Detailed information for compound 1518528
Basic information
Technical information
- TDR Targets ID: 1518528
- Name: (1S)-8-fluoro-1-[(3,4,5-trimethoxyphenyl)meth yl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol
- MW: 363.38 | Formula: C19H22FNO5
-
H donors: 3
H acceptors: 2
LogP: 2.62
Rotable bonds: 5
Rule of 5 violations (Lipinski): 1 - SMILES: COc1cc(C[C@@H]2NCCc3c2c(F)c(c(c3)O)O)cc(c1OC)OC
- InChi: 1S/C19H22FNO5/c1-24-14-7-10(8-15(25-2)19(14)26-3)6-12-16-11(4-5-21-12)9-13(22)18(23)17(16)20/h7-9,12,21-23H,4-6H2,1-3H3/t12-/m0/s1
- InChiKey: MKRDKFSQEPQZSX-LBPRGKRZSA-N
Network
Hover on a compound node to display the structore
Synonyms
- (1S)-8-fluoro-1-(3,4,5-trimethoxybenzyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol
- PDSP1_000596
- PDSP2_000593
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Cavia porcellus | Beta-1 adrenergic receptor | Starlite/ChEMBL | References |
| Cavia porcellus | Beta-2 adrenergic receptor | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0076 | 1 | 1 |
| Brugia malayi | oxidoreductase, aldo/keto reductase family protein | 0.0076 | 1 | 1 |
| Trichomonas vaginalis | aldo/keto reductase, putative | 0.0076 | 1 | 0.5 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0076 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0076 | 1 | 1 |
| Onchocerca volvulus | 0.0076 | 1 | 0.5 | |
| Trichomonas vaginalis | dihydrodiol dehydrogenase, putative | 0.0076 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0076 | 1 | 1 |
| Mycobacterium leprae | PROBABLE OXIDOREDUCTASE | 0.0076 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0076 | 1 | 1 |
| Trypanosoma brucei | prostaglandin f synthase | 0.0076 | 1 | 0.5 |
| Onchocerca volvulus | 0.0076 | 1 | 0.5 | |
| Entamoeba histolytica | aldose reductase, putative | 0.0076 | 1 | 0.5 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0076 | 1 | 1 |
| Brugia malayi | Corticotropin releasing factor receptor 2 precursor, putative | 0.0054 | 0.4412 | 0.4412 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0076 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, aldo/keto reductase family protein | 0.0076 | 1 | 1 |
| Entamoeba histolytica | aldose reductase, putative | 0.0076 | 1 | 0.5 |
| Trichomonas vaginalis | aldo/keto reductase, putative | 0.0076 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, aldo/keto reductase family protein | 0.0076 | 1 | 1 |
| Leishmania major | prostaglandin f2-alpha synthase/D-arabinose dehydrogenase | 0.0076 | 1 | 0.5 |
| Echinococcus multilocularis | aldo keto reductase | 0.0076 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0076 | 1 | 0.5 |
| Brugia malayi | Calcitonin receptor-like protein seb-1 | 0.0054 | 0.4412 | 0.4412 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0076 | 1 | 1 |
| Schistosoma mansoni | pol-related | 0.0076 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0076 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0076 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0076 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0076 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase | 0.0076 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0076 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0076 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0076 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0076 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0076 | 1 | 0.5 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0076 | 1 | 0.5 |
| Schistosoma mansoni | aldo-keto reductase | 0.0076 | 1 | 1 |
| Entamoeba histolytica | aldose reductase, putative | 0.0076 | 1 | 0.5 |
| Schistosoma mansoni | aldo-keto reductase | 0.0076 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0076 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0076 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0076 | 1 | 1 |
| Leishmania major | aldehyde reductase, putative,oxidoreductase, putative | 0.0076 | 1 | 0.5 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0076 | 1 | 0.5 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0076 | 1 | 0.5 |
| Trypanosoma cruzi | aldo-keto reductase | 0.0076 | 1 | 0.5 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0076 | 1 | 1 |
| Trichomonas vaginalis | dihydrodiol dehydrogenase, putative | 0.0076 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0076 | 1 | 1 |
| Onchocerca volvulus | 0.0076 | 1 | 0.5 | |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0076 | 1 | 0.5 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0076 | 1 | 1 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0076 | 1 | 0.5 |
| Leishmania major | aldo-keto reductase-like protein | 0.0076 | 1 | 0.5 |
| Giardia lamblia | Aldose reductase | 0.0076 | 1 | 0.5 |
| Echinococcus granulosus | aldo keto reductase | 0.0076 | 1 | 1 |
| Giardia lamblia | Aldose reductase | 0.0076 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0076 | 1 | 1 |
| Mycobacterium ulcerans | oxidoreductase | 0.0076 | 1 | 0.5 |
| Echinococcus multilocularis | aldo keto reductase | 0.0076 | 1 | 1 |
| Trypanosoma brucei | aldo-keto reductase, putative | 0.0076 | 1 | 0.5 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0076 | 1 | 0.5 |
| Leishmania major | prostaglandin f synthase, putative | 0.0076 | 1 | 0.5 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0076 | 1 | 0.5 |
| Trichomonas vaginalis | aldo/keto reductase, putative | 0.0076 | 1 | 0.5 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0076 | 1 | 1 |
| Loa Loa (eye worm) | pigment dispersing factor receptor c | 0.0054 | 0.4412 | 0.4412 |
| Onchocerca volvulus | 0.0076 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0076 | 1 | 0.5 | |
| Toxoplasma gondii | aldose reductase, putative | 0.0076 | 1 | 0.5 |
| Trypanosoma cruzi | aldo/keto reductase, putative | 0.0076 | 1 | 0.5 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0076 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0076 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase | 0.0076 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0054 | 0.4412 | 0.4412 |
| Onchocerca volvulus | 0.0076 | 1 | 0.5 | |
| Echinococcus granulosus | aldo keto reductase | 0.0076 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0076 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase | 0.0076 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0076 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0076 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0076 | 1 | 0.5 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0076 | 1 | 1 |
| Trichomonas vaginalis | dihydrodiol dehydrogenase, putative | 0.0076 | 1 | 0.5 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| EC50 (binding) | = -6.62 | Inhibitory activity against Beta-1 adrenergic receptor in guinea pig atria | ChEMBL. | 1346651 |
| EC50 (binding) | = -6.53 | Inhibitory activity against Beta-2 adrenergic receptor in guinea pig trachea | ChEMBL. | 1346651 |
| IC50 (functional) | = -4.4 | Inhibitory activity against U-46,619-induced responses in human platelet aggregation (Thromboxane A2 alpha receptor) | ChEMBL. | 1346651 |
| Intrinsic activity (binding) | = 0.76 | Maximum response of drug relative to the response of 10e-5 isoproterenol | ChEMBL. | 1346651 |
| Intrinsic activity (binding) | = 0.9 | Maximum response of drug relative to the response of 10e-5 isoproterenol | ChEMBL. | 1346651 |
| Ki (binding) | = -7.35 | Binding affinity against Beta-2 adrenergic receptor in guinea pig lung membranes | ChEMBL. | 1346651 |
| Ki (binding) | = -7.12 | Binding affinity against Beta-1 adrenergic receptor in guinea pig left ventricle | ChEMBL. | 1346651 |
| pKB (functional) | = 5.71 | Inhibitory activity against U4-6,619-mediated contraction of rat thoracic aorta (Thromboxane A2 tau receptor) | ChEMBL. | 1346651 |
| Potency ratio (functional) | = 0.01 | Potency ratio of the compound was measured as EC50 (trimetoquinol )/EC50 (drug) | ChEMBL. | 1346651 |
| Potency ratio (functional) | = 0.13 | Potency ratio of the compound was measured as EC50 (trimetoquinol )/EC50 (drug) | ChEMBL. | 1346651 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1788251
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.