Detailed information for compound 187970
Basic information
Technical information
- Name: Unnamed compound
- MW: 735.529 | Formula: C26H20F8N4Pt++
-
H donors: 0
H acceptors: 0
LogP: 7.5
Rotable bonds: 4
Rule of 5 violations (Lipinski): 2 - SMILES: Cc1cc[n+](cc1)[Pt]1([n+]2ccc(cc2)C)N(CCN1c1c(F)c(F)cc(c1F)F)c1c(F)c(F)cc(c1F)F
- InChi: 1S/C14H6F8N2.2C6H7N.Pt/c15-5-3-6(16)10(20)13(9(5)19)23-1-2-24-14-11(21)7(17)4-8(18)12(14)22;2*1-6-2-4-7-5-3-6;/h3-4H,1-2H2;2*2-5H,1H3;/q-2;;;+4
- InChiKey: YNIGNWORZXNRGX-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Trypanosoma cruzi | beta-ketoacyl-ACP reductase 2, putative | 0.0068 | 1 | 1 |
| Plasmodium vivax | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Schistosoma mansoni | carbonyl reductase | 0.0068 | 1 | 1 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | conserved hypothetical protein | 0.0068 | 1 | 1 |
| Giardia lamblia | Oxidoreductase, short chain dehydrogenase/reductase family | 0.0068 | 1 | 1 |
| Onchocerca volvulus | Sepiapterin reductase homolog | 0.0068 | 1 | 0.5 |
| Entamoeba histolytica | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | oxidoreductase-like protein, putative | 0.0068 | 1 | 1 |
| Entamoeba histolytica | estradiol 17-beta-dehydrogenase, putative | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | 3-keto-dihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | ketoacyl reductase | 0.0068 | 1 | 0.5 |
| Brugia malayi | Dehydrogenases, short chain protein 2 | 0.0068 | 1 | 1 |
| Trypanosoma brucei | 3-ketoacyl-CoA reductase, putative | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Entamoeba histolytica | estradiol 17-beta-dehydrogenase, putative | 0.0068 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0068 | 1 | 1 |
| Trypanosoma brucei | 3-keto-dihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Onchocerca volvulus | Dehydrogenase\/reductase SDR family member 13 homolog | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | dehydrogenase | 0.0068 | 1 | 1 |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Decaprenylphosphoryl-D-2-keto erythro pentose reductase | 0.0068 | 1 | 0.5 |
| Toxoplasma gondii | carbonyl reductase 1, putative | 0.0068 | 1 | 1 |
| Schistosoma mansoni | 3-hydroxyacyl-CoA dehydrogenase | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Possible ketoacyl reductase | 0.0068 | 1 | 0.5 |
| Leishmania major | oxidoreductase-like protein | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | epidermal retinal dehydrogenase 2 | 0.0068 | 1 | 1 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | NAD(P)-dependent oxidoreductase, putative | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Mycobacterium leprae | ROBABLE SHORT-CHAIN TYPE DEHYDROGENASE/REDUCTASE | 0.0068 | 1 | 0.5 |
| Echinococcus granulosus | WW domain containing oxidoreductase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | Dehydrogenase:reductase SDR family | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Mycobacterium leprae | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Leishmania major | short chain dehydrogenase/reductase, putative | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Possible iron-regulated short-chain dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | beta-ketoacyl-ACP reductase 2, putative | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | transient receptor potential cation channel | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Entamoeba histolytica | short chain dehydrogenase family protein | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Onchocerca volvulus | Dehydrogenase\/reductase SDR family member 1 homolog | 0.0068 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Echinococcus granulosus | retinol dehydrogenase 11 | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | short chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Plasmodium falciparum | steroid dehydrogenase, putative | 0.0068 | 1 | 1 |
| Echinococcus granulosus | Dehydrogenase:reductase SDR family | 0.0068 | 1 | 1 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Mycobacterium leprae | PROBABLE SHORT CHAIN ALCOHOL DEHYDROGENASE/REDUCTASE | 0.0068 | 1 | 0.5 |
| Echinococcus granulosus | 3 ketodihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Schistosoma mansoni | retinal dehydrogenase | 0.0068 | 1 | 1 |
| Trypanosoma brucei | oxidoreductase-like protein | 0.0068 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Leishmania major | dehydrogenase-like protein | 0.0068 | 1 | 1 |
| Brugia malayi | dehydrogenases, short chain protein 2 | 0.0068 | 1 | 1 |
| Entamoeba histolytica | oxidoreductase, short chain dehydrogenase/reductase family | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Leishmania major | 3-oxoacyl-(acyl-carrier protein) reductase, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Entamoeba histolytica | estradiol 17-beta-dehydrogenase, putative | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | 3-ketoacyl-CoA reductase, putative | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Entamoeba histolytica | 3-ketodihydrosphingosine reductase protein, putative | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Brugia malayi | Dehydrogenases, short chain protein 30 | 0.0068 | 1 | 1 |
| Schistosoma mansoni | oxidoreductase short chain dehydrogenase/reductase family | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | 3-ketoacyl-CoA reductase, putative | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Toxoplasma gondii | sterol carrier protein-2 HAD-2SCP-2 | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | dehydrogenase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | carbonyl reductase | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | 3 ketodihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | ketoacyl reductase | 0.0068 | 1 | 0.5 |
| Echinococcus granulosus | hypothetical protein | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | oxidoreductase | 0.0068 | 1 | 0.5 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Schistosoma mansoni | 3-keto-dihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Brugia malayi | 3-hydroxyacyl-CoA dehydrogenase type II | 0.0068 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain membrane-associated dehydrogenase | 0.0068 | 1 | 0.5 |
| Toxoplasma gondii | 3-ketoacyl-CoA reductase, putative | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | estradiol 17 beta dehydrogenase 12 | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | dehydrogenase | 0.0068 | 1 | 1 |
| Brugia malayi | Retinol dehydrogenase 12 | 0.0068 | 1 | 1 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Possible oxidoreductase | 0.0068 | 1 | 0.5 |
| Leishmania major | short chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Echinococcus granulosus | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short-chain dehydrogenase/reductase | 0.0068 | 1 | 1 |
| Mycobacterium leprae | Possible short-chain dehydrogenase EphD | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short-chain type oxidoreductase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | short chain dehydrogenase/reductase, putative | 0.0068 | 1 | 1 |
| Giardia lamblia | Reductase, putative | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | estradiol 17 beta-dehydrogenase, putative | 0.0068 | 1 | 1 |
| Brugia malayi | dehydrogenases, short chain protein 9 | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Toxoplasma gondii | oxidoreductase, putative | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Possible multi-functional enzyme with acyl-CoA-reductase activity AcrA1 | 0.0068 | 1 | 0.5 |
| Leishmania major | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type oxidoreductase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | oxidoreductase-like protein, putative | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Plasmodium falciparum | conserved Plasmodium protein, unknown function | 0.0068 | 1 | 1 |
| Entamoeba histolytica | short chain dehydrogenase family protein | 0.0068 | 1 | 1 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Brugia malayi | D-beta-hydroxybutyrate dehydrogenase, mitochondrial precursor | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Plasmodium vivax | steroid dehydrogenase, putative | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | 3-alpha-hydroxysteroid dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | oxidoreductase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | NAD(P)-dependent oxidoreductase, putative | 0.0068 | 1 | 1 |
| Echinococcus granulosus | oxidoreductase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Trypanosoma brucei | beta-D-hydroxybutyrate dehydrogenase | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Trypanosoma brucei | beta-ketoacyl-ACP reductase 2 | 0.0068 | 1 | 1 |
| Mycobacterium leprae | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Leishmania major | short chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Possible fatty acyl-CoA reductase | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | steroid dehydrogenase, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenases/reductase, putative | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Leishmania major | short chain dehydrogenase/reductase, putative | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | retinol dehydrogenase 13 | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Leishmania major | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | retinol dehydrogenase 11 | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable shortchain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Trypanosoma brucei | beta-ketoacyl-ACP reductase 3, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Leishmania major | short chain dehydrogenase-like protein | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | retinol dehydrogenase 11 | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | short chain dehydrogenase/reductase family oxidoreductase | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Possible oxidoreductase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Possible short-chain dehydrogenase EphD | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Leishmania major | pteridine reductase 1 | 0.0068 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Giardia lamblia | Short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Echinococcus granulosus | epidermal retinal dehydrogenase 2 | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Brugia malayi | Hypothetical oxidoreductase F56D1.5 | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | quinonoid dihydropteridine reductase, putative | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Wolbachia endosymbiont of Brugia malayi | Short-chain alcohol dehydrogenase family enzyme | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium leprae | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | short chain dehydrogenase/reductase, putative | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | short chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | ketoacyl reductase | 0.0068 | 1 | 0.5 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | carveol-like dehydrogenase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Toxoplasma gondii | oxidoreductase, putative | 0.0068 | 1 | 1 |
| Leishmania major | 3-keto-dihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | 3-ketoacyl-ACP reductase | 0.0068 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Echinococcus granulosus | retinol dehydrogenase 11 | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Echinococcus granulosus | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | oxidoreductase | 0.0068 | 1 | 1 |
| Plasmodium falciparum | oxidoreductase, short-chain dehydrogenase family, putative | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short chain alcohol dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | 3-keto-dihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | carbonyl reductase | 0.0068 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Onchocerca volvulus | Dehydrogenase\/reductase SDR family member 13 homolog | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Toxoplasma gondii | 2,4-dienoyl CoA reductase 2, peroxisomal family protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | dehydrogenase/decarboxylase protein | 0.0068 | 1 | 0.5 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | hydroxyacyl dehydrogenase, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Giardia lamblia | Hypothetical protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable dehydrogenase | 0.0068 | 1 | 0.5 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| ID50 (functional) | = 0.3 uM | Compound was tested against P388 cell line | ChEMBL. | 1527784 |
| ID50 (functional) | = 0.7 uM | Compound was evaluated invitro for its inhibitory activity against L1210/DDP leukemia cell line using Coulter counter assay | ChEMBL. | 1527784 |
| ID50 (functional) | = 0.8 uM | Compound was evaluated invitro for its inhibitory activity againstHT-29 and BE human colon carcinoma cell line using Coulter counter assay | ChEMBL. | 1527784 |
| ID50 (functional) | = 1 uM | Compound was evaluated invitro for its inhibitory activity againstHT-29 and BE human colon carcinoma cell line using MTT assay | ChEMBL. | 1527784 |
| ID50 (functional) | = 1.1 uM | Compound was evaluated invitro for its inhibitory activity against L1210/DDP leukemia cell line using MTT assay | ChEMBL. | 1527784 |
| ID50 (functional) | = 2 uM | Compound was evaluated invitro for its inhibitory activity against L1210 leukemia cell line using Coulter counter assay | ChEMBL. | 1527784 |
| ID50 (functional) | = 2.7 uM | Compound was evaluated invitro for its inhibitory activity against L1210 leukemia cell line using Coulter MTT assay | ChEMBL. | 1527784 |
| T/C (functional) | = 126 % | Mean survival time of treated animals compared with those of control animals expressed as percentage. T/C was determined against murine leukemia P388 implanted mouseat the dose of 136 micromol/kg | ChEMBL. | 1527784 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: 286441
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.