Detailed information for compound 1472366
Basic information
Technical information
- TDR Targets ID: 1472366
- Name: N-(3-imino-1H-isoindol-2-yl)-4-methylbenzenes ulfonamide
- MW: 301.364 | Formula: C15H15N3O2S
-
H donors: 1
H acceptors: 2
LogP: 2.26
Rotable bonds: 3
Rule of 5 violations (Lipinski): 1 - SMILES: Cc1ccc(cc1)S(=O)(=O)NN1Cc2c(C1=N)cccc2
- InChi: 1S/C15H15N3O2S/c1-11-6-8-13(9-7-11)21(19,20)17-18-10-12-4-2-3-5-14(12)15(18)16/h2-9,16-17H,10H2,1H3
- InChiKey: LZXANTHIMAGSIS-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- N-(1-iminoisoindolin-2-yl)-4-methyl-benzenesulfonamide
- N-(1-imino-2-isoindolinyl)-4-methylbenzenesulfonamide
- N-(3-imino-1H-isoindol-2-yl)-4-methyl-benzenesulfonamide
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus granulosus | g-protein coupled receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0044 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0044 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0044 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0042 | 0.9318 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0044 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0044 | 1 | 1 |
| Trypanosoma cruzi | PAB1-binding protein , putative | 0.0029 | 0.4224 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0044 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0044 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0029 | 0.4224 | 0.5 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 0.5 | |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 0.5 | |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0044 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0044 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0044 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0044 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0044 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0044 | 1 | 0.5 |
| Onchocerca volvulus | 0.0044 | 1 | 0.5 | |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0044 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0044 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0042 | 0.9318 | 0.5 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0044 | 1 | 1 |
| Trypanosoma brucei | PAB1-binding protein , putative | 0.0029 | 0.4224 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0044 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0042 | 0.9318 | 0.9318 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0044 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0044 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0044 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0044 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0044 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0044 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 0.5 | |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0044 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0044 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0044 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0044 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0042 | 0.9318 | 0.5 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0044 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0044 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0044 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0042 | 0.9318 | 0.5 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0044 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0044 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0044 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 0.5 | |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0044 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0044 | 1 | 0.5 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Toxoplasma gondii | LsmAD domain-containing protein | 0.0029 | 0.4224 | 0.5 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0044 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0044 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0044 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0044 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0044 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0044 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0044 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0044 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 0.5 | |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 0.5 | |
| Echinococcus granulosus | allatostatin A receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0029 | 0.4224 | 0.4224 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0044 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0044 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 0.5 | |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0044 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0044 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0044 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0044 | 1 | 1 |
| Plasmodium falciparum | ataxin-2 like protein, putative | 0.0029 | 0.4224 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0044 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0044 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0044 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0044 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0044 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0044 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Plasmodium vivax | ataxin-2 like protein, putative | 0.0029 | 0.4224 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0044 | 1 | 1 |
| Plasmodium falciparum | ataxin-2 like protein, putative | 0.0029 | 0.4224 | 0.5 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 0.5 | |
| Brugia malayi | RE15519p | 0.0044 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0044 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0044 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0044 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0044 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0044 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0044 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0044 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0044 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 0.5 | |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0044 | 1 | 1 |
| Onchocerca volvulus | 0.0044 | 1 | 0.5 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0044 | 1 | 1 |
| Trypanosoma cruzi | PAB1-binding protein , putative | 0.0029 | 0.4224 | 0.5 |
| Onchocerca volvulus | 0.0044 | 1 | 0.5 | |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0044 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0044 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0044 | 1 | 1 |
Activities
No activities found for this compound.
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1625277
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.