Detailed information for compound 1772702
Basic information
Technical information
- Name: Unnamed compound
- MW: 347.412 | Formula: C17H25N5O3
-
H donors: 1
H acceptors: 3
LogP: 1.6
Rotable bonds: 5
Rule of 5 violations (Lipinski): 1 - SMILES: CC(=CCn1c(OC[C@H]2CCCN2)nc2c1c(=O)n(c(=O)n2C)C)C
- InChi: 1S/C17H25N5O3/c1-11(2)7-9-22-13-14(20(3)17(24)21(4)15(13)23)19-16(22)25-10-12-6-5-8-18-12/h7,12,18H,5-6,8-10H2,1-4H3/t12-/m1/s1
- InChiKey: CVJWBMIJZVYAIY-GFCCVEGCSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus multilocularis | somatostatin receptor | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0079 | 1 | 0.5 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0079 | 1 | 0.5 |
| Brugia malayi | sulfakinin receptor protein | 0.0079 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | CYP4Cod1 | 0.0077 | 0.9395 | 0.9395 |
| Brugia malayi | RE15519p | 0.0079 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0079 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0079 | 1 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0079 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0079 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | allatostatin A receptor | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0079 | 1 | 0.5 |
| Onchocerca volvulus | 0.0079 | 1 | 0.5 | |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0079 | 1 | 0.5 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0079 | 1 | 0.5 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0079 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0079 | 1 | 0.5 |
| Brugia malayi | neuropeptide F receptor | 0.0079 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0079 | 1 | 0.5 |
| Onchocerca volvulus | 0.0079 | 1 | 0.5 | |
| Echinococcus granulosus | neuropeptide receptor | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | somatostatin receptor | 0.0079 | 1 | 0.5 |
| Onchocerca volvulus | 0.0079 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0079 | 1 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0079 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0079 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0079 | 1 | 0.5 |
| Leishmania major | cytochrome p450-like protein | 0.0077 | 0.9395 | 0.5 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0079 | 1 | 0.5 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0079 | 1 | 0.5 |
| Brugia malayi | Dopamine receptor | 0.0079 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0079 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | myosin xvIII | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | neuropeptide receptor | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0079 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0079 | 1 | 0.5 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0079 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0079 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | g protein coupled receptor | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0079 | 1 | 0.5 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0079 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0079 | 1 | 0.5 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0079 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0079 | 1 | 0.5 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0079 | 1 | 0.5 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0079 | 1 | 0.5 |
| Brugia malayi | ORL1-like opioid receptor | 0.0079 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0079 | 1 | 0.5 |
| Onchocerca volvulus | 0.0079 | 1 | 0.5 | |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0079 | 1 | 1 |
| Onchocerca volvulus | 0.0079 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0079 | 1 | 0.5 |
| Brugia malayi | G-protein coupled receptor | 0.0079 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0079 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptide receptor | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | opsin-like receptor | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | neuropeptide receptor | 0.0079 | 1 | 0.5 |
| Onchocerca volvulus | 0.0079 | 1 | 0.5 | |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0079 | 1 | 0.5 |
| Brugia malayi | GnHR receptor homolog | 0.0079 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | fmrfamide receptor | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.0079 | 1 | 0.5 |
| Brugia malayi | Melatonin receptor type 1A | 0.0079 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0079 | 1 | 0.5 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0079 | 1 | 0.5 |
| Echinococcus multilocularis | serotonin receptor | 0.0079 | 1 | 0.5 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | amine GPCR | 0.0079 | 1 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0079 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0079 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | opsin-like receptor | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0079 | 1 | 0.5 |
| Brugia malayi | larval opioid receptor | 0.0079 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0079 | 1 | 0.5 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0079 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0079 | 1 | 0.5 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0079 | 1 | 1 |
| Onchocerca volvulus | 0.0079 | 1 | 0.5 | |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0079 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0079 | 1 | 0.5 |
| Onchocerca volvulus | 0.0079 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0079 | 1 | 0.5 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Trypanosoma cruzi | cytochrome P450, putative | 0.0077 | 0.9395 | 0.5 |
| Brugia malayi | Serotonin receptor | 0.0079 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | cytochrome P450 family protein | 0.0077 | 0.9395 | 0.9395 |
| Schistosoma mansoni | amine GPCR | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0079 | 1 | 0.5 |
| Onchocerca volvulus | 0.0079 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0079 | 1 | 0.5 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0079 | 1 | 0.5 |
| Onchocerca volvulus | 0.0079 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0079 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0079 | 1 | 0.5 | |
| Schistosoma mansoni | biogenic amine receptor | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Trypanosoma cruzi | cytochrome P450, putative | 0.0077 | 0.9395 | 0.5 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0079 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0079 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0079 | 1 | 0.5 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0079 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0079 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Mycobacterium ulcerans | cytochrome P450 185A4 Cyp185A4 | 0.0077 | 0.9395 | 0.5 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0079 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0079 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0079 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0079 | 1 | 0.5 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0079 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0079 | 1 | 0.5 |
| Brugia malayi | G-protein coupled receptor | 0.0079 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0079 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | g protein coupled receptor | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0079 | 1 | 0.5 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0079 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0079 | 1 | 0.5 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0079 | 1 | 0.5 |
| Brugia malayi | neuropeptide F receptor | 0.0079 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0079 | 1 | 0.5 |
| Onchocerca volvulus | 0.0079 | 1 | 0.5 | |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0079 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0079 | 1 | 0.5 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0079 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0079 | 1 | 0.5 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | cytochrome P450 family protein | 0.0077 | 0.9395 | 0.9395 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Onchocerca volvulus | 0.0079 | 1 | 0.5 | |
| Brugia malayi | AKH receptor | 0.0079 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0079 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0079 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0079 | 1 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0079 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0079 | 1 | 0.5 |
| Trypanosoma brucei | cytochrome P450, putative | 0.0077 | 0.9395 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0079 | 1 | 0.5 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0079 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0079 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | opsin-like receptor | 0.0079 | 1 | 0.5 |
| Brugia malayi | G protein-coupled receptor | 0.0079 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0079 | 1 | 0.5 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0079 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0079 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0079 | 1 | 0.5 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0079 | 1 | 0.5 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0079 | 1 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0079 | 1 | 0.5 |
| Onchocerca volvulus | 0.0079 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0079 | 1 | 0.5 |
| Onchocerca volvulus | 0.0079 | 1 | 0.5 | |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0079 | 1 | 0.5 |
| Onchocerca volvulus | 0.0079 | 1 | 0.5 | |
| Schistosoma mansoni | histamine h1 receptor | 0.0079 | 1 | 0.5 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Activity (binding) | > 7000 nM | Inhibition of porcine DPP4 assessed as residual enzyme activity using H-Gly-Pro-AMC as substrate by fluorescence assay | ChEMBL. | 24900744 |
| Activity (binding) | > 7000 nM | Inhibition of human DPP4 assessed as residual enzyme activity using H-Gly-Pro-AMC as substrate by fluorescence assay | ChEMBL. | 24900744 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL2408647
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.