Detailed information for compound 187970
Basic information
Technical information
- Name: Unnamed compound
- MW: 735.529 | Formula: C26H20F8N4Pt++
-
H donors: 0
H acceptors: 0
LogP: 7.5
Rotable bonds: 4
Rule of 5 violations (Lipinski): 2 - SMILES: Cc1cc[n+](cc1)[Pt]1([n+]2ccc(cc2)C)N(CCN1c1c(F)c(F)cc(c1F)F)c1c(F)c(F)cc(c1F)F
- InChi: 1S/C14H6F8N2.2C6H7N.Pt/c15-5-3-6(16)10(20)13(9(5)19)23-1-2-24-14-11(21)7(17)4-8(18)12(14)22;2*1-6-2-4-7-5-3-6;/h3-4H,1-2H2;2*2-5H,1H3;/q-2;;;+4
- InChiKey: YNIGNWORZXNRGX-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Mycobacterium ulcerans | dehydrogenase/decarboxylase protein | 0.0068 | 1 | 0.5 |
| Brugia malayi | Dehydrogenases, short chain protein 30 | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | retinol dehydrogenase 11 | 0.0068 | 1 | 1 |
| Trypanosoma brucei | oxidoreductase-like protein | 0.0068 | 1 | 1 |
| Entamoeba histolytica | estradiol 17-beta-dehydrogenase, putative | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Plasmodium falciparum | steroid dehydrogenase, putative | 0.0068 | 1 | 1 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | oxidoreductase short chain dehydrogenase/reductase family | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | ketoacyl reductase | 0.0068 | 1 | 0.5 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Echinococcus granulosus | WW domain containing oxidoreductase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | short chain dehydrogenase/reductase family oxidoreductase | 0.0068 | 1 | 1 |
| Giardia lamblia | Oxidoreductase, short chain dehydrogenase/reductase family | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | steroid dehydrogenase, putative | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Entamoeba histolytica | oxidoreductase, short chain dehydrogenase/reductase family | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Brugia malayi | dehydrogenases, short chain protein 9 | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Possible oxidoreductase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | conserved hypothetical protein | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | 3 ketodihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenases/reductase, putative | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | oxidoreductase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | transient receptor potential cation channel | 0.0068 | 1 | 1 |
| Schistosoma mansoni | carbonyl reductase | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | 3-ketoacyl-CoA reductase, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Possible short-chain dehydrogenase EphD | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Entamoeba histolytica | hypothetical protein | 0.0068 | 1 | 1 |
| Mycobacterium leprae | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Plasmodium falciparum | conserved Plasmodium protein, unknown function | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | oxidoreductase-like protein, putative | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short chain alcohol dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Leishmania major | 3-oxoacyl-(acyl-carrier protein) reductase, putative | 0.0068 | 1 | 1 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Plasmodium falciparum | oxidoreductase, short-chain dehydrogenase family, putative | 0.0068 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Onchocerca volvulus | Sepiapterin reductase homolog | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | dehydrogenase | 0.0068 | 1 | 1 |
| Entamoeba histolytica | estradiol 17-beta-dehydrogenase, putative | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Possible ketoacyl reductase | 0.0068 | 1 | 0.5 |
| Entamoeba histolytica | estradiol 17-beta-dehydrogenase, putative | 0.0068 | 1 | 1 |
| Entamoeba histolytica | short chain dehydrogenase family protein | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Echinococcus granulosus | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | short chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Possible iron-regulated short-chain dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Schistosoma mansoni | retinal dehydrogenase | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | estradiol 17 beta dehydrogenase 12 | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium leprae | PROBABLE SHORT CHAIN ALCOHOL DEHYDROGENASE/REDUCTASE | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Trypanosoma brucei | beta-D-hydroxybutyrate dehydrogenase | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Trypanosoma brucei | 3-ketoacyl-CoA reductase, putative | 0.0068 | 1 | 1 |
| Trypanosoma brucei | beta-ketoacyl-ACP reductase 2 | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain membrane-associated dehydrogenase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable dehydrogenase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | NAD(P)-dependent oxidoreductase, putative | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | 3-keto-dihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | 3-alpha-hydroxysteroid dehydrogenase | 0.0068 | 1 | 0.5 |
| Toxoplasma gondii | sterol carrier protein-2 HAD-2SCP-2 | 0.0068 | 1 | 1 |
| Mycobacterium leprae | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Possible oxidoreductase | 0.0068 | 1 | 0.5 |
| Leishmania major | short chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Entamoeba histolytica | short chain dehydrogenase family protein | 0.0068 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0068 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Toxoplasma gondii | 2,4-dienoyl CoA reductase 2, peroxisomal family protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type oxidoreductase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Trypanosoma brucei | beta-ketoacyl-ACP reductase 3, putative | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | short chain dehydrogenase/reductase, putative | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Echinococcus granulosus | retinol dehydrogenase 11 | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Entamoeba histolytica | 3-ketodihydrosphingosine reductase protein, putative | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Plasmodium vivax | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Echinococcus granulosus | retinol dehydrogenase 11 | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short-chain dehydrogenase/reductase | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | retinol dehydrogenase 13 | 0.0068 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | short chain dehydrogenase/reductase, putative | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Giardia lamblia | Reductase, putative | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Possible fatty acyl-CoA reductase | 0.0068 | 1 | 0.5 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Toxoplasma gondii | carbonyl reductase 1, putative | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Decaprenylphosphoryl-D-2-keto erythro pentose reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Leishmania major | 3-keto-dihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Echinococcus granulosus | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0068 | 1 | 1 |
| Leishmania major | dehydrogenase-like protein | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Echinococcus granulosus | Dehydrogenase:reductase SDR family | 0.0068 | 1 | 1 |
| Leishmania major | short chain dehydrogenase-like protein | 0.0068 | 1 | 1 |
| Toxoplasma gondii | 3-ketoacyl-CoA reductase, putative | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Brugia malayi | Dehydrogenases, short chain protein 2 | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Wolbachia endosymbiont of Brugia malayi | Short-chain alcohol dehydrogenase family enzyme | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Schistosoma mansoni | carbonyl reductase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Echinococcus granulosus | 3 ketodihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Toxoplasma gondii | oxidoreductase, putative | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Brugia malayi | dehydrogenases, short chain protein 2 | 0.0068 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | NAD(P)-dependent oxidoreductase, putative | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | hydroxyacyl dehydrogenase, putative | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | estradiol 17 beta-dehydrogenase, putative | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Brugia malayi | 3-hydroxyacyl-CoA dehydrogenase type II | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | 3-ketoacyl-ACP reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium leprae | Possible short-chain dehydrogenase EphD | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | oxidoreductase | 0.0068 | 1 | 0.5 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Trypanosoma brucei | 3-keto-dihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Mycobacterium leprae | ROBABLE SHORT-CHAIN TYPE DEHYDROGENASE/REDUCTASE | 0.0068 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Brugia malayi | Retinol dehydrogenase 12 | 0.0068 | 1 | 1 |
| Echinococcus granulosus | epidermal retinal dehydrogenase 2 | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | dehydrogenase | 0.0068 | 1 | 1 |
| Leishmania major | short chain dehydrogenase/reductase, putative | 0.0068 | 1 | 1 |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | beta-ketoacyl-ACP reductase 2, putative | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | 3-hydroxyacyl-CoA dehydrogenase | 0.0068 | 1 | 1 |
| Leishmania major | pteridine reductase 1 | 0.0068 | 1 | 1 |
| Leishmania major | short chain dehydrogenase/reductase, putative | 0.0068 | 1 | 1 |
| Giardia lamblia | Short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | ketoacyl reductase | 0.0068 | 1 | 0.5 |
| Toxoplasma gondii | oxidoreductase, putative | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | retinol dehydrogenase 11 | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | epidermal retinal dehydrogenase 2 | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Onchocerca volvulus | Dehydrogenase\/reductase SDR family member 1 homolog | 0.0068 | 1 | 0.5 |
| Giardia lamblia | Hypothetical protein | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Leishmania major | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type oxidoreductase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | short chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0068 | 1 | 1 |
| Onchocerca volvulus | Dehydrogenase\/reductase SDR family member 13 homolog | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | 3-keto-dihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0068 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | quinonoid dihydropteridine reductase, putative | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Schistosoma mansoni | carbonyl reductase | 0.0068 | 1 | 1 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | Dehydrogenase:reductase SDR family | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Leishmania major | short chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0068 | 1 | 1 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | oxidoreductase-like protein, putative | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Possible multi-functional enzyme with acyl-CoA-reductase activity AcrA1 | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | beta-ketoacyl-ACP reductase 2, putative | 0.0068 | 1 | 1 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | 3-keto-dihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Brugia malayi | Hypothetical oxidoreductase F56D1.5 | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Leishmania major | oxidoreductase-like protein | 0.0068 | 1 | 1 |
| Plasmodium vivax | steroid dehydrogenase, putative | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | ketoacyl reductase | 0.0068 | 1 | 0.5 |
| Echinococcus granulosus | oxidoreductase | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Mycobacterium ulcerans | carveol-like dehydrogenase | 0.0068 | 1 | 0.5 |
| Onchocerca volvulus | Dehydrogenase\/reductase SDR family member 13 homolog | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Brugia malayi | D-beta-hydroxybutyrate dehydrogenase, mitochondrial precursor | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | oxidoreductase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | 3-ketoacyl-CoA reductase, putative | 0.0068 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium leprae | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable shortchain dehydrogenase | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| ID50 (functional) | = 0.3 uM | Compound was tested against P388 cell line | ChEMBL. | 1527784 |
| ID50 (functional) | = 0.7 uM | Compound was evaluated invitro for its inhibitory activity against L1210/DDP leukemia cell line using Coulter counter assay | ChEMBL. | 1527784 |
| ID50 (functional) | = 0.8 uM | Compound was evaluated invitro for its inhibitory activity againstHT-29 and BE human colon carcinoma cell line using Coulter counter assay | ChEMBL. | 1527784 |
| ID50 (functional) | = 1 uM | Compound was evaluated invitro for its inhibitory activity againstHT-29 and BE human colon carcinoma cell line using MTT assay | ChEMBL. | 1527784 |
| ID50 (functional) | = 1.1 uM | Compound was evaluated invitro for its inhibitory activity against L1210/DDP leukemia cell line using MTT assay | ChEMBL. | 1527784 |
| ID50 (functional) | = 2 uM | Compound was evaluated invitro for its inhibitory activity against L1210 leukemia cell line using Coulter counter assay | ChEMBL. | 1527784 |
| ID50 (functional) | = 2.7 uM | Compound was evaluated invitro for its inhibitory activity against L1210 leukemia cell line using Coulter MTT assay | ChEMBL. | 1527784 |
| T/C (functional) | = 126 % | Mean survival time of treated animals compared with those of control animals expressed as percentage. T/C was determined against murine leukemia P388 implanted mouseat the dose of 136 micromol/kg | ChEMBL. | 1527784 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: 286441
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.