Detailed information for compound 1766371
Basic information
Technical information
- Name: Unnamed compound
- MW: 370.401 | Formula: C23H18N2O3
-
H donors: 3
H acceptors: 3
LogP: 3.77
Rotable bonds: 6
Rule of 5 violations (Lipinski): 1 - SMILES: ONC(=O)[C@@H](c1ccccc1)NC(=O)c1ccc(cc1)C#Cc1ccccc1
- InChi: 1S/C23H18N2O3/c26-22(24-21(23(27)25-28)19-9-5-2-6-10-19)20-15-13-18(14-16-20)12-11-17-7-3-1-4-8-17/h1-10,13-16,21,28H,(H,24,26)(H,25,27)/t21-/m1/s1
- InChiKey: KHJVWCHVQMYPRJ-OAQYLSRUSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Leishmania major | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.016 | 0.6036 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0241 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0241 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0241 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0241 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0105 | 0.3331 | 0.4996 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | glyceraldehyde-3-phosphate dehydrogenase | 0.011 | 0.361 | 0.3545 |
| Schistosoma mansoni | opsin-like receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0241 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0241 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Toxoplasma gondii | glyceraldehyde-3-phosphate dehydrogenase GAPDH1 | 0.016 | 0.6036 | 0.5 |
| Loa Loa (eye worm) | glyceraldehyde 3-phosphate dehydrogenase | 0.0105 | 0.3335 | 0.3267 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0241 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Brugia malayi | ORL1-like opioid receptor | 0.0241 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0241 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Trypanosoma brucei | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.016 | 0.6036 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0241 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Schistosoma mansoni | cell adhesion molecule | 0.0039 | 0.0101 | 0.0101 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0241 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0241 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0105 | 0.3335 | 0.4737 |
| Echinococcus multilocularis | somatostatin receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0241 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0105 | 0.3335 | 0.3267 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 0.0466 | 0.0369 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Entamoeba histolytica | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 0.5 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0241 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0241 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0241 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0241 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | TK/KIN16 protein kinase | 0.0178 | 0.6911 | 0.688 |
| Schistosoma mansoni | opsin-like receptor | 0.0241 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Echinococcus multilocularis | glyceraldehyde 3 phosphate dehydrogenase | 0.0105 | 0.3335 | 0.3335 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0241 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0105 | 0.3331 | 0.4996 |
| Loa Loa (eye worm) | glyceraldehyde-3-phosphate dehydrogenase | 0.011 | 0.361 | 0.3545 |
| Echinococcus multilocularis | serotonin receptor | 0.0241 | 1 | 1 |
| Mycobacterium ulcerans | glyceraldehyde 3-phosphate dehydrogenase Gap | 0.016 | 0.6036 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Brugia malayi | neuropeptide F receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | glyceraldehyde 3 phosphate dehydrogenase | 0.0105 | 0.3335 | 0.3335 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0241 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Echinococcus granulosus | glyceraldehyde 3 phosphate dehydrogenase | 0.016 | 0.6036 | 0.6036 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Echinococcus granulosus | neuropeptide receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Echinococcus multilocularis | g protein coupled receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0241 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0241 | 1 | 1 |
| Plasmodium falciparum | glyceraldehyde-3-phosphate dehydrogenase | 0.016 | 0.6036 | 0.5 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.016 | 0.6036 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0241 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0241 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0241 | 1 | 1 |
| Plasmodium vivax | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 0.5 |
| Brugia malayi | putative neuropeptide receptor | 0.0241 | 1 | 1 |
| Mycobacterium leprae | Probable glyceraldehyde 3-phosphate dehydrogenase Gap (GAPDH) | 0.0055 | 0.091 | 0.5 |
| Echinococcus multilocularis | glyceraldehyde 3 phosphate dehydrogenase | 0.016 | 0.6036 | 0.6036 |
| Brugia malayi | G-protein coupled receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0241 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Echinococcus multilocularis | roundabout 2 | 0.0046 | 0.0466 | 0.0466 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0241 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.016 | 0.6036 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0241 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0105 | 0.3335 | 0.4737 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0241 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0241 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0241 | 1 | 1 |
| Brugia malayi | Glyceraldehyde 3-phosphate dehydrogenase | 0.016 | 0.6036 | 0.5769 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0241 | 1 | 1 |
| Echinococcus granulosus | roundabout 2 | 0.0046 | 0.0466 | 0.0466 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | neurotracting:lsamp:neurotrimin:obcam | 0.0039 | 0.0101 | 0.0101 |
| Brugia malayi | GnHR receptor homolog | 0.0241 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0241 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0241 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | glyceraldehyde 3 phosphate dehydrogenase | 0.016 | 0.6036 | 0.6036 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.016 | 0.6036 | 0.6036 |
| Schistosoma mansoni | biogenic amine receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | glyceraldehyde 3 phosphate dehydrogenase | 0.016 | 0.6036 | 0.6036 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0241 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0241 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0241 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0241 | 1 | 1 |
| Giardia lamblia | Glyceraldehyde 3-phosphate dehydrogenase | 0.016 | 0.6036 | 1 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 0.0466 | 0.0369 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0241 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0241 | 1 | 1 |
| Treponema pallidum | glyceraldehyde 3-phosphate dehydrogenase (gap) | 0.016 | 0.6036 | 0.5 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Leishmania major | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.016 | 0.6036 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Brugia malayi | Glyceraldehyde 3-phosphate dehydrogenase | 0.0055 | 0.0905 | 0.0293 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.016 | 0.6036 | 1 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0241 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0241 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Entamoeba histolytica | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 0.5 |
| Schistosoma mansoni | adenoreceptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | glyceraldehyde 3-phosphate dehydrogenase | 0.0105 | 0.3335 | 0.3267 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0241 | 1 | 1 |
| Trypanosoma brucei | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.016 | 0.6036 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Wolbachia endosymbiont of Brugia malayi | glyceraldehyde-3-phosphate dehydrogenase, GapA | 0.016 | 0.6036 | 0.5 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0241 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.016 | 0.6036 | 0.6036 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0241 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0241 | 1 | 1 |
| Chlamydia trachomatis | glyceraldehyde-3-phosphate dehydrogenase | 0.016 | 0.6036 | 0.5 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Brugia malayi | RE15519p | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Brugia malayi | Immunoglobulin I-set domain containing protein | 0.0178 | 0.6911 | 0.6703 |
| Toxoplasma gondii | glyceraldehyde-3-phosphate dehydrogenase GAPDH2 | 0.016 | 0.6036 | 0.5 |
| Schistosoma mansoni | biogenic amine receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0241 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0241 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Onchocerca volvulus | Tyrosine kinase homolog | 0.0147 | 0.5381 | 0.0968 |
| Mycobacterium tuberculosis | Probable glyceraldehyde 3-phosphate dehydrogenase Gap (GAPDH) | 0.0055 | 0.091 | 0.5 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.016 | 0.6036 | 0.6036 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0241 | 1 | 1 |
| Trypanosoma brucei | glyceraldehyde 3-phosphate dehydrogenase, cytosolic | 0.016 | 0.6036 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Entamoeba histolytica | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.016 | 0.6036 | 0.6036 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| MIC (functional) | = 12.5 uM | Antibacterial activity against wild-type Escherichia coli ARC523 by CLSI method | ChEMBL. | 23499237 |
| MIC (functional) | > 200 uM | Antibacterial activity against wild-type Plasmodium falciparum ARC545 by CLSI method | ChEMBL. | 23499237 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL2377566
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.