Detailed information for compound 1550496
Basic information
Technical information
- TDR Targets ID: 1550496
- Name: N,N'-bis[2-(3,4-dimethoxyphenyl)ethyl]benzene -1,2-dicarboxamide
- MW: 492.563 | Formula: C28H32N2O6
-
H donors: 2
H acceptors: 2
LogP: 4.27
Rotable bonds: 14
Rule of 5 violations (Lipinski): 1 - SMILES: COc1cc(CCNC(=O)c2ccccc2C(=O)NCCc2ccc(c(c2)OC)OC)ccc1OC
- InChi: 1S/C28H32N2O6/c1-33-23-11-9-19(17-25(23)35-3)13-15-29-27(31)21-7-5-6-8-22(21)28(32)30-16-14-20-10-12-24(34-2)26(18-20)36-4/h5-12,17-18H,13-16H2,1-4H3,(H,29,31)(H,30,32)
- InChiKey: UQELUQDLAWEBMG-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- N,N'-bis[2-(3,4-dimethoxyphenyl)ethyl]phthalamide
- IVK/9056249
- MLS001180634
- N~1~,N~2~-bis[2-(3,4-dimethoxyphenyl)ethyl]phthalamide
- SMR000476761
- Oprea1_519396
- AK-968/15256090
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Brugia malayi | Nuclear hormone receptor family member nhr-14 | 0.0443 | 1 | 1 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0443 | 1 | 1 |
| Echinococcus granulosus | FTZ F1 nuclear receptor protein | 0.0443 | 1 | 1 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0443 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0443 | 1 | 1 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0234 | 0.1071 | 0.1071 |
| Echinococcus multilocularis | Nuclear hormone receptor family member nhr 41 | 0.0443 | 1 | 1 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0443 | 1 | 1 |
| Echinococcus multilocularis | COUP TF:Svp nuclear hormone receptor | 0.0443 | 1 | 1 |
| Onchocerca volvulus | Steroid hormone receptor family member cnr14 homolog | 0.0443 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0443 | 1 | 1 |
| Schistosoma mansoni | ecdysone-induced protein 78c (dr-78) | 0.0234 | 0.1071 | 0.1071 |
| Echinococcus multilocularis | FTZ F1 nuclear receptor protein | 0.0443 | 1 | 1 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0443 | 1 | 1 |
| Echinococcus granulosus | ecdysone induced protein 78C | 0.0443 | 1 | 1 |
| Schistosoma mansoni | nuclear hormone receptor nor-1/nor-2 | 0.0443 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-49 | 0.0443 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0443 | 1 | 1 |
| Echinococcus multilocularis | nuclear receptor subfamily 1 group D | 0.0234 | 0.1071 | 0.1071 |
| Loa Loa (eye worm) | hypothetical protein | 0.0443 | 1 | 1 |
| Brugia malayi | nuclear receptor NHR-88 | 0.0443 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-3 | 0.0443 | 1 | 1 |
| Onchocerca volvulus | 0.0443 | 1 | 1 | |
| Echinococcus granulosus | nuclear receptor subfamily 1 group D | 0.0234 | 0.1071 | 0.1071 |
| Brugia malayi | Nuclear hormone receptor family member nhr-40 | 0.0443 | 1 | 1 |
| Echinococcus granulosus | Nuclear hormone receptor family member nhr 41 | 0.0443 | 1 | 1 |
| Echinococcus granulosus | FTZ F1 alpha | 0.0443 | 1 | 1 |
| Echinococcus granulosus | COUP TF:Svp nuclear hormone receptor | 0.0443 | 1 | 1 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0443 | 1 | 1 |
| Schistosoma mansoni | photoreceptor-specific nuclear receptor related | 0.0443 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0443 | 1 | 1 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0443 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0234 | 0.1071 | 0.1071 |
| Brugia malayi | Steroid receptor seven-up type 2 | 0.0443 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-14 | 0.0443 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0443 | 1 | 1 |
| Echinococcus granulosus | hepatocyte nuclear factor 4 alpha | 0.0443 | 1 | 1 |
| Onchocerca volvulus | Bile acid receptor homolog | 0.0443 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0443 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0443 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0443 | 1 | 1 |
| Echinococcus granulosus | retinoic acid receptor rxr beta a | 0.0443 | 1 | 1 |
| Echinococcus multilocularis | thyroid hormone receptor alpha | 0.0443 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0234 | 0.1071 | 0.1071 |
| Echinococcus multilocularis | FTZ F1 alpha | 0.0443 | 1 | 1 |
| Brugia malayi | nuclear hormone receptor | 0.0443 | 1 | 1 |
| Schistosoma mansoni | RAR-like nuclear receptor | 0.0443 | 1 | 1 |
| Brugia malayi | nuclear receptor RXR | 0.0234 | 0.1071 | 0.1071 |
| Schistosoma mansoni | Tr4/Tr2 (homologue) | 0.0443 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0234 | 0.1071 | 0.1071 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0443 | 1 | 1 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0443 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-41 | 0.0443 | 1 | 1 |
| Echinococcus multilocularis | ecdysone induced protein 78C | 0.0443 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-31 | 0.0443 | 1 | 1 |
| Schistosoma mansoni | retinoic acid receptor RXR | 0.0443 | 1 | 1 |
| Schistosoma mansoni | FTZ-F1 nuclear receptor-like protein | 0.0443 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0234 | 0.1071 | 0.1071 |
| Loa Loa (eye worm) | hypothetical protein | 0.0234 | 0.1071 | 0.1071 |
| Brugia malayi | hypothetical protein | 0.0234 | 0.1071 | 0.1071 |
| Brugia malayi | steroid hormone receptor | 0.0443 | 1 | 1 |
| Schistosoma mansoni | nuclear receptor 2DBD-gamma | 0.0443 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0234 | 0.1071 | 0.1071 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0443 | 1 | 1 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0443 | 1 | 1 |
| Schistosoma mansoni | steroid hormone receptor ad4bp | 0.0443 | 1 | 1 |
| Loa Loa (eye worm) | nuclear Hormone Receptor family member | 0.0443 | 1 | 1 |
| Loa Loa (eye worm) | steroid hormone receptor | 0.0443 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-1 | 0.0443 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-40 | 0.0443 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-41 | 0.0443 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0443 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0234 | 0.1071 | 0.1071 |
| Loa Loa (eye worm) | hypothetical protein | 0.0443 | 1 | 1 |
| Onchocerca volvulus | Protein ultraspiracle homolog | 0.0443 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0234 | 0.1071 | 0.1071 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-31 | 0.0443 | 1 | 1 |
| Brugia malayi | photoreceptor-specific nuclear receptor | 0.0443 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0443 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-49 | 0.0443 | 1 | 1 |
| Echinococcus multilocularis | hepatocyte nuclear factor 4 alpha | 0.0443 | 1 | 1 |
| Schistosoma mansoni | coup transcription factor | 0.0443 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor-like 1 | 0.0234 | 0.1071 | 0.1071 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-1 | 0.0443 | 1 | 1 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0443 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Potency (functional) | 2.8184 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of binding or entry into cells for Lassa Virus. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID463114, AID540249] | ChEMBL. | No reference |
| Potency (functional) | 29.0929 uM | PubChem BioAssay. qHTS for induction of synthetic lethality in tumor cells producing 2HG: qHTS for the HT-1080-NT fibrosarcoma cell line. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 89.1251 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Polymerase Iota. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588623] | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Homo sapiens | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1880430
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.