Detailed information for compound 173128
Basic information
Technical information
- TDR Targets ID: 173128
- Name: (E)-4-(4-dimethylaminophenyl)but-3-en-2-one
- MW: 189.254 | Formula: C12H15NO
-
H donors: 0
H acceptors: 1
LogP: 2.15
Rotable bonds: 3
Rule of 5 violations (Lipinski): 1 - SMILES: CC(=O)/C=C/c1ccc(cc1)N(C)C
- InChi: 1S/C12H15NO/c1-10(14)4-5-11-6-8-12(9-7-11)13(2)3/h4-9H,1-3H3/b5-4+
- InChiKey: IAMOQOMGCKCSEJ-SNAWJCMRSA-N
Network
Hover on a compound node to display the structore
Synonyms
- (E)-4-(4-dimethylaminophenyl)-3-buten-2-one
- 4-(4-N,N-dimethylaminophenyl)but-3-en-2-one
- 4-(4-dimethylaminophenyl)but-3-en-2-one
- 5432-53-1
- 30625-58-2
- 3-Buten-2-one, 4-(4-(dimethylamino)phenyl)-
- SBB017113
- 4-(4-(Dimethylamino)phenyl)-3-buten-2-one
- AI3-31810
- DMAPB
- 3-Buten-2-one, 4-[4-(dimethylamino)phenyl]-
- 3-Buten-2-one, 4-[p-(dimethylamino)phenyl]-
- NSC11433
- ZINC00159652
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Schistosoma mansoni | histamine h1 receptor | 0.0078 | 1 | 1 |
| Onchocerca volvulus | 0.0078 | 1 | 0.5 | |
| Brugia malayi | sulfakinin receptor protein | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0078 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Trypanosoma brucei | proteasome subunit beta type-5, putative | 0.0051 | 0.2979 | 1 |
| Giardia lamblia | Proteasome subunit beta type 5 precursor | 0.0051 | 0.2979 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0078 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0078 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0078 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | proteasome catalytic subunit 3 (T01 family) | 0.0051 | 0.2979 | 0.2979 |
| Echinococcus granulosus | fmrfamide receptor | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0078 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0078 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Mycobacterium ulcerans | proteasome PrcB | 0.0051 | 0.2979 | 0.5 |
| Onchocerca volvulus | 0.0078 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0078 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0078 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0078 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0078 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0078 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0078 | 1 | 1 |
| Onchocerca volvulus | 0.0078 | 1 | 0.5 | |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0078 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0078 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Onchocerca volvulus | 0.0078 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.0078 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0078 | 1 | 1 |
| Onchocerca volvulus | 0.0078 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0078 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0078 | 1 | 1 |
| Trichomonas vaginalis | Family T1, proteasome beta subunit, threonine peptidase | 0.0051 | 0.2979 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0078 | 1 | 1 |
| Onchocerca volvulus | 0.0078 | 1 | 0.5 | |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Entamoeba histolytica | proteasome subunit beta type 5 precursor, putative | 0.0051 | 0.2979 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Toxoplasma gondii | proteasome subunit beta type, putative | 0.0051 | 0.2979 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0078 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0078 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0078 | 1 | 1 |
| Onchocerca volvulus | 0.0078 | 1 | 0.5 | |
| Echinococcus granulosus | sex peptide receptor | 0.0078 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0078 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0078 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0078 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0078 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0078 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0078 | 1 | 0.5 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0078 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0078 | 1 | 1 |
| Onchocerca volvulus | 0.0078 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0078 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0078 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0078 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0078 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0078 | 1 | 1 |
| Onchocerca volvulus | 0.0078 | 1 | 0.5 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0078 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0078 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0078 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0078 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0078 | 1 | 0.5 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0078 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | proteasome A-type and B-type family protein | 0.0051 | 0.2979 | 0.2979 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0078 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | proteasome (prosome, macropain) | 0.0051 | 0.2979 | 0.2979 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0078 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0078 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0078 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0078 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0078 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0078 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0078 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0078 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0078 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0078 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0078 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Trypanosoma cruzi | proteasome subunit beta type-5, putative | 0.0051 | 0.2979 | 1 |
| Trypanosoma cruzi | proteasome subunit beta type-5, putative | 0.0051 | 0.2979 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0078 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0078 | 1 | 1 |
| Leishmania major | proteasome beta 5 subunit, putative | 0.0051 | 0.2979 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0078 | 1 | 1 |
| Onchocerca volvulus | 0.0078 | 1 | 0.5 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Echinococcus granulosus | proteasome prosome macropain | 0.0051 | 0.2979 | 0.2979 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0078 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0078 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0078 | 1 | 1 |
| Onchocerca volvulus | 0.0078 | 1 | 0.5 | |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0078 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0078 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0078 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0078 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0078 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0078 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0078 | 1 | 1 |
| Onchocerca volvulus | 0.0078 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0078 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0078 | 1 | 0.5 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0078 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0078 | 1 | 1 |
| Mycobacterium tuberculosis | Proteasome beta subunit PrcB; assembles with alpha subunit PrcA. | 0.0051 | 0.2979 | 0.5 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Plasmodium vivax | proteasome subunit beta type-5, putative | 0.0051 | 0.2979 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0078 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0078 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0078 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Onchocerca volvulus | 0.0078 | 1 | 0.5 | |
| Schistosoma mansoni | biogenic amine receptor | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0078 | 1 | 1 |
| Onchocerca volvulus | 0.0078 | 1 | 0.5 | |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0078 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0078 | 1 | 1 |
| Brugia malayi | Proteasome A-type and B-type family protein | 0.0051 | 0.2979 | 0.2979 |
| Schistosoma mansoni | amine GPCR | 0.0078 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0078 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0078 | 1 | 1 |
| Plasmodium falciparum | proteasome subunit beta type-5 | 0.0051 | 0.2979 | 1 |
| Brugia malayi | Dopamine receptor | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0078 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0078 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0078 | 1 | 1 |
| Mycobacterium leprae | proteasome (beta subunit) PrcB | 0.0051 | 0.2979 | 0.5 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0078 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0078 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0078 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0078 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0078 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0078 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0078 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0078 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0078 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0078 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0078 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0078 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0078 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (functional) | = 90 uM | In vitro cell growth inhibitory activity against K562 human chronic myelogenous leukemia cell line | ChEMBL. | No reference |
| IC50 (functional) | = 90 uM | In vitro cell growth inhibitory activity against K562 human chronic myelogenous leukemia cell line | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.