Detailed information for compound 1370758
Basic information
Technical information
- TDR Targets ID: 1370758
- Name: [2-[(2,6-difluorophenyl)amino]-2-oxoethyl] 3, 5-dimethoxy-4-methylbenzoate
- MW: 365.328 | Formula: C18H17F2NO5
-
H donors: 1
H acceptors: 2
LogP: 3.19
Rotable bonds: 8
Rule of 5 violations (Lipinski): 1 - SMILES: COc1cc(cc(c1C)OC)C(=O)OCC(=O)Nc1c(F)cccc1F
- InChi: 1S/C18H17F2NO5/c1-10-14(24-2)7-11(8-15(10)25-3)18(23)26-9-16(22)21-17-12(19)5-4-6-13(17)20/h4-8H,9H2,1-3H3,(H,21,22)
- InChiKey: RQMXRLVWDWFOFF-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- [2-[(2,6-difluorophenyl)amino]-2-oxo-ethyl] 3,5-dimethoxy-4-methyl-benzoate
- 3,5-dimethoxy-4-methylbenzoic acid [2-[(2,6-difluorophenyl)amino]-2-oxoethyl] ester
- 3,5-dimethoxy-4-methyl-benzoic acid [2-[(2,6-difluorophenyl)amino]-2-keto-ethyl] ester
- MLS001018216
- SMR000354474
- T0519-9623
- ZINC03280787
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | nuclear factor, erythroid 2-like 2 | Starlite/ChEMBL | No references |
| Homo sapiens | lamin A/C | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0111 | 1 | 1 |
| Onchocerca volvulus | 0.0111 | 1 | 1 | |
| Echinococcus multilocularis | g protein coupled receptor | 0.0111 | 1 | 1 |
| Onchocerca volvulus | 0.0111 | 1 | 1 | |
| Schistosoma mansoni | amine GPCR | 0.0111 | 1 | 1 |
| Onchocerca volvulus | 0.0111 | 1 | 1 | |
| Echinococcus granulosus | neuropeptide receptor | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0111 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0111 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0111 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0111 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0111 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0111 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0111 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0111 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0111 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0111 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0111 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0111 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0111 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0111 | 1 | 1 |
| Brugia malayi | intermediate filament protein | 0.0033 | 0.1608 | 0.1608 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0111 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0111 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0111 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0111 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0111 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0111 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0111 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0111 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | intermediate filament tail domain-containing protein | 0.0033 | 0.1608 | 0.1608 |
| Brugia malayi | G-protein coupled receptor | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0111 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0111 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0111 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0111 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0111 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0111 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0111 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0111 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0111 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0111 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0111 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0111 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0111 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0111 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0111 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0111 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0111 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0111 | 1 | 1 |
| Onchocerca volvulus | 0.0111 | 1 | 1 | |
| Schistosoma mansoni | transcription factor LCR-F1 | 0.0043 | 0.2765 | 0.1379 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0111 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0111 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0111 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0111 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0111 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0111 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0111 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0111 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0111 | 1 | 1 |
| Onchocerca volvulus | 0.0111 | 1 | 1 | |
| Brugia malayi | hypothetical protein | 0.0111 | 1 | 1 |
| Onchocerca volvulus | 0.0111 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0111 | 1 | 1 |
| Onchocerca volvulus | 0.0111 | 1 | 1 | |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0111 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0111 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0033 | 0.1608 | 0.1608 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | Basic leucine zipper (bZIP) transcription | 0.0043 | 0.2765 | 0.1379 |
| Schistosoma mansoni | neuropeptide receptor | 0.0111 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0111 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0111 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0111 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0111 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0111 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0111 | 1 | 1 |
| Brugia malayi | Intermediate filament tail domain containing protein | 0.0033 | 0.1608 | 0.1608 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0111 | 1 | 1 |
| Onchocerca volvulus | 0.0111 | 1 | 1 | |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0111 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0111 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0111 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0111 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0111 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0111 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0043 | 0.2765 | 0.5 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0111 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0111 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0111 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0111 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0111 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0111 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0111 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0111 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0111 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0111 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Onchocerca volvulus | 0.0111 | 1 | 1 | |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0111 | 1 | 1 |
| Onchocerca volvulus | 0.0111 | 1 | 1 | |
| Schistosoma mansoni | amine GPCR | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0111 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0111 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0111 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0111 | 1 | 1 |
| Onchocerca volvulus | 0.0111 | 1 | 1 | |
| Echinococcus multilocularis | sex peptide receptor | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0111 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0111 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0111 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0111 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0111 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0111 | 1 | 1 |
| Echinococcus granulosus | Basic leucine zipper bZIP transcription | 0.0043 | 0.2765 | 0.1379 |
| Onchocerca volvulus | 0.0111 | 1 | 1 | |
| Schistosoma mansoni | neuropeptide receptor | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0111 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0111 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0111 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0111 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0111 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0111 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0111 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0111 | 1 | 1 |
| Onchocerca volvulus | 0.0111 | 1 | 1 | |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0111 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0111 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0111 | 1 | 1 |
| Onchocerca volvulus | 0.0111 | 1 | 1 | |
| Onchocerca volvulus | 0.0111 | 1 | 1 | |
| Echinococcus granulosus | neuropeptide receptor | 0.0111 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0043 | 0.2765 | 0.5 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0111 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0111 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0111 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0043 | 0.2765 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 0.1545 | 0.1545 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0043 | 0.2765 | 0.2765 |
| Brugia malayi | RE15519p | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | intermediate filament protein | 0.0033 | 0.1608 | 0.1608 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0111 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0111 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0111 | 1 | 1 |
| Onchocerca volvulus | 0.0111 | 1 | 1 | |
| Onchocerca volvulus | 0.0111 | 1 | 1 | |
| Schistosoma mansoni | hypothetical protein | 0.0043 | 0.2765 | 0.1379 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0111 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0111 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0111 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0111 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0111 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0111 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0111 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0111 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0111 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0111 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0111 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0111 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0043 | 0.2765 | 0.5 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0111 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0111 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0111 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0111 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Potency (functional) | = 0.0045 um | PUBCHEM_BIOASSAY: qHTS Assay for Modulators of Lamin A Splicing. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 4.1095 uM | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493153, AID493163, AID504648] | ChEMBL. | No reference |
| Potency (functional) | = 25.1189 um | PUBCHEM_BIOASSAY: qHTS Assay for the Inhibitors of L3MBTL1. (Class of assay: confirmatory) [Related pubchem assays: 485292 (Probe Development Summary for Inhibitors of L3MBTL1)] | ChEMBL. | No reference |
| Potency (functional) | = 39.8107 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Aldehyde Dehydrogenase 1 (ALDH1A1). (Class of assay: confirmatory) [Related pubchem assays: 1030 (qHTS Validation Assay for Inhibitors of aldehyde dehydrogenase 1 (ALDH1A1))] | ChEMBL. | No reference |
| Potency (functional) | 44.6684 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Histone Lysine Methyltransferase G9a. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504404] | ChEMBL. | No reference |
| Potency (functional) | 50.1187 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BAZ2B. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504391] | ChEMBL. | No reference |
| Potency (functional) | 63.0957 uM | PubChem BioAssay. qHTS Assay for Inhibitors of the HIV-1 protein Vpr. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 79.4328 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Polymerase Iota. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588623] | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1505401
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.