Detailed information for compound 1494741
Basic information
Technical information
- Name: Unnamed compound
- MW: 937.106 | Formula: C42H68N18O7
-
H donors: 5
H acceptors: 11
LogP: -2.4
Rotable bonds: 29
Rule of 5 violations (Lipinski): 3 - SMILES: C#CCOCCOCCOCCNc1nc(nc(n1)N1CCN(CC1)C(=O)[C@@H](n1nnc(c1)C([C@@H](CC)C)N)CC(=O)N)N1CCN(CC1)C(=O)[C@@H](n1nnc(c1)C([C@H](CC)C)N)CC(=O)N
- InChi: 1S/C42H68N18O7/c1-6-18-65-20-22-67-23-21-66-19-9-47-40-48-41(57-14-10-55(11-15-57)38(63)32(24-34(43)61)59-26-30(51-53-59)36(45)28(4)7-2)50-42(49-40)58-16-12-56(13-17-58)39(64)33(25-35(44)62)60-27-31(52-54-60)37(46)29(5)8-3/h1,26-29,32-33,36-37H,7-25,45-46H2,2-5H3,(H2,43,61)(H2,44,62)(H,47,48,49,50)/t28-,29+,32-,33-,36?,37?/m0/s1
- InChiKey: YQVSMNJWVWCCJO-DFXFWSQUSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | polymerase (DNA directed) iota | Starlite/ChEMBL | No references |
| Homo sapiens | ataxin 2 | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus multilocularis | neuropeptide s receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0031 | 1 | 1 |
| Trypanosoma brucei | PAB1-binding protein , putative | 0.003 | 0.9929 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.003 | 0.9929 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Trypanosoma cruzi | PAB1-binding protein , putative | 0.003 | 0.9929 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0031 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0031 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0031 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0031 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0031 | 1 | 1 |
| Plasmodium falciparum | ataxin-2 like protein, putative | 0.003 | 0.9929 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0031 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Giardia lamblia | DINP protein human, muc B family | 0.0023 | 0.3363 | 0.5 |
| Trichomonas vaginalis | DNA polymerase eta, putative | 0.0023 | 0.3363 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0031 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0031 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | DNA polymerase IV / kappa, putative | 0.0023 | 0.3363 | 0.5 |
| Echinococcus granulosus | allatostatin A receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Trypanosoma cruzi | PAB1-binding protein , putative | 0.003 | 0.9929 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0031 | 1 | 1 |
| Entamoeba histolytica | deoxycytidyl transferase, putative | 0.0023 | 0.3363 | 0.5 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0031 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0031 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.003 | 0.9929 | 0.9929 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0031 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0031 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0031 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Echinococcus multilocularis | allatostatin A receptor | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.0031 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0031 | 1 | 1 |
| Plasmodium falciparum | ataxin-2 like protein, putative | 0.003 | 0.9929 | 0.5 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0031 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0031 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0031 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0031 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0031 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0031 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0031 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0031 | 1 | 0.5 |
| Brugia malayi | ORL1-like opioid receptor | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Brugia malayi | neuropeptide F receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0031 | 1 | 1 |
| Brugia malayi | ImpB/MucB/SamB family protein | 0.0023 | 0.3363 | 0.3363 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0031 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0031 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0031 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0031 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0031 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0031 | 1 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0031 | 1 | 1 |
| Mycobacterium ulcerans | DNA polymerase IV | 0.0023 | 0.3363 | 0.5 |
| Mycobacterium tuberculosis | Conserved hypothetical protein | 0.0023 | 0.3363 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0031 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0031 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0031 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0031 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Echinococcus granulosus | neuropeptide receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0031 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0031 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0031 | 1 | 1 |
| Mycobacterium ulcerans | DNA polymerase IV | 0.0023 | 0.3363 | 0.5 |
| Plasmodium vivax | ataxin-2 like protein, putative | 0.003 | 0.9929 | 0.5 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0031 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0031 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0031 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0031 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0031 | 1 | 1 |
| Brugia malayi | ImpB/MucB/SamB family protein | 0.0023 | 0.3363 | 0.3363 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0031 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0031 | 1 | 1 |
| Toxoplasma gondii | LsmAD domain-containing protein | 0.003 | 0.9929 | 0.5 |
| Mycobacterium tuberculosis | Possible DNA-damage-inducible protein P DinP (DNA polymerase V) (pol IV 2) (DNA nucleotidyltransferase (DNA-directed)) | 0.0023 | 0.3363 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0031 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0031 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Echinococcus granulosus | somatostatin receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0031 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0031 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.003 | 0.9929 | 0.9893 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0031 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Potency (functional) | 10 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Polymerase Iota. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588623] | ChEMBL. | No reference |
| Potency (functional) | 19.9526 uM | PubChem BioAssay. qHTS for Inhibitors of ATXN expression. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 22.3872 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of JMJD2A-Tudor Domain. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504402] | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1715953
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.