Detailed information for compound 1356776
Basic information
Technical information
- TDR Targets ID: 1356776
- Name: 3-[[4-(morpholine-4-carbonyl)cyclohexyl]methy l]-1-(phenylmethyl)thieno[2,3-e]pyrimidine-2, 4-dione
- MW: 467.58 | Formula: C25H29N3O4S
-
H donors: 0
H acceptors: 3
LogP: 2.87
Rotable bonds: 6
Rule of 5 violations (Lipinski): 1 - SMILES: O=C(N1CCOCC1)C1CCC(CC1)Cn1c(=O)c2sccc2n(c1=O)Cc1ccccc1
- InChi: 1S/C25H29N3O4S/c29-23(26-11-13-32-14-12-26)20-8-6-19(7-9-20)17-28-24(30)22-21(10-15-33-22)27(25(28)31)16-18-4-2-1-3-5-18/h1-5,10,15,19-20H,6-9,11-14,16-17H2
- InChiKey: SZEQOTJRYDMSNL-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 3-[[4-(morpholino-oxomethyl)cyclohexyl]methyl]-1-(phenylmethyl)thieno[2,3-e]pyrimidine-2,4-dione
- 1-(benzyl)-3-[[4-(morpholine-4-carbonyl)cyclohexyl]methyl]thieno[2,3-e]pyrimidine-2,4-quinone
- 3-[(4-morpholin-4-ylcarbonylcyclohexyl)methyl]-1-(phenylmethyl)thieno[2,3-e]pyrimidine-2,4-dione
- G346-0463
- NCGC00130365-01
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | lamin A/C | Starlite/ChEMBL | No references |
| Homo sapiens | galactosylceramidase | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Brugia malayi | Serotonin receptor | 0.0042 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0042 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0042 | 1 | 1 |
| Onchocerca volvulus | 0.0042 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0042 | 1 | 1 |
| Onchocerca volvulus | 0.0042 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0042 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0042 | 1 | 1 |
| Onchocerca volvulus | 0.0042 | 1 | 1 | |
| Echinococcus multilocularis | fmrfamide receptor | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | intermediate filament protein | 0.0033 | 0.6142 | 0.6142 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0042 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0042 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0042 | 1 | 1 |
| Onchocerca volvulus | 0.0042 | 1 | 1 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0042 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0042 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0042 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0042 | 1 | 1 |
| Onchocerca volvulus | 0.0042 | 1 | 1 | |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0042 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0042 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0042 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0042 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0042 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0042 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0042 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0042 | 1 | 1 |
| Onchocerca volvulus | 0.0042 | 1 | 1 | |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0042 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0042 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0042 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0042 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0042 | 1 | 1 |
| Onchocerca volvulus | 0.0042 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0042 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0042 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0042 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0042 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0042 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0042 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0042 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0042 | 1 | 1 |
| Onchocerca volvulus | 0.0042 | 1 | 1 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0042 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0042 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0042 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0042 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0042 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0042 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0042 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0042 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0042 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0042 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0042 | 1 | 1 |
| Onchocerca volvulus | 0.0042 | 1 | 1 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0042 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0042 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0042 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0042 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0042 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 0.59 | 0.59 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0033 | 0.6142 | 0.6142 |
| Onchocerca volvulus | 0.0042 | 1 | 1 | |
| Brugia malayi | intermediate filament protein | 0.0033 | 0.6142 | 0.6142 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0042 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0042 | 1 | 1 |
| Onchocerca volvulus | 0.0042 | 1 | 1 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0042 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0042 | 1 | 1 |
| Onchocerca volvulus | 0.0042 | 1 | 1 | |
| Echinococcus multilocularis | somatostatin receptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0042 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0042 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0042 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | intermediate filament tail domain-containing protein | 0.0033 | 0.6142 | 0.6142 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0042 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0042 | 1 | 1 |
| Onchocerca volvulus | 0.0042 | 1 | 1 | |
| Echinococcus multilocularis | g protein coupled receptor | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0042 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0042 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0042 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0042 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0042 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0042 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0042 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0042 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0042 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0042 | 1 | 1 |
| Onchocerca volvulus | 0.0042 | 1 | 1 | |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0042 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0042 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0042 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0042 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0042 | 1 | 1 |
| Onchocerca volvulus | 0.0042 | 1 | 1 | |
| Onchocerca volvulus | 0.0042 | 1 | 1 | |
| Onchocerca volvulus | 0.0042 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0042 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0042 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0042 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Brugia malayi | Intermediate filament tail domain containing protein | 0.0033 | 0.6142 | 0.6142 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0042 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0042 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0042 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0042 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0042 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0042 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0042 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0042 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0042 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0042 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0042 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0042 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0042 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0042 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0042 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Potency (functional) | = 5.0119 um | PUBCHEM_BIOASSAY: qHTS Assay for Modulators of Lamin A Splicing. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 8.9125 uM | PubChem BioAssay. A Novel Cell-Based Assay to Identify Small Molecules for B -Galactocerebrosidase. (Class of assay: confirmatory) | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1475829
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.