Detailed information for compound 1437614
Basic information
Technical information
- TDR Targets ID: 1437614
- Name: N-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)be nzamide
- MW: 267.344 | Formula: C13H17NO3S
-
H donors: 0
H acceptors: 3
LogP: 1.14
Rotable bonds: 3
Rule of 5 violations (Lipinski): 1 - SMILES: CN(C1(C)CCS(=O)(=O)C1)C(=O)c1ccccc1
- InChi: 1S/C13H17NO3S/c1-13(8-9-18(16,17)10-13)14(2)12(15)11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3
- InChiKey: ZALNPEYMWWLORG-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- N-methyl-N-(3-methyl-1,1-dioxo-thiolan-3-yl)benzamide
- N-methyl-N-(3-methyl-1,1-dioxo-3-thiolanyl)benzamide
- N-(1,1-diketo-3-methyl-thiolan-3-yl)-N-methyl-benzamide
- SMR000078636
- T5480799
- MLS000065143
- N-methyl-N-(3-methyl-1,1-dioxidotetrahydro-3-thienyl)benzamide
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.008 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.008 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | voltage and ligand gated potassium channel | 0.0042 | 0.4443 | 0.4443 |
| Trypanosoma cruzi | cytochrome P450, putative | 0.003 | 0.2674 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.008 | 1 | 1 |
| Mycobacterium tuberculosis | Probable cytochrome P450 141 Cyp141 | 0.002 | 0.1188 | 0.5 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 0.5 | |
| Brugia malayi | neuropeptide F receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.008 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.002 | 0.1188 | 0.1188 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.008 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Mycobacterium tuberculosis | Cytochrome P450 51 Cyp51 (CYPL1) (P450-L1A1) (sterol 14-alpha demethylase) (lanosterol 14-alpha demethylase) (P450-14DM) | 0.002 | 0.1188 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Mycobacterium tuberculosis | Probable cytochrome P450 138 Cyp138 | 0.002 | 0.1188 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.008 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Trichomonas vaginalis | voltage and ligand gated potassium channel, putative | 0.0039 | 0.4032 | 0.5 |
| Mycobacterium tuberculosis | Probable cytochrome P450 139 Cyp139 | 0.002 | 0.1188 | 0.5 |
| Schistosoma mansoni | amine GPCR | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.008 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.008 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.008 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.008 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.008 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Toxoplasma gondii | cytochrome p450 superfamily protein | 0.002 | 0.1188 | 0.5 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.008 | 1 | 0.5 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.008 | 1 | 1 |
| Echinococcus granulosus | cytochrome P450 2K1 | 0.002 | 0.1188 | 0.1188 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 0.5 | |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.008 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.008 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.008 | 1 | 1 |
| Brugia malayi | Cytochrome P450 family protein | 0.003 | 0.2674 | 0.2674 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.008 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.008 | 1 | 1 |
| Mycobacterium leprae | Conserved hypothetical protein | 0.002 | 0.1188 | 0.5 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 0.5 | |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.008 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | 0.002 | 0.1188 | 0.1188 | |
| Mycobacterium tuberculosis | Probable cytochrome P450 140 Cyp140 | 0.002 | 0.1188 | 0.5 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.008 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.008 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Mycobacterium tuberculosis | Cytochrome P450 121 Cyp121 | 0.002 | 0.1188 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.008 | 1 | 1 |
| Mycobacterium tuberculosis | Probable cytochrome P450 144 Cyp144 | 0.002 | 0.1188 | 0.5 |
| Brugia malayi | Serotonin receptor | 0.008 | 1 | 1 |
| Brugia malayi | Cytochrome P450 family protein | 0.003 | 0.2674 | 0.2674 |
| Brugia malayi | Cytochrome P450 family protein | 0.0064 | 0.766 | 0.766 |
| Echinococcus granulosus | serotonin receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.008 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.008 | 1 | 1 |
| Mycobacterium tuberculosis | Probable cytochrome P450 136 Cyp136 | 0.002 | 0.1188 | 0.5 |
| Brugia malayi | hypothetical protein | 0.008 | 1 | 1 |
| Brugia malayi | Cytochrome P450 family protein | 0.002 | 0.1188 | 0.1188 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.008 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | CYP4Cod1 | 0.003 | 0.2674 | 0.2674 |
| Loa Loa (eye worm) | cytochrome P450 family protein | 0.003 | 0.2674 | 0.2674 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.008 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 0.5 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.008 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.008 | 1 | 1 |
| Mycobacterium tuberculosis | Probable cytochrome P450 128 Cyp128 | 0.002 | 0.1188 | 0.5 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.008 | 1 | 1 |
| Mycobacterium tuberculosis | Probable cytochrome P450 137 Cyp137 | 0.002 | 0.1188 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 0.5 | |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.008 | 1 | 1 |
| Echinococcus granulosus | potassium voltage gated channel subfamily H | 0.0042 | 0.4443 | 0.4443 |
| Mycobacterium tuberculosis | Probable cytochrome P450 132 Cyp132 | 0.002 | 0.1188 | 0.5 |
| Onchocerca volvulus | 0.008 | 1 | 0.5 | |
| Echinococcus multilocularis | fmrfamide receptor | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 0.5 | |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.008 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.008 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.008 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.008 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Brugia malayi | RE15519p | 0.008 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 0.5 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.008 | 1 | 1 |
| Mycobacterium tuberculosis | Probable cytochrome P450 124 Cyp124 | 0.002 | 0.1188 | 0.5 |
| Brugia malayi | neuropeptide F receptor | 0.008 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.008 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.008 | 1 | 1 |
| Mycobacterium tuberculosis | Possible cytochrome P450 126 Cyp126 | 0.002 | 0.1188 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.008 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.008 | 1 | 1 |
| Mycobacterium tuberculosis | Probable cytochrome P450 143 Cyp143 | 0.002 | 0.1188 | 0.5 |
| Trypanosoma brucei | cytochrome P450, putative | 0.003 | 0.2674 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.008 | 1 | 1 |
| Leishmania major | cytochrome p450-like protein | 0.003 | 0.2674 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.008 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.008 | 1 | 1 |
| Mycobacterium leprae | putative cytochrome p450 | 0.002 | 0.1188 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.008 | 1 | 0.5 |
| Echinococcus multilocularis | g protein coupled receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.008 | 1 | 1 |
| Mycobacterium tuberculosis | Probable cytochrome P450 125 Cyp125 | 0.002 | 0.1188 | 0.5 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.008 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.008 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.008 | 1 | 1 |
| Schistosoma mansoni | voltage-gated potassium channel | 0.0046 | 0.5018 | 0.5018 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.008 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0037 | 0.3617 | 0.3617 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.008 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.008 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | cytochrome P450 | 0.002 | 0.1188 | 0.1188 |
| Schistosoma mansoni | amine GPCR | 0.008 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.008 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.008 | 1 | 1 |
| Mycobacterium tuberculosis | Probable cytochrome P450 123 Cyp123 | 0.002 | 0.1188 | 0.5 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.008 | 1 | 1 |
| Mycobacterium tuberculosis | Possible cytochrome P450 135B1 Cyp135B1 | 0.002 | 0.1188 | 0.5 |
| Schistosoma mansoni | opsin-like receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.008 | 1 | 1 |
| Schistosoma mansoni | cytochrome P450 | 0.002 | 0.1188 | 0.1188 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 0.5 | |
| Loa Loa (eye worm) | cytochrome P450 family protein | 0.003 | 0.2674 | 0.2674 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.008 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 0.5 | |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.008 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.008 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.008 | 1 | 1 |
| Mycobacterium tuberculosis | Probable cytochrome P450 130 Cyp130 | 0.002 | 0.1188 | 0.5 |
| Echinococcus granulosus | g protein coupled receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Mycobacterium ulcerans | cytochrome P450 185A4 Cyp185A4 | 0.003 | 0.2674 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.008 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.008 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.008 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.008 | 1 | 1 |
| Brugia malayi | Voltage-gated potassium channel, HERG (KCNH2)-related. C. elegans unc-103 ortholog | 0.0042 | 0.4443 | 0.4443 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.008 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.008 | 1 | 1 |
| Trypanosoma cruzi | cytochrome P450, putative | 0.003 | 0.2674 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.008 | 1 | 1 |
| Schistosoma mansoni | voltage-gated potassium channel | 0.0046 | 0.5018 | 0.5018 |
| Mycobacterium tuberculosis | Possible cytochrome P450 135A1 Cyp135A1 | 0.002 | 0.1188 | 0.5 |
| Echinococcus granulosus | allatostatin A receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 0.5 | |
| Onchocerca volvulus | 0.008 | 1 | 0.5 | |
| Trichomonas vaginalis | voltage and ligand gated potassium channel, putative | 0.0039 | 0.4032 | 0.5 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | potassium voltage gated channel subfamily H | 0.0042 | 0.4443 | 0.4443 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.008 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.008 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 0.5 | |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.008 | 1 | 1 |
| Brugia malayi | cytochrome P450 | 0.002 | 0.1188 | 0.1188 |
| Onchocerca volvulus | 0.008 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.008 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.008 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.008 | 1 | 1 |
| Mycobacterium tuberculosis | Probable cytochrome P450 monooxygenase 142 Cyp142 | 0.002 | 0.1188 | 0.5 |
| Schistosoma mansoni | biogenic amine receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | cytochrome P450 family protein | 0.0064 | 0.766 | 0.766 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.008 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.008 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Potency (functional) | 18.526 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 96 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488745, AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
| Potency (functional) | 35.4813 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of TGF-b: Cytotox Counterscreen. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588855, AID588860] | ChEMBL. | No reference |
| Potency (functional) | 70.7946 uM | PUBCHEM_BIOASSAY: Inhibitors of Regulator of G Protein Signaling (RGS) 4: qHTS. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504856] | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Plasmodium falciparum | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1608008
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.