Detailed information for compound 1781526
Basic information
Technical information
- Name: Unnamed compound
- MW: 445.542 | Formula: C17H15N7O2S3
-
H donors: 0
H acceptors: 7
LogP: 3.88
Rotable bonds: 7
Rule of 5 violations (Lipinski): 1 - SMILES: Cc1cc(C)n2c(n1)nc(n2)SCc1nnc(s1)SCc1cccc(c1)[N+](=O)[O-]
- InChi: 1S/C17H15N7O2S3/c1-10-6-11(2)23-15(18-10)19-16(22-23)27-9-14-20-21-17(29-14)28-8-12-4-3-5-13(7-12)24(25)26/h3-7H,8-9H2,1-2H3
- InChiKey: SPBGIEBTEQNBDG-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0472 | 1 | 1 |
| Leishmania major | dihydrofolate reductase-thymidylate synthase | 0.0151 | 0.2971 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0472 | 1 | 1 |
| Trypanosoma brucei | dihydrofolate reductase-thymidylate synthase | 0.0151 | 0.2971 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0472 | 1 | 1 |
| Schistosoma mansoni | voltage-gated potassium channel | 0.0022 | 0.0151 | 0.0151 |
| Schistosoma mansoni | neuropeptide receptor | 0.0472 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0472 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0472 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0472 | 1 | 1 |
| Brugia malayi | Dihydrofolate reductase | 0.0394 | 0.8295 | 0.8295 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0472 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0472 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0472 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0258 | 0.5312 | 0.5312 |
| Mycobacterium ulcerans | dihydrofolate reductase DfrA | 0.0394 | 0.8295 | 1 |
| Brugia malayi | AKH receptor | 0.0472 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0472 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0472 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0472 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0472 | 1 | 1 |
| Onchocerca volvulus | 0.0472 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0472 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0472 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0472 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0472 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0472 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0472 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0472 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0258 | 0.5312 | 0.5312 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0472 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0472 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0472 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0472 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Onchocerca volvulus | 0.0472 | 1 | 1 | |
| Onchocerca volvulus | 0.0472 | 1 | 1 | |
| Schistosoma mansoni | hypothetical protein | 0.0472 | 1 | 1 |
| Onchocerca volvulus | 0.0472 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0065 | 0.1102 | 0.1102 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0472 | 1 | 1 |
| Brugia malayi | Voltage-gated potassium channel, EAG (KCNH1)-related. C. elegans egl-2 ortholog | 0.0022 | 0.0151 | 0.0151 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0472 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0022 | 0.0151 | 0.0151 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0472 | 1 | 1 |
| Brugia malayi | TspO/MBR family protein | 0.0258 | 0.5312 | 0.5312 |
| Brugia malayi | dihydrofolate reductase family protein | 0.0394 | 0.8295 | 0.8295 |
| Brugia malayi | Serotonin receptor | 0.0472 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0472 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0472 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0472 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0472 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0472 | 1 | 1 |
| Onchocerca volvulus | 0.0472 | 1 | 1 | |
| Brugia malayi | G-protein coupled receptor | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | voltage and ligand gated potassium channel | 0.0075 | 0.1319 | 0.1319 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0472 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0472 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0472 | 1 | 1 |
| Onchocerca volvulus | 0.0472 | 1 | 1 | |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0472 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0472 | 1 | 1 |
| Plasmodium falciparum | bifunctional dihydrofolate reductase-thymidylate synthase | 0.0151 | 0.2971 | 0.5 |
| Onchocerca volvulus | 0.0472 | 1 | 1 | |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0472 | 1 | 1 |
| Onchocerca volvulus | 0.0472 | 1 | 1 | |
| Brugia malayi | Serotonin receptor | 0.0472 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0472 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0472 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0472 | 1 | 1 |
| Schistosoma mansoni | voltage-gated potassium channel | 0.0022 | 0.0151 | 0.0151 |
| Schistosoma mansoni | voltage-gated potassium channel | 0.0082 | 0.147 | 0.147 |
| Brugia malayi | sulfakinin receptor protein | 0.0472 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0472 | 1 | 1 |
| Onchocerca volvulus | 0.0472 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0472 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0472 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0472 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0258 | 0.5312 | 0.5312 |
| Schistosoma mansoni | peripheral-type benzodiazepine receptor | 0.0258 | 0.5312 | 0.5312 |
| Echinococcus granulosus | g protein coupled receptor | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0472 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0472 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0472 | 1 | 1 |
| Trichomonas vaginalis | voltage and ligand gated potassium channel, putative | 0.007 | 0.1211 | 1 |
| Brugia malayi | RE15519p | 0.0472 | 1 | 1 |
| Onchocerca volvulus | 0.0472 | 1 | 1 | |
| Schistosoma mansoni | myosin xvIII | 0.0472 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0472 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0472 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0472 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0472 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0472 | 1 | 1 |
| Toxoplasma gondii | bifunctional dihydrofolate reductase-thymidylate synthase | 0.0151 | 0.2971 | 0.5 |
| Plasmodium vivax | bifunctional dihydrofolate reductase-thymidylate synthase, putative | 0.0151 | 0.2971 | 0.5 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0472 | 1 | 1 |
| Echinococcus granulosus | translocator protein | 0.0258 | 0.5312 | 0.5312 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0472 | 1 | 1 |
| Onchocerca volvulus | 0.0472 | 1 | 1 | |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0472 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0472 | 1 | 1 |
| Brugia malayi | Voltage-gated potassium channel, HERG (KCNH2)-related. C. elegans unc-103 ortholog | 0.0075 | 0.1319 | 0.1319 |
| Mycobacterium leprae | DIHYDROFOLATE REDUCTASE DFRA (DHFR) (TETRAHYDROFOLATE DEHYDROGENASE) | 0.0394 | 0.8295 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0472 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0472 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0472 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0472 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0472 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0472 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0472 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0472 | 1 | 1 |
| Trichomonas vaginalis | voltage and ligand gated potassium channel, putative | 0.007 | 0.1211 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0472 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | voltage gated potassium channel | 0.0022 | 0.0151 | 0.0151 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0472 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus granulosus | voltage gated potassium channel | 0.0022 | 0.0151 | 0.0151 |
| Brugia malayi | G protein-coupled receptor | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0472 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0472 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0472 | 1 | 1 |
| Schistosoma mansoni | voltage-gated potassium channel | 0.0082 | 0.147 | 0.147 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0472 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0472 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0472 | 1 | 1 |
| Echinococcus granulosus | potassium voltage gated channel subfamily H | 0.0022 | 0.0151 | 0.0151 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0472 | 1 | 1 |
| Schistosoma mansoni | nuclear hormone receptor superfamily protein-related | 0.0342 | 0.7164 | 0.7164 |
| Echinococcus granulosus | sex peptide receptor | 0.0472 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus granulosus | dihydrofolate reductase | 0.0394 | 0.8295 | 0.8295 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0472 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0472 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0472 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0472 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0472 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0258 | 0.5312 | 0.5312 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0472 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0472 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0472 | 1 | 1 |
| Schistosoma mansoni | dihydrofolate reductase | 0.0394 | 0.8295 | 0.8295 |
| Schistosoma mansoni | hypothetical protein | 0.0472 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0472 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0472 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Onchocerca volvulus | 0.0472 | 1 | 1 | |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0472 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0472 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0472 | 1 | 1 |
| Trypanosoma cruzi | dihydrofolate reductase-thymidylate synthase | 0.0151 | 0.2971 | 0.5 |
| Onchocerca volvulus | 0.0472 | 1 | 1 | |
| Echinococcus multilocularis | translocator protein | 0.0258 | 0.5312 | 0.5312 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0472 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0472 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | potassium voltage gated channel subfamily H | 0.0075 | 0.1319 | 0.1319 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0472 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0472 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0472 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | potassium voltage gated channel subfamily H | 0.0022 | 0.0151 | 0.0151 |
| Onchocerca volvulus | 0.0472 | 1 | 1 | |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0472 | 1 | 1 |
| Onchocerca volvulus | 0.0472 | 1 | 1 | |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0472 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0472 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0472 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0472 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0472 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0104 | 0.1951 | 0.1951 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0472 | 1 | 1 |
| Mycobacterium tuberculosis | Dihydrofolate reductase DfrA (DHFR) (tetrahydrofolate dehydrogenase) | 0.0394 | 0.8295 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0472 | 1 | 1 |
| Echinococcus granulosus | potassium voltage gated channel subfamily H | 0.0075 | 0.1319 | 0.1319 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0472 | 1 | 1 |
| Chlamydia trachomatis | dihydrofolate reductase | 0.0394 | 0.8295 | 0.5 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | dihydrofolate reductase | 0.0394 | 0.8295 | 0.8295 |
| Echinococcus multilocularis | dihydrofolate reductase | 0.0394 | 0.8295 | 0.8295 |
| Onchocerca volvulus | 0.0472 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0472 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0472 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0472 | 1 | 1 |
| Onchocerca volvulus | 0.0472 | 1 | 1 | |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0472 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| MIC (functional) | = 25 ug ml-1 | Antibacterial activity against Escherichia coli ATCC 35218 assessed as growth inhibition after 24 hrs by two-fold serial dilution method | ChEMBL. | 23644188 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL2386021
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.