Detailed information for compound 1816722
Basic information
Technical information
- Name: Unnamed compound
- MW: 364.462 | Formula: C15H12N2O3S3
-
H donors: 2
H acceptors: 3
LogP: 2.3
Rotable bonds: 3
Rule of 5 violations (Lipinski): 1 - SMILES: S=C1NC(=O)/C(=C\c2ccc(s2)c2ccc(cc2)S(=O)(=O)C)/N1
- InChi: 1S/C15H12N2O3S3/c1-23(19,20)11-5-2-9(3-6-11)13-7-4-10(22-13)8-12-14(18)17-15(21)16-12/h2-8H,1H3,(H2,16,17,18,21)/b12-8+
- InChiKey: LSAATOAIMHPTGE-XYOKQWHBSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | perforin 1 (pore forming protein) | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0032 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0032 | 1 | 1 |
| Echinococcus granulosus | Nuclear hormone receptor family member nhr 41 | 0.0024 | 0.5941 | 0.5941 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0032 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-14 | 0.0024 | 0.5941 | 0.5941 |
| Schistosoma mansoni | hypothetical protein | 0.0032 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0032 | 1 | 1 |
| Schistosoma mansoni | nuclear hormone receptor nor-1/nor-2 | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0032 | 1 | 1 |
| Schistosoma mansoni | nuclear receptor 2DBD-gamma | 0.0024 | 0.5941 | 0.5941 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0032 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0032 | 1 | 1 |
| Schistosoma mansoni | RAR-like nuclear receptor | 0.0024 | 0.5941 | 0.5941 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0032 | 1 | 1 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0032 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0032 | 1 | 1 |
| Echinococcus granulosus | retinoic acid receptor rxr beta a | 0.0024 | 0.5941 | 0.5941 |
| Brugia malayi | Nuclear hormone receptor family member nhr-3 | 0.0024 | 0.5941 | 0.5941 |
| Brugia malayi | steroid hormone receptor | 0.0024 | 0.5941 | 0.5941 |
| Schistosoma mansoni | hypothetical protein | 0.0032 | 1 | 1 |
| Brugia malayi | ecdysteroid receptor | 0.0024 | 0.5941 | 0.5941 |
| Onchocerca volvulus | 0.0032 | 1 | 1 | |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0032 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0032 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0032 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0032 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0032 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0032 | 1 | 1 |
| Echinococcus granulosus | COUP TF:Svp nuclear hormone receptor | 0.0024 | 0.5941 | 0.5941 |
| Onchocerca volvulus | 0.0032 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-49 | 0.0024 | 0.5941 | 0.5941 |
| Schistosoma mansoni | amine GPCR | 0.0032 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0032 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0032 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0032 | 1 | 1 |
| Brugia malayi | Steroid receptor seven-up type 2 | 0.0024 | 0.5941 | 0.5941 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-41 | 0.0024 | 0.5941 | 0.5941 |
| Onchocerca volvulus | 0.0032 | 1 | 1 | |
| Schistosoma mansoni | hypothetical protein | 0.0032 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0032 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0032 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | Nuclear hormone receptor family member nhr 41 | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus granulosus | g protein coupled receptor | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0032 | 1 | 1 |
| Schistosoma mansoni | FTZ-F1 nuclear receptor-like protein | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus granulosus | g protein coupled receptor | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | FTZ F1 nuclear receptor protein | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus multilocularis | thyroid hormone receptor alpha | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0032 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0032 | 1 | 1 |
| Brugia malayi | photoreceptor-specific nuclear receptor | 0.0024 | 0.5941 | 0.5941 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0032 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.5941 | 0.5941 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-31 | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0032 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.5941 | 0.5941 |
| Loa Loa (eye worm) | steroid hormone receptor | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0032 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0032 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0032 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | FTZ F1 alpha | 0.0024 | 0.5941 | 0.5941 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0024 | 0.5941 | 0.5941 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0032 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0032 | 1 | 1 |
| Onchocerca volvulus | 0.0032 | 1 | 1 | |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0032 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | COUP TF:Svp nuclear hormone receptor | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0032 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0032 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0032 | 1 | 1 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0032 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0032 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0032 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus granulosus | hypothetical protein | 0.0032 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0032 | 1 | 1 |
| Schistosoma mansoni | steroid hormone receptor ad4bp | 0.0024 | 0.5941 | 0.5941 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0032 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0032 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0032 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-1 | 0.0024 | 0.5941 | 0.5941 |
| Schistosoma mansoni | amine GPCR | 0.0032 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-49 | 0.0024 | 0.5941 | 0.5941 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.5941 | 0.5941 |
| Onchocerca volvulus | 0.0032 | 1 | 1 | |
| Schistosoma mansoni | neuropeptide receptor | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0032 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-31 | 0.0024 | 0.5941 | 0.5941 |
| Schistosoma mansoni | amine GPCR | 0.0032 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0032 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0032 | 1 | 1 |
| Schistosoma mansoni | retinoic acid receptor RXR | 0.0024 | 0.5941 | 0.5941 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-40 | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus multilocularis | sex peptide receptor | 0.0032 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Onchocerca volvulus | 0.0032 | 1 | 1 | |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.5941 | 0.5941 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0032 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0032 | 1 | 1 |
| Echinococcus granulosus | ecdysone induced protein 78C | 0.0024 | 0.5941 | 0.5941 |
| Schistosoma mansoni | Tr4/Tr2 (homologue) | 0.0024 | 0.5941 | 0.5941 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0032 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0024 | 0.5941 | 0.5941 |
| Brugia malayi | hypothetical protein | 0.0032 | 1 | 1 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0024 | 0.5941 | 0.5941 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0032 | 1 | 1 |
| Schistosoma mansoni | coup transcription factor | 0.0024 | 0.5941 | 0.5941 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-14 | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus granulosus | neuropeptide receptor | 0.0032 | 1 | 1 |
| Onchocerca volvulus | 0.0032 | 1 | 1 | |
| Echinococcus multilocularis | g protein coupled receptor | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0032 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0032 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-40 | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus granulosus | g protein coupled receptor | 0.0032 | 1 | 1 |
| Brugia malayi | nuclear hormone receptor | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0032 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0032 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Onchocerca volvulus | 0.0032 | 1 | 1 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0032 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0032 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0032 | 1 | 1 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0024 | 0.5941 | 0.5941 |
| Brugia malayi | Nuclear hormone receptor family member nhr-41 | 0.0024 | 0.5941 | 0.5941 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | ecdysone induced protein 78C | 0.0024 | 0.5941 | 0.5941 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0032 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0032 | 1 | 1 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0024 | 0.5941 | 0.5941 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0032 | 1 | 1 |
| Schistosoma mansoni | photoreceptor-specific nuclear receptor related | 0.0024 | 0.5941 | 0.5941 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0032 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0032 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0032 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0032 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0032 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | hepatocyte nuclear factor 4 alpha | 0.0024 | 0.5941 | 0.5941 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0032 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0032 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0032 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0032 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0032 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0032 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0032 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0032 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0032 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0032 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0032 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0032 | 1 | 1 |
| Onchocerca volvulus | 0.0032 | 1 | 1 | |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0032 | 1 | 1 |
| Onchocerca volvulus | 0.0032 | 1 | 1 | |
| Echinococcus multilocularis | neuropeptide receptor | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Echinococcus granulosus | FTZ F1 nuclear receptor protein | 0.0024 | 0.5941 | 0.5941 |
| Schistosoma mansoni | myosin xvIII | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0032 | 1 | 1 |
| Onchocerca volvulus | 0.0032 | 1 | 1 | |
| Brugia malayi | G protein-coupled receptor | 0.0032 | 1 | 1 |
| Onchocerca volvulus | 0.0032 | 1 | 1 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.5941 | 0.5941 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Onchocerca volvulus | 0.0032 | 1 | 1 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Echinococcus granulosus | FTZ F1 alpha | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0032 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0032 | 1 | 1 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0024 | 0.5941 | 0.5941 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Onchocerca volvulus | 0.0032 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Echinococcus granulosus | hepatocyte nuclear factor 4 alpha | 0.0024 | 0.5941 | 0.5941 |
| Brugia malayi | nuclear receptor NHR-88 | 0.0024 | 0.5941 | 0.5941 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.5941 | 0.5941 |
| Brugia malayi | sulfakinin receptor protein | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0024 | 0.5941 | 0.5941 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.5941 | 0.5941 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Onchocerca volvulus | 0.0032 | 1 | 1 | |
| Brugia malayi | Serotonin receptor | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0032 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0032 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0032 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0032 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0032 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0032 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0032 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0032 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | nuclear Hormone Receptor family member | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0032 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0032 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0032 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0032 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-1 | 0.0024 | 0.5941 | 0.5941 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0032 | 1 | 1 |
| Onchocerca volvulus | 0.0032 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0032 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0032 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0032 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0032 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0032 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0032 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0032 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0032 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0032 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0032 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0032 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0032 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0032 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0032 | 1 | 1 |
| Onchocerca volvulus | 0.0032 | 1 | 1 | |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0032 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0032 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 13.8 uM | Inhibition of recombinant perforin (unknown origin)-mediated lysis of human [51Cr]-labelled Jurkat cells assessed as release of [51Cr] preincubated for 30 mins followed by addition of cells measured after 4 hrs by gamma counting analysis | ChEMBL. | 24195776 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL3104025
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.