivapain-2 | 0.002 | 0.109 | 0.5501 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Schistosoma mansoni | ap endonuclease | 0.0023 | 0.1366 | 0.1366 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.7404 | 1 |
| Brugia malayi | Cathepsin L-like cysteine proteinase | 0.0014 | 0.0347 | 0.0347 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Onchocerca volvulus | 0.002 | 0.109 | 0.077 | |
| Echinococcus multilocularis | guanine nucleotide binding protein G(s) subunit | 0.0055 | 0.4981 | 0.4981 |
| Brugia malayi | hypothetical protein | 0.0043 | 0.3671 | 0.3671 |
| Trypanosoma cruzi | apurinic/apyrimidinic endonuclease | 0.0023 | 0.1366 | 0.1845 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.002 | 0.109 | 0.2968 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0077 | 0.7404 | 1 |
| Loa Loa (eye worm) | Papain cysteine protease/cathepsin propeptide inhibitor-containing protein | 0.002 | 0.109 | 0.077 |
| Wolbachia endosymbiont of Brugia malayi | 4'-phosphopantetheinyl transferase | 0.0028 | 0.1981 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.109 | 0.109 |
| Mycobacterium ulcerans | phosphopantetheinyl transferase, PptII | 0.0028 | 0.1981 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.109 | 0.109 |
| Echinococcus multilocularis | L aminoadipate semialdehyde | 0.01 | 1 | 1 |
| Plasmodium vivax | vivapain-2 | 0.002 | 0.109 | 0.5501 |
| Giardia lamblia | Endonuclease/Exonuclease/phosphatase | 0.0023 | 0.1366 | 0.5 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0014 | 0.0347 | 0.2537 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.7404 | 1 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.002 | 0.109 | 0.2968 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.7404 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0077 | 0.7404 | 1 |
| Loa Loa (eye worm) | fibroinase | 0.002 | 0.109 | 0.077 |
| Schistosoma mansoni | hypothetical protein | 0.0043 | 0.3671 | 0.3671 |
| Leishmania major | apurinic/apyrimidinic endonuclease-redox protein | 0.0023 | 0.1366 | 0.0438 |
| Loa Loa (eye worm) | cysteine protease | 0.002 | 0.109 | 0.077 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Onchocerca volvulus | 0.002 | 0.109 | 0.077 | |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.109 | 0.109 |
| Loa Loa (eye worm) | hypothetical protein | 0.01 | 1 | 1 |
| Mycobacterium tuberculosis | holo-[acyl-carrier protein] synthase AcpS (holo-ACP synthase) (CoA:APO-[ACP]pantetheinephosphotransferase) (CoA:APO-[acyl-carrie | 0.0028 | 0.1981 | 1 |
| Plasmodium falciparum | cysteine proteinase falcipain 3 | 0.002 | 0.109 | 0.5501 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.002 | 0.109 | 0.109 |
| Schistosoma mansoni | aminoadipate-semialdehyde dehydrogenase | 0.01 | 1 | 1 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.002 | 0.109 | 0.109 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Echinococcus granulosus | cathepsin L cysteine proteinase | 0.002 | 0.109 | 0.109 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.7404 | 1 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.002 | 0.109 | 0.109 |
| Trypanosoma cruzi | apurinic/apyrimidinic endonuclease, putative | 0.0023 | 0.1366 | 0.1845 |
| Onchocerca volvulus | 0.01 | 1 | 1 | |
| Onchocerca volvulus | Cathepsin L homolog | 0.002 | 0.109 | 0.077 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.109 | 0.7974 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.7404 | 1 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.002 | 0.109 | 0.077 |
| Brugia malayi | Cathepsin L-like precursor | 0.0014 | 0.0347 | 0.0347 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0077 | 0.7404 | 1 |
| Plasmodium falciparum | cysteine proteinase falcipain 2a | 0.002 | 0.109 | 0.5501 |
| Echinococcus granulosus | cathepsin l1 | 0.0014 | 0.0347 | 0.0347 |
| Echinococcus granulosus | Basic leucine zipper bZIP transcription | 0.0043 | 0.3671 | 0.3671 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0055 | 0.4981 | 0.4981 |
| Trypanosoma cruzi | major cysteine proteinase, putative | 0.0061 | 0.5571 | 0.7525 |
| Plasmodium falciparum | holo-[acyl-carrier-protein] synthase, putative | 0.0028 | 0.1981 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0014 | 0.0347 | 0.2537 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Potency (functional) | 2.5929 uM | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493153, AID493163, AID504648] | ChEMBL. | No reference |
| Potency (functional) | 3.9811 uM | PubChem BioAssay. qHTS for Agonist of gsp, the Etiologic Mutation Responsible for Fibrous Dysplasia/McCune-Albright Syndrome: qHTS. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 4.4668 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Bacillus subtilis Sfp phosphopantetheinyl transferase (PPTase). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 7.9433 um | PUBCHEM_BIOASSAY: qHTS Assay for Promiscuous and Specific Inhibitors of Cruzain (without detergent). (Class of assay: confirmatory) [Related pubchem assays: 2158 (Confirmation qHTS Assay for Inhibitors of Cruzain), 2249 (Probe Development Summary of Promiscuous Inhibitors (Artifacts) of Cruzain), 2161 (qHTS Assay for Inhibitors of Papain: Counterscreen for Cruzain Assay), 1478 (qHTS Assay for Promiscuous and Specific Inhibitors of Cruzain (with detergent))] | ChEMBL. | No reference |
| Potency (functional) | 8.2753 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 96 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488745, AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
| Potency (functional) | 8.9125 uM | PubChem BioAssay. qHTS Assay for Inhibitors of the Human Apurinic/apyrimidinic Endonuclease 1 (APE1). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 10.4179 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 48 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
| Potency (functional) | = 25.1189 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of HPGD (15-Hydroxyprostaglandin Dehydrogenase). (Class of assay: confirmatory) [Related pubchem assays: 2429 (Confirmation qHTS Assay for Inhibitors of HPGD (15-Hydroxyprostaglandin Dehydrogenase)), 2407 (Probe Development Summary for Inhibitors of HPGD (15-Hydroxyprostaglandin Dehydrogenase)), 2427 (Thermal Shift Assay for Inhibitors of HPGD (15-Hydroxyprostaglandin Dehydrogenase))] | ChEMBL. | No reference |
| Potency (functional) | 112.2018 uM | PUBCHEM_BIOASSAY: HTS for Inhibitors of HP1-beta Chromodomain Interactions with Methylated Histone Tails. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488962] | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Plasmodium falciparum | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1456753
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.