Detailed information for compound 1659668
Basic information
Technical information
- TDR Targets ID: 1659668
- Name: 2-Methyl-4-nitroindazole
- MW: 177.16 | Formula: C8H7N3O2
-
H donors: 0
H acceptors: 3
LogP: 1.4
Rotable bonds: 1
Rule of 5 violations (Lipinski): 1 - SMILES: Cn1nc2c(c1)c(ccc2)[N+](=O)[O-]
- InChi: 1S/C8H7N3O2/c1-10-5-6-7(9-10)3-2-4-8(6)11(12)13/h2-5H,1H3
- InChiKey: NCSBJAWUBPTMRX-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 2-methyl-4-nitro-indazole
- 26120-44-5
- 2H-Indazole, 2-methyl-4-nitro-
- NSC131657
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | NADPH cytochrome P450 reductase | 0.0027 | 0.6033 | 0.5397 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0036 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0036 | 1 | 1 |
| Schistosoma mansoni | 5-methyl tetrahydrofolate-homocysteine methyltransferase reductase | 0.0017 | 0.1382 | 0.1382 |
| Schistosoma mansoni | biogenic amine receptor | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0036 | 1 | 1 |
| Onchocerca volvulus | 0.0036 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0036 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0036 | 1 | 1 |
| Echinococcus granulosus | NADPH dependent diflavin oxidoreductase 1 | 0.0027 | 0.6033 | 0.5397 |
| Schistosoma mansoni | adenoreceptor | 0.0036 | 1 | 1 |
| Trypanosoma cruzi | p450 reductase, putative | 0.0027 | 0.6033 | 0.5 |
| Brugia malayi | flavodoxin family protein | 0.0027 | 0.6033 | 0.5397 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0036 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0036 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0036 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0036 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0036 | 1 | 1 |
| Onchocerca volvulus | 0.0036 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Onchocerca volvulus | 0.0036 | 1 | 0.5 | |
| Brugia malayi | hypothetical protein | 0.0036 | 1 | 1 |
| Schistosoma mansoni | cytochrome P450 reductase | 0.0027 | 0.6033 | 0.6033 |
| Brugia malayi | sulfakinin receptor protein | 0.0036 | 1 | 1 |
| Trypanosoma cruzi | NADPH-dependent FMN/FAD containing oxidoreductase, putative | 0.0027 | 0.6033 | 0.5 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0036 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0036 | 1 | 1 |
| Trypanosoma brucei | NADPH-cytochrome p450 reductase, putative | 0.0027 | 0.6033 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Onchocerca volvulus | 0.0036 | 1 | 0.5 | |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0036 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | FAD binding domain-containing protein | 0.0027 | 0.6033 | 0.5397 |
| Brugia malayi | Serotonin receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0036 | 1 | 1 |
| Trypanosoma cruzi | cytochrome P450 reductase, putative | 0.0027 | 0.6033 | 0.5 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0036 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0036 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0036 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0036 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0036 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0036 | 1 | 1 |
| Giardia lamblia | Hypothetical protein | 0.0024 | 0.4651 | 0.5 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0036 | 1 | 1 |
| Onchocerca volvulus | 0.0036 | 1 | 0.5 | |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0036 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0036 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0036 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0036 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0036 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0036 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0036 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0036 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0036 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | NADPH dependent diflavin oxidoreductase 1 | 0.0027 | 0.6033 | 0.5397 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0036 | 1 | 1 |
| Onchocerca volvulus | 0.0036 | 1 | 0.5 | |
| Brugia malayi | larval opioid receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0036 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Mycobacterium ulcerans | formate dehydrogenase H FdhF | 0.0027 | 0.6033 | 0.5 |
| Trypanosoma brucei | NADPH--cytochrome P450 reductase, putative | 0.0027 | 0.6033 | 0.5 |
| Schistosoma mansoni | neuropeptide receptor | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0036 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0036 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0036 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0036 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0036 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0036 | 1 | 1 |
| Onchocerca volvulus | 0.0036 | 1 | 0.5 | |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0036 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0036 | 1 | 1 |
| Chlamydia trachomatis | sulfite reductase | 0.0017 | 0.1382 | 0.5 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0036 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Trypanosoma brucei | NADPH-dependent diflavin oxidoreductase 1 | 0.0027 | 0.6033 | 0.5 |
| Schistosoma mansoni | opsin-like receptor | 0.0036 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0036 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0036 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0036 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0036 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0036 | 1 | 1 |
| Brugia malayi | FAD binding domain containing protein | 0.0027 | 0.6033 | 0.5397 |
| Brugia malayi | hypothetical protein | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0036 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0027 | 0.6033 | 0.5397 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0036 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0036 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0036 | 1 | 0.5 |
| Onchocerca volvulus | 0.0036 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0036 | 1 | 1 |
| Trypanosoma brucei | NADPH--cytochrome P450 reductase, putative | 0.0027 | 0.6033 | 0.5 |
| Schistosoma mansoni | amine GPCR | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0036 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0036 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0036 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0036 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0036 | 1 | 1 |
| Onchocerca volvulus | 0.0036 | 1 | 0.5 | |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0036 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0036 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0036 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0036 | 1 | 1 |
| Onchocerca volvulus | 0.0036 | 1 | 0.5 | |
| Echinococcus granulosus | hypothetical protein | 0.0036 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0036 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0036 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0036 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0036 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0036 | 1 | 1 |
| Trichomonas vaginalis | sulfite reductase, putative | 0.0027 | 0.6033 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0036 | 1 | 1 |
| Trypanosoma cruzi | cytochrome P450 reductase, putative | 0.0027 | 0.6033 | 0.5 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0036 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0036 | 1 | 1 |
| Giardia lamblia | Nitric oxide synthase, inducible | 0.0024 | 0.4651 | 0.5 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0036 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0036 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0036 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0036 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0036 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0036 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Plasmodium falciparum | nitric oxide synthase, putative | 0.0027 | 0.6033 | 0.5 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0036 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0036 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0036 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0036 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0036 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0036 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0036 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0036 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0036 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0036 | 1 | 1 |
| Onchocerca volvulus | 0.0036 | 1 | 0.5 | |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0036 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0036 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0036 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0036 | 1 | 1 |
| Echinococcus granulosus | NADPH cytochrome P450 reductase | 0.0027 | 0.6033 | 0.5397 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Onchocerca volvulus | 0.0036 | 1 | 0.5 | |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0036 | 1 | 1 |
| Onchocerca volvulus | 0.0036 | 1 | 0.5 | |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0036 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0036 | 1 | 1 |
| Onchocerca volvulus | 0.0036 | 1 | 0.5 | |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Onchocerca volvulus | 0.0036 | 1 | 0.5 | |
| Leishmania major | p450 reductase, putative | 0.0027 | 0.6033 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Plasmodium vivax | NADPH-cytochrome p450 reductase, putative | 0.0027 | 0.6033 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0036 | 1 | 1 |
| Onchocerca volvulus | 0.0036 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.0036 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0036 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0036 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0036 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0036 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0036 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0036 | 1 | 0.5 |
| Schistosoma mansoni | biogenic amine receptor | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0036 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0036 | 1 | 1 |
| Leishmania major | NADPH-cytochrome p450 reductase-like protein | 0.0027 | 0.6033 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0036 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0036 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0036 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0036 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0036 | 1 | 1 |
| Onchocerca volvulus | 0.0036 | 1 | 0.5 | |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0036 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0036 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0036 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0036 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0036 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0036 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0036 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | > 100 uM | Inhibition of nNOS in rat cerebellum homogenates assessed as reduction in conversion of L-[3H]arginine to L-[3H]citrulline | ChEMBL. | 22831803 |
| Inhibition (binding) | = 34 % | Inhibition of nNOS in rat cerebellum homogenates assessed as reduction in conversion of L-[3H]arginine to L-[3H]citrulline at 100 uM | ChEMBL. | 22831803 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL2071544
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.