Detailed information for compound 1383638
Basic information
Technical information
- TDR Targets ID: 1383638
- Name: 2-[4-amino-5-(4-ethoxyphenyl)-3-methylpyrazol o[3,4-d]pyrimidin-6-yl]sulfanyl-N-butan-2-yla cetamide
- MW: 414.524 | Formula: C20H26N6O2S
-
H donors: 2
H acceptors: 4
LogP: 2.94
Rotable bonds: 9
Rule of 5 violations (Lipinski): 1 - SMILES: CCOc1ccc(cc1)n1c(SCC(=O)NC(CC)C)nc2c(c1N)c(C)nn2
- InChi: 1S/C20H26N6O2S/c1-5-12(3)22-16(27)11-29-20-23-19-17(13(4)24-25-19)18(21)26(20)14-7-9-15(10-8-14)28-6-2/h7-10,12H,5-6,11,21H2,1-4H3,(H,22,27)
- InChiKey: DTFBMMNEICUESP-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 2-[4-amino-5-(4-ethoxyphenyl)-3-methyl-pyrazolo[3,4-d]pyrimidin-6-yl]sulfanyl-N-sec-butyl-acetamide
- 2-[[4-amino-5-(4-ethoxyphenyl)-3-methyl-6-pyrazolo[3,4-d]pyrimidinyl]thio]-N-sec-butylacetamide
- 2-[[4-amino-5-(4-ethoxyphenyl)-3-methyl-pyrazolo[3,4-d]pyrimidin-6-yl]thio]-N-sec-butyl-acetamide
- 2-[4-amino-5-(4-ethoxyphenyl)-3-methyl-pyrazolo[3,4-d]pyrimidin-6-yl]sulfanyl-N-butan-2-yl-ethanamide
- Oprea1_848281
- MLS000047106
- N-(sec-butyl)-2-{[5-(4-ethoxyphenyl)-4-imino-3-methyl-4,5-dihydro-1H-pyrazolo[3,4-d]pyrimidin-6-yl]thio}acetamide
- SMR000033117
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | aldehyde dehydrogenase 1 family, member A1 | Starlite/ChEMBL | No references |
| Trypanosoma cruzi | cysteine peptidase, putative | Starlite/ChEMBL | No references |
| Homo sapiens | lamin A/C | Starlite/ChEMBL | No references |
| Homo sapiens | GNAS complex locus | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Schistosoma mansoni | GTP-binding protein alpha subunit gna | GNAS complex locus | 394 aa | 450 aa | 28.7 % |
| Mycobacterium tuberculosis | Succinate-semialdehyde dehydrogenase [NADP+] dependent (SSDH) GabD1 | aldehyde dehydrogenase 1 family, member A1 | 501 aa | 456 aa | 33.3 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Plasmodium vivax | vivapain-2 | 0.002 | 0.1472 | 1 |
| Echinococcus granulosus | guanine nucleotide binding protein Gs subunit | 0.0055 | 0.6728 | 0.7125 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0077 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0015 | 0.0706 | 0.038 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Echinococcus multilocularis | cytoplasmic intermediate filament protein | 0.0016 | 0.0796 | 0.0843 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.002 | 0.1472 | 0.1603 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Mycobacterium ulcerans | aldehyde dehydrogenase | 0.0073 | 0.9443 | 0.5 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.1472 | 0.2187 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0077 | 1 | 1 |
| Echinococcus granulosus | cytoplasmic intermediate filament protein | 0.0016 | 0.0796 | 0.0843 |
| Brugia malayi | cathepsin L-like precursor | 0.0014 | 0.0468 | 0.0696 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 0.3235 | 0.4421 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.002 | 0.1472 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Echinococcus granulosus | cathepsin l1 | 0.002 | 0.1472 | 0.1558 |
| Plasmodium falciparum | cysteine proteinase falcipain 3 | 0.002 | 0.1472 | 1 |
| Loa Loa (eye worm) | ctsf protein | 0.002 | 0.1472 | 0.1603 |
| Schistosoma mansoni | aldehyde dehydrogenase | 0.0073 | 0.9443 | 1 |
| Echinococcus multilocularis | aldehyde dehydrogenase, mitochondrial | 0.0073 | 0.9443 | 1 |
| Brugia malayi | Cathepsin L-like cysteine proteinase | 0.0014 | 0.0468 | 0.0696 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.1472 | 0.2187 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.002 | 0.1472 | 0.2187 |
| Onchocerca volvulus | 0.002 | 0.1472 | 0.3513 | |
| Echinococcus granulosus | lamin dm0 | 0.0033 | 0.3325 | 0.3521 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.002 | 0.1472 | 1 |
| Trypanosoma cruzi | cruzipain precursor, putative | 0.0077 | 1 | 1 |
| Leishmania major | aldehyde dehydrogenase, mitochondrial precursor | 0.0073 | 0.9443 | 0.9347 |
| Trypanosoma cruzi | major cysteine proteinase, putative | 0.0061 | 0.7525 | 0.7525 |
| Entamoeba histolytica | cysteine protease, putative | 0.002 | 0.1472 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Onchocerca volvulus | Cathepsin F homolog | 0.002 | 0.1472 | 0.3513 |
| Loa Loa (eye worm) | GTP-binding regulatory protein Gs alpha-S chain | 0.0055 | 0.6728 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0016 | 0.0796 | 0.0523 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Schistosoma mansoni | lamin | 0.0033 | 0.3325 | 0.3521 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 1 | 1 |
| Onchocerca volvulus | 0.002 | 0.1472 | 0.3513 | |
| Brugia malayi | Cathepsin L-like precursor | 0.0014 | 0.0468 | 0.0696 |
| Echinococcus multilocularis | cysteine protease | 0.002 | 0.1472 | 0.1558 |
| Loa Loa (eye worm) | hypothetical protein | 0.002 | 0.1472 | 0.1603 |
| Mycobacterium ulcerans | aldehyde dehydrogenase | 0.0073 | 0.9443 | 0.5 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Onchocerca volvulus | 0.002 | 0.1472 | 0.3513 | |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.002 | 0.1472 | 0.1558 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0014 | 0.0468 | 0.0696 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.002 | 0.1472 | 0.1558 |
| Brugia malayi | GTP-binding regulatory protein Gs alpha-S chain, putative | 0.0055 | 0.6728 | 1 |
| Loa Loa (eye worm) | cysteine protease | 0.002 | 0.1472 | 0.1603 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0055 | 0.6728 | 0.7125 |
| Plasmodium vivax | vivapain-2 | 0.002 | 0.1472 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | musashi | 0.0033 | 0.3325 | 0.3521 |
| Onchocerca volvulus | Cathepsin L homolog | 0.002 | 0.1472 | 0.3513 |
| Loa Loa (eye worm) | intermediate filament protein | 0.0033 | 0.3325 | 0.4563 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Echinococcus granulosus | lamin | 0.0033 | 0.3325 | 0.3521 |
| Echinococcus granulosus | cathepsin l1 | 0.0014 | 0.0468 | 0.0496 |
| Echinococcus granulosus | cathepsin l cysteine peptidase | 0.002 | 0.1472 | 0.1558 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0014 | 0.0468 | 0.3182 |
| Loa Loa (eye worm) | intermediate filament tail domain-containing protein | 0.0033 | 0.3325 | 0.4563 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Schistosoma mansoni | lamin | 0.0033 | 0.3325 | 0.3521 |
| Echinococcus granulosus | cathepsin L cysteine proteinase | 0.002 | 0.1472 | 0.1558 |
| Leishmania major | cathepsin L-like protease | 0.0077 | 1 | 1 |
| Plasmodium falciparum | cysteine proteinase falcipain 2a | 0.002 | 0.1472 | 1 |
| Loa Loa (eye worm) | fibroinase | 0.002 | 0.1472 | 0.1603 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Mycobacterium ulcerans | aldehyde dehydrogenase | 0.0073 | 0.9443 | 0.5 |
| Echinococcus multilocularis | guanine nucleotide binding protein G(s) subunit | 0.0055 | 0.6728 | 0.7125 |
| Onchocerca volvulus | 0.0033 | 0.3325 | 1 | |
| Leishmania major | cathepsin L-like protease | 0.0077 | 1 | 1 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.002 | 0.1472 | 0.1558 |
| Loa Loa (eye worm) | hypothetical protein | 0.0015 | 0.0706 | 0.038 |
| Loa Loa (eye worm) | hypothetical protein | 0.0033 | 0.3325 | 0.4563 |
| Mycobacterium tuberculosis | Probable aldehyde dehydrogenase | 0.0073 | 0.9443 | 0.5 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.1472 | 0.2187 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.1472 | 0.2187 |
| Echinococcus granulosus | aldehyde dehydrogenase mitochondrial | 0.0073 | 0.9443 | 1 |
| Brugia malayi | Intermediate filament tail domain containing protein | 0.0033 | 0.3325 | 0.4942 |
| Onchocerca volvulus | 0.002 | 0.1472 | 0.3513 | |
| Onchocerca volvulus | Cathepsin L homolog | 0.002 | 0.1472 | 0.3513 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0014 | 0.0468 | 0.3182 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0055 | 0.6728 | 0.7125 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 1 | 1 |
| Echinococcus granulosus | guanine nucleotide binding protein Gs subunit | 0.0055 | 0.6728 | 0.7125 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.002 | 0.1472 | 0.1472 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0014 | 0.0468 | 0.0496 |
| Loa Loa (eye worm) | Papain cysteine protease/cathepsin propeptide inhibitor-containing protein | 0.002 | 0.1472 | 0.1603 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Brugia malayi | intermediate filament protein | 0.0033 | 0.3325 | 0.4942 |
| Echinococcus multilocularis | lamin dm0 | 0.0033 | 0.3325 | 0.3521 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.002 | 0.1472 | 0.1558 |
| Onchocerca volvulus | 0.002 | 0.1472 | 0.3513 | |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | cysteine protease | 0.002 | 0.1472 | 0.1558 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0055 | 0.6728 | 0.7125 |
| Schistosoma mansoni | aldehyde dehydrogenase | 0.0073 | 0.9443 | 1 |
| Brugia malayi | cytoplasmic intermediate filament protein | 0.0017 | 0.1055 | 0.1568 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.002 | 0.1472 | 0.1558 |
| Echinococcus multilocularis | guanine nucleotide binding protein G(s) subunit | 0.0055 | 0.6728 | 0.7125 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Onchocerca volvulus | 0.0033 | 0.3325 | 1 | |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0014 | 0.0468 | 0.3182 |
| Onchocerca volvulus | 0.002 | 0.1472 | 0.3513 | |
| Schistosoma mansoni | intermediate filament proteins | 0.0033 | 0.3325 | 0.3521 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Echinococcus granulosus | intermediate filament protein | 0.0033 | 0.3325 | 0.3521 |
| Trypanosoma cruzi | cysteine peptidase, clan CA, family C1, cathepsin L-like, putative | 0.007 | 0.8997 | 0.8997 |
| Loa Loa (eye worm) | cytoplasmic intermediate filament protein | 0.0017 | 0.1055 | 0.0938 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.1472 | 0.2187 |
| Onchocerca volvulus | 0.002 | 0.1472 | 0.3513 | |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.002 | 0.1472 | 0.1558 |
| Toxoplasma gondii | aldehyde dehydrogenase | 0.0073 | 0.9443 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.1472 | 0.2187 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.1472 | 1 |
| Echinococcus multilocularis | lamin | 0.0033 | 0.3325 | 0.3521 |
| Plasmodium falciparum | cysteine proteinase falcipain 2b | 0.002 | 0.1472 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Potency (functional) | 0.5623 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of TGF-b: Cytotox Counterscreen. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588855, AID588860] | ChEMBL. | No reference |
| Potency (functional) | = 3.5481 um | PUBCHEM_BIOASSAY: qHTS Assay for Modulators of Lamin A Splicing. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 3.6964 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 96 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488745, AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
| Potency (functional) | 5.2213 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 48 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
| Potency (functional) | 7.0795 uM | PubChem BioAssay. qHTS for Antagonists of gsp, the Etiologic Mutation Responsible for Fibrous Dysplasia/McCune-Albright Syndrome: qHTS. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 7.9433 um | PUBCHEM_BIOASSAY: qHTS Assay for Promiscuous and Specific Inhibitors of Cruzain (without detergent). (Class of assay: confirmatory) [Related pubchem assays: 2158 (Confirmation qHTS Assay for Inhibitors of Cruzain), 2249 (Probe Development Summary of Promiscuous Inhibitors (Artifacts) of Cruzain), 2161 (qHTS Assay for Inhibitors of Papain: Counterscreen for Cruzain Assay), 1478 (qHTS Assay for Promiscuous and Specific Inhibitors of Cruzain (with detergent))] | ChEMBL. | No reference |
| Potency (functional) | = 8.9125 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Aldehyde Dehydrogenase 1 (ALDH1A1). (Class of assay: confirmatory) [Related pubchem assays: 1030 (qHTS Validation Assay for Inhibitors of aldehyde dehydrogenase 1 (ALDH1A1))] | ChEMBL. | No reference |
| Potency (functional) | = 25.1189 um | PUBCHEM_BIOASSAY: qHTS Assay for Identifying the Cell-Membrane Permeable IMPase Inhibitors. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 29.0929 uM | PubChem BioAssay. qHTS for induction of synthetic lethality in tumor cells producing 2HG: qHTS for the HT-1080-NT fibrosarcoma cell line. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 31.6228 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of HSD17B4, hydroxysteroid (17-beta) dehydrogenase 4. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 35.4813 uM | PubChem BioAssay. qHTS Assay for Activators of ClpP. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 39.8107 um | PUBCHEM_BIOASSAY: qHTS Assay for Agonists of the Relaxin Receptor RXFP1. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 70.7946 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Histone Lysine Methyltransferase G9a. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504404] | ChEMBL. | No reference |
| Potency (functional) | 79.4328 uM | PUBCHEM_BIOASSAY: Inhibitors of TCP-1 ring complex (TRiC) of Methanococcus maripaludis (MmCpn): qHTS. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488991] | ChEMBL. | No reference |
| Potency (functional) | 79.4328 uM | PubChem BioAssay. qHTS for Inhibitors of WRN Helicase. (Class of assay: confirmatory) | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Homo sapiens | ChEMBL23 | ||
| Plasmodium falciparum | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1536353
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.