Detailed information for compound 1569544
Basic information
Technical information
- Name: Unnamed compound
- MW: 358.514 | Formula: C23H34O3
-
H donors: 0
H acceptors: 1
LogP: 5.92
Rotable bonds: 11
Rule of 5 violations (Lipinski): 1 - SMILES: COC(C(C=CCC(=O)OCCCc1ccccc1)C)C1CCCCC1
- InChi: 1S/C23H34O3/c1-19(23(25-2)21-15-7-4-8-16-21)11-9-17-22(24)26-18-10-14-20-12-5-3-6-13-20/h3,5-6,9,11-13,19,21,23H,4,7-8,10,14-18H2,1-2H3
- InChiKey: WFDPQRQYLWKFNQ-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Schistosoma mansoni | tubulin subunit beta | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | tubulin alpha-1 chain, putative | 0.0069 | 0.3392 | 0.3392 |
| Trichomonas vaginalis | tubulin beta chain, putative | 0.0158 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0158 | 1 | 1 |
| Trypanosoma cruzi | alpha tubulin, putative | 0.0158 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | peroxisome assembly protein 26 | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | tubulin beta-4 chain | 0.0158 | 1 | 1 |
| Entamoeba histolytica | tubulin family protein | 0.0158 | 1 | 1 |
| Schistosoma mansoni | tubulin subunit alpha | 0.0158 | 1 | 1 |
| Plasmodium vivax | tubulin alpha chain, putative | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | tubulin beta chain, putative | 0.0158 | 1 | 1 |
| Plasmodium falciparum | tubulin beta chain | 0.0158 | 1 | 1 |
| Schistosoma mansoni | tubulin subunit alpha | 0.0158 | 1 | 1 |
| Trypanosoma brucei | alpha tubulin | 0.0158 | 1 | 1 |
| Echinococcus granulosus | Tubulin beta 2C chain | 0.0158 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0158 | 1 | 1 |
| Trypanosoma brucei | beta tubulin | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | beta tubulin | 0.0158 | 1 | 1 |
| Brugia malayi | beta-tubulin, identical | 0.0158 | 1 | 1 |
| Giardia lamblia | Beta tubulin | 0.0158 | 1 | 1 |
| Schistosoma mansoni | tubulin subunit beta | 0.0158 | 1 | 1 |
| Trypanosoma brucei | alpha tubulin, putative | 0.0089 | 0.493 | 0.493 |
| Leishmania major | beta tubulin | 0.0158 | 1 | 1 |
| Brugia malayi | Tubulin beta chain | 0.0089 | 0.493 | 0.493 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | tubulin alpha 1C chain | 0.0158 | 1 | 1 |
| Trypanosoma brucei | alpha tubulin | 0.0158 | 1 | 1 |
| Echinococcus granulosus | tubulin delta chain | 0.0069 | 0.3392 | 0.3392 |
| Trichomonas vaginalis | tubulin epsilon chain, putative | 0.0069 | 0.3392 | 0.3392 |
| Schistosoma mansoni | tubulin subunit beta | 0.0158 | 1 | 1 |
| Echinococcus granulosus | tubulin alpha chain | 0.0158 | 1 | 1 |
| Schistosoma mansoni | tubulin subunit alpha | 0.0069 | 0.3392 | 0.3392 |
| Toxoplasma gondii | beta tubulin | 0.0158 | 1 | 1 |
| Brugia malayi | tubulin alpha chain - mouse | 0.0158 | 1 | 1 |
| Giardia lamblia | Gamma tubulin | 0.0158 | 1 | 1 |
| Giardia lamblia | Alpha-tubulin | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | tubulin alpha chain, putative | 0.0089 | 0.493 | 0.493 |
| Entamoeba histolytica | tubulin alpha chain, putative | 0.0158 | 1 | 1 |
| Trypanosoma cruzi | epsilon tubulin, putative | 0.0158 | 1 | 1 |
| Echinococcus granulosus | peroxisome assembly protein 26 | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | tubulin gamma chain, putative | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | Tubulin alpha 1 chain | 0.0158 | 1 | 1 |
| Leishmania major | alpha tubulin | 0.0158 | 1 | 1 |
| Echinococcus granulosus | tubulin alpha 1C chain | 0.0158 | 1 | 1 |
| Leishmania major | alpha tubulin | 0.0158 | 1 | 1 |
| Leishmania major | delta tubulin, putative | 0.0069 | 0.3392 | 0.3392 |
| Trichomonas vaginalis | tubulin beta chain, putative | 0.0158 | 1 | 1 |
| Echinococcus granulosus | tubulin beta 1 chain | 0.0158 | 1 | 1 |
| Echinococcus granulosus | tubulin alpha chain | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | tubulin beta chain, putative | 0.0158 | 1 | 1 |
| Echinococcus granulosus | tubulin alpha 3 chain | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | alpha-tubulin | 0.0158 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0158 | 1 | 1 |
| Brugia malayi | Tubulin alpha-2 chain | 0.0158 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | tubulin subunit beta | 0.0158 | 1 | 1 |
| Plasmodium falciparum | tubulin epsilon chain, putative | 0.0158 | 1 | 1 |
| Giardia lamblia | Beta tubulin | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | tubulin beta chain, putative | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | tubulin alpha chain, putative | 0.0158 | 1 | 1 |
| Trypanosoma brucei | epsilon tubulin | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | tubulin gamma 1 chain | 0.0158 | 1 | 1 |
| Leishmania major | alpha tubulin | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | tubulin alpha 2 | 0.0089 | 0.493 | 0.493 |
| Trichomonas vaginalis | tubulin gamma chain, putative | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | Tubulin beta 2C chain | 0.0158 | 1 | 1 |
| Trypanosoma brucei | beta tubulin | 0.0158 | 1 | 1 |
| Echinococcus granulosus | tubulin alpha chain | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | tubulin alpha | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0069 | 0.3392 | 0.3392 |
| Toxoplasma gondii | tubulin/FtsZ family, GTPase domain-containing protein | 0.0158 | 1 | 1 |
| Giardia lamblia | Epsilon tubulin | 0.0069 | 0.3392 | 0.3392 |
| Trichomonas vaginalis | tubulin, putative | 0.0158 | 1 | 1 |
| Mycobacterium tuberculosis | Cell division protein FtsZ | 0.0069 | 0.3392 | 1 |
| Brugia malayi | Cell division protein ftsZ | 0.0069 | 0.3392 | 0.3392 |
| Toxoplasma gondii | alpha tubulin TUBA1 | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | tubulin alpha chain | 0.0158 | 1 | 1 |
| Schistosoma mansoni | tubulin subunit gamma | 0.0158 | 1 | 1 |
| Brugia malayi | Tubulin alpha chain | 0.0069 | 0.3392 | 0.3392 |
| Schistosoma mansoni | tubulin subunit beta | 0.0069 | 0.3392 | 0.3392 |
| Schistosoma mansoni | tubulin subunit beta | 0.0158 | 1 | 1 |
| Echinococcus granulosus | tubulin alpha chain | 0.0158 | 1 | 1 |
| Trypanosoma cruzi | tubulin gamma chain | 0.0158 | 1 | 1 |
| Leishmania major | alpha tubulin | 0.0158 | 1 | 1 |
| Plasmodium vivax | tubulin alpha chain, putative | 0.0158 | 1 | 1 |
| Brugia malayi | Tubulin alpha chain | 0.0158 | 1 | 1 |
| Schistosoma mansoni | tubulin subunit beta | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | tubulin epsilon chain, putative | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | hypothetical protein | 0.0158 | 1 | 1 |
| Leishmania major | alpha tubulin | 0.0158 | 1 | 1 |
| Brugia malayi | Tubulin beta-1 chain | 0.0158 | 1 | 1 |
| Echinococcus granulosus | tubulin gamma 1 chain | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | Tubulin beta 2C chain | 0.0158 | 1 | 1 |
| Echinococcus granulosus | tubulin alpha | 0.0158 | 1 | 1 |
| Trypanosoma cruzi | epsilon tubulin, putative | 0.0158 | 1 | 1 |
| Trypanosoma brucei | zeta tubulin | 0.0069 | 0.3392 | 0.3392 |
| Trypanosoma brucei | alpha tubulin | 0.0158 | 1 | 1 |
| Toxoplasma gondii | beta-tubulin, putative | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | tubulin beta-1 chain | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | tubulin delta chain | 0.0069 | 0.3392 | 0.3392 |
| Echinococcus multilocularis | tubulin, beta 4A class IVa | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | tubulin alpha-1 chain, putative | 0.0089 | 0.493 | 0.493 |
| Echinococcus multilocularis | Tubulin beta 2C chain | 0.0158 | 1 | 1 |
| Giardia lamblia | Delta tubulin | 0.0069 | 0.3392 | 0.3392 |
| Loa Loa (eye worm) | hypothetical protein | 0.0069 | 0.3392 | 0.3392 |
| Leishmania major | alpha tubulin | 0.0158 | 1 | 1 |
| Wolbachia endosymbiont of Brugia malayi | cell division protein FtsZ | 0.0069 | 0.3392 | 1 |
| Leishmania major | alpha tubulin | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | Tubulin beta 2C chain | 0.0158 | 1 | 1 |
| Entamoeba histolytica | tubulin family protein | 0.0158 | 1 | 1 |
| Echinococcus granulosus | tubulin beta 4A class IVa | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | tubulin alpha chain, putative | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | tubulin beta chain, putative | 0.0089 | 0.493 | 0.493 |
| Leishmania major | beta tubulin | 0.0158 | 1 | 1 |
| Toxoplasma gondii | alpha-tubulin I, putative | 0.0158 | 1 | 1 |
| Echinococcus granulosus | Tubulin alpha 1 chain | 0.0158 | 1 | 1 |
| Leishmania major | gamma-tubulin | 0.0158 | 1 | 1 |
| Trypanosoma cruzi | tubulin delta chain | 0.0069 | 0.3392 | 0.3392 |
| Echinococcus granulosus | tubulin alpha 1C chain | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | tubulin gamma chain, putative | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | tubulin beta 1 chain | 0.0158 | 1 | 1 |
| Brugia malayi | alpha-tubulin | 0.0158 | 1 | 1 |
| Schistosoma mansoni | alpha tubulin | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | BEN-1 protein | 0.0158 | 1 | 1 |
| Echinococcus granulosus | Tubulin alpha 1 chain | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | tubulin alpha 1C chain | 0.0158 | 1 | 1 |
| Schistosoma mansoni | tubulin subunit beta | 0.0158 | 1 | 1 |
| Trypanosoma cruzi | zeta tubulin, putative | 0.0069 | 0.3392 | 0.3392 |
| Schistosoma mansoni | alpha tubulin | 0.0158 | 1 | 1 |
| Entamoeba histolytica | tubulin gamma chain | 0.0158 | 1 | 1 |
| Trypanosoma cruzi | beta tubulin, putative | 0.0158 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | tubulin subunit TubB | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | tubulin beta chain, putative | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | tubulin alpha chain | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | tubulin alpha chain | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | tubulin alpha chain | 0.0158 | 1 | 1 |
| Trypanosoma cruzi | tubulin delta chain | 0.0069 | 0.3392 | 0.3392 |
| Trichomonas vaginalis | tubulin, putative | 0.0089 | 0.493 | 0.493 |
| Trichomonas vaginalis | tubulin alpha chain, putative | 0.0089 | 0.493 | 0.493 |
| Echinococcus multilocularis | tubulin epsilon chain | 0.0158 | 1 | 1 |
| Giardia lamblia | Beta tubulin | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | tubulin alpha chain | 0.0158 | 1 | 1 |
| Leishmania major | zeta tubulin, putative | 0.0069 | 0.3392 | 0.3392 |
| Echinococcus multilocularis | beta tubulin | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | tubulin alpha 3 chain | 0.0158 | 1 | 1 |
| Leishmania major | alpha tubulin | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | tubulin beta chain | 0.0158 | 1 | 1 |
| Brugia malayi | Tubulin gamma chain | 0.0158 | 1 | 1 |
| Echinococcus granulosus | alpha tubulin | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | Tubulin alpha 1 chain | 0.0158 | 1 | 1 |
| Trypanosoma brucei | alpha tubulin | 0.0158 | 1 | 1 |
| Echinococcus granulosus | tubulin epsilon chain | 0.0158 | 1 | 1 |
| Toxoplasma gondii | beta-1 tubulin, putative | 0.0158 | 1 | 1 |
| Trypanosoma cruzi | zeta tubulin, putative | 0.0069 | 0.3392 | 0.3392 |
| Toxoplasma gondii | tubulin/FtsZ family, GTPase domain-containing protein | 0.0069 | 0.3392 | 0.3392 |
| Leishmania major | epsilon tubulin, putative | 0.0158 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | tubulin alpha-1 chain, putative | 0.0089 | 0.493 | 0.493 |
| Trypanosoma brucei | epsilon tubulin | 0.0158 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0158 | 1 | 1 |
| Echinococcus granulosus | Tubulin beta 2C chain | 0.0158 | 1 | 1 |
| Brugia malayi | Tubulin beta chain | 0.0069 | 0.3392 | 0.3392 |
| Loa Loa (eye worm) | tubulin beta chain | 0.0069 | 0.3392 | 0.3392 |
| Plasmodium falciparum | tubulin gamma chain | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | alpha-tubulin isotype 2 | 0.0089 | 0.493 | 0.493 |
| Echinococcus granulosus | beta tubulin | 0.0158 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | Tubulin beta 2C chain | 0.0158 | 1 | 1 |
| Onchocerca volvulus | 0.0089 | 0.493 | 0.5 | |
| Leishmania major | alpha tubulin | 0.0158 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | tubulin alpha 3 chain | 0.0158 | 1 | 1 |
| Trypanosoma brucei | beta tubulin | 0.0158 | 1 | 1 |
| Plasmodium vivax | tubulin beta chain, putative | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | tubulin, putative | 0.0089 | 0.493 | 0.493 |
| Trichomonas vaginalis | tubulin alpha-1 chain, putative | 0.0158 | 1 | 1 |
| Plasmodium falciparum | alpha tubulin 1 | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | tubulin alpha-2 chain | 0.0158 | 1 | 1 |
| Trypanosoma brucei | beta tubulin | 0.0158 | 1 | 1 |
| Echinococcus granulosus | beta tubulin | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | tubulin epsilon chain, putative | 0.0158 | 1 | 1 |
| Echinococcus granulosus | tubulin alpha 3 chain | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | tubulin beta-2A chain | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | tubulin gamma chain, putative | 0.0069 | 0.3392 | 0.3392 |
| Loa Loa (eye worm) | BEN-1 protein | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | tubulin alpha chain | 0.0158 | 1 | 1 |
| Schistosoma mansoni | tubulin subunit delta | 0.0069 | 0.3392 | 0.3392 |
| Leishmania major | alpha tubulin | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0089 | 0.493 | 0.493 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0069 | 0.3392 | 0.3392 |
| Schistosoma mansoni | tubulin subunit epsilon | 0.0158 | 1 | 1 |
| Toxoplasma gondii | tubulin/FtsZ family, GTPase domain-containing protein | 0.0069 | 0.3392 | 0.3392 |
| Schistosoma mansoni | alpha tubulin | 0.0158 | 1 | 1 |
| Schistosoma mansoni | tubulin subunit alpha | 0.0158 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | tubulin beta-1 chain, putative | 0.0069 | 0.3392 | 0.3392 |
| Loa Loa (eye worm) | tubulin gamma chain | 0.0158 | 1 | 1 |
| Plasmodium falciparum | alpha tubulin 2 | 0.0158 | 1 | 1 |
| Echinococcus granulosus | tubulin subunit beta | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | tubulin epsilon chain, putative | 0.0158 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0158 | 1 | 1 |
| Trypanosoma brucei | beta tubulin | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | tubulin alpha chain | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | tubulin alpha 2 | 0.0089 | 0.493 | 0.493 |
| Mycobacterium leprae | cell division protein FtsZ | 0.0069 | 0.3392 | 0.5 |
| Loa Loa (eye worm) | alpha-tubulin | 0.0158 | 1 | 1 |
| Entamoeba histolytica | tubulin alpha-1 chain | 0.0158 | 1 | 1 |
| Echinococcus granulosus | Tubulin beta 2C chain | 0.0158 | 1 | 1 |
| Mycobacterium ulcerans | cell division protein FtsZ | 0.0069 | 0.3392 | 1 |
| Plasmodium vivax | tubulin epsilon chain, putative | 0.0158 | 1 | 1 |
| Echinococcus granulosus | Tubulin beta 2C chain | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | Tubulin alpha 1 chain | 0.0158 | 1 | 1 |
| Echinococcus granulosus | tubulin alpha chain | 0.0158 | 1 | 1 |
| Giardia lamblia | Alpha-tubulin | 0.0158 | 1 | 1 |
| Plasmodium falciparum | tubulin delta chain, putative | 0.0069 | 0.3392 | 0.3392 |
| Echinococcus granulosus | Tubulin alpha 1 chain | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | tubulin epsilon chain, putative | 0.0158 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0158 | 1 | 1 |
| Trypanosoma brucei | tubulin gamma chain | 0.0158 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | tubulin beta chain, putative | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | beta-tubulin | 0.0158 | 1 | 1 |
| Leishmania major | alpha tubulin | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | tubulin, putative | 0.0069 | 0.3392 | 0.3392 |
| Echinococcus granulosus | tubulin subunit TubB | 0.0158 | 1 | 1 |
| Trypanosoma brucei | tubulin delta chain | 0.0069 | 0.3392 | 0.3392 |
| Trypanosoma brucei | epsilon tubulin | 0.0158 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0158 | 1 | 1 |
| Trypanosoma brucei | zeta tubulin, putative | 0.0069 | 0.3392 | 0.3392 |
| Echinococcus granulosus | Tubulin beta 2C chain | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | tubulin alpha chain, putative | 0.0089 | 0.493 | 0.493 |
| Treponema pallidum | cell division protein FtsZ | 0.0069 | 0.3392 | 1 |
| Brugia malayi | Tubulin alpha-2 chain | 0.0158 | 1 | 1 |
| Plasmodium vivax | tubulin gamma chain, putative | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | tubulin alpha-3 chain | 0.0069 | 0.3392 | 0.3392 |
| Leishmania major | beta tubulin | 0.0158 | 1 | 1 |
| Leishmania major | alpha tubulin | 0.0158 | 1 | 1 |
| Plasmodium vivax | delta tubulin, putative | 0.0069 | 0.3392 | 0.3392 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Potency (functional) | 0.3759 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of binding or entry into cells for Lassa Virus. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID463114, AID540249] | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Homo sapiens | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1895068
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.