Detailed information for compound 1829586
Basic information
Technical information
- Name: Unnamed compound
- MW: 331.275 | Formula: C13H17NO9
-
H donors: 8
H acceptors: 8
LogP: -2
Rotable bonds: 4
Rule of 5 violations (Lipinski): 2 - SMILES: OC[C@H]1O[C@@H](NC(=O)c2cc(O)c(c(c2)O)O)[C@@H]([C@H]([C@@H]1O)O)O
- InChi: 1S/C13H17NO9/c15-3-7-9(19)10(20)11(21)13(23-7)14-12(22)4-1-5(16)8(18)6(17)2-4/h1-2,7,9-11,13,15-21H,3H2,(H,14,22)/t7-,9-,10+,11-,13-/m1/s1
- InChiKey: XUJZFHXISHUMRM-JEUROIALSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | aldo-keto reductase family 1, member B1 (aldose reductase) | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Mycobacterium tuberculosis | Conserved protein | aldo-keto reductase family 1, member B1 (aldose reductase) | 316 aa | 325 aa | 24.6 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | TK protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase csk | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Onchocerca volvulus | 0.0277 | 1 | 1 | |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase pr2 | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase csk | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | transfer RNA-Thr | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/KIN16 protein kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TKL/RAF/KSR protein kinase | 0.0277 | 1 | 1 |
| Echinococcus granulosus | raf serine:threonine protein kinase | 0.0277 | 1 | 1 |
| Trypanosoma brucei | Flagellum attachment zone protein 20 | 0.0277 | 1 | 1 |
| Onchocerca volvulus | 0.0277 | 1 | 1 | |
| Loa Loa (eye worm) | TKL/RAF/RAF protein kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/INSR protein kinase | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine protein kinase fes (fps) (ptk group IV) | 0.0277 | 1 | 1 |
| Echinococcus granulosus | protein kinase | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Srms | 0.0277 | 1 | 1 |
| Giardia lamblia | Kinase, NEK | 0.0277 | 1 | 1 |
| Brugia malayi | Tyrosine-protein kinase abl-1 | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Schistosoma mansoni | proto-oncogene tyrosine-protein kinase src | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0277 | 1 | 1 |
| Brugia malayi | Immunoglobulin I-set domain containing protein | 0.0277 | 1 | 1 |
| Echinococcus granulosus | insulin receptor | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase csk | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Fyn | 0.0277 | 1 | 1 |
| Plasmodium falciparum | protein kinase, putative | 0.0277 | 1 | 0.5 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Lyn | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Fyn | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Abl | 0.0277 | 1 | 1 |
| Entamoeba histolytica | tyrosin kinase, putative | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Fyn | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | RGC/RGC protein kinase | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase ABL1 | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Trypanosoma cruzi | protein kinase, putative | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/ACK protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Echinococcus granulosus | retinal guanylyl cyclase 2 | 0.0277 | 1 | 1 |
| Giardia lamblia | Kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0277 | 1 | 1 |
| Echinococcus granulosus | integrin linked protein kinase | 0.0277 | 1 | 1 |
| Brugia malayi | SH2 domain containing protein | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Btk29A | 0.0277 | 1 | 1 |
| Trypanosoma cruzi | protein kinase, putative | 0.0277 | 1 | 1 |
| Entamoeba histolytica | cysteine surface protein, putative | 0.0277 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0277 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Echinococcus granulosus | epidermal growth factor receptor | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TKL/MLK/HH498 protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/EGFR protein kinase | 0.0277 | 1 | 1 |
| Brugia malayi | Tyrosine-protein kinase F09A5.2 in chromosome X, putative | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Brugia malayi | Raf kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0277 | 1 | 1 |
| Trypanosoma cruzi | STE/STE11 serine/threonine-protein kinase, putative | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TKL/STKR/TYPE1 protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase with ankyrin repeats, putative | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0277 | 1 | 1 |
| Schistosoma mansoni | serine/threonine RGC | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0277 | 1 | 1 |
| Echinococcus granulosus | c src tyrosine kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Echinococcus granulosus | mitogen-activated protein kinase kinase kinase 9 | 0.0277 | 1 | 1 |
| Onchocerca volvulus | 0.0277 | 1 | 1 | |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Trypanosoma cruzi | STE/STE11 serine/threonine-protein kinase, putative | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Entamoeba histolytica | ankyrin repeat protein | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/RYK protein kinase | 0.0277 | 1 | 1 |
| Toxoplasma gondii | protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase lyn lyn a protein tyrosine kinase lymphocyte specific protein tyrosine kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0277 | 1 | 1 |
| Entamoeba histolytica | receptor protein kinase, putative | 0.0277 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Echinococcus granulosus | mitogen activated protein kinase kinase kinase | 0.0277 | 1 | 1 |
| Onchocerca volvulus | 0.0277 | 1 | 1 | |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Brugia malayi | proto-oncogene tyrosine-protein kinase FER | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Onchocerca volvulus | 0.0277 | 1 | 1 | |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.0277 | 1 | 1 |
| Onchocerca volvulus | Tyrosine kinase receptor Cad96Ca homolog | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine kinase|tyrosine protein kinase Fyn | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine kinase | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase HCK | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | insulin growth factor 1 receptor beta | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | ankyrin repeat-containing protein, putative | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | leucine-rich repeat domain-containing protein | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | activated cdc42 kinase 1 | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | activin receptor type | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | STE family protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase HCK | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | serine/threonine kinase, putative | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | mitogen activated protein kinase kinase kinase | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Fyn | 0.0277 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Giardia lamblia | Protein 21.1 | 0.0277 | 1 | 1 |
| Plasmodium vivax | tyrosine kinase-like protein, putative | 0.0277 | 1 | 0.5 |
| Echinococcus multilocularis | tyrosine protein kinase Src42A | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Toxoplasma gondii | STE kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | FL cytokine receptor | 0.0277 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Fgr | 0.0277 | 1 | 1 |
| Toxoplasma gondii | Tyrosine kinase-like (TKL) protein | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | kinase suppressor of Ras 1 | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Schistosoma mansoni | ephrin receptor | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | c src tyrosine kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | protein kinase | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | basic fibroblast growth factor receptor 1 A | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK protein kinase | 0.0277 | 1 | 1 |
| Brugia malayi | C-terminal src kinase protein 1 | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | RGC/RGC protein kinase | 0.0277 | 1 | 1 |
| Echinococcus granulosus | retinal guanylyl cyclase 2 | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase csk | 0.0277 | 1 | 1 |
| Onchocerca volvulus | 0.0277 | 1 | 1 | |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Onchocerca volvulus | 0.0277 | 1 | 1 | |
| Entamoeba histolytica | hypothetical protein | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | serine-threonine protein kinase, putative | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | ephrin type A receptor 4 A | 0.0277 | 1 | 1 |
| Entamoeba histolytica | tyrosin kinase, putative | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0277 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | RGC/RGC protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK protein kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0277 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase transmembrane receptor | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/ALK protein kinase | 0.0277 | 1 | 1 |
| Brugia malayi | Adenylate and Guanylate cyclase catalytic domain containing protein | 0.0277 | 1 | 1 |
| Echinococcus granulosus | macrophage colony stimulating factor 1 receptor | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Onchocerca volvulus | 0.0277 | 1 | 1 | |
| Schistosoma mansoni | protein tyrosine kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | ankyrin repeat protein | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | receptor type guanylyl cyclase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | raf serine:threonine protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase transmembrane receptor | 0.0277 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Fps85D | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | AGC family protein kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0277 | 1 | 1 |
| Entamoeba histolytica | serine/threonine kinase, putative | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.0277 | 1 | 1 |
| Echinococcus granulosus | fibroblast growth factor receptor 4 | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Fes:Fps | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase transmembrane receptor | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0277 | 1 | 1 |
| Plasmodium vivax | protein kinase, putative | 0.0277 | 1 | 0.5 |
| Entamoeba histolytica | protein kinase, putative | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | heat shock protein 70 | 0.0277 | 1 | 1 |
| Onchocerca volvulus | 0.0277 | 1 | 1 | |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/ABL protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein, conserved | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0277 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0277 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Leishmania major | protein kinase, putative | 0.0277 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Fps85D | 0.0277 | 1 | 1 |
| Echinococcus granulosus | activated cdc42 kinase 1 | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | dual specificity testis specific protein kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | serine/threonine-protein kinase wnk, putative | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/Met protein kinase | 0.0277 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | serine/threonine protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Schistosoma mansoni | ephrin receptor | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0277 | 1 | 1 |
| Mycobacterium leprae | PROBABLE OXIDOREDUCTASE | 0.0038 | 0 | 0.5 |
| Trypanosoma brucei | protein kinase, putative | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Plasmodium vivax | tyrosine kinase-like protein, putative | 0.0277 | 1 | 0.5 |
| Entamoeba histolytica | protein kinase, putative | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase shark | 0.0277 | 1 | 1 |
| Plasmodium falciparum | tyrosine kinase-like protein | 0.0277 | 1 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | proto oncogene tyrosine protein kinase LCK | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0277 | 1 | 1 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0038 | 0 | 0.5 |
| Plasmodium falciparum | protein kinase, putative | 0.0277 | 1 | 0.5 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Entamoeba histolytica | receptor protein kinase, putative | 0.0277 | 1 | 1 |
| Onchocerca volvulus | 0.0277 | 1 | 1 | |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Blk | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase lyn tyrosine protein kinase blk | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TK family protein kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase transmembrane receptor | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine protein kinase fes (fps) (ptk group IV) | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/FAK protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Toxoplasma gondii | Tyrosine kinase-like (TKL) protein | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0277 | 1 | 1 |
| Giardia lamblia | Kinase, NEK | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0277 | 1 | 1 |
| Trypanosoma brucei | Pseudokinase, putative | 0.0277 | 1 | 1 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase csk | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | epidermal growth factor receptor | 0.0277 | 1 | 1 |
| Brugia malayi | SRC-1 | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Echinococcus granulosus | ephrin type A receptor 4 A | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK protein kinase | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Srms | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/ROR protein kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Toxoplasma gondii | calcium dependent protein kinase CDPK8 | 0.0277 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0277 | 1 | 1 |
| Echinococcus granulosus | 3'partial|tyrosine protein kinase Fgr | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase pr2 | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0277 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/CSK protein kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | retinal guanylyl cyclase 2 | 0.0277 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TKL/MLK/ILK protein kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase csk | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Brugia malayi | Furin-like cysteine rich region family protein | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0277 | 1 | 1 |
| Trypanosoma brucei | AGC/RSK family serine/threonine kinase, putative | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Echinococcus granulosus | insulin growth factor 1 receptor beta | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine kinase | 0.0277 | 1 | 1 |
| Echinococcus granulosus | receptor type guanylyl cyclase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | SH2-protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Leishmania major | protein kinase, putative | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/DDR protein kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/KIN6 protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase ABL1 | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine-protein kinase fps85d | 0.0277 | 1 | 1 |
| Brugia malayi | SH2 domain containing protein | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0277 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | macrophage colony stimulating factor 1 receptor | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | atrial natriuretic peptide receptor 1 | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0277 | 1 | 1 |
| Echinococcus granulosus | basic fibroblast growth factor receptor 1 A | 0.0277 | 1 | 1 |
| Brugia malayi | protein-tyrosine kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0277 | 1 | 1 |
| Schistosoma mansoni | proto-oncogene tyrosine-protein kinase src | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Btk29A | 0.0277 | 1 | 1 |
| Entamoeba histolytica | tyrosine- protein kinase 2, putative | 0.0277 | 1 | 1 |
| Onchocerca volvulus | Atrial natriuretic peptide receptor 3 homolog | 0.0277 | 1 | 1 |
| Schistosoma mansoni | src-type protein tyrosine kinase-related | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | retinal guanylyl cyclase 2 | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | protein kinase domain-containing protein | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0277 | 1 | 1 |
| Plasmodium falciparum | protein kinase, putative | 0.0277 | 1 | 0.5 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | insulin receptor | 0.0277 | 1 | 1 |
| Onchocerca volvulus | 0.0277 | 1 | 1 | |
| Echinococcus multilocularis | tyrosine protein kinase Src64B | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0277 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Brugia malayi | Immunoglobulin I-set domain containing protein | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0277 | 1 | 1 |
| Onchocerca volvulus | 0.0277 | 1 | 1 | |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | protein KINase family member (kin 25) | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Brugia malayi | Tyrosine-protein kinase PR2 | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine protein kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | integrin linked protein kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | tyrosin kinase, putative | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | SRC-1 | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Fyn | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | serine/threonine kinase, putative | 0.0277 | 1 | 1 |
| Brugia malayi | Receptor family ligand binding region containing protein | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TKL/MLK/TAK1 protein kinase | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0277 | 1 | 1 |
| Echinococcus granulosus | protein tyrosine kinase | 0.0277 | 1 | 1 |
| Brugia malayi | integrin-linked kinase | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/EPH protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Echinococcus granulosus | melanoma receptor tyrosine protein kinase | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Fes:Fps | 0.0277 | 1 | 1 |
| Entamoeba histolytica | serine/threonine kinase, putative | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | serine/threonine kinase, putative | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Fyn | 0.0277 | 1 | 1 |
| Onchocerca volvulus | Tyrosine kinase homolog | 0.0277 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Blk | 0.0277 | 1 | 1 |
| Echinococcus granulosus | activated cdc42 kinase 1 | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Toxoplasma gondii | protein kinase domain-containing protein | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | epidermal growth factor receptor | 0.0277 | 1 | 1 |
| Entamoeba histolytica | serine/threonine kinase, putative | 0.0277 | 1 | 1 |
| Echinococcus granulosus | proto oncogene tyrosine protein kinase LCK | 0.0277 | 1 | 1 |
| Plasmodium falciparum | tyrosine kinase-like protein | 0.0277 | 1 | 0.5 |
| Schistosoma mansoni | protein kinase | 0.0277 | 1 | 1 |
| Trypanosoma brucei | STE/STE11 serine/threonine-protein kinase, putative | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Brugia malayi | Adenylate and Guanylate cyclase catalytic domain containing protein | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | natriuretic peptide receptor 1 | 0.0277 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.0277 | 1 | 1 |
| Brugia malayi | ephrin receptor 1 precursor | 0.0277 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | protein kinase atn1, putative | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase shark | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Echinococcus granulosus | kinase suppressor of Ras 1 | 0.0277 | 1 | 1 |
| Echinococcus granulosus | retinal guanylyl cyclase 2 | 0.0277 | 1 | 1 |
| Brugia malayi | Probable tyrosine-protein kinase kin-31 | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Src64B | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | protein tyrosine kinase, putative | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Brugia malayi | Guanylyl cyclase protein 23 | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | protein tyrosine kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Fyn | 0.0277 | 1 | 1 |
| Onchocerca volvulus | 0.0277 | 1 | 1 | |
| Echinococcus multilocularis | tyrosine protein kinase Btk29A | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Echinococcus granulosus | 3'partial|retinal guanylyl cyclase 2 | 0.0277 | 1 | 1 |
| Mycobacterium ulcerans | oxidoreductase | 0.0038 | 0 | 0.5 |
| Onchocerca volvulus | 0.0277 | 1 | 1 | |
| Echinococcus granulosus | dual specificity testis-specific protein kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | retinal guanylyl cyclase 2 | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | TK protein kinase | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Src42A | 0.0277 | 1 | 1 |
| Brugia malayi | Probable tyrosine-protein kinase kin-31 | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | mitogen activated protein kinase kinase kinase | 0.0277 | 1 | 1 |
| Onchocerca volvulus | 0.0277 | 1 | 1 | |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0277 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | RGC/RGC protein kinase | 0.0277 | 1 | 1 |
| Echinococcus multilocularis | fibroblast growth factor receptor 4 | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Echinococcus granulosus | activin receptor type | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | tyrosin kinase, putative | 0.0277 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase csk | 0.0277 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0277 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0277 | 1 | 1 |
| Echinococcus granulosus | atrial natriuretic peptide receptor 1 | 0.0277 | 1 | 1 |
| Brugia malayi | bone morphogenetic protein type 1 receptor | 0.0277 | 1 | 1 |
| Echinococcus granulosus | epidermal growth factor receptor | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | br serine/threonine-protein kinase, putative | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0277 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0277 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0277 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0277 | 1 | 1 |
| Schistosoma mansoni | tyrosine-protein kinase fps85d | 0.0277 | 1 | 1 |
| Echinococcus granulosus | natriuretic peptide receptor 1 | 0.0277 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 9 uM | Inhibition of human recombinant AKR1B1 expressed in Escherichia coli using DL-glyceraldehyde as substrate after 5 mins by spectrophotometry | ChEMBL. | 24341381 |
| Inhibition (binding) | Inhibition of AKR1A1 (unknown origin) using DL-glyceraldehyde as substrate at 15 uM after 5 mins by spectrophotometry | ChEMBL. | 24341381 | |
| Inhibition (binding) | Inhibition of AKR1B10 (unknown origin) using DL-glyceraldehyde as substrate at 15 uM after 5 mins by spectrophotometry | ChEMBL. | 24341381 | |
| Inhibition (binding) | = 50 % | Inhibition of AKR1B1 in mouse RAW264.7 cells assessed as inhibition of sorbitol accumulation at 50 uM after 24 hrs by colorimetric assay | ChEMBL. | 24341381 |
| Inhibition (binding) | = 80 % | Inhibition of human AKR1B1 expressing in PAR40 C57BL6 mouse lens assessed as inhibition of glucose-induced sorbitol accumulation at 25 to 50 uM after 72 hrs by colorimetric assay | ChEMBL. | 24341381 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL3109109
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.