Detailed information for compound 1612684
Basic information
Technical information
- Name: Unnamed compound
- MW: 526.672 | Formula: C31H38N6O2
-
H donors: 3
H acceptors: 3
LogP: 5.79
Rotable bonds: 13
Rule of 5 violations (Lipinski): 2 - SMILES: CCN(CCNC(=O)c1cccc(c1)n1nc(cc1NC(=O)Nc1cccc2c1cccc2)C(C)(C)C)CC
- InChi: 1S/C31H38N6O2/c1-6-36(7-2)19-18-32-29(38)23-14-10-15-24(20-23)37-28(21-27(35-37)31(3,4)5)34-30(39)33-26-17-11-13-22-12-8-9-16-25(22)26/h8-17,20-21H,6-7,18-19H2,1-5H3,(H,32,38)(H2,33,34,39)
- InChiKey: NOBMKUVHFRVBES-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | mitogen-activated protein kinase kinase kinase kinase 2 | Starlite/ChEMBL | No references |
| Homo sapiens | colony stimulating factor 1 receptor | Starlite/ChEMBL | No references |
| Homo sapiens | neurotrophic tyrosine kinase, receptor, type 1 | Starlite/ChEMBL | No references |
| Homo sapiens | dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 1A | Starlite/ChEMBL | No references |
| Homo sapiens | G protein-coupled receptor kinase 5 | Starlite/ChEMBL | No references |
| Homo sapiens | mitogen-activated protein kinase kinase 1 | Starlite/ChEMBL | No references |
| Homo sapiens | Bruton agammaglobulinemia tyrosine kinase | Starlite/ChEMBL | No references |
| Homo sapiens | mitogen-activated protein kinase kinase kinase kinase 4 | Starlite/ChEMBL | No references |
| Homo sapiens | inhibitor of kappa light polypeptide gene enhancer in B-cells, kinase epsilon | Starlite/ChEMBL | No references |
| Homo sapiens | FYN proto-oncogene, Src family tyrosine kinase | Starlite/ChEMBL | No references |
| Homo sapiens | protein tyrosine kinase 2 | Starlite/ChEMBL | No references |
| Homo sapiens | mitogen-activated protein kinase 8 | Starlite/ChEMBL | No references |
| Homo sapiens | cyclin-dependent kinase 9 | Starlite/ChEMBL | No references |
| Homo sapiens | activin A receptor, type I | Starlite/ChEMBL | No references |
| Homo sapiens | ABL proto-oncogene 1, non-receptor tyrosine kinase | Starlite/ChEMBL | No references |
| Homo sapiens | casein kinase 1, alpha 1 | Starlite/ChEMBL | No references |
| Homo sapiens | ribosomal protein S6 kinase, 90kDa, polypeptide 3 | Starlite/ChEMBL | No references |
| Homo sapiens | insulin-like growth factor 1 receptor | Starlite/ChEMBL | No references |
| Homo sapiens | leukocyte receptor tyrosine kinase | Starlite/ChEMBL | No references |
| Homo sapiens | Janus kinase 2 | Starlite/ChEMBL | No references |
| Homo sapiens | calcium/calmodulin-dependent protein kinase II alpha | Starlite/ChEMBL | No references |
| Homo sapiens | fms-related tyrosine kinase 1 | Starlite/ChEMBL | No references |
| Homo sapiens | p21 protein (Cdc42/Rac)-activated kinase 4 | Starlite/ChEMBL | No references |
| Homo sapiens | death-associated protein kinase 3 | Starlite/ChEMBL | No references |
| Homo sapiens | neurotrophic tyrosine kinase, receptor, type 2 | Starlite/ChEMBL | No references |
| Homo sapiens | mitogen-activated protein kinase 14 | Starlite/ChEMBL | No references |
| Homo sapiens | aurora kinase A | Starlite/ChEMBL | No references |
| Homo sapiens | protein kinase, X-linked | Starlite/ChEMBL | No references |
| Homo sapiens | protein kinase C, theta | Starlite/ChEMBL | No references |
| Homo sapiens | MET proto-oncogene, receptor tyrosine kinase | Starlite/ChEMBL | No references |
| Homo sapiens | cyclin-dependent kinase 7 | Starlite/ChEMBL | No references |
| Homo sapiens | ret proto-oncogene | Starlite/ChEMBL | No references |
| Homo sapiens | Pim-1 proto-oncogene, serine/threonine kinase | Starlite/ChEMBL | No references |
| Homo sapiens | anaplastic lymphoma receptor tyrosine kinase | Starlite/ChEMBL | No references |
| Homo sapiens | dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 1B | Starlite/ChEMBL | No references |
| Homo sapiens | calcium/calmodulin-dependent protein kinase ID | Starlite/ChEMBL | No references |
| Homo sapiens | TYRO3 protein tyrosine kinase | Starlite/ChEMBL | No references |
| Homo sapiens | fms-related tyrosine kinase 3 | Starlite/ChEMBL | No references |
| Homo sapiens | fibroblast growth factor receptor 1 | Starlite/ChEMBL | No references |
| Homo sapiens | CDC-like kinase 2 | Starlite/ChEMBL | No references |
| Homo sapiens | cyclin-dependent kinase 8 | Starlite/ChEMBL | No references |
| Homo sapiens | TANK-binding kinase 1 | Starlite/ChEMBL | No references |
| Homo sapiens | Janus kinase 3 | Starlite/ChEMBL | No references |
| Homo sapiens | protein kinase, cAMP-dependent, catalytic, alpha | Starlite/ChEMBL | No references |
| Homo sapiens | neurotrophic tyrosine kinase, receptor, type 3 | Starlite/ChEMBL | No references |
| Homo sapiens | platelet-derived growth factor receptor, alpha polypeptide | Starlite/ChEMBL | No references |
| Homo sapiens | platelet-derived growth factor receptor, beta polypeptide | Starlite/ChEMBL | No references |
| Homo sapiens | LCK proto-oncogene, Src family tyrosine kinase | Starlite/ChEMBL | No references |
| Homo sapiens | glycogen synthase kinase 3 beta | Starlite/ChEMBL | No references |
| Homo sapiens | tyrosine kinase, non-receptor, 2 | Starlite/ChEMBL | No references |
| Homo sapiens | protein kinase D3 | Starlite/ChEMBL | No references |
| Homo sapiens | kinase insert domain receptor | Starlite/ChEMBL | No references |
| Homo sapiens | mitogen-activated protein kinase kinase 2 | Starlite/ChEMBL | No references |
| Homo sapiens | glycogen synthase kinase 3 alpha | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Trypanosoma brucei | mitogen-activated protein kinase 5 | calcium/calmodulin-dependent protein kinase ID | 357 aa | 361 aa | 23.6 % |
| Brugia malayi | Peroxidasin | neurotrophic tyrosine kinase, receptor, type 2 | 477 aa | 385 aa | 22.6 % |
| Brugia malayi | Peroxidasin | neurotrophic tyrosine kinase, receptor, type 3 | 612 aa | 491 aa | 21.4 % |
| Trypanosoma brucei | mitogen-activated protein kinase 5 | cyclin-dependent kinase 7 | 346 aa | 311 aa | 32.5 % |
| Trypanosoma brucei | mitogen-activated protein kinase 5 | cyclin-dependent kinase 9 | 372 aa | 313 aa | 31.6 % |
| Brugia malayi | Protein kinase domain containing protein | casein kinase 1, alpha 1 | 365 aa | 307 aa | 24.4 % |
| Trypanosoma brucei | mitogen-activated protein kinase 5 | mitogen-activated protein kinase 14 | 360 aa | 336 aa | 33.3 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | CAMK/PIM protein kinase | 0.0206 | 0.0246 | 0.1491 |
| Brugia malayi | cyclin-dependent kinase 7 homolog | 0.0117 | 0.011 | 0.0658 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0085 | 0.0061 | 0.2021 |
| Plasmodium falciparum | glycogen synthase kinase 3 | 0.013 | 0.0129 | 0.0106 |
| Leishmania major | cathepsin L-like protease | 0.0161 | 0.0177 | 0.5954 |
| Trichomonas vaginalis | CMGC family protein kinase | 0.013 | 0.0129 | 0.0199 |
| Loa Loa (eye worm) | hypothetical protein | 0.005 | 0.0009 | 0.0045 |
| Echinococcus granulosus | 3'partial|tyrosine protein kinase Fgr | 0.0101 | 0.0086 | 0.1151 |
| Echinococcus granulosus | melanoma receptor tyrosine protein kinase | 0.0099 | 0.0083 | 0.1115 |
| Loa Loa (eye worm) | AGC/PKA protein kinase | 0.0111 | 0.0101 | 0.0604 |
| Giardia lamblia | Kinase, CMGC CLK | 0.0087 | 0.0065 | 0.0041 |
| Brugia malayi | Protein kinase domain containing protein | 0.0229 | 0.028 | 0.1699 |
| Brugia malayi | Tyrosine-protein kinase abl-1 | 0.0154 | 0.0166 | 0.1003 |
| Brugia malayi | hypothetical protein | 0.0074 | 0.0044 | 0.026 |
| Echinococcus granulosus | serine:threonine protein kinase mig 15 | 0.0133 | 0.0134 | 0.181 |
| Plasmodium falciparum | cysteine proteinase falcipain 1 | 0.0085 | 0.0061 | 0.0038 |
| Echinococcus multilocularis | casein kinase I delta | 0.006 | 0.0024 | 0.0155 |
| Echinococcus granulosus | titin | 0.0045 | 0.0002 | 0.0003 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0167 | 0.0186 | 0.0186 |
| Schistosoma mansoni | tyrosine kinase | 0.0101 | 0.0086 | 0.0086 |
| Echinococcus granulosus | tyrosine protein kinase ABL1 | 0.0299 | 0.0387 | 0.5259 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0229 | 0.028 | 1 |
| Echinococcus multilocularis | casein kinase I alpha | 0.006 | 0.0024 | 0.0155 |
| Echinococcus granulosus | proto oncogene serine:threonine protein kinase | 0.0206 | 0.0246 | 0.3336 |
| Loa Loa (eye worm) | hypothetical protein | 0.0052 | 0.0011 | 0.0058 |
| Echinococcus granulosus | dual specificity mitogen activated protein | 0.0193 | 0.0225 | 0.3052 |
| Brugia malayi | Stress-activated protein kinase jnk-1 | 0.0292 | 0.0376 | 0.2286 |
| Schistosoma mansoni | tyrosine kinase | 0.0071 | 0.004 | 0.004 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0161 | 0.0177 | 0.6216 |
| Echinococcus multilocularis | cyclin dependent kinase 19 | 0.0172 | 0.0194 | 0.1336 |
| Echinococcus granulosus | cathepsin b | 0.0167 | 0.0186 | 0.2511 |
| Echinococcus granulosus | ribosomal protein S6 kinase alpha 3 | 0.0145 | 0.0153 | 0.2064 |
| Echinococcus multilocularis | enhancer of mRNA decapping protein 4 | 0.0096 | 0.0079 | 0.0536 |
| Echinococcus multilocularis | tyrosine protein kinase HCK | 0.0064 | 0.003 | 0.0194 |
| Echinococcus multilocularis | Immunoglobulin | 0.0093 | 0.0074 | 0.05 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.0098 | 0.0587 |
| Trypanosoma cruzi | kinetoplastid kinetochore protein 10, putative | 0.0087 | 0.0065 | 0.2265 |
| Loa Loa (eye worm) | G protein-coupled receptor kinase 1 | 0.0153 | 0.0166 | 0.1 |
| Echinococcus multilocularis | epidermal growth factor receptor | 0.0099 | 0.0083 | 0.0568 |
| Plasmodium vivax | vivapain-1 | 0.0085 | 0.0061 | 0.005 |
| Echinococcus multilocularis | receptor type tyrosine protein phosphatase | 0.0047 | 0.0005 | 0.0022 |
| Echinococcus multilocularis | cysteine protease | 0.0161 | 0.0177 | 0.1215 |
| Leishmania major | cysteine peptidase A (CPA) | 0.0161 | 0.0177 | 0.5954 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0111 | 0.0101 | 0.0101 |
| Echinococcus granulosus | Serine/threonine-protein kinase Genghis Khan | 0.0093 | 0.0075 | 0.0996 |
| Echinococcus granulosus | protein kinase | 0.0087 | 0.0065 | 0.0858 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Entamoeba histolytica | cysteine protease, putative | 0.0085 | 0.0061 | 0.2021 |
| Loa Loa (eye worm) | hypothetical protein | 0.0047 | 0.0005 | 0.0018 |
| Schistosoma mansoni | nephrin | 0.0124 | 0.012 | 0.012 |
| Loa Loa (eye worm) | CAMK/PKD protein kinase | 0.0106 | 0.0094 | 0.0564 |
| Echinococcus multilocularis | tyrosine protein kinase Src42A | 0.0059 | 0.0022 | 0.0144 |
| Brugia malayi | cyclin-dependent kinase 9 | 0.0069 | 0.0037 | 0.0216 |
| Leishmania major | cathepsin L-like protease | 0.0161 | 0.0177 | 0.5954 |
| Trypanosoma cruzi | cAMP-dependent protein kinase catalytic subunit 2 | 0.0111 | 0.0101 | 0.3556 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0161 | 0.0177 | 0.6216 |
| Loa Loa (eye worm) | hypothetical protein | 0.0093 | 0.0074 | 0.0437 |
| Trypanosoma brucei | calcium/calmodulin-dependent protein kinase, putative | 0.006 | 0.0024 | 0.0647 |
| Echinococcus granulosus | tyrosine protein kinase Lyn | 0.0115 | 0.0108 | 0.1452 |
| Echinococcus multilocularis | c src tyrosine kinase | 0.0066 | 0.0033 | 0.0215 |
| Brugia malayi | hypothetical protein | 0.005 | 0.0009 | 0.0045 |
| Echinococcus granulosus | tyrosine kinase | 0.0086 | 0.0063 | 0.0833 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0161 | 0.0177 | 0.0177 |
| Echinococcus multilocularis | receptor type tyrosine protein phosphatase F | 0.0047 | 0.0005 | 0.0022 |
| Echinococcus multilocularis | tyrosine protein kinase Fps85D | 0.005 | 0.0009 | 0.0053 |
| Echinococcus multilocularis | tyrosine protein kinase Abl | 0.0161 | 0.0177 | 0.1219 |
| Schistosoma mansoni | Neurotrimin precursor (hNT) | 0.0093 | 0.0074 | 0.0074 |
| Schistosoma mansoni | tyrosine kinase | 0.0332 | 0.0437 | 0.0437 |
| Schistosoma mansoni | kinase | 0.0069 | 0.0037 | 0.0037 |
| Toxoplasma gondii | protein kinase, cAMP-dependent, catalytic chain | 0.0111 | 0.0101 | 0.0077 |
| Schistosoma mansoni | proto-oncogene tyrosine-protein kinase src | 0.0066 | 0.0033 | 0.0033 |
| Trypanosoma brucei | cysteine peptidase C (CPC) | 0.0074 | 0.0046 | 0.1447 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Echinococcus multilocularis | cAMP dependent protein kinase catalytic subunit | 0.0111 | 0.0101 | 0.069 |
| Loa Loa (eye worm) | TK/EGFR protein kinase | 0.0099 | 0.0083 | 0.0497 |
| Echinococcus multilocularis | roundabout 2 | 0.014 | 0.0145 | 0.0999 |
| Echinococcus granulosus | cyclin dependent kinase 19 | 0.0172 | 0.0194 | 0.2623 |
| Loa Loa (eye worm) | cysteine protease | 0.0161 | 0.0177 | 0.1066 |
| Loa Loa (eye worm) | hypothetical protein | 0.0097 | 0.008 | 0.0478 |
| Brugia malayi | cathepsin B-like cysteine proteinase | 0.0167 | 0.0186 | 0.1122 |
| Brugia malayi | casein kinase 1, delta | 0.006 | 0.0024 | 0.0135 |
| Brugia malayi | Cathepsin L-like precursor | 0.0052 | 0.0011 | 0.0058 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0093 | 0.0075 | 0.0075 |
| Trypanosoma brucei | protein kinase A catalytic subunit, putative | 0.0111 | 0.0101 | 0.3459 |
| Brugia malayi | Immunoglobulin I-set domain containing protein | 0.0047 | 0.0005 | 0.0018 |
| Trypanosoma cruzi | mitogen-activated protein kinase kinase 5 | 0.0193 | 0.0225 | 0.8025 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Brugia malayi | Protein kinase domain containing protein | 0.0336 | 0.0443 | 0.269 |
| Loa Loa (eye worm) | hypothetical protein | 0.0052 | 0.0011 | 0.0058 |
| Brugia malayi | hypothetical protein | 0.0061 | 0.0025 | 0.014 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0161 | 0.0177 | 0.0177 |
| Echinococcus granulosus | protein kinase c epsilon type | 0.0062 | 0.0027 | 0.0352 |
| Echinococcus multilocularis | glycogen synthase kinase 3 beta | 0.013 | 0.0129 | 0.0888 |
| Loa Loa (eye worm) | ctsf protein | 0.0161 | 0.0177 | 0.1066 |
| Trypanosoma brucei | kinetoplastid kinetochore protein 19 | 0.0087 | 0.0065 | 0.215 |
| Echinococcus granulosus | mitogen activated protein kinase kinase kinase | 0.0075 | 0.0047 | 0.0618 |
| Brugia malayi | SRC-1 | 0.0101 | 0.0086 | 0.0513 |
| Leishmania major | protein kinase A catalytic subunit | 0.0111 | 0.0101 | 0.3007 |
| Echinococcus multilocularis | tyrosine protein kinase Src64B | 0.0101 | 0.0086 | 0.0586 |
| Brugia malayi | Protein kinase domain containing protein | 0.0048 | 0.0006 | 0.0025 |
| Brugia malayi | cathepsin L-like precursor | 0.0109 | 0.0098 | 0.0587 |
| Trichomonas vaginalis | CK1 family protein kinase | 0.006 | 0.0024 | 0.0029 |
| Plasmodium vivax | calcium-dependent protein kinase 1, putative | 0.006 | 0.0024 | 0.0012 |
| Echinococcus multilocularis | tyrosine protein kinase lyn tyrosine protein kinase blk | 0.0101 | 0.0086 | 0.0586 |
| Trypanosoma brucei | casein kinase I, isoform 2 | 0.006 | 0.0024 | 0.0656 |
| Schistosoma mansoni | protein kinase | 0.0193 | 0.0226 | 0.0226 |
| Onchocerca volvulus | 0.005 | 0.0009 | 0.0045 | |
| Echinococcus multilocularis | casein kinase I delta | 0.006 | 0.0024 | 0.0155 |
| Echinococcus multilocularis | serine:threonine protein kinase MRCK beta | 0.0093 | 0.0075 | 0.0507 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0074 | 0.0046 | 0.0046 |
| Onchocerca volvulus | 0.0161 | 0.0177 | 0.1066 | |
| Echinococcus multilocularis | casein kinase I alpha | 0.006 | 0.0024 | 0.0155 |
| Plasmodium vivax | glycogen synthase kinase 3, putative | 0.013 | 0.0129 | 0.0118 |
| Onchocerca volvulus | 0.005 | 0.0009 | 0.0045 | |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0087 | 0.0065 | 0.0065 |
| Loa Loa (eye worm) | TKL/STKR/TYPE1 protein kinase | 0.0088 | 0.0067 | 0.0395 |
| Giardia lamblia | Kinase, AGC PKA | 0.0111 | 0.0101 | 0.0077 |
| Echinococcus granulosus | cathepsin l1 | 0.0109 | 0.0098 | 0.1315 |
| Loa Loa (eye worm) | hypothetical protein | 0.0167 | 0.0186 | 0.1122 |
| Echinococcus multilocularis | tyrosine protein kinase shark | 0.005 | 0.0009 | 0.0053 |
| Loa Loa (eye worm) | AGC/PKC/ETA protein kinase | 0.0062 | 0.0027 | 0.0156 |
| Giardia lamblia | Dipeptidyl-peptidase I precursor | 0.2538 | 0.3784 | 0.3769 |
| Echinococcus multilocularis | epidermal growth factor receptor | 0.0099 | 0.0083 | 0.0568 |
| Trichomonas vaginalis | AGC family protein kinase | 0.0082 | 0.0058 | 0.0083 |
| Echinococcus multilocularis | Immunoglobulin | 0.0093 | 0.0074 | 0.05 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0085 | 0.0061 | 0.2021 |
| Echinococcus granulosus | cyclin dependent kinase 9 | 0.0069 | 0.0037 | 0.0485 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.0052 | 0.0011 | 0.0058 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0161 | 0.0177 | 0.6216 |
| Echinococcus granulosus | tyrosine protein kinase Fyn | 0.0101 | 0.0086 | 0.1151 |
| Echinococcus multilocularis | neuroglian | 0.0119 | 0.0114 | 0.078 |
| Brugia malayi | Cathepsin L-like cysteine proteinase | 0.0109 | 0.0098 | 0.0587 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.006 | 0.0024 | 0.0301 |
| Brugia malayi | Protein kinase domain containing protein | 0.0115 | 0.0107 | 0.0641 |
| Echinococcus multilocularis | tyrosine protein kinase Fyn | 0.0101 | 0.0086 | 0.0586 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Loa Loa (eye worm) | fibroinase | 0.0161 | 0.0177 | 0.1066 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0047 | 0.0004 | 0.0004 |
| Toxoplasma gondii | AGC kinase | 0.0111 | 0.0101 | 0.0077 |
| Echinococcus granulosus | basic fibroblast growth factor receptor 1 A | 0.0148 | 0.0157 | 0.2116 |
| Brugia malayi | bone morphogenetic protein type 1 receptor | 0.0115 | 0.0107 | 0.0641 |
| Echinococcus multilocularis | mitogen activated protein kinase kinase kinase | 0.0075 | 0.0047 | 0.0315 |
| Echinococcus granulosus | tyrosine protein kinase Fps85D | 0.005 | 0.0009 | 0.0104 |
| Trypanosoma brucei | Vacuolar sorting protein 39 domain 1/Vacuolar sorting protein 39 domain 2, putative | 0.0061 | 0.0025 | 0.0688 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.0099 | 0.059 |
| Loa Loa (eye worm) | CMGC/MAPK/JNK protein kinase | 0.0292 | 0.0376 | 0.2286 |
| Brugia malayi | Protein kinase domain containing protein | 0.0646 | 0.0913 | 0.556 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0063 | 0.0028 | 0.0028 |
| Echinococcus multilocularis | G protein coupled receptor kinase 6 | 0.0153 | 0.0166 | 0.114 |
| Entamoeba histolytica | casein kinase, putative | 0.006 | 0.0024 | 0.0656 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0161 | 0.0177 | 0.6216 |
| Leishmania major | protein kinase, putative | 0.0087 | 0.0065 | 0.1607 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0062 | 0.0027 | 0.0027 |
| Echinococcus granulosus | mitogen activated protein kinase 11 | 0.0166 | 0.0185 | 0.25 |
| Echinococcus multilocularis | 0.0072 | 0.0043 | 0.0286 | |
| Trypanosoma brucei | aurora B kinase | 0.0082 | 0.0058 | 0.1879 |
| Schistosoma mansoni | rap gtpase-activating protein | 0.0061 | 0.0025 | 0.0025 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0161 | 0.0177 | 0.6216 |
| Loa Loa (eye worm) | hypothetical protein | 0.0185 | 0.0213 | 0.1291 |
| Echinococcus granulosus | activin receptor type | 0.0483 | 0.0666 | 0.9065 |
| Schistosoma mansoni | titin | 0.0045 | 0.0002 | 0.0002 |
| Echinococcus granulosus | roundabout 2 | 0.0047 | 0.0005 | 0.0043 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.005 | 0.0009 | 0.0045 |
| Brugia malayi | Calcium/calmodulin-dependent protein kinase type II alpha chain | 0.0133 | 0.0135 | 0.0814 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0161 | 0.0177 | 0.6271 |
| Echinococcus multilocularis | mitogen activated protein kinase 14 | 0.0166 | 0.0185 | 0.1273 |
| Toxoplasma gondii | cathepsin B | 0.0074 | 0.0046 | 0.0022 |
| Trypanosoma cruzi | kinetoplastid kinetochore protein 19, putative | 0.0087 | 0.0065 | 0.2265 |
| Echinococcus multilocularis | serine:threonine protein kinase PAK 4 | 0.0216 | 0.0261 | 0.18 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0087 | 0.0065 | 0.0065 |
| Brugia malayi | Protein kinase domain containing protein | 0.0206 | 0.0246 | 0.1491 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.006 | 0.0024 | 0.0154 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.005 | 0.0009 | 0.0045 |
| Onchocerca volvulus | Cathepsin F homolog | 0.0161 | 0.0177 | 0.1066 |
| Entamoeba histolytica | cysteine protease, putative | 0.0085 | 0.0061 | 0.2021 |
| Echinococcus granulosus | [G-protein-coupledreceptor] kinase | 0.0153 | 0.0166 | 0.2239 |
| Loa Loa (eye worm) | AGC/RSK/RSK protein kinase | 0.0145 | 0.0153 | 0.0922 |
| Brugia malayi | Protein kinase domain containing protein | 0.005 | 0.0009 | 0.0045 |
| Loa Loa (eye worm) | CK1/CK1/CK1-A protein kinase | 0.006 | 0.0024 | 0.0135 |
| Loa Loa (eye worm) | CMGC/CDK/CDK7 protein kinase | 0.0107 | 0.0095 | 0.057 |
| Loa Loa (eye worm) | hypothetical protein | 0.0214 | 0.0258 | 0.1564 |
| Plasmodium vivax | vivapain-2 | 0.0161 | 0.0177 | 0.0165 |
| Echinococcus granulosus | twitchin | 0.0134 | 0.0136 | 0.1832 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.006 | 0.0024 | 0.0154 |
| Trypanosoma brucei | kinetoplastid kinetochore protein 10 | 0.0087 | 0.0065 | 0.215 |
| Echinococcus granulosus | Protein kinase C brain isozyme | 0.0062 | 0.0027 | 0.0352 |
| Brugia malayi | P38 map kinase family protein 2 | 0.0166 | 0.0185 | 0.1117 |
| Onchocerca volvulus | 0.0161 | 0.0177 | 0.1066 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 0.0139 | 0.0836 |
| Leishmania major | serine/threonine-protein kinase, putative,protein kinase, putative | 0.0229 | 0.028 | 1 |
| Echinococcus multilocularis | 0.0087 | 0.0065 | 0.0437 | |
| Trichomonas vaginalis | AGC family protein kinase | 0.0111 | 0.0101 | 0.0153 |
| Echinococcus multilocularis | dual specificity | 0.0229 | 0.028 | 0.1937 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0082 | 0.0058 | 0.0058 |
| Loa Loa (eye worm) | CMGC/MAPK/P38 protein kinase | 0.0166 | 0.0185 | 0.1117 |
| Loa Loa (eye worm) | STE/STE20/MSN protein kinase | 0.0087 | 0.0065 | 0.0382 |
| Trypanosoma cruzi | casein kinase, putative | 0.006 | 0.0024 | 0.0794 |
| Schistosoma mansoni | tyrosine kinase | 0.0101 | 0.0086 | 0.0086 |
| Loa Loa (eye worm) | hypothetical protein | 0.006 | 0.0024 | 0.0133 |
| Plasmodium vivax | dipeptidyl aminopeptidase 2, putative | 0.6636 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0109 | 0.0098 | 0.0149 |
| Echinococcus multilocularis | cyclin dependent kinase 9 | 0.0078 | 0.0052 | 0.0347 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 0.0101 | 0.0604 |
| Schistosoma mansoni | protein kinase | 0.0193 | 0.0226 | 0.0226 |
| Leishmania major | cathepsin L-like protease | 0.0161 | 0.0177 | 0.5954 |
| Loa Loa (eye worm) | hypothetical protein | 0.0077 | 0.0049 | 0.029 |
| Entamoeba histolytica | protein kinase , putative | 0.0082 | 0.0058 | 0.1879 |
| Brugia malayi | Immunoglobulin I-set domain containing protein | 0.0097 | 0.008 | 0.0478 |
| Brugia malayi | serine/threonine-protein kinase 6 | 0.0082 | 0.0058 | 0.034 |
| Loa Loa (eye worm) | hypothetical protein | 0.0161 | 0.0177 | 0.1066 |
| Echinococcus multilocularis | protein kinase shaggy | 0.013 | 0.0129 | 0.0888 |
| Schistosoma mansoni | vam6/vps39 related | 0.0061 | 0.0025 | 0.0025 |
| Loa Loa (eye worm) | hypothetical protein | 0.0061 | 0.0025 | 0.014 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.005 | 0.0009 | 0.0045 |
| Trichomonas vaginalis | CMGC family protein kinase | 0.013 | 0.0129 | 0.0199 |
| Schistosoma mansoni | SmCL2-like peptidase (C01 family) | 0.0085 | 0.0061 | 0.0061 |
| Schistosoma mansoni | tyrosine kinase | 0.0212 | 0.0255 | 0.0255 |
| Entamoeba histolytica | cysteine protease, putative | 0.0161 | 0.0177 | 0.6216 |
| Echinococcus granulosus | cathepsin L cysteine proteinase | 0.0161 | 0.0177 | 0.2386 |
| Loa Loa (eye worm) | immunoglobulin I-set domain-containing protein | 0.0061 | 0.0025 | 0.0143 |
| Entamoeba histolytica | protein kinase, putative | 0.006 | 0.0024 | 0.0647 |
| Echinococcus multilocularis | tyrosine protein kinase transmembrane receptor | 0.0055 | 0.0016 | 0.0103 |
| Loa Loa (eye worm) | hypothetical protein | 0.0167 | 0.0186 | 0.1122 |
| Trypanosoma cruzi | cruzipain precursor, putative | 0.0052 | 0.0011 | 0.0341 |
| Schistosoma mansoni | vesicular amine transporter | 0.0093 | 0.0074 | 0.0074 |
| Echinococcus granulosus | aurora kinase A | 0.0082 | 0.0058 | 0.0763 |
| Brugia malayi | Protein kinase domain containing protein | 0.005 | 0.0009 | 0.0045 |
| Onchocerca volvulus | 0.0161 | 0.0177 | 0.1066 | |
| Brugia malayi | Protein kinase domain containing protein | 0.0228 | 0.0279 | 0.1689 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0085 | 0.0061 | 0.0363 |
| Schistosoma mansoni | tyrosine kinase | 0.0071 | 0.004 | 0.004 |
| Loa Loa (eye worm) | calcium/calmodulin-dependent protein kinase ID | 0.006 | 0.0024 | 0.0133 |
| Brugia malayi | Cam kinase protein 1 | 0.006 | 0.0024 | 0.0133 |
| Loa Loa (eye worm) | CMGC/CDK/CDK8 protein kinase | 0.0172 | 0.0194 | 0.1172 |
| Echinococcus granulosus | Vam6:Vps39 protein | 0.0061 | 0.0025 | 0.0317 |
| Brugia malayi | Protein kinase domain containing protein | 0.005 | 0.0009 | 0.0045 |
| Echinococcus multilocularis | titin | 0.0045 | 0.0002 | 0.0002 |
| Schistosoma mansoni | protein kinase C mu | 0.0106 | 0.0094 | 0.0094 |
| Trypanosoma brucei | CMGC/DYRK protein kinase, putative | 0.0229 | 0.028 | 1 |
| Trypanosoma cruzi | CMGC/DYRK protein kinase, putative | 0.0229 | 0.028 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Src42A | 0.0059 | 0.0022 | 0.0283 |
| Echinococcus granulosus | cathepsin l1 | 0.0161 | 0.0177 | 0.2386 |
| Loa Loa (eye worm) | TKL/STKR/TYPE1 protein kinase | 0.0115 | 0.0107 | 0.0641 |
| Entamoeba histolytica | cysteine protease, putative | 0.0085 | 0.0061 | 0.2021 |
| Loa Loa (eye worm) | hypothetical protein | 0.0061 | 0.0025 | 0.014 |
| Trypanosoma cruzi | mitogen-activated protein kinase 3, putative | 0.0166 | 0.0185 | 0.6572 |
| Echinococcus granulosus | tyrosine kinase | 0.005 | 0.0009 | 0.0104 |
| Trichomonas vaginalis | STE family protein kinase | 0.0193 | 0.0225 | 0.0354 |
| Loa Loa (eye worm) | hypothetical protein | 0.0133 | 0.0134 | 0.0808 |
| Loa Loa (eye worm) | TK/ABL protein kinase | 0.0299 | 0.0387 | 0.2351 |
| Toxoplasma gondii | cell-cycle-associated protein kinase GSK, putative | 0.013 | 0.0129 | 0.0106 |
| Echinococcus granulosus | dual specificity | 0.0229 | 0.028 | 0.3802 |
| Trypanosoma cruzi | cruzipain precursor, putative | 0.0161 | 0.0177 | 0.6271 |
| Schistosoma mansoni | protein kinase | 0.0115 | 0.0107 | 0.0107 |
| Schistosoma mansoni | mitogen-activated protein kinase kinase kinase 3 mapkkk3 mekk3 | 0.0061 | 0.0025 | 0.0025 |
| Echinococcus granulosus | receptor type tyrosine protein phosphatase | 0.0047 | 0.0005 | 0.0043 |
| Trypanosoma brucei | protein kinase, putative | 0.013 | 0.0129 | 0.4498 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Toxoplasma gondii | cathepsin CPC1 | 0.6636 | 1 | 1 |
| Echinococcus multilocularis | protein tyrosine kinase | 0.0332 | 0.0437 | 0.3027 |
| Loa Loa (eye worm) | hypothetical protein | 0.0228 | 0.0279 | 0.1689 |
| Echinococcus granulosus | defective proboscis extension response | 0.0093 | 0.0074 | 0.0981 |
| Schistosoma mansoni | protein kinase | 0.0193 | 0.0226 | 0.0226 |
| Trichomonas vaginalis | AGC family protein kinase | 0.0082 | 0.0058 | 0.0083 |
| Entamoeba histolytica | cysteine protease, putative | 0.0085 | 0.0061 | 0.2021 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0085 | 0.0061 | 0.2139 |
| Echinococcus granulosus | tyrosine kinase|tyrosine protein kinase Fyn | 0.0086 | 0.0063 | 0.0833 |
| Loa Loa (eye worm) | hypothetical protein | 0.0074 | 0.0044 | 0.026 |
| Loa Loa (eye worm) | hypothetical protein | 0.0074 | 0.0044 | 0.026 |
| Toxoplasma gondii | cathepsin CPL | 0.0161 | 0.0177 | 0.0153 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.0098 | 0.0587 |
| Echinococcus multilocularis | cAMP dependent protein kinase catalytic subunit | 0.0111 | 0.0101 | 0.069 |
| Schistosoma mansoni | mitogen-activated protein kinase kinase kinase 3 mapkkk3 mekk3 | 0.0061 | 0.0025 | 0.0025 |
| Brugia malayi | Furin-like cysteine rich region family protein | 0.0099 | 0.0083 | 0.0497 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0193 | 0.0226 | 0.1559 |
| Echinococcus multilocularis | tyrosine protein kinase Blk | 0.0086 | 0.0063 | 0.0424 |
| Echinococcus granulosus | TGF beta receptor type 1 | 0.0101 | 0.0086 | 0.1148 |
| Trichomonas vaginalis | STE family protein kinase | 0.0193 | 0.0225 | 0.0354 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0161 | 0.0177 | 0.6216 |
| Onchocerca volvulus | 0.005 | 0.0009 | 0.0045 | |
| Brugia malayi | protein-tyrosine kinase | 0.0086 | 0.0063 | 0.0371 |
| Trypanosoma cruzi | kinetoplastid kinetochore protein 19, putative | 0.0087 | 0.0065 | 0.2265 |
| Echinococcus multilocularis | tyrosine protein kinase Fyn | 0.0086 | 0.0063 | 0.0424 |
| Schistosoma mansoni | tyrosine kinase | 0.0099 | 0.0083 | 0.0083 |
| Leishmania major | protein kinase A catalytic subunit isoform 2 | 0.0111 | 0.0101 | 0.3007 |
| Trypanosoma cruzi | cysteine peptidase (N-terminal), putative | 0.0085 | 0.0061 | 0.2139 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.0161 | 0.0177 | 0.1215 |
| Echinococcus granulosus | contactin | 0.0047 | 0.0005 | 0.0043 |
| Echinococcus granulosus | protein kinase c iota type | 0.0062 | 0.0027 | 0.0352 |
| Entamoeba histolytica | cysteine protease, putative | 0.0085 | 0.0061 | 0.2021 |
| Brugia malayi | Immunoglobulin I-set domain containing protein | 0.0047 | 0.0005 | 0.0018 |
| Echinococcus granulosus | tyrosine protein kinase Btk29A | 0.0226 | 0.0276 | 0.3737 |
| Plasmodium vivax | dipeptidyl aminopeptidase 3, putative | 0.2538 | 0.3784 | 0.3777 |
| Loa Loa (eye worm) | hypothetical protein | 0.0093 | 0.0074 | 0.0441 |
| Trypanosoma cruzi | cAMP-dependent protein kinase catalytic subunit 1 | 0.0111 | 0.0101 | 0.3556 |
| Echinococcus granulosus | insulin growth factor 1 receptor beta | 0.019 | 0.0221 | 0.2989 |
| Brugia malayi | probable protein kinase | 0.0147 | 0.0156 | 0.0943 |
| Onchocerca volvulus | 0.0167 | 0.0186 | 0.1122 | |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0085 | 0.0061 | 0.2021 |
| Echinococcus granulosus | roundabout 2 | 0.0047 | 0.0005 | 0.0043 |
| Echinococcus multilocularis | protein kinase c epsilon type | 0.0062 | 0.0027 | 0.0179 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Plasmodium falciparum | cysteine proteinase falcipain 2b | 0.0161 | 0.0177 | 0.0153 |
| Echinococcus multilocularis | fibroblast growth factor receptor 4 | 0.0148 | 0.0157 | 0.1078 |
| Entamoeba histolytica | cysteine protease, putative | 0.0085 | 0.0061 | 0.2021 |
| Echinococcus multilocularis | mitogen activated protein kinase 14 | 0.0166 | 0.0185 | 0.1273 |
| Echinococcus multilocularis | casein kinase i | 0.006 | 0.0024 | 0.0155 |
| Schistosoma mansoni | tyrosine kinase | 0.005 | 0.0009 | 0.0009 |
| Plasmodium vivax | serine/threonine protein kinase 6, putative | 0.0082 | 0.0058 | 0.0046 |
| Echinococcus multilocularis | cathepsin b | 0.0167 | 0.0186 | 0.1279 |
| Loa Loa (eye worm) | Papain cysteine protease/cathepsin propeptide inhibitor-containing protein | 0.0161 | 0.0177 | 0.1066 |
| Schistosoma mansoni | protein kinase | 0.0101 | 0.0086 | 0.0086 |
| Schistosoma mansoni | SmCB2 peptidase (C01 family) | 0.0167 | 0.0186 | 0.0186 |
| Trypanosoma cruzi | CMGC/DYRK protein kinase, putative | 0.0229 | 0.028 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0064 | 0.003 | 0.086 |
| Brugia malayi | Cathepsin L-like precursor | 0.0161 | 0.0177 | 0.1066 |
| Onchocerca volvulus | 0.0161 | 0.0177 | 0.1066 | |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0161 | 0.0177 | 0.6216 |
| Brugia malayi | protein kinase C II. | 0.0062 | 0.0027 | 0.0156 |
| Trypanosoma cruzi | cysteine peptidase C (CPC), putative | 0.0074 | 0.0046 | 0.1573 |
| Loa Loa (eye worm) | hypothetical protein | 0.0061 | 0.0025 | 0.014 |
| Schistosoma mansoni | receptor tyrosine phosphatase type r2a | 0.0047 | 0.0005 | 0.0005 |
| Echinococcus granulosus | epidermal growth factor receptor | 0.0099 | 0.0083 | 0.1115 |
| Plasmodium falciparum | protein serine/threonine kinase-1 | 0.0087 | 0.0065 | 0.0041 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 0.0139 | 0.0836 |
| Trypanosoma cruzi | casein kinase, putative | 0.006 | 0.0024 | 0.0794 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.005 | 0.0009 | 0.0045 |
| Schistosoma mansoni | tyrosine kinase | 0.0278 | 0.0354 | 0.0354 |
| Schistosoma mansoni | protein kinase | 0.0193 | 0.0225 | 0.0225 |
| Echinococcus granulosus | casein kinase I delta | 0.006 | 0.0024 | 0.0305 |
| Entamoeba histolytica | protein kinase, putative | 0.0082 | 0.0058 | 0.1879 |
| Plasmodium vivax | cAMP-dependent protein kinase catalytic subunit, putative | 0.0111 | 0.0101 | 0.009 |
| Plasmodium vivax | unspecified product | 0.0085 | 0.0061 | 0.005 |
| Leishmania major | rac serine-threonine kinase, putative,protein kinase, putative | 0.012 | 0.0115 | 0.3538 |
| Loa Loa (eye worm) | hypothetical protein | 0.0167 | 0.0186 | 0.1122 |
| Entamoeba histolytica | cysteine protease, putative | 0.0085 | 0.0061 | 0.2021 |
| Onchocerca volvulus | 0.0109 | 0.0098 | 0.0587 | |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0062 | 0.0027 | 0.0027 |
| Entamoeba histolytica | cysteine protease, putative | 0.0085 | 0.0061 | 0.2021 |
| Echinococcus multilocularis | insulin receptor | 0.0185 | 0.0214 | 0.1477 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.013 | 0.0129 | 0.4498 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.006 | 0.0024 | 0.0024 |
| Plasmodium vivax | calcium-dependent protein kinase, putative | 0.006 | 0.0024 | 0.0012 |
| Loa Loa (eye worm) | AGC/PKA protein kinase | 0.0111 | 0.0101 | 0.0604 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Leishmania major | cathepsin L-like protease | 0.0161 | 0.0177 | 0.5954 |
| Loa Loa (eye worm) | hypothetical protein | 0.0086 | 0.0064 | 0.0377 |
| Leishmania major | mitogen-activated protein kinase 3, putative,map kinase 3, putative | 0.0166 | 0.0185 | 0.628 |
| Loa Loa (eye worm) | hypothetical protein | 0.0214 | 0.0258 | 0.1564 |
| Schistosoma mansoni | SmCL2-like peptidase (C01 family) | 0.0085 | 0.0061 | 0.0061 |
| Echinococcus multilocularis | cyclin dependent kinase 7 | 0.0107 | 0.0095 | 0.0651 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Loa Loa (eye worm) | hypothetical protein | 0.0583 | 0.0818 | 0.4979 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Loa Loa (eye worm) | CAMK/PKD protein kinase | 0.0088 | 0.0067 | 0.0395 |
| Brugia malayi | Cathepsin L-like precursor | 0.0161 | 0.0177 | 0.1066 |
| Loa Loa (eye worm) | gastrulation defective protein 1 | 0.0157 | 0.0172 | 0.1037 |
| Echinococcus granulosus | cAMP dependent protein kinase catalytic subunit | 0.0111 | 0.0101 | 0.1354 |
| Trypanosoma cruzi | Vacuolar sorting protein 39 domain 1/Vacuolar sorting protein 39 domain 2, putative | 0.0061 | 0.0025 | 0.0825 |
| Plasmodium falciparum | cysteine proteinase falcipain 3 | 0.0161 | 0.0177 | 0.0153 |
| Trichomonas vaginalis | CK1 family protein kinase | 0.006 | 0.0024 | 0.0029 |
| Brugia malayi | Immunoglobulin I-set domain containing protein | 0.0047 | 0.0005 | 0.0018 |
| Echinococcus multilocularis | dual specificity mitogen activated protein | 0.0193 | 0.0225 | 0.1555 |
| Plasmodium falciparum | serine/threonine protein kinase, putative | 0.0082 | 0.0058 | 0.0034 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Echinococcus multilocularis | serine:threonine protein kinase 12 B | 0.0082 | 0.0058 | 0.0388 |
| Schistosoma mansoni | tyrosine kinase | 0.0099 | 0.0083 | 0.0083 |
| Schistosoma mansoni | atypical protein kinase C | 0.0062 | 0.0027 | 0.0027 |
| Echinococcus multilocularis | roundabout 2 | 0.0047 | 0.0005 | 0.0022 |
| Schistosoma mansoni | neuroglian | 0.0047 | 0.0005 | 0.0005 |
| Echinococcus granulosus | tyrosine protein kinase Blk | 0.0086 | 0.0063 | 0.0833 |
| Brugia malayi | Cathepsin L-like precursor | 0.0161 | 0.0177 | 0.1066 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0085 | 0.0061 | 0.2021 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0085 | 0.0061 | 0.0363 |
| Onchocerca volvulus | 0.005 | 0.0009 | 0.0045 | |
| Loa Loa (eye worm) | TK protein kinase | 0.0064 | 0.003 | 0.0169 |
| Trypanosoma brucei | cAMP-dependent protein kinase catalytic subunit 2 | 0.0111 | 0.0101 | 0.3459 |
| Entamoeba histolytica | casein kinase 1, putative | 0.006 | 0.0024 | 0.0656 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Loa Loa (eye worm) | hypothetical protein | 0.0097 | 0.008 | 0.0478 |
| Leishmania major | protein kinase, putative | 0.0087 | 0.0065 | 0.1607 |
| Loa Loa (eye worm) | TK/ALK protein kinase | 0.0646 | 0.0913 | 0.5558 |
| Entamoeba histolytica | cysteine protease, putative | 0.0085 | 0.0061 | 0.2021 |
| Echinococcus granulosus | tyrosine protein kinase Btk29A | 0.0105 | 0.0093 | 0.1241 |
| Echinococcus granulosus | tyrosine protein kinase Fyn | 0.0101 | 0.0086 | 0.1151 |
| Echinococcus multilocularis | casein kinase I alpha | 0.006 | 0.0024 | 0.0155 |
| Loa Loa (eye worm) | STE/STE7/MEK1 protein kinase | 0.0193 | 0.0225 | 0.1364 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Schistosoma mansoni | protein kinase | 0.0087 | 0.0065 | 0.0065 |
| Echinococcus multilocularis | cathepsin L | 0.0085 | 0.0061 | 0.0416 |
| Echinococcus granulosus | cathepsin l cysteine peptidase | 0.0161 | 0.0177 | 0.2386 |
| Toxoplasma gondii | aurora kinase | 0.0082 | 0.0058 | 0.0034 |
| Echinococcus multilocularis | tyrosine protein kinase Fgr | 0.0101 | 0.0086 | 0.0586 |
| Entamoeba histolytica | protein kinase, putative | 0.006 | 0.0024 | 0.0647 |
| Trichomonas vaginalis | AGC family protein kinase | 0.0054 | 0.0014 | 0.0013 |
| Echinococcus multilocularis | proto oncogene tyrosine protein kinase LCK | 0.0101 | 0.0086 | 0.0586 |
| Loa Loa (eye worm) | CAMK/PIM protein kinase | 0.0206 | 0.0246 | 0.1491 |
| Loa Loa (eye worm) | STE/STE20/PAKB protein kinase | 0.0235 | 0.0289 | 0.1754 |
| Echinococcus granulosus | raf serine:threonine protein kinase | 0.0047 | 0.0004 | 0.003 |
| Loa Loa (eye worm) | immunoglobulin I-set domain-containing protein | 0.0047 | 0.0005 | 0.0018 |
| Brugia malayi | Probable G protein-coupled receptor kinase F19C6.1, putative | 0.0169 | 0.0189 | 0.1143 |
| Toxoplasma gondii | AGC kinase | 0.0111 | 0.0101 | 0.0077 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0107 | 0.0095 | 0.0095 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0148 | 0.0157 | 0.0157 |
| Loa Loa (eye worm) | AGC/GRK/GRK protein kinase | 0.0169 | 0.0189 | 0.1143 |
| Brugia malayi | ribosomal protein S6 kinase alpha 3 | 0.0116 | 0.0108 | 0.0649 |
| Loa Loa (eye worm) | hypothetical protein | 0.0199 | 0.0235 | 0.1425 |
| Trypanosoma brucei | mitogen-activated protein kinase 3, putative | 0.0166 | 0.0185 | 0.6521 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.006 | 0.0024 | 0.0301 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 0.0072 | 0.0429 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Loa Loa (eye worm) | calcium/calmodulin-dependent protein kinase subunit type II alpha | 0.0133 | 0.0135 | 0.0814 |
| Echinococcus multilocularis | cAMP dependent protein kinase catalytic subunit | 0.0111 | 0.0101 | 0.069 |
| Toxoplasma gondii | cathepsin CPC2 | 0.2538 | 0.3784 | 0.3769 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.0098 | 0.0587 |
| Echinococcus granulosus | mitogen activated protein kinase kinase kinase | 0.0209 | 0.0249 | 0.3378 |
| Brugia malayi | Protein kinase domain containing protein | 0.0209 | 0.0249 | 0.1509 |
| Giardia lamblia | Kinase, AGC AKT | 0.0116 | 0.0108 | 0.0084 |
| Loa Loa (eye worm) | TK/KIN16 protein kinase | 0.0513 | 0.0711 | 0.4325 |
| Echinococcus multilocularis | proto oncogene serine:threonine protein kinase | 0.0206 | 0.0246 | 0.1699 |
| Giardia lamblia | Aurora kinase | 0.0082 | 0.0058 | 0.0034 |
| Brugia malayi | cathepsin F-like cysteine proteinase | 0.0052 | 0.0011 | 0.0058 |
| Brugia malayi | Protein kinase domain containing protein | 0.0172 | 0.0194 | 0.1172 |
| Brugia malayi | cAMP-dependent protein kinase catalytic subunit, putative | 0.0111 | 0.0101 | 0.0604 |
| Schistosoma mansoni | protein kinase | 0.006 | 0.0024 | 0.0024 |
| Brugia malayi | SH2 domain containing protein | 0.005 | 0.0009 | 0.0045 |
| Echinococcus granulosus | neuroglian | 0.0047 | 0.0005 | 0.0043 |
| Schistosoma mansoni | cell adhesion molecule | 0.0114 | 0.0105 | 0.0105 |
| Trypanosoma cruzi | cysteine peptidase C (CPC), putative | 0.0167 | 0.0186 | 0.6602 |
| Echinococcus multilocularis | neuroglian | 0.0047 | 0.0005 | 0.0022 |
| Onchocerca volvulus | Serine\/threonine protein kinase homolog | 0.0206 | 0.0246 | 0.1491 |
| Onchocerca volvulus | 0.0161 | 0.0177 | 0.1066 | |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.005 | 0.0009 | 0.0045 |
| Echinococcus multilocularis | ribosomal protein S6 kinase alpha 3 | 0.0145 | 0.0153 | 0.1052 |
| Brugia malayi | Temporarily assigned gene name protein 59 | 0.0061 | 0.0025 | 0.014 |
| Schistosoma mansoni | tyrosine kinase | 0.0066 | 0.0033 | 0.0033 |
| Schistosoma mansoni | tyrosine kinase | 0.0185 | 0.0214 | 0.0214 |
| Onchocerca volvulus | Cathepsin L homolog | 0.0161 | 0.0177 | 0.1066 |
| Echinococcus multilocularis | roundabout 2 | 0.0047 | 0.0005 | 0.0022 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Giardia lamblia | Cathepsin B precursor | 0.0074 | 0.0046 | 0.0022 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Echinococcus granulosus | neuroglian | 0.0119 | 0.0114 | 0.153 |
| Echinococcus granulosus | casein kinase I alpha | 0.006 | 0.0024 | 0.0305 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0161 | 0.0177 | 0.1066 |
| Brugia malayi | Cathepsin L-like precursor | 0.0161 | 0.0177 | 0.1066 |
| Loa Loa (eye worm) | TK/ROR protein kinase | 0.0055 | 0.0016 | 0.0089 |
| Schistosoma mansoni | nephrin | 0.0047 | 0.0005 | 0.0005 |
| Trichomonas vaginalis | AGC family protein kinase | 0.0082 | 0.0058 | 0.0083 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.005 | 0.0009 | 0.0045 |
| Echinococcus granulosus | cyclin dependent kinase 9 | 0.0078 | 0.0052 | 0.0682 |
| Trypanosoma cruzi | cysteine proteinase, putative | 0.0085 | 0.0061 | 0.2139 |
| Echinococcus granulosus | mitogen activated protein kinase 14 | 0.0166 | 0.0185 | 0.25 |
| Plasmodium vivax | calcium-dependent protein kinase 3, putative | 0.006 | 0.0024 | 0.0012 |
| Plasmodium falciparum | dipeptidyl aminopeptidase 3 | 0.2538 | 0.3784 | 0.3769 |
| Echinococcus multilocularis | raf serine:threonine protein kinase | 0.0047 | 0.0004 | 0.0015 |
| Echinococcus granulosus | casein kinase I delta | 0.006 | 0.0024 | 0.0305 |
| Echinococcus granulosus | epidermal growth factor receptor | 0.0099 | 0.0083 | 0.1115 |
| Leishmania major | cathepsin L-like protease | 0.0161 | 0.0177 | 0.5954 |
| Echinococcus granulosus | tyrosine protein kinase HCK | 0.0064 | 0.003 | 0.0381 |
| Echinococcus multilocularis | protein KINase family member (kin 25) | 0.0105 | 0.0093 | 0.0632 |
| Brugia malayi | Protein kinase domain containing protein | 0.0088 | 0.0067 | 0.0395 |
| Toxoplasma gondii | preprocathepsin c precursor, putative | 0.6636 | 1 | 1 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0206 | 0.0246 | 0.0246 |
| Onchocerca volvulus | 0.0092 | 0.0072 | 0.0429 | |
| Schistosoma mansoni | tyrosine kinase | 0.0148 | 0.0157 | 0.0157 |
| Echinococcus multilocularis | aurora kinase A | 0.0082 | 0.0058 | 0.0388 |
| Echinococcus multilocularis | tyrosine protein kinase Srms | 0.0086 | 0.0063 | 0.0424 |
| Schistosoma mansoni | cathepsin s | 0.0052 | 0.0011 | 0.0011 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Echinococcus multilocularis | cAMP dependent protein kinase catalytic subunit | 0.0111 | 0.0101 | 0.069 |
| Trypanosoma cruzi | cysteine proteinase, putative | 0.0085 | 0.0061 | 0.2139 |
| Echinococcus granulosus | cyclin dependent kinase 7 | 0.0107 | 0.0095 | 0.1277 |
| Echinococcus granulosus | casein kinase I alpha | 0.006 | 0.0024 | 0.0305 |
| Loa Loa (eye worm) | hypothetical protein | 0.0097 | 0.008 | 0.0478 |
| Entamoeba histolytica | serine/threonine- protein kinase 6, putative | 0.0082 | 0.0058 | 0.1879 |
| Echinococcus multilocularis | cysteine protease | 0.0161 | 0.0177 | 0.1215 |
| Echinococcus multilocularis | TGF beta receptor type 1 | 0.0101 | 0.0086 | 0.0585 |
| Leishmania major | protein kinase, putative | 0.0082 | 0.0058 | 0.1317 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.0161 | 0.0177 | 0.1215 |
| Entamoeba histolytica | serine/threonine protein kinase 6, putative | 0.0082 | 0.0058 | 0.1879 |
| Trichomonas vaginalis | CMGC family protein kinase | 0.0087 | 0.0065 | 0.0095 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 0.0043 | 0.025 |
| Echinococcus granulosus | activated cdc42 kinase 1 | 0.0228 | 0.0279 | 0.3779 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0229 | 0.028 | 0.028 |
| Echinococcus multilocularis | mitogen activated protein kinase 11 | 0.0166 | 0.0185 | 0.1273 |
| Echinococcus granulosus | enhancer of mRNA decapping protein 4 | 0.0096 | 0.0079 | 0.1053 |
| Trypanosoma cruzi | casein kinase, putative | 0.006 | 0.0024 | 0.0794 |
| Schistosoma mansoni | defective proboscis extension response (dpr)-related | 0.0093 | 0.0074 | 0.0074 |
| Echinococcus multilocularis | tyrosine protein kinase ABL1 | 0.0299 | 0.0387 | 0.2679 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.006 | 0.0024 | 0.0029 |
| Entamoeba histolytica | cysteine protease, putative | 0.0085 | 0.0061 | 0.2021 |
| Onchocerca volvulus | 0.005 | 0.0009 | 0.0045 | |
| Echinococcus multilocularis | protein kinase c iota type | 0.0062 | 0.0027 | 0.0179 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0093 | 0.0075 | 0.0075 |
| Schistosoma mansoni | cell adhesion molecule | 0.0047 | 0.0005 | 0.0005 |
| Plasmodium vivax | casein kinase 1, putative | 0.006 | 0.0024 | 0.0013 |
| Echinococcus multilocularis | activated cdc42 kinase 1 | 0.0228 | 0.0279 | 0.1925 |
| Brugia malayi | Cathepsin L-like precursor | 0.0109 | 0.0098 | 0.0587 |
| Echinococcus granulosus | cAMP dependent protein kinase catalytic subunit | 0.0111 | 0.0101 | 0.1354 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0172 | 0.0194 | 0.0194 |
| Echinococcus multilocularis | cathepsin b | 0.0167 | 0.0186 | 0.1279 |
| Onchocerca volvulus | 0.005 | 0.0009 | 0.0045 | |
| Brugia malayi | Protein kinase domain containing protein | 0.0087 | 0.0065 | 0.0385 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0161 | 0.0177 | 0.6216 |
| Plasmodium falciparum | dipeptidyl aminopeptidase 1 | 0.6636 | 1 | 1 |
| Echinococcus granulosus | cathepsin L cysteine protease | 0.0085 | 0.0061 | 0.0816 |
| Schistosoma mansoni | tyrosine kinase | 0.0072 | 0.0041 | 0.0041 |
| Plasmodium falciparum | dipeptidyl aminopeptidase 2 | 0.6636 | 1 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0109 | 0.0098 | 0.0587 |
| Echinococcus granulosus | GTPase activating Rap:RanGAP domain 3 | 0.0061 | 0.0025 | 0.0317 |
| Echinococcus granulosus | neurotracting:lsamp:neurotrimin:obcam | 0.0109 | 0.0099 | 0.1322 |
| Echinococcus multilocularis | cyclin dependent kinase 9 | 0.0069 | 0.0037 | 0.0247 |
| Loa Loa (eye worm) | TKL/STKR/TYPE2 protein kinase | 0.0088 | 0.0067 | 0.0395 |
| Entamoeba histolytica | serine/threonine- protein kinase 6 , putative | 0.0082 | 0.0058 | 0.1879 |
| Entamoeba histolytica | PH domain containing protein kinase, putative | 0.0115 | 0.0107 | 0.3688 |
| Brugia malayi | intracellular kinase | 0.013 | 0.0129 | 0.0778 |
| Trypanosoma brucei | mitogen-activated protein kinase kinase 5 | 0.0193 | 0.0225 | 0.7995 |
| Echinococcus granulosus | proto oncogene tyrosine protein kinase LCK | 0.0101 | 0.0086 | 0.1151 |
| Echinococcus multilocularis | transfer RNA-Thr | 0.0228 | 0.0279 | 0.1925 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0109 | 0.0098 | 0.0149 |
| Echinococcus granulosus | cysteine protease | 0.0085 | 0.0061 | 0.0816 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0069 | 0.0037 | 0.0037 |
| Loa Loa (eye worm) | CK1/CK1/CK1-A protein kinase | 0.006 | 0.0024 | 0.0135 |
| Echinococcus multilocularis | activin receptor type | 0.0483 | 0.0666 | 0.4618 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Echinococcus granulosus | serine:threonine protein kinase PAK 4 | 0.0216 | 0.0261 | 0.3534 |
| Trypanosoma cruzi | kinetoplastid kinetochore protein 10, putative | 0.0087 | 0.0065 | 0.2265 |
| Loa Loa (eye worm) | TK/INSR protein kinase | 0.0185 | 0.0214 | 0.1295 |
| Giardia lamblia | Kinase, CMGC GSK | 0.013 | 0.0129 | 0.0106 |
| Echinococcus granulosus | macrophage colony stimulating factor 1 receptor | 0.0529 | 0.0735 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.013 | 0.0129 | 0.4498 |
| Onchocerca volvulus | 0.006 | 0.0024 | 0.0135 | |
| Schistosoma mansoni | glycogen synthase kinase 3-related (gsk3) (cmgc group III) | 0.013 | 0.0129 | 0.0129 |
| Brugia malayi | Protein kinase domain containing protein | 0.005 | 0.0009 | 0.0045 |
| Loa Loa (eye worm) | hypothetical protein | 0.0211 | 0.0253 | 0.153 |
| Onchocerca volvulus | Tyrosine kinase homolog | 0.043 | 0.0585 | 0.356 |
| Entamoeba histolytica | protein kinase, putative | 0.0082 | 0.0058 | 0.1879 |
| Onchocerca volvulus | Cathepsin L homolog | 0.0161 | 0.0177 | 0.1066 |
| Schistosoma mansoni | hypothetical protein | 0.0061 | 0.0025 | 0.0025 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type 1 | 0.006 | 0.0024 | 0.0301 |
| Schistosoma mansoni | tyrosine kinase | 0.0099 | 0.0083 | 0.0083 |
| Trypanosoma cruzi | cysteine protease, putative | 0.0085 | 0.0061 | 0.2139 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.005 | 0.0009 | 0.0045 |
| Loa Loa (eye worm) | CAMK/CAMK2 protein kinase | 0.006 | 0.0024 | 0.0133 |
| Loa Loa (eye worm) | IKK protein kinase | 0.1126 | 0.1641 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0052 | 0.0011 | 0.0058 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0161 | 0.0177 | 0.6271 |
| Schistosoma mansoni | SmCL2-like peptidase (C01 family) | 0.0085 | 0.0061 | 0.0061 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0085 | 0.0061 | 0.2021 |
| Onchocerca volvulus | 0.0045 | 0.0002 | 0.0000038438 | |
| Trichomonas vaginalis | AGC family protein kinase | 0.0082 | 0.0058 | 0.0083 |
| Echinococcus multilocularis | Protein kinase C, brain isozyme | 0.0062 | 0.0027 | 0.0179 |
| Trypanosoma cruzi | mitogen-activated protein kinase 3, putative | 0.0166 | 0.0185 | 0.6572 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0161 | 0.0177 | 0.6216 |
| Brugia malayi | Protein kinase domain containing protein | 0.005 | 0.0009 | 0.0045 |
| Trypanosoma brucei | cAMP-dependent protein kinase catalytic subunit 1 | 0.0111 | 0.0101 | 0.3459 |
| Entamoeba histolytica | cysteine proteinase 2 | 0.0085 | 0.0061 | 0.2021 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Onchocerca volvulus | 0.0161 | 0.0177 | 0.1066 | |
| Echinococcus granulosus | TGF-beta receptor type-1 | 0.0101 | 0.0086 | 0.1148 |
| Brugia malayi | Cathepsin L-like precursor | 0.0161 | 0.0177 | 0.1066 |
| Onchocerca volvulus | 0.0096 | 0.0078 | 0.0467 | |
| Echinococcus granulosus | dual specificity protein kinase clk2 | 0.0087 | 0.0065 | 0.0864 |
| Giardia lamblia | Kinase, STE STE20 | 0.0193 | 0.0225 | 0.0202 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0045 | 0.0002 | 0.0002 |
| Entamoeba histolytica | protein kinase, putative | 0.0229 | 0.028 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0047 | 0.0005 | 0.0005 |
| Schistosoma mansoni | tyrosine kinase | 0.0105 | 0.0093 | 0.0093 |
| Schistosoma mansoni | protein kinase | 0.0147 | 0.0156 | 0.0156 |
| Loa Loa (eye worm) | TK/FAK protein kinase | 0.0336 | 0.0443 | 0.269 |
| Schistosoma mansoni | tyrosine kinase | 0.0071 | 0.004 | 0.004 |
| Loa Loa (eye worm) | TK protein kinase | 0.0086 | 0.0063 | 0.0371 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.005 | 0.0009 | 0.0045 |
| Echinococcus multilocularis | basement membrane specific heparan sulfate | 0.0093 | 0.0074 | 0.05 |
| Echinococcus granulosus | hypothetical protein | 0.0072 | 0.0043 | 0.0562 |
| Plasmodium vivax | calcium-dependent protein kinase 4, putative | 0.006 | 0.0024 | 0.0012 |
| Schistosoma mansoni | cell adhesion molecule | 0.0047 | 0.0005 | 0.0005 |
| Brugia malayi | hypothetical protein | 0.0097 | 0.008 | 0.0478 |
| Loa Loa (eye worm) | CK1/CK1/CK1-D protein kinase | 0.006 | 0.0024 | 0.0135 |
| Trichomonas vaginalis | CK1 family protein kinase | 0.006 | 0.0024 | 0.0029 |
| Loa Loa (eye worm) | hypothetical protein | 0.0096 | 0.0078 | 0.0467 |
| Trypanosoma cruzi | casein kinase, putative | 0.006 | 0.0024 | 0.0794 |
| Brugia malayi | serine/threonine kinase 12 | 0.0082 | 0.0058 | 0.034 |
| Loa Loa (eye worm) | hypothetical protein | 0.0124 | 0.0121 | 0.0725 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0109 | 0.0098 | 0.3356 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0161 | 0.0177 | 0.6216 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0161 | 0.0177 | 0.6216 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0161 | 0.0177 | 0.6216 |
| Giardia lamblia | Encystation-specific protease | 0.2538 | 0.3784 | 0.3769 |
| Echinococcus granulosus | fibroblast growth factor receptor 4 | 0.0148 | 0.0157 | 0.2116 |
| Entamoeba histolytica | protein kinase, putative | 0.013 | 0.0129 | 0.4498 |
| Echinococcus multilocularis | GTPase activating Rap:RanGAP domain 3 | 0.0061 | 0.0025 | 0.0161 |
| Echinococcus multilocularis | mitogen activated protein kinase kinase kinase | 0.0209 | 0.0249 | 0.1721 |
| Echinococcus granulosus | Immunoglobulin | 0.0093 | 0.0074 | 0.0981 |
| Plasmodium vivax | vivapain-3 | 0.0085 | 0.0061 | 0.005 |
| Brugia malayi | C1-like domain containing protein | 0.0106 | 0.0094 | 0.0564 |
| Echinococcus granulosus | casein kinase i | 0.006 | 0.0024 | 0.0305 |
| Entamoeba histolytica | protein kinase, putative | 0.0229 | 0.028 | 1 |
| Schistosoma mansoni | dipeptidyl-peptidase I (C01 family) | 0.6636 | 1 | 1 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0169 | 0.0189 | 0.0189 |
| Onchocerca volvulus | 0.0074 | 0.0044 | 0.026 | |
| Echinococcus multilocularis | insulin growth factor 1 receptor beta | 0.019 | 0.0221 | 0.1523 |
| Onchocerca volvulus | 0.0061 | 0.0025 | 0.014 | |
| Leishmania major | glycogen synthase kinase, putative;with=GeneDB:LinJ18_V3.0270 | 0.013 | 0.0129 | 0.4118 |
| Trypanosoma cruzi | cAMP-dependent protein kinase catalytic subunit 3 | 0.0111 | 0.0101 | 0.3556 |
| Entamoeba histolytica | SH2-protein kinase domain containing protein | 0.005 | 0.0009 | 0.0119 |
| Trypanosoma cruzi | cAMP-dependent protein kinase catalytic subunit 3 | 0.0111 | 0.0101 | 0.3556 |
| Brugia malayi | Phorbol esters/diacylglycerol binding domain | 0.0106 | 0.0094 | 0.0564 |
| Echinococcus multilocularis | death associated protein kinase 1 | 0.0994 | 0.1441 | 1 |
| Echinococcus granulosus | insulin receptor | 0.0185 | 0.0214 | 0.2899 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0145 | 0.0153 | 0.0153 |
| Entamoeba histolytica | cysteine protease, putative | 0.0085 | 0.0061 | 0.2021 |
| Echinococcus multilocularis | receptor type tyrosine protein phosphatase | 0.0047 | 0.0005 | 0.0022 |
| Plasmodium vivax | serine/threonine kinase-1, putative | 0.0087 | 0.0065 | 0.0054 |
| Brugia malayi | Protein kinase domain containing protein | 0.1126 | 0.1641 | 1 |
| Loa Loa (eye worm) | AUR protein kinase | 0.0082 | 0.0058 | 0.034 |
| Echinococcus granulosus | tyrosine protein kinase Srms | 0.005 | 0.0009 | 0.0104 |
| Loa Loa (eye worm) | CMGC/DYRK/DYRK1 protein kinase | 0.0229 | 0.028 | 0.1699 |
| Echinococcus multilocularis | basic fibroblast growth factor receptor 1 A | 0.0148 | 0.0157 | 0.1078 |
| Loa Loa (eye worm) | SRC-1 | 0.0101 | 0.0086 | 0.0513 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0069 | 0.0037 | 0.1139 |
| Echinococcus granulosus | tyrosine protein kinase Src42A | 0.0101 | 0.0086 | 0.1151 |
| Trypanosoma cruzi | casein kinase, delta isoform, putative | 0.006 | 0.0024 | 0.0794 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0109 | 0.0098 | 0.0098 |
| Echinococcus granulosus | titin | 0.0045 | 0.0002 | 0.0003 |
| Leishmania major | protein kinase A catalytic subunit isoform 1 | 0.0111 | 0.0101 | 0.3007 |
| Loa Loa (eye worm) | CMGC/GSK protein kinase | 0.013 | 0.0129 | 0.0778 |
| Echinococcus granulosus | glycogen synthase kinase 3 beta | 0.013 | 0.0129 | 0.1743 |
| Echinococcus granulosus | tyrosine protein kinase shark | 0.005 | 0.0009 | 0.0104 |
| Echinococcus multilocularis | serine:threonine protein kinase receptor R3 | 0.0101 | 0.0086 | 0.0585 |
| Loa Loa (eye worm) | AUR protein kinase | 0.0082 | 0.0058 | 0.034 |
| Brugia malayi | SH2 domain containing protein | 0.005 | 0.0009 | 0.0045 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.005 | 0.0009 | 0.0045 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin B-like cysteine peptidase | 0.0074 | 0.0046 | 0.0064 |
| Trypanosoma cruzi | casein kinase, putative | 0.006 | 0.0024 | 0.0794 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0082 | 0.0058 | 0.1879 |
| Giardia lamblia | Cathepsin B precursor | 0.0074 | 0.0046 | 0.0022 |
| Loa Loa (eye worm) | hypothetical protein | 0.0077 | 0.0049 | 0.029 |
| Schistosoma mansoni | tyrosine kinase | 0.0066 | 0.0033 | 0.0033 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Trypanosoma cruzi | aurora B kinase, putative | 0.0082 | 0.0058 | 0.1998 |
| Plasmodium vivax | vivapain-2 | 0.0161 | 0.0177 | 0.0165 |
| Brugia malayi | serine/threonine protein kinase 6 | 0.0082 | 0.0058 | 0.034 |
| Onchocerca volvulus | 0.013 | 0.0129 | 0.0778 | |
| Echinococcus granulosus | tyrosine protein kinase Src64B | 0.0101 | 0.0086 | 0.1151 |
| Leishmania major | casein kinase, putative | 0.006 | 0.0024 | 0.001 |
| Loa Loa (eye worm) | hypothetical protein | 0.0105 | 0.0093 | 0.0554 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0052 | 0.0011 | 0.0341 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0062 | 0.0027 | 0.0027 |
| Loa Loa (eye worm) | AUR protein kinase | 0.0082 | 0.0058 | 0.034 |
| Loa Loa (eye worm) | CAMK/MLCK protein kinase | 0.0062 | 0.0027 | 0.0153 |
| Echinococcus multilocularis | tyrosine protein kinase Btk29A | 0.0226 | 0.0276 | 0.1904 |
| Echinococcus multilocularis | tyrosine protein kinase Fyn | 0.0101 | 0.0086 | 0.0586 |
| Brugia malayi | Dual specificity mitogen-activated protein kinase kinase mek-2 | 0.0193 | 0.0225 | 0.1364 |
| Schistosoma mansoni | tyrosine kinase | 0.0185 | 0.0214 | 0.0214 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0193 | 0.0226 | 0.3061 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0167 | 0.0186 | 0.0186 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0085 | 0.0061 | 0.009 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0161 | 0.0177 | 0.6271 |
| Brugia malayi | Immunoglobulin I-set domain containing protein | 0.0061 | 0.0025 | 0.0143 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0085 | 0.0061 | 0.009 |
| Loa Loa (eye worm) | hypothetical protein | 0.0093 | 0.0074 | 0.0437 |
| Echinococcus granulosus | protein tyrosine kinase | 0.0332 | 0.0437 | 0.5942 |
| Brugia malayi | serine/threonine-protein kinase PAK 7 | 0.0235 | 0.0289 | 0.1754 |
| Giardia lamblia | Cathepsin B precursor | 0.0074 | 0.0046 | 0.0022 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0111 | 0.0101 | 0.0101 |
| Echinococcus granulosus | c src tyrosine kinase | 0.0066 | 0.0033 | 0.0422 |
| Brugia malayi | Immunoglobulin I-set domain containing protein | 0.0513 | 0.0711 | 0.4325 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0085 | 0.0061 | 0.2021 |
| Loa Loa (eye worm) | AGC/GRK/GRK protein kinase | 0.0153 | 0.0166 | 0.1 |
| Loa Loa (eye worm) | CMGC/GSK protein kinase | 0.013 | 0.0129 | 0.0778 |
| Brugia malayi | Immunoglobulin I-set domain containing protein | 0.0174 | 0.0197 | 0.1191 |
| Plasmodium falciparum | cAMP-dependent protein kinase catalytic subunit | 0.0111 | 0.0101 | 0.0077 |
| Echinococcus multilocularis | mitogen activated protein kinase 11 | 0.0166 | 0.0185 | 0.1273 |
| Echinococcus granulosus | tyrosine protein kinase Fyn | 0.0101 | 0.0086 | 0.1151 |
| Loa Loa (eye worm) | AGC/AKT protein kinase | 0.0048 | 0.0006 | 0.0025 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0161 | 0.0177 | 0.6216 |
| Echinococcus multilocularis | tyrosine protein kinase Src42A | 0.0101 | 0.0086 | 0.0586 |
| Echinococcus granulosus | cathepsin L | 0.0085 | 0.0061 | 0.0816 |
| Loa Loa (eye worm) | STE/STE20/KHS protein kinase | 0.0209 | 0.0249 | 0.1509 |
| Brugia malayi | Fibronectin type III domain containing protein | 0.0097 | 0.008 | 0.0478 |
| Brugia malayi | casein kinase I | 0.006 | 0.0024 | 0.0135 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Echinococcus multilocularis | tyrosine protein kinase lyn lyn a protein tyrosine kinase lymphocyte specific protein tyrosine kinase | 0.0101 | 0.0086 | 0.0586 |
| Echinococcus multilocularis | contactin neuroglian septate junction protein | 0.0047 | 0.0005 | 0.0022 |
| Plasmodium vivax | dipeptidyl aminopeptidase 1, putative | 0.6636 | 1 | 1 |
| Leishmania major | cysteine peptidase C (CPC),CPC cysteine peptidase, Clan CA, family C1, Cathepsin B-like | 0.0074 | 0.0046 | 0.0856 |
| Loa Loa (eye worm) | hypothetical protein | 0.0074 | 0.0044 | 0.026 |
| Trypanosoma cruzi | Vacuolar sorting protein 39 domain 1/Vacuolar sorting protein 39 domain 2, putative | 0.0061 | 0.0025 | 0.0825 |
| Entamoeba histolytica | hypothetical protein | 0.0229 | 0.028 | 1 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0107 | 0.0095 | 0.0095 |
| Echinococcus granulosus | roundabout 2 | 0.014 | 0.0145 | 0.1961 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.005 | 0.0009 | 0.0045 |
| Schistosoma mansoni | protein kinase | 0.0082 | 0.0058 | 0.0058 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin B-like cysteine peptidase | 0.4131 | 0.6199 | 1 |
| Brugia malayi | Tyrosine-protein kinase abl-1 | 0.0161 | 0.0177 | 0.1069 |
| Entamoeba histolytica | cysteine protease, putative | 0.0085 | 0.0061 | 0.2021 |
| Onchocerca volvulus | 0.0375 | 0.0502 | 0.3051 | |
| Schistosoma mansoni | serine/threonine protein kinase | 0.006 | 0.0024 | 0.0024 |
| Echinococcus granulosus | casein kinase I alpha | 0.006 | 0.0024 | 0.0305 |
| Echinococcus granulosus | cAMP dependent protein kinase catalytic subunit | 0.0111 | 0.0101 | 0.1354 |
| Brugia malayi | Cathepsin L-like precursor | 0.0161 | 0.0177 | 0.1066 |
| Loa Loa (eye worm) | cathepsin B | 0.0074 | 0.0046 | 0.0267 |
| Toxoplasma gondii | cell-cycle-associated protein kinase CLK, putative | 0.0087 | 0.0065 | 0.0041 |
| Brugia malayi | Calcium/calmodulin-dependent protein kinase type II alpha chain | 0.006 | 0.0024 | 0.0133 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0167 | 0.0186 | 0.0186 |
| Entamoeba histolytica | cysteine protease, putative | 0.0085 | 0.0061 | 0.2021 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.0161 | 0.0177 | 0.1066 |
| Echinococcus multilocularis | tyrosine kinase | 0.005 | 0.0009 | 0.0053 |
| Giardia lamblia | Kinase, CMGC GSK | 0.013 | 0.0129 | 0.0106 |
| Leishmania major | cathepsin L-like protease | 0.0161 | 0.0177 | 0.5954 |
| Schistosoma mansoni | protein kinase | 0.0209 | 0.0249 | 0.0249 |
| Echinococcus multilocularis | c Jun NH2 terminal kinase | 0.0292 | 0.0376 | 0.2605 |
| Echinococcus granulosus | activated cdc42 kinase 1 | 0.0228 | 0.0279 | 0.3779 |
| Brugia malayi | cathepsin L-like cysteine proteinase, identical | 0.0052 | 0.0011 | 0.0058 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0161 | 0.0177 | 0.6271 |
| Brugia malayi | Probable G protein-coupled receptor kinase F19C6.1, putative | 0.0153 | 0.0166 | 0.1 |
| Onchocerca volvulus | 0.0161 | 0.0177 | 0.1066 | |
| Entamoeba histolytica | PH domain containing protein kinase, putative | 0.0115 | 0.0107 | 0.3688 |
| Trypanosoma cruzi | cysteine peptidase, clan CA, family C1, cathepsin L-like, putative | 0.0109 | 0.0098 | 0.3454 |
| Loa Loa (eye worm) | CMGC/CLK protein kinase | 0.0087 | 0.0065 | 0.0385 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.0161 | 0.0177 | 0.1215 |
| Leishmania major | cathepsin L-like protease | 0.0161 | 0.0177 | 0.5954 |
| Loa Loa (eye worm) | TK protein kinase | 0.0174 | 0.0197 | 0.1191 |
| Echinococcus granulosus | serine:threonine protein kinase 12 B | 0.0082 | 0.0058 | 0.0763 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Echinococcus granulosus | c-Jun N-terminal kinases | 0.0292 | 0.0376 | 0.5113 |
| Leishmania major | cathepsin L-like protease | 0.0161 | 0.0177 | 0.5954 |
| Echinococcus granulosus | protein kinase shaggy | 0.013 | 0.0129 | 0.1743 |
| Plasmodium falciparum | cysteine proteinase falcipain 2a | 0.0161 | 0.0177 | 0.0153 |
| Trypanosoma cruzi | glycogen synthase kinase 3, putative | 0.013 | 0.0129 | 0.4579 |
| Entamoeba histolytica | cysteine proteinase 1, putative | 0.0085 | 0.0061 | 0.2021 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0161 | 0.0177 | 0.0275 |
| Echinococcus granulosus | cathepsin b | 0.0167 | 0.0186 | 0.2511 |
| Echinococcus granulosus | tyrosine protein kinase transmembrane receptor | 0.0055 | 0.0016 | 0.0202 |
| Brugia malayi | protein C17H12.11 | 0.0074 | 0.0044 | 0.026 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0111 | 0.0101 | 0.0101 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0292 | 0.0376 | 0.0376 |
| Brugia malayi | Protein kinase domain containing protein | 0.0185 | 0.0214 | 0.1295 |
| Echinococcus multilocularis | tyrosine protein kinase Fyn | 0.0101 | 0.0086 | 0.0586 |
| Loa Loa (eye worm) | hypothetical protein | 0.0167 | 0.0186 | 0.1122 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.006 | 0.0024 | 0.0154 |
| Trichomonas vaginalis | STE family protein kinase | 0.0193 | 0.0225 | 0.0354 |
| Leishmania major | mitogen-activated protein kinase kinase 5, putative;with=GeneDB:LmxM36.0860 | 0.0193 | 0.0225 | 0.7857 |
| Giardia lamblia | Dipeptidyl-peptidase I precursor | 0.2538 | 0.3784 | 0.3769 |
| Onchocerca volvulus | 0.1126 | 0.1641 | 1 | |
| Echinococcus multilocularis | dual specificity protein kinase clk2 | 0.0087 | 0.0065 | 0.044 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.0161 | 0.0177 | 0.1215 |
| Brugia malayi | Serine/threonine-protein kinase Pim-3 | 0.0206 | 0.0246 | 0.1491 |
| Loa Loa (eye worm) | CMGC/CDK/CDK9 protein kinase | 0.0069 | 0.0037 | 0.0216 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Ki (functional) | = 5.2 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: LCK | ChEMBL. | No reference |
| Ki (functional) | > 5.3 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: MAP4K4 | ChEMBL. | No reference |
| Ki (functional) | > 5.3 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: MAPK8 | ChEMBL. | No reference |
| Ki (functional) | = 5.3 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: BTK | ChEMBL. | No reference |
| Ki (functional) | = 5.4 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: CAMK2A | ChEMBL. | No reference |
| Ki (functional) | = 5.4 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: FGFR1 | ChEMBL. | No reference |
| Ki (functional) | > 5.4 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: MAPK9 | ChEMBL. | No reference |
| Ki (functional) | > 5.5 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: TBK1 | ChEMBL. | No reference |
| Ki (functional) | > 5.5 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: IKBKE | ChEMBL. | No reference |
| Ki (functional) | = 5.5 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: CLK2 | ChEMBL. | No reference |
| Ki (functional) | > 5.5 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: FLT3 | ChEMBL. | No reference |
| Ki (functional) | = 5.5 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: PIM1 | ChEMBL. | No reference |
| Ki (functional) | = 5.5 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: FYN | ChEMBL. | No reference |
| Ki (functional) | > 5.6 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: CSF1R | ChEMBL. | No reference |
| Ki (functional) | = 5.6 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: DAPK3 | ChEMBL. | No reference |
| Ki (functional) | = 5.6 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: CSNK1A1 | ChEMBL. | No reference |
| Ki (functional) | > 5.6 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: IGF1R | ChEMBL. | No reference |
| Ki (functional) | > 5.6 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: CAMK1D | ChEMBL. | No reference |
| Ki (functional) | = 5.7 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: MAP2K1 | ChEMBL. | No reference |
| Ki (functional) | > 5.7 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: DYRK1A | ChEMBL. | No reference |
| Ki (functional) | = 5.7 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: GSK3A | ChEMBL. | No reference |
| Ki (functional) | = 5.7 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: PTK2 | ChEMBL. | No reference |
| Ki (functional) | = 5.7 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: ACVR1 | ChEMBL. | No reference |
| Ki (functional) | = 5.7 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: JAK3 | ChEMBL. | No reference |
| Ki (functional) | = 5.7 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: FLT1 | ChEMBL. | No reference |
| Ki (functional) | = 5.8 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: JAK2 | ChEMBL. | No reference |
| Ki (functional) | = 5.8 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: KDR | ChEMBL. | No reference |
| Ki (functional) | = 5.8 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: STK6 | ChEMBL. | No reference |
| Ki (functional) | = 5.8 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: ABL1 | ChEMBL. | No reference |
| Ki (functional) | > 5.8 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: CDK9 | ChEMBL. | No reference |
| Ki (functional) | = 5.9 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: RPS6KA3 | ChEMBL. | No reference |
| Ki (functional) | = 5.9 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: MET | ChEMBL. | No reference |
| Ki (functional) | = 5.9 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: ACK1 | ChEMBL. | No reference |
| Ki (functional) | = 5.9 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: GPRK5 | ChEMBL. | No reference |
| Ki (functional) | = 5.9 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: NTRK1 | ChEMBL. | No reference |
| Ki (functional) | = 5.9 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: GSK3B | ChEMBL. | No reference |
| Ki (functional) | = 6 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: NTRK3 | ChEMBL. | No reference |
| Ki (functional) | = 6 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: MAP2K2 | ChEMBL. | No reference |
| Ki (functional) | = 6 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: CDK8 | ChEMBL. | No reference |
| Ki (functional) | = 6.1 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: TYRO3 | ChEMBL. | No reference |
| Ki (functional) | = 6.1 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: CDK7 | ChEMBL. | No reference |
| Ki (functional) | = 6.2 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: LTK | ChEMBL. | No reference |
| Ki (functional) | = 6.2 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: DYRK1B | ChEMBL. | No reference |
| Ki (functional) | = 6.3 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: ALK | ChEMBL. | No reference |
| Ki (functional) | = 6.3 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: RET | ChEMBL. | No reference |
| Ki (functional) | = 6.3 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: PAK4 | ChEMBL. | No reference |
| Ki (functional) | = 6.3 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: NTRK2 | ChEMBL. | No reference |
| Ki (functional) | = 6.4 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: PRKX | ChEMBL. | No reference |
| Ki (functional) | = 6.4 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: PRKCN | ChEMBL. | No reference |
| Ki (functional) | = 6.5 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: PDGFRB | ChEMBL. | No reference |
| Ki (functional) | = 6.5 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: MAP4K2 | ChEMBL. | No reference |
| Ki (functional) | = 6.5 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: PRKACA | ChEMBL. | No reference |
| Ki (functional) | = 6.6 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: PRKCQ | ChEMBL. | No reference |
| Ki (functional) | = 6.6 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: PDGFRA | ChEMBL. | No reference |
| Ki (functional) | = 7.1 | PUBCHEM_BIOASSAY: Navigating the Kinome. (Class of assay: other) Panel member name: MAPK14 | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1970290
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.