Detailed information for compound 1367288
Basic information
Technical information
- TDR Targets ID: 1367288
- Name: 1-cyclohexyl-5-oxo-2-phenylpyrrolidine-3-carb oxylic acid
- MW: 287.354 | Formula: C17H21NO3
-
H donors: 1
H acceptors: 3
LogP: 2.3
Rotable bonds: 3
Rule of 5 violations (Lipinski): 1 - SMILES: OC(=O)C1CC(=O)N(C1c1ccccc1)C1CCCCC1
- InChi: 1S/C17H21NO3/c19-15-11-14(17(20)21)16(12-7-3-1-4-8-12)18(15)13-9-5-2-6-10-13/h1,3-4,7-8,13-14,16H,2,5-6,9-11H2,(H,20,21)
- InChiKey: RJUKZKFCEJJYRU-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 1-cyclohexyl-5-oxo-2-phenyl-pyrrolidine-3-carboxylic acid
- 1-cyclohexyl-5-oxo-2-phenyl-3-pyrrolidinecarboxylic acid
- 1-cyclohexyl-5-keto-2-phenyl-pyrrolidine-3-carboxylic acid
- SMR000126672
- 6R-0055
- Oprea1_280816
- MLS000544915
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | lamin A/C | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Brugia malayi | Dopamine receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0059 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0059 | 1 | 1 |
| Onchocerca volvulus | 0.0059 | 1 | 1 | |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0059 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 0.3517 | 0.3517 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0059 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0059 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0059 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0059 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0059 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0059 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0059 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0059 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0059 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0059 | 1 | 1 |
| Onchocerca volvulus | 0.0059 | 1 | 1 | |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0059 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0059 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0059 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0059 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | intermediate filament tail domain-containing protein | 0.0033 | 0.3662 | 0.3662 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0059 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0033 | 0.3662 | 0.3662 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0059 | 1 | 1 |
| Onchocerca volvulus | 0.0059 | 1 | 1 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0059 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0059 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0059 | 1 | 1 |
| Onchocerca volvulus | 0.0059 | 1 | 1 | |
| Brugia malayi | intermediate filament protein | 0.0033 | 0.3662 | 0.3662 |
| Brugia malayi | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0059 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0059 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0059 | 1 | 1 |
| Onchocerca volvulus | 0.0059 | 1 | 1 | |
| Brugia malayi | hypothetical protein | 0.0059 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0059 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0059 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0059 | 1 | 1 |
| Onchocerca volvulus | 0.0059 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Onchocerca volvulus | 0.0059 | 1 | 1 | |
| Onchocerca volvulus | 0.0059 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0059 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0059 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0059 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0059 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0059 | 1 | 1 |
| Onchocerca volvulus | 0.0059 | 1 | 1 | |
| Echinococcus multilocularis | g protein coupled receptor | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0059 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0059 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0059 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0059 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0059 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0059 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0059 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0059 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0059 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0059 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0059 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0059 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0059 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0059 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0059 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0059 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0059 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Brugia malayi | Intermediate filament tail domain containing protein | 0.0033 | 0.3662 | 0.3662 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0059 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0059 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0059 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | intermediate filament protein | 0.0033 | 0.3662 | 0.3662 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0059 | 1 | 1 |
| Onchocerca volvulus | 0.0059 | 1 | 1 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Onchocerca volvulus | 0.0059 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0059 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0059 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0059 | 1 | 1 |
| Onchocerca volvulus | 0.0059 | 1 | 1 | |
| Echinococcus granulosus | neuropeptide receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0059 | 1 | 1 |
| Onchocerca volvulus | 0.0059 | 1 | 1 | |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0059 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0059 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0059 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0059 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0059 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0059 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0059 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0059 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0059 | 1 | 1 |
| Onchocerca volvulus | 0.0059 | 1 | 1 | |
| Schistosoma mansoni | biogenic amine receptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0059 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0059 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0059 | 1 | 1 |
| Onchocerca volvulus | 0.0059 | 1 | 1 | |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0059 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0059 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0059 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0059 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0059 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0059 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0059 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0059 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0059 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0059 | 1 | 1 |
| Onchocerca volvulus | 0.0059 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0059 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0059 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0059 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0059 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0059 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0059 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0059 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0059 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0059 | 1 | 1 |
| Onchocerca volvulus | 0.0059 | 1 | 1 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0059 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Potency (functional) | = 0.0447 um | PUBCHEM_BIOASSAY: qHTS Assay for Modulators of Lamin A Splicing. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 1.2589 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of binding or entry into cells for Lassa Virus. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID463114, AID540249] | ChEMBL. | No reference |
| Potency (functional) | 16.5113 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 96 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488745, AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Homo sapiens | ChEMBL23 | ||
| Plasmodium falciparum | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1495017
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.