Detailed information for compound 203018
Basic information
Technical information
- TDR Targets ID: 203018
- Name: 3-(3,8-diamino-6-phenylphenanthridin-5-ium-5- yl)propyl-diethyl-methylazanium diiodide
- MW: 414.586 | Formula: C27H34N4++
-
H donors: 2
H acceptors: 0
LogP: 4.95
Rotable bonds: 7
Rule of 5 violations (Lipinski): 1 - SMILES: CC[N+](CCC[n+]1c(c2ccccc2)c2cc(N)ccc2c2c1cc(N)cc2)(CC)C
- InChi: 1S/C27H33N4/c1-4-31(3,5-2)17-9-16-30-26-19-22(29)13-15-24(26)23-14-12-21(28)18-25(23)27(30)20-10-7-6-8-11-20/h6-8,10-15,18-19,29H,4-5,9,16-17,28H2,1-3H3/q+1/p+1
- InChiKey: ZDWVWKDAWBGPDN-UHFFFAOYSA-O
Network
Hover on a compound node to display the structore
Synonyms
- Propidium
- 3-(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)propyl-diethyl-methylazanium
- 3-(3,8-diamino-6-phenyl-phenanthridin-5-ium-5-yl)propyl-diethyl-methyl-ammonium
- 3-(3,8-diamino-6-phenyl-5-phenanthridin-5-iumyl)propyl-diethyl-methylammonium
- 3-[3,8-bis(azanyl)-6-phenyl-phenanthridin-5-ium-5-yl]propyl-diethyl-methyl-azanium
- 3-(3,8-diamino-6-phenyl-phenanthridin-5-ium-5-yl)propyl-diethyl-methyl-azanium
- KBio2_000378
- KBio2_002946
- KBio2_005514
- BPBio1_001018
- KBioGR_000378
- Bio1_001232
- SPBio_002863
- NCGC00163475-01
- IDI1_002114
- Bio2_000359
- 3,8-DIAMINO-5[3-(DIETHYLMETHYLAMMONIO)PROPYL]-6-PHENYLPHENANTHRIDINIUM
- PRM
- CBiol_001968
- BSPBio_001038
- BSPBio_000924
- Prestwick1_000792
- Bio1_000254
- Bio2_000839
- Prestwick3_000792
- CAS-25535-16-4
- NCGC00016793-01
- Bio1_000743
- Prestwick0_000792
- Prestwick2_000792
- KBioSS_000378
- KBio3_000735
- KBio3_000736
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | APEX nuclease (multifunctional DNA repair enzyme) 1 | Starlite/ChEMBL | No references |
| Homo sapiens | thyroid hormone receptor, beta | Starlite/ChEMBL | No references |
| Homo sapiens | microtubule-associated protein tau | Starlite/ChEMBL | No references |
| Homo sapiens | hydroxyprostaglandin dehydrogenase 15-(NAD) | Starlite/ChEMBL | No references |
| Homo sapiens | lysine (K)-specific demethylase 4E | Starlite/ChEMBL | No references |
| Homo sapiens | vitamin D (1,25- dihydroxyvitamin D3) receptor | Starlite/ChEMBL | No references |
| Homo sapiens | caspase 1, apoptosis-related cysteine peptidase | Starlite/ChEMBL | No references |
| Homo sapiens | cytochrome P450, family 2, subfamily C, polypeptide 19 | Starlite/ChEMBL | No references |
| Mus musculus | RAR-related orphan receptor gamma | Starlite/ChEMBL | No references |
| Homo sapiens | ubiquitin specific peptidase 1 | Starlite/ChEMBL | No references |
| Homo sapiens | core-binding factor, beta subunit | No references | |
| Homo sapiens | RecQ helicase-like | Starlite/ChEMBL | No references |
| Homo sapiens | cytochrome P450, family 2, subfamily C, polypeptide 9 | Starlite/ChEMBL | No references |
| Homo sapiens | cytochrome P450, family 3, subfamily A, polypeptide 4 | Starlite/ChEMBL | No references |
| Homo sapiens | cytochrome P450, family 2, subfamily D, polypeptide 6 | Starlite/ChEMBL | No references |
| Homo sapiens | Bloom syndrome, RecQ helicase-like | Starlite/ChEMBL | No references |
| Homo sapiens | caspase 7, apoptosis-related cysteine peptidase | Starlite/ChEMBL | No references |
| Homo sapiens | runt-related transcription factor 1 | Starlite/ChEMBL | No references |
| Homo sapiens | ataxin 2 | Starlite/ChEMBL | No references |
| Homo sapiens | lysine (K)-specific methyltransferase 2A | Starlite/ChEMBL | No references |
| Homo sapiens | K(lysine) acetyltransferase 2A | Starlite/ChEMBL | No references |
| Homo sapiens | multiple endocrine neoplasia I | No references | |
| Homo sapiens | euchromatic histone-lysine N-methyltransferase 2 | Starlite/ChEMBL | No references |
| Homo sapiens | cytochrome P450, family 1, subfamily A, polypeptide 2 | Starlite/ChEMBL | No references |
| Homo sapiens | polymerase (DNA directed) kappa | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Trypanosoma cruzi | metacaspase, putative | 0.0053 | 0.0505 | 0.169 |
| Echinococcus multilocularis | nuclear receptor subfamily 1 group D | 0.0019 | 0.009 | 0.0089 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0037 | 0.0301 | 0.0472 |
| Brugia malayi | jmjC domain containing protein | 0.0019 | 0.0085 | 0.0134 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0019 | 0.0085 | 0.0132 |
| Loa Loa (eye worm) | nuclear Hormone Receptor family member | 0.0037 | 0.0301 | 0.047 |
| Leishmania major | apurinic/apyrimidinic endonuclease-redox protein | 0.0023 | 0.0131 | 0.0246 |
| Giardia lamblia | Histone acetyltransferase GCN5 | 0.0047 | 0.0429 | 0.118 |
| Schistosoma mansoni | photoreceptor-specific nuclear receptor related | 0.0037 | 0.0301 | 0.028 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.005 | 0.0459 | 0.1721 |
| Schistosoma mansoni | cpg binding protein | 0.0037 | 0.0301 | 0.0281 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0065 | 0.01 |
| Echinococcus multilocularis | Mitotic checkpoint protein PRCC, C terminal | 0.0152 | 0.1706 | 0.1704 |
| Echinococcus multilocularis | caspase 3, apoptosis cysteine peptidase | 0.0141 | 0.1574 | 0.1573 |
| Echinococcus granulosus | JmjC domain containing protein 4 | 0.0019 | 0.0085 | 0.0084 |
| Schistosoma mansoni | histone-lysine n-methyltransferase suv9 | 0.0037 | 0.0303 | 0.0282 |
| Loa Loa (eye worm) | cytochrome P450 family protein | 0.0067 | 0.0676 | 0.106 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0037 | 0.0301 | 0.0299 |
| Schistosoma mansoni | mixed-lineage leukemia protein mll | 0.0075 | 0.0767 | 0.0747 |
| Trichomonas vaginalis | Clan CD, family C14, metacaspase-like cysteine peptidase | 0.0053 | 0.0505 | 0.1163 |
| Loa Loa (eye worm) | hypothetical protein | 0.0535 | 0.6367 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0019 | 0.009 | 0.0139 |
| Loa Loa (eye worm) | hypothetical protein | 0.0037 | 0.0301 | 0.047 |
| Echinococcus multilocularis | lysine specific demethylase 6a | 0.0019 | 0.0085 | 0.0084 |
| Onchocerca volvulus | 0.0535 | 0.6367 | 1 | |
| Mycobacterium leprae | Conserved hypothetical protein | 0.0021 | 0.0115 | 0.5 |
| Echinococcus granulosus | 5'partial|histone lysine N methyltransferase SETDB2 | 0.0035 | 0.0278 | 0.0276 |
| Schistosoma mansoni | protein phosphatase 2C | 0.0019 | 0.0085 | 0.0065 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0065 | 0.01 |
| Brugia malayi | Nuclear hormone receptor family member nhr-1 | 0.0037 | 0.0301 | 0.0472 |
| Brugia malayi | nuclear hormone receptor | 0.0017 | 0.0065 | 0.0102 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.005 | 0.0459 | 0.1721 |
| Echinococcus multilocularis | Protein lozenge | 0.0067 | 0.0672 | 0.067 |
| Brugia malayi | tailless protein | 0.0017 | 0.0065 | 0.0102 |
| Brugia malayi | ImpB/MucB/SamB family protein | 0.0017 | 0.0068 | 0.0106 |
| Brugia malayi | conserved hypotetical protein | 0.0017 | 0.0065 | 0.0102 |
| Echinococcus granulosus | Mitotic checkpoint protein PRCC C terminal | 0.0152 | 0.1706 | 0.1704 |
| Loa Loa (eye worm) | ATP-dependent DNA helicase | 0.0035 | 0.0276 | 0.0431 |
| Toxoplasma gondii | ATP-dependent DNA helicase, RecQ family protein | 0.0035 | 0.0276 | 0.3656 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0053 | 0.0505 | 0.1163 |
| Echinococcus granulosus | caspase 3 apoptosis cysteine peptidase | 0.0141 | 0.1574 | 0.1573 |
| Onchocerca volvulus | 0.0035 | 0.0277 | 0.0336 | |
| Mycobacterium tuberculosis | Probable cytochrome P450 128 Cyp128 | 0.0021 | 0.0115 | 0.4881 |
| Echinococcus granulosus | Nuclear hormone receptor HR96 | 0.0017 | 0.0065 | 0.0064 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-1 | 0.0037 | 0.0301 | 0.047 |
| Echinococcus granulosus | cpg binding protein | 0.0037 | 0.0301 | 0.03 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.002 | 0.0099 | 0.0365 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0017 | 0.0065 | 0.0064 |
| Schistosoma mansoni | Tr4/Tr2 (homologue) | 0.0037 | 0.0301 | 0.028 |
| Brugia malayi | nuclear receptor RXR | 0.0017 | 0.0065 | 0.0102 |
| Brugia malayi | Pre-SET motif family protein | 0.0037 | 0.0303 | 0.0476 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.005 | 0.0459 | 0.1721 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-31 | 0.0037 | 0.0301 | 0.047 |
| Loa Loa (eye worm) | DR-78 | 0.0017 | 0.0065 | 0.01 |
| Wolbachia endosymbiont of Brugia malayi | exonuclease III | 0.0023 | 0.0131 | 0.5 |
| Plasmodium vivax | ADP-dependent DNA helicase RecQ, putative | 0.003 | 0.0216 | 0.3475 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.005 | 0.0459 | 0.1721 |
| Plasmodium falciparum | ADP-dependent DNA helicase RecQ | 0.0047 | 0.0422 | 0.8014 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.005 | 0.0459 | 0.1721 |
| Brugia malayi | Cytochrome P450 family protein | 0.0021 | 0.0115 | 0.0181 |
| Leishmania major | ATP-dependent DEAD/H DNA helicase recQ, putative | 0.0038 | 0.0314 | 0.0951 |
| Brugia malayi | hypothetical protein | 0.005 | 0.0461 | 0.0723 |
| Toxoplasma gondii | exonuclease III APE | 0.0023 | 0.0131 | 0.1609 |
| Trichomonas vaginalis | bromodomain-containing protein, putative | 0.0051 | 0.0482 | 0.1089 |
| Onchocerca volvulus | 0.0287 | 0.3347 | 0.5207 | |
| Brugia malayi | Cytochrome P450 family protein | 0.0032 | 0.0244 | 0.0383 |
| Leishmania major | cytochrome p450-like protein | 0.0032 | 0.0244 | 0.068 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0037 | 0.0301 | 0.0472 |
| Echinococcus multilocularis | Nuclear hormone receptor HR96 | 0.0017 | 0.0065 | 0.0064 |
| Loa Loa (eye worm) | hypothetical protein | 0.0019 | 0.009 | 0.0139 |
| Brugia malayi | Nuclear hormone receptor family member nhr-49 | 0.0037 | 0.0301 | 0.0472 |
| Plasmodium vivax | AP endonuclease (DNA-[apurinic or apyrimidinic site] lyase), putative | 0.0023 | 0.0131 | 0.158 |
| Leishmania major | DNA polymerase kappa, putative | 0.0025 | 0.0165 | 0.0375 |
| Schistosoma mansoni | retinoic acid receptor RXR | 0.0037 | 0.0301 | 0.028 |
| Brugia malayi | Steroid receptor seven-up type 2 | 0.0037 | 0.0301 | 0.0472 |
| Trypanosoma cruzi | ATP-dependent DEAD/H DNA helicase recQ, putative | 0.0038 | 0.0314 | 0.0951 |
| Trypanosoma cruzi | metacaspase, putative | 0.0053 | 0.0505 | 0.169 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0312 | 0.0487 |
| Mycobacterium tuberculosis | Probable cytochrome P450 monooxygenase 142 Cyp142 | 0.0021 | 0.0115 | 0.4881 |
| Onchocerca volvulus | 0.0037 | 0.0301 | 0.0374 | |
| Brugia malayi | Cell death protein 3 precursor | 0.0103 | 0.1111 | 0.1745 |
| Onchocerca volvulus | Protein ultraspiracle homolog | 0.0037 | 0.0301 | 0.0374 |
| Trypanosoma cruzi | PAB1-binding protein , putative | 0.003 | 0.0225 | 0.0609 |
| Trypanosoma cruzi | ATP-dependent DEAD/H DNA helicase recQ, putative | 0.0018 | 0.0069 | 0.0007 |
| Loa Loa (eye worm) | hypothetical protein | 0.0037 | 0.0303 | 0.0473 |
| Giardia lamblia | DINP protein human, muc B family | 0.0025 | 0.0165 | 0.0132 |
| Echinococcus granulosus | nuclear receptor nhr 48 | 0.0017 | 0.0065 | 0.0064 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0065 | 0.01 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0017 | 0.0065 | 0.0044 |
| Plasmodium falciparum | ATP-dependent DNA helicase Q1 | 0.0035 | 0.0276 | 0.4533 |
| Echinococcus granulosus | histone acetyltransferase KAT2B | 0.017 | 0.1926 | 0.1925 |
| Schistosoma mansoni | microtubule-associated protein tau | 0.0833 | 1 | 1 |
| Schistosoma mansoni | ap endonuclease | 0.0023 | 0.0131 | 0.0111 |
| Echinococcus granulosus | caspase 8 | 0.0053 | 0.0505 | 0.0504 |
| Schistosoma mansoni | terminal deoxycytidyl transferase | 0.0017 | 0.0068 | 0.0047 |
| Loa Loa (eye worm) | cytochrome P450 family protein | 0.0032 | 0.0244 | 0.038 |
| Schistosoma mansoni | nuclear receptor nhr-48 | 0.0017 | 0.0065 | 0.0044 |
| Echinococcus multilocularis | caspase 8 | 0.0053 | 0.0505 | 0.0504 |
| Trypanosoma cruzi | JmjC domain, hydroxylase, putative | 0.0019 | 0.0085 | 0.0069 |
| Trypanosoma cruzi | apurinic/apyrimidinic endonuclease | 0.0023 | 0.0131 | 0.0246 |
| Schistosoma mansoni | cpg binding protein | 0.0035 | 0.0277 | 0.0257 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0065 | 0.01 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0065 | 0.01 |
| Trypanosoma cruzi | ATP-dependent DEAD/H DNA helicase recQ, putative | 0.0018 | 0.0069 | 0.0007 |
| Loa Loa (eye worm) | nuclear hormone receptor-like 1 | 0.0019 | 0.009 | 0.0139 |
| Plasmodium vivax | hypothetical protein, conserved | 0.0053 | 0.0505 | 1 |
| Echinococcus granulosus | thyroid hormone receptor alpha | 0.0017 | 0.0065 | 0.0064 |
| Schistosoma mansoni | phosphatidylserine receptor | 0.0019 | 0.0085 | 0.0065 |
| Onchocerca volvulus | 0.005 | 0.0461 | 0.0628 | |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.005 | 0.0459 | 0.1721 |
| Echinococcus multilocularis | lysine specific demethylase 5A | 0.0071 | 0.072 | 0.0718 |
| Trypanosoma cruzi | DNA repair and recombination helicase protein PIF7, putative | 0.023 | 0.2657 | 1 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0037 | 0.0301 | 0.0299 |
| Trypanosoma cruzi | cytochrome p450-like protein, putative | 0.0021 | 0.0115 | 0.0183 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0017 | 0.0065 | 0.0064 |
| Trypanosoma brucei | PAB1-binding protein , putative | 0.003 | 0.0225 | 0.0843 |
| Leishmania major | PIF1 helicase-like protein, putative,DNA repair and recombination protein, mitochondrial precursor, putative | 0.023 | 0.2657 | 1 |
| Echinococcus multilocularis | Nuclear hormone receptor family member nhr 41 | 0.0037 | 0.0301 | 0.0299 |
| Schistosoma mansoni | jumonji domain containing protein | 0.0071 | 0.072 | 0.07 |
| Schistosoma mansoni | ecdysone-induced protein 78c (dr-78) | 0.0019 | 0.009 | 0.0069 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0065 | 0.01 |
| Brugia malayi | jmjC domain containing protein | 0.0019 | 0.0085 | 0.0134 |
| Trypanosoma brucei | unspecified product | 0.0042 | 0.0362 | 0.1356 |
| Brugia malayi | ATP-dependent DNA helicase, RecQ family protein | 0.0035 | 0.0276 | 0.0433 |
| Loa Loa (eye worm) | RecQ helicase | 0.005 | 0.046 | 0.072 |
| Trypanosoma brucei | JmjC domain, hydroxylase, putative | 0.0019 | 0.0085 | 0.0316 |
| Brugia malayi | jmjC domain containing protein | 0.0073 | 0.0744 | 0.1168 |
| Loa Loa (eye worm) | hypothetical protein | 0.0019 | 0.009 | 0.0139 |
| Brugia malayi | hypothetical protein | 0.0017 | 0.0065 | 0.0102 |
| Brugia malayi | nuclear receptor RXR | 0.0019 | 0.009 | 0.0142 |
| Echinococcus granulosus | Nuclear hormone receptor family member nhr 41 | 0.0037 | 0.0301 | 0.0299 |
| Mycobacterium tuberculosis | Probable cytochrome P450 139 Cyp139 | 0.0021 | 0.0115 | 0.4881 |
| Echinococcus granulosus | apoptotic protease activating factor 1 | 0.005 | 0.0461 | 0.0459 |
| Echinococcus granulosus | nuclear receptor subfamily 1 group D | 0.0019 | 0.009 | 0.0089 |
| Toxoplasma gondii | ATP-dependent DNA helicase, RecQ family protein | 0.0029 | 0.0207 | 0.2686 |
| Brugia malayi | nuclear receptor subfamily 1, group D, member 1, putative | 0.0017 | 0.0065 | 0.0102 |
| Schistosoma mansoni | nuclear receptor 2DBD-gamma | 0.0037 | 0.0301 | 0.028 |
| Echinococcus granulosus | DNA apurinic or apyrimidinic site lyase | 0.0023 | 0.0131 | 0.013 |
| Echinococcus multilocularis | bloom syndrome protein | 0.005 | 0.046 | 0.0458 |
| Trichomonas vaginalis | DNA helicase recq, putative | 0.0038 | 0.0314 | 0.0568 |
| Echinococcus multilocularis | caspase 2 | 0.0103 | 0.1111 | 0.1109 |
| Loa Loa (eye worm) | cytochrome P450 family protein | 0.0032 | 0.0244 | 0.038 |
| Loa Loa (eye worm) | hypothetical protein | 0.0037 | 0.0301 | 0.047 |
| Loa Loa (eye worm) | hypothetical protein | 0.0019 | 0.0085 | 0.0132 |
| Trypanosoma brucei | DNA polymerase IV, putative | 0.0042 | 0.0362 | 0.1356 |
| Trichomonas vaginalis | Clan CD, family C14, metacaspase-like cysteine peptidase | 0.0053 | 0.0505 | 0.1163 |
| Brugia malayi | nuclear receptor NHR-88 | 0.0017 | 0.0065 | 0.0102 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 0.0276 | 0.0431 |
| Brugia malayi | Nuclear hormone receptor family member nhr-40 | 0.0037 | 0.0301 | 0.0472 |
| Loa Loa (eye worm) | hypothetical protein | 0.0037 | 0.0301 | 0.047 |
| Schistosoma mansoni | caspase-3 (C14 family) | 0.0141 | 0.1574 | 0.1557 |
| Echinococcus granulosus | FTZ F1 alpha | 0.0037 | 0.0301 | 0.0299 |
| Trypanosoma cruzi | metacaspase 5, putative | 0.0053 | 0.0505 | 0.169 |
| Schistosoma mansoni | steroid hormone receptor ad4bp | 0.0037 | 0.0301 | 0.028 |
| Schistosoma mansoni | histone-lysine n-methyltransferase setb1 | 0.0037 | 0.0303 | 0.0282 |
| Echinococcus granulosus | Nuclear hormone receptor HR96 | 0.0017 | 0.0065 | 0.0064 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0019 | 0.0085 | 0.0132 |
| Trypanosoma brucei | DNA polymerase IV, putative | 0.005 | 0.0459 | 0.1721 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0019 | 0.0085 | 0.0132 |
| Schistosoma mansoni | cytochrome P450 | 0.0021 | 0.0115 | 0.0094 |
| Trichomonas vaginalis | DNA helicase recq1, putative | 0.005 | 0.046 | 0.1022 |
| Schistosoma mansoni | blooms syndrome DNA helicase | 0.0032 | 0.0245 | 0.0225 |
| Schistosoma mansoni | DNA helicase recq1 | 0.0035 | 0.0276 | 0.0255 |
| Brugia malayi | orphan nuclear receptor NR2E1 | 0.0017 | 0.0065 | 0.0102 |
| Trypanosoma cruzi | cytochrome P450, putative | 0.0032 | 0.0244 | 0.068 |
| Trypanosoma brucei | apurinic/apyrimidinic endonuclease, putative | 0.0023 | 0.0131 | 0.0489 |
| Echinococcus granulosus | ATP dependent DNA helicase Q1 | 0.0035 | 0.0276 | 0.0274 |
| Schistosoma mansoni | hepatocyte nuclear factor 4-alpha (hnf-4-alpha) | 0.0017 | 0.0065 | 0.0044 |
| Brugia malayi | nuclear hormone receptor family member nhr-6 | 0.0017 | 0.0065 | 0.0102 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.005 | 0.0459 | 0.1721 |
| Schistosoma mansoni | zinc finger protein | 0.0017 | 0.0065 | 0.0044 |
| Mycobacterium ulcerans | DNA polymerase IV | 0.005 | 0.0459 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0019 | 0.0085 | 0.0132 |
| Loa Loa (eye worm) | hypothetical protein | 0.0053 | 0.0505 | 0.0791 |
| Schistosoma mansoni | histone-lysine n-methyltransferase setb1 | 0.0037 | 0.0303 | 0.0282 |
| Loa Loa (eye worm) | exodeoxyribonuclease III family protein | 0.0023 | 0.0131 | 0.0204 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0037 | 0.0301 | 0.028 |
| Leishmania major | DNA polymerase kappa, putative,DNA polymerase IV, putative | 0.0025 | 0.0165 | 0.0375 |
| Schistosoma mansoni | FTZ-F1 nuclear receptor-like protein | 0.0037 | 0.0301 | 0.028 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0073 | 0.0744 | 0.1166 |
| Schistosoma mansoni | hypothetical protein | 0.0021 | 0.0115 | 0.0094 |
| Schistosoma mansoni | subfamily C14A unassigned peptidase (C14 family) | 0.0053 | 0.0505 | 0.0485 |
| Trypanosoma brucei | ATP-dependent DEAD/H DNA helicase recQ, putative | 0.0038 | 0.0314 | 0.1176 |
| Loa Loa (eye worm) | acetyltransferase | 0.0175 | 0.1986 | 0.3117 |
| Trichomonas vaginalis | DNA polymerase eta, putative | 0.005 | 0.0459 | 0.1018 |
| Echinococcus multilocularis | retinoic acid receptor rxr beta a retinoic acid receptor rxr alpha a retinoic acid receptor rxr alpha | 0.0017 | 0.0065 | 0.0064 |
| Loa Loa (eye worm) | hypothetical protein | 0.0103 | 0.1111 | 0.1743 |
| Echinococcus granulosus | terminal deoxycytidyl transferase rev1 | 0.0017 | 0.0068 | 0.0066 |
| Loa Loa (eye worm) | hypothetical protein | 0.0037 | 0.0301 | 0.047 |
| Loa Loa (eye worm) | steroid hormone receptor | 0.0037 | 0.0301 | 0.047 |
| Trichomonas vaginalis | Clan CD, family C14, metacaspase-like cysteine peptidase | 0.0053 | 0.0505 | 0.1163 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.005 | 0.0459 | 0.151 |
| Mycobacterium tuberculosis | Cytochrome P450 121 Cyp121 | 0.0021 | 0.0115 | 0.4881 |
| Loa Loa (eye worm) | cytochrome P450 | 0.0021 | 0.0115 | 0.0178 |
| Entamoeba histolytica | DNA repair and recombination protein, putative | 0.023 | 0.2657 | 1 |
| Loa Loa (eye worm) | CXXC zinc finger family protein | 0.0035 | 0.0277 | 0.0433 |
| Toxoplasma gondii | ATP-dependent DNA helicase, RecQ family protein | 0.0035 | 0.0276 | 0.3656 |
| Brugia malayi | acetyltransferase, GNAT family protein | 0.0175 | 0.1986 | 0.3119 |
| Loa Loa (eye worm) | ImpB/MucB/SamB family protein | 0.0017 | 0.0068 | 0.0104 |
| Trypanosoma brucei | metacaspase | 0.0053 | 0.0505 | 0.1896 |
| Schistosoma mansoni | caspase-7 (C14 family) | 0.0141 | 0.1574 | 0.1557 |
| Echinococcus multilocularis | FTZ F1 alpha | 0.0037 | 0.0301 | 0.0299 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0037 | 0.0301 | 0.0472 |
| Trypanosoma cruzi | apurinic/apyrimidinic endonuclease, putative | 0.0023 | 0.0131 | 0.0246 |
| Schistosoma mansoni | jumonji/arid domain-containing protein | 0.0073 | 0.0744 | 0.0724 |
| Onchocerca volvulus | Cell death protein 3 homolog | 0.0103 | 0.1111 | 0.166 |
| Echinococcus granulosus | phd:f box containing protein | 0.0019 | 0.0085 | 0.0084 |
| Mycobacterium tuberculosis | Probable cytochrome P450 141 Cyp141 | 0.0021 | 0.0115 | 0.4881 |
| Leishmania major | cytochrome p450-like protein | 0.0021 | 0.0115 | 0.0183 |
| Giardia lamblia | Sgs1 DNA helicase, putative | 0.0035 | 0.0276 | 0.0572 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.005 | 0.0459 | 0.1721 |
| Plasmodium falciparum | ataxin-2 like protein, putative | 0.003 | 0.0225 | 0.3335 |
| Trichomonas vaginalis | Clan CD, family C14, metacaspase-like cysteine peptidase | 0.0053 | 0.0505 | 0.1163 |
| Echinococcus granulosus | dna polymerase eta | 0.0017 | 0.0068 | 0.0066 |
| Leishmania major | lanosterol 14-alpha-demethylase, putative | 0.0021 | 0.0115 | 0.0183 |
| Trichomonas vaginalis | Clan CD, family C14, metacaspase-like cysteine peptidase | 0.0053 | 0.0505 | 0.1163 |
| Toxoplasma gondii | histone lysine demethylase JMJC1/KDM5D/JARID1D | 0.0019 | 0.0085 | 0.0958 |
| Trypanosoma brucei | DNA polymerase IV, putative | 0.005 | 0.0459 | 0.1721 |
| Trichomonas vaginalis | DNA polymerase IV / kappa, putative | 0.005 | 0.0459 | 0.1018 |
| Trypanosoma cruzi | metacaspase, putative | 0.0053 | 0.0505 | 0.169 |
| Brugia malayi | photoreceptor-specific nuclear receptor | 0.0037 | 0.0301 | 0.0472 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-49 | 0.0037 | 0.0301 | 0.047 |
| Mycobacterium ulcerans | exodeoxyribonuclease III protein XthA | 0.0023 | 0.0131 | 0.0476 |
| Trichomonas vaginalis | Clan CD, family C14, metacaspase-like cysteine peptidase | 0.0053 | 0.0505 | 0.1163 |
| Leishmania major | hypothetical protein, conserved | 0.003 | 0.0225 | 0.0609 |
| Schistosoma mansoni | coup transcription factor | 0.0037 | 0.0301 | 0.028 |
| Plasmodium falciparum | histone acetyltransferase GCN5 | 0.0047 | 0.0429 | 0.8191 |
| Toxoplasma gondii | histone lysine acetyltransferase GCN5-A | 0.0051 | 0.0482 | 0.6574 |
| Loa Loa (eye worm) | hypothetical protein | 0.0033 | 0.0254 | 0.0396 |
| Treponema pallidum | exodeoxyribonuclease (exoA) | 0.0023 | 0.0131 | 1 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0019 | 0.009 | 0.0142 |
| Trichomonas vaginalis | Clan CD, family C14, metacaspase-like cysteine peptidase | 0.0053 | 0.0505 | 0.1163 |
| Toxoplasma gondii | ICE family protease (caspase) p20 domain-containing protein | 0.0053 | 0.0505 | 0.691 |
| Toxoplasma gondii | ICE family protease (caspase) p20 domain-containing protein | 0.0053 | 0.0505 | 0.691 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0053 | 0.0505 | 0.1163 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0019 | 0.009 | 0.0142 |
| Mycobacterium tuberculosis | Probable cytochrome P450 144 Cyp144 | 0.0021 | 0.0115 | 0.4881 |
| Echinococcus multilocularis | microtubule associated protein 2 | 0.0833 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0065 | 0.01 |
| Echinococcus granulosus | Jumonji AT rich interactive domain 1B | 0.0021 | 0.011 | 0.0108 |
| Trichomonas vaginalis | DNA helicase recq, putative | 0.005 | 0.046 | 0.1022 |
| Brugia malayi | nuclear receptor NHR-67 | 0.0017 | 0.0065 | 0.0102 |
| Leishmania major | cytochrome p450-like protein | 0.0021 | 0.0115 | 0.0183 |
| Brugia malayi | jmjC domain containing protein | 0.0019 | 0.0085 | 0.0134 |
| Schistosoma mansoni | lozenge | 0.0067 | 0.0672 | 0.0652 |
| Brugia malayi | hypothetical protein | 0.0017 | 0.0065 | 0.0102 |
| Echinococcus granulosus | dnaJ subfamily B | 0.0494 | 0.5868 | 0.5867 |
| Schistosoma mansoni | nuclear hormone receptor superfamily protein-related | 0.0017 | 0.0065 | 0.0044 |
| Loa Loa (eye worm) | nuclear receptor NHR-67 | 0.0017 | 0.0065 | 0.01 |
| Brugia malayi | CXXC zinc finger family protein | 0.0035 | 0.0277 | 0.0435 |
| Echinococcus granulosus | ATP dependent DNA helicase Q5 | 0.0035 | 0.0276 | 0.0274 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0053 | 0.0505 | 0.1163 |
| Echinococcus granulosus | histone lysine methyltransferase setb | 0.0037 | 0.0303 | 0.0301 |
| Echinococcus granulosus | histone acetyltransferase KAT2B | 0.0051 | 0.0482 | 0.048 |
| Mycobacterium tuberculosis | Probable cytochrome P450 140 Cyp140 | 0.0021 | 0.0115 | 0.4881 |
| Brugia malayi | Nuclear hormone receptor family member nhr-3 | 0.0037 | 0.0301 | 0.0472 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0069 | 0.0106 |
| Echinococcus multilocularis | dna polymerase kappa | 0.005 | 0.0459 | 0.0457 |
| Trypanosoma cruzi | DNA repair and recombination helicase protein PIF6, putative | 0.023 | 0.2657 | 1 |
| Schistosoma mansoni | nuclear receptor | 0.0017 | 0.0065 | 0.0044 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0053 | 0.0505 | 0.1163 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0025 | 0.0165 | 0.0614 |
| Brugia malayi | Nuclear hormone receptor E75 | 0.0017 | 0.0065 | 0.0102 |
| Echinococcus multilocularis | nuclear receptor subfamily 4 group A | 0.0017 | 0.0065 | 0.0064 |
| Echinococcus granulosus | caspase | 0.0141 | 0.1574 | 0.1573 |
| Brugia malayi | Nuclear hormone receptor E75 | 0.0017 | 0.0065 | 0.0102 |
| Trypanosoma brucei | Lanosterol 14-alpha demethylase | 0.0021 | 0.0115 | 0.0427 |
| Mycobacterium tuberculosis | Probable cytochrome P450 138 Cyp138 | 0.0021 | 0.0115 | 0.4881 |
| Echinococcus multilocularis | hepatocyte nuclear factor 4 alpha | 0.0037 | 0.0301 | 0.0299 |
| Mycobacterium tuberculosis | Probable cytochrome P450 123 Cyp123 | 0.0021 | 0.0115 | 0.4881 |
| Echinococcus granulosus | cytochrome P450 2K1 | 0.0021 | 0.0115 | 0.0113 |
| Entamoeba histolytica | recQ family DNA helicase | 0.0018 | 0.0069 | 0.0031 |
| Brugia malayi | cytochrome P450 | 0.0021 | 0.0115 | 0.0181 |
| Brugia malayi | ImpB/MucB/SamB family protein | 0.0017 | 0.0068 | 0.0106 |
| Echinococcus multilocularis | DNA (apurinic or apyrimidinic site) lyase | 0.0023 | 0.0131 | 0.013 |
| Trypanosoma brucei | DNA polymerase eta, putative | 0.0017 | 0.0068 | 0.0249 |
| Loa Loa (eye worm) | pre-SET domain-containing protein family protein | 0.0252 | 0.2924 | 0.4591 |
| Mycobacterium tuberculosis | Probable cytochrome P450 125 Cyp125 | 0.0021 | 0.0115 | 0.4881 |
| Echinococcus granulosus | lysine specific demethylase 5A | 0.0073 | 0.0744 | 0.0742 |
| Toxoplasma gondii | ICE family protease (caspase) p20 domain-containing protein | 0.0053 | 0.0505 | 0.691 |
| Echinococcus multilocularis | gcn5proteinral control of amino acid synthesis | 0.0175 | 0.1986 | 0.1984 |
| Schistosoma mansoni | cpg binding protein | 0.0037 | 0.0301 | 0.0281 |
| Echinococcus multilocularis | ATP dependent DNA helicase PIF1 | 0.023 | 0.2657 | 0.2656 |
| Plasmodium vivax | metacaspase 1, putative | 0.0053 | 0.0505 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor | 0.0017 | 0.0065 | 0.01 |
| Entamoeba histolytica | recQ family helicase, putative | 0.0038 | 0.0314 | 0.0973 |
| Mycobacterium tuberculosis | Probable cytochrome P450 124 Cyp124 | 0.0021 | 0.0115 | 0.4881 |
| Schistosoma mansoni | gcn5proteinral control of amino-acid synthesis 5-like 2 gcnl2 | 0.0175 | 0.1986 | 0.1969 |
| Brugia malayi | Nuclear hormone receptor family member nhr-31 | 0.0037 | 0.0301 | 0.0472 |
| Entamoeba histolytica | acetyltransferase, GNAT family | 0.0047 | 0.0429 | 0.1418 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0068 | 0.0104 |
| Loa Loa (eye worm) | hypothetical protein | 0.0535 | 0.6367 | 1 |
| Echinococcus multilocularis | cpg binding protein | 0.0037 | 0.0301 | 0.03 |
| Echinococcus multilocularis | ATP dependent DNA helicase Q5 | 0.0035 | 0.0276 | 0.0274 |
| Schistosoma mansoni | phd/f-box containing protein | 0.0019 | 0.0085 | 0.0065 |
| Plasmodium falciparum | ataxin-2 like protein, putative | 0.003 | 0.0225 | 0.3335 |
| Trypanosoma brucei | cytochrome P450, putative | 0.0032 | 0.0244 | 0.0912 |
| Trypanosoma cruzi | metacaspase 5, putative | 0.0053 | 0.0505 | 0.169 |
| Leishmania major | PIF1 helicase-like protein, putative,DNA repair and recombination protein, mitochondrial precursor, putative | 0.023 | 0.2657 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0037 | 0.0301 | 0.047 |
| Plasmodium falciparum | metacaspase-like protein | 0.0053 | 0.0505 | 1 |
| Plasmodium vivax | SET domain protein, putative | 0.0037 | 0.0303 | 0.5445 |
| Toxoplasma gondii | LsmAD domain-containing protein | 0.003 | 0.0225 | 0.2943 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0038 | 0.0312 | 0.1168 |
| Trypanosoma cruzi | JmjC domain, hydroxylase, putative | 0.0019 | 0.0085 | 0.0069 |
| Brugia malayi | hypothetical protein | 0.0019 | 0.009 | 0.0142 |
| Trypanosoma cruzi | Lanosterol 14-alpha demethylase | 0.0021 | 0.0115 | 0.0183 |
| Echinococcus multilocularis | caspase 3 | 0.0088 | 0.0924 | 0.0923 |
| Echinococcus granulosus | Transcription factor JmjC domain containing protein | 0.0071 | 0.072 | 0.0718 |
| Echinococcus multilocularis | Jumonji, AT rich interactive domain 1B | 0.0021 | 0.011 | 0.0108 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0037 | 0.0301 | 0.0472 |
| Echinococcus granulosus | Ataxin 2 N terminaldomain containing protein | 0.0014 | 0.0021 | 0.0019 |
| Echinococcus granulosus | ecdysone induced protein 78C | 0.0037 | 0.0301 | 0.0299 |
| Trichomonas vaginalis | Clan CD, family C14, metacaspase-like cysteine peptidase | 0.0053 | 0.0505 | 0.1163 |
| Entamoeba histolytica | deoxycytidyl transferase, putative | 0.0017 | 0.0068 | 0.0025 |
| Schistosoma mansoni | hypothetical protein | 0.023 | 0.2657 | 0.2642 |
| Plasmodium vivax | JmjC domain containing protein | 0.0019 | 0.0085 | 0.0546 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0189 | 0.2151 | 0.2135 |
| Schistosoma mansoni | hypothetical protein | 0.0494 | 0.5868 | 0.5859 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0065 | 0.01 |
| Echinococcus multilocularis | nuclear receptor nhr 48 | 0.0017 | 0.0065 | 0.0064 |
| Brugia malayi | exodeoxyribonuclease III family protein | 0.0023 | 0.0131 | 0.0206 |
| Schistosoma mansoni | histone-lysine n-methyltransferase setb1 | 0.0037 | 0.0303 | 0.0282 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.005 | 0.0459 | 0.1721 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0037 | 0.0301 | 0.0472 |
| Brugia malayi | ATP-dependent DNA helicase, RecQ family protein | 0.0035 | 0.0276 | 0.0433 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0037 | 0.0301 | 0.028 |
| Echinococcus multilocularis | histone lysine methyltransferase setb histone lysine methyltransferase eggless | 0.0037 | 0.0303 | 0.0301 |
| Echinococcus multilocularis | dnaJ subfamily B | 0.0494 | 0.5868 | 0.5867 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0065 | 0.01 |
| Brugia malayi | jmjC domain containing protein | 0.0071 | 0.072 | 0.113 |
| Loa Loa (eye worm) | hypothetical protein | 0.0037 | 0.0301 | 0.047 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0038 | 0.0312 | 0.1168 |
| Echinococcus granulosus | caspase 2 | 0.0103 | 0.1111 | 0.1109 |
| Mycobacterium tuberculosis | Probable cytochrome P450 136 Cyp136 | 0.0021 | 0.0115 | 0.4881 |
| Plasmodium falciparum | metacaspase 1 | 0.0053 | 0.0505 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0019 | 0.0085 | 0.0132 |
| Echinococcus granulosus | caspase 3 | 0.0088 | 0.0924 | 0.0923 |
| Echinococcus multilocularis | apoptotic protease activating factor 1 | 0.005 | 0.0461 | 0.0459 |
| Brugia malayi | ecdysteroid receptor | 0.0037 | 0.0301 | 0.0472 |
| Mycobacterium tuberculosis | Probable cytochrome P450 130 Cyp130 | 0.0021 | 0.0115 | 0.4881 |
| Schistosoma mansoni | hypothetical protein | 0.005 | 0.0461 | 0.044 |
| Brugia malayi | nuclear hormone receptor family member odr-7 | 0.0017 | 0.0065 | 0.0102 |
| Schistosoma mansoni | rab geranylgeranyl transferase alpha subunit | 0.0017 | 0.0068 | 0.0047 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0065 | 0.01 |
| Echinococcus granulosus | nuclear receptor subfamily 4 group A | 0.0017 | 0.0065 | 0.0064 |
| Entamoeba histolytica | hypothetical protein, conserved | 0.023 | 0.2657 | 1 |
| Mycobacterium tuberculosis | Possible cytochrome P450 135B1 Cyp135B1 | 0.0021 | 0.0115 | 0.4881 |
| Mycobacterium ulcerans | cytochrome P450 185A4 Cyp185A4 | 0.0032 | 0.0244 | 0.3749 |
| Echinococcus multilocularis | ATP dependent DNA helicase Q1 | 0.0035 | 0.0276 | 0.0274 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0037 | 0.0301 | 0.0472 |
| Trypanosoma brucei | metacaspase 5, putative | 0.0053 | 0.0505 | 0.1896 |
| Echinococcus multilocularis | JmjC domain containing protein 4 | 0.0019 | 0.0085 | 0.0084 |
| Echinococcus multilocularis | phd:f box containing protein | 0.0019 | 0.0085 | 0.0084 |
| Echinococcus granulosus | retinoic acid receptor rxr beta a | 0.0037 | 0.0301 | 0.0299 |
| Loa Loa (eye worm) | hypothetical protein | 0.003 | 0.0225 | 0.0352 |
| Schistosoma mansoni | caspase-7 (C14 family) | 0.0103 | 0.1111 | 0.1092 |
| Echinococcus multilocularis | thyroid hormone receptor alpha | 0.0189 | 0.2151 | 0.215 |
| Mycobacterium tuberculosis | Probable cytochrome P450 137 Cyp137 | 0.0021 | 0.0115 | 0.4881 |
| Schistosoma mansoni | DNA polymerase eta | 0.0017 | 0.0068 | 0.0047 |
| Onchocerca volvulus | Bile acid receptor homolog | 0.0037 | 0.0301 | 0.0374 |
| Schistosoma mansoni | hypothetical protein | 0.0152 | 0.1706 | 0.1688 |
| Schistosoma mansoni | nuclear hormone receptor nor-1/nor-2 | 0.0037 | 0.0301 | 0.028 |
| Toxoplasma gondii | histone lysine methyltransferase SET1 | 0.0071 | 0.0723 | 1 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0037 | 0.0301 | 0.0472 |
| Brugia malayi | polk-prov protein | 0.0038 | 0.0312 | 0.049 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0037 | 0.0301 | 0.0299 |
| Brugia malayi | steroid hormone receptor | 0.0037 | 0.0301 | 0.0472 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-40 | 0.0037 | 0.0301 | 0.047 |
| Mycobacterium leprae | putative cytochrome p450 | 0.0021 | 0.0115 | 0.5 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.002 | 0.0099 | 0.0365 |
| Loa Loa (eye worm) | runx1 | 0.0067 | 0.0672 | 0.1053 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0037 | 0.0301 | 0.0299 |
| Mycobacterium tuberculosis | Possible cytochrome P450 126 Cyp126 | 0.0021 | 0.0115 | 0.4881 |
| Brugia malayi | hypothetical protein | 0.003 | 0.0225 | 0.0354 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.023 | 0.2657 | 0.7856 |
| Brugia malayi | mucosa associated lymphoid tissue lymphoma translocation protein 1 | 0.0053 | 0.0505 | 0.0794 |
| Echinococcus multilocularis | Ataxin 2, N terminal,domain containing protein | 0.0014 | 0.0021 | 0.0019 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-14 | 0.0037 | 0.0301 | 0.047 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.002 | 0.0099 | 0.0365 |
| Brugia malayi | jmjC domain containing protein | 0.0019 | 0.0085 | 0.0134 |
| Echinococcus granulosus | hepatocyte nuclear factor 4 alpha | 0.0037 | 0.0301 | 0.0299 |
| Toxoplasma gondii | ATP-dependent DNA helicase, RecQ family protein | 0.0018 | 0.0069 | 0.073 |
| Toxoplasma gondii | cytochrome p450 superfamily protein | 0.0021 | 0.0115 | 0.1377 |
| Trypanosoma cruzi | Lanosterol 14-alpha demethylase | 0.0021 | 0.0115 | 0.0183 |
| Onchocerca volvulus | Steroid hormone receptor family member cnr14 homolog | 0.0037 | 0.0301 | 0.0374 |
| Onchocerca volvulus | 0.0037 | 0.0303 | 0.0377 | |
| Mycobacterium tuberculosis | Probable cytochrome P450 132 Cyp132 | 0.0021 | 0.0115 | 0.4881 |
| Echinococcus granulosus | dna polymerase kappa | 0.005 | 0.0459 | 0.0457 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.005 | 0.0459 | 0.151 |
| Echinococcus granulosus | jumonji domain containing 1A | 0.0019 | 0.0085 | 0.0084 |
| Schistosoma mansoni | ubiquitously transcribed sex (X/Y) chromosome tetratricopeptide repeat protein-related | 0.0019 | 0.0085 | 0.0065 |
| Echinococcus multilocularis | caspase | 0.0141 | 0.1574 | 0.1573 |
| Brugia malayi | Cytochrome P450 family protein | 0.0067 | 0.0676 | 0.1062 |
| Brugia malayi | Cytochrome P450 family protein | 0.0032 | 0.0244 | 0.0383 |
| Trypanosoma brucei | DNA repair and recombination helicase protein PIF7 | 0.023 | 0.2657 | 1 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.005 | 0.0459 | 0.151 |
| Schistosoma mansoni | RAR-like nuclear receptor | 0.0037 | 0.0301 | 0.028 |
| Loa Loa (eye worm) | hypothetical protein | 0.0037 | 0.0301 | 0.047 |
| Trypanosoma brucei | metacaspase MCA3 | 0.0053 | 0.0505 | 0.1896 |
| Trypanosoma cruzi | PAB1-binding protein , putative | 0.003 | 0.0225 | 0.0609 |
| Trypanosoma brucei | Metacaspase-4 | 0.0053 | 0.0505 | 0.1896 |
| Echinococcus granulosus | bloom syndrome protein | 0.005 | 0.046 | 0.0458 |
| Trichomonas vaginalis | set domain proteins, putative | 0.0287 | 0.3347 | 1 |
| Giardia lamblia | Rrm3p helicase | 0.023 | 0.2657 | 1 |
| Schistosoma mansoni | jumonji/arid domain-containing protein | 0.0073 | 0.0744 | 0.0724 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0019 | 0.009 | 0.0069 |
| Trypanosoma cruzi | cytochrome P450, putative | 0.0032 | 0.0244 | 0.068 |
| Echinococcus multilocularis | histone lysine N methyltransferase SETMAR | 0.0037 | 0.0303 | 0.0301 |
| Brugia malayi | hypothetical protein | 0.0535 | 0.6367 | 1 |
| Brugia malayi | Bloom's syndrome protein homolog | 0.005 | 0.046 | 0.0722 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0053 | 0.0505 | 0.1163 |
| Plasmodium vivax | ataxin-2 like protein, putative | 0.003 | 0.0225 | 0.3699 |
| Leishmania major | metacaspase, putative | 0.0053 | 0.0505 | 0.169 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0065 | 0.01 |
| Trichomonas vaginalis | cat eye syndrome critical region protein 2, cscr2, putative | 0.0051 | 0.0482 | 0.1089 |
| Schistosoma mansoni | nuclear receptor | 0.0017 | 0.0065 | 0.0044 |
| Schistosoma mansoni | blooms syndrome DNA helicase | 0.0018 | 0.0069 | 0.0048 |
| Mycobacterium ulcerans | DNA polymerase IV | 0.005 | 0.0459 | 1 |
| Echinococcus multilocularis | jumonji domain containing 1A | 0.0019 | 0.0085 | 0.0084 |
| Echinococcus granulosus | COUP TF:Svp nuclear hormone receptor | 0.0037 | 0.0301 | 0.0299 |
| Echinococcus multilocularis | ecdysone induced protein 78C | 0.0037 | 0.0301 | 0.0299 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-41 | 0.0037 | 0.0301 | 0.047 |
| Loa Loa (eye worm) | hypothetical protein | 0.0019 | 0.009 | 0.0139 |
| Plasmodium vivax | histone acetyltransferase GCN5, putative | 0.0051 | 0.0482 | 0.9466 |
| Loa Loa (eye worm) | hypothetical protein | 0.0019 | 0.009 | 0.0139 |
| Brugia malayi | Pre-SET motif family protein | 0.0252 | 0.2924 | 0.4592 |
| Echinococcus granulosus | FTZ F1 nuclear receptor protein | 0.0037 | 0.0301 | 0.0299 |
| Trichomonas vaginalis | Clan CD, family C14, metacaspase-like cysteine peptidase | 0.0053 | 0.0505 | 0.1163 |
| Schistosoma mansoni | ap endonuclease | 0.0023 | 0.0131 | 0.0111 |
| Toxoplasma gondii | histone lysine demethylase JMJD6a | 0.0019 | 0.0085 | 0.0958 |
| Brugia malayi | Nuclear hormone receptor family member nhr-41 | 0.0037 | 0.0301 | 0.0472 |
| Mycobacterium tuberculosis | Possible DNA-damage-inducible protein P DinP (DNA polymerase V) (pol IV 2) (DNA nucleotidyltransferase (DNA-directed)) | 0.0025 | 0.0165 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-14 | 0.0037 | 0.0301 | 0.0472 |
| Mycobacterium tuberculosis | Cytochrome P450 51 Cyp51 (CYPL1) (P450-L1A1) (sterol 14-alpha demethylase) (lanosterol 14-alpha demethylase) (P450-14DM) | 0.0021 | 0.0115 | 0.4881 |
| Brugia malayi | hypothetical protein | 0.002 | 0.0094 | 0.0148 |
| Echinococcus multilocularis | dna polymerase eta | 0.0017 | 0.0068 | 0.0066 |
| Toxoplasma gondii | histone lysine acetyltransferase GCN5-B | 0.0051 | 0.0482 | 0.6574 |
| Echinococcus multilocularis | COUP TF:Svp nuclear hormone receptor | 0.0037 | 0.0301 | 0.0299 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0017 | 0.0065 | 0.0044 |
| Echinococcus multilocularis | Transcription factor, JmjC domain containing protein | 0.0071 | 0.072 | 0.0718 |
| Brugia malayi | ecdysone receptor | 0.0017 | 0.0065 | 0.0102 |
| Leishmania major | hypothetical protein, conserved | 0.0019 | 0.0085 | 0.0069 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0065 | 0.01 |
| Brugia malayi | nuclear hormone receptor | 0.0037 | 0.0301 | 0.0472 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0065 | 0.01 |
| Mycobacterium tuberculosis | Possible cytochrome P450 135A1 Cyp135A1 | 0.0021 | 0.0115 | 0.4881 |
| Echinococcus granulosus | lysine specific demethylase 6a | 0.0019 | 0.0085 | 0.0084 |
| Loa Loa (eye worm) | hypothetical protein | 0.005 | 0.0461 | 0.0721 |
| Entamoeba histolytica | exodeoxyribonuclease III, putative | 0.0023 | 0.0131 | 0.027 |
| Trypanosoma brucei | DNA repair and recombination helicase protein PIF6 | 0.023 | 0.2657 | 1 |
| Schistosoma mansoni | DNA helicase recq5 | 0.0035 | 0.0276 | 0.0255 |
| Mycobacterium tuberculosis | Probable cytochrome P450 143 Cyp143 | 0.0021 | 0.0115 | 0.4881 |
| Echinococcus multilocularis | FTZ F1 nuclear receptor protein | 0.0037 | 0.0301 | 0.0299 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.005 | 0.0459 | 0.151 |
| Toxoplasma gondii | histone lysine methyltransferase SET/SUV39 | 0.0037 | 0.0303 | 0.4042 |
| Schistosoma mansoni | jumonji domain containing protein | 0.0019 | 0.0085 | 0.0065 |
| Trypanosoma cruzi | metacaspase, putative | 0.0053 | 0.0505 | 0.169 |
| Trypanosoma brucei | metacaspase MCA2 | 0.0053 | 0.0505 | 0.1896 |
| Brugia malayi | hypothetical protein | 0.0019 | 0.009 | 0.0142 |
| Trypanosoma cruzi | DNA repair and recombination helicase protein PIF7, putative | 0.023 | 0.2657 | 1 |
| Loa Loa (eye worm) | CYP4Cod1 | 0.0032 | 0.0244 | 0.038 |
| Echinococcus multilocularis | 0.0021 | 0.0115 | 0.0113 | |
| Schistosoma mansoni | thyroid hormone receptor | 0.0189 | 0.2151 | 0.2135 |
| Mycobacterium tuberculosis | Probable exodeoxyribonuclease III protein XthA (exonuclease III) (EXO III) (AP endonuclease VI) | 0.0023 | 0.0131 | 0.6567 |
| Echinococcus granulosus | ATP dependent DNA helicase PIF1 | 0.023 | 0.2657 | 0.2656 |
| Brugia malayi | nuclear receptor NHR-88 | 0.0037 | 0.0301 | 0.0472 |
| Echinococcus multilocularis | Nuclear hormone receptor HR96 | 0.0017 | 0.0065 | 0.0064 |
| Loa Loa (eye worm) | hypothetical protein | 0.0037 | 0.0301 | 0.047 |
| Plasmodium falciparum | AP endonuclease (DNA-[apurinic or apyrimidinic site] lyase), putative | 0.0023 | 0.0131 | 0.1094 |
| Loa Loa (eye worm) | nuclear receptor nhr-7B | 0.0017 | 0.0065 | 0.01 |
| Echinococcus multilocularis | terminal deoxycytidyl transferase rev1 | 0.0017 | 0.0068 | 0.0066 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0053 | 0.0505 | 0.1163 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| AC50 (functional) | = 1.584893192 uM | PUBCHEM_BIOASSAY: Cytochrome panel assay with activity outcomes. (Class of assay: other) Panel member name: p450-cyp2c19 Compounds with AC50 equal or less than 10 uM are considered active | ChEMBL. | No reference |
| AC50 (functional) | = 6.309573445 uM | PUBCHEM_BIOASSAY: Cytochrome panel assay with activity outcomes. (Class of assay: other) Panel member name: p450-cyp2d6 Compounds with AC50 equal or less than 10 uM are considered active | ChEMBL. | No reference |
| AC50 (functional) | = 12.58925412 uM | PUBCHEM_BIOASSAY: Cytochrome panel assay with activity outcomes. (Class of assay: other) Panel member name: p450-cyp1a2 Compounds with AC50 equal or less than 10 uM are considered active | ChEMBL. | No reference |
| AC50 (functional) | = 12.58925412 uM | PUBCHEM_BIOASSAY: Cytochrome panel assay with activity outcomes. (Class of assay: other) Panel member name: p450-cyp2c9 Compounds with AC50 equal or less than 10 uM are considered active | ChEMBL. | No reference |
| AC50 (functional) | = 15.84893192 uM | PUBCHEM_BIOASSAY: Cytochrome panel assay with activity outcomes. (Class of assay: other) Panel member name: p450-cyp3a4 Compounds with AC50 equal or less than 10 uM are considered active | ChEMBL. | No reference |
| IC50 (binding) | = 13200 nM | Inhibition of Butyrylcholinesterase | ChEMBL. | 15633997 |
| IC50 (binding) | = 32300 nM | Inhibition of Acetylcholinesterase | ChEMBL. | 15633997 |
| IC50 (binding) | = 6.8 uM | Tested for the binding of [3H]-dizocilpine to DEPC (diethylpyrocarbonate) membranes of rat | ChEMBL. | No reference |
| IC50 (functional) | = 12.6 uM | Inhibitory concentration of the compound was determined against amyloid-beta aggregation | ChEMBL. | 15633997 |
| IC50 (binding) | = 12.6 uM | Inhibition of human AchE-induced amyloid beta aggregation | ChEMBL. | 18181565 |
| IC50 (functional) | = 13 uM | Inhibition of human AChE-induced beta amyloid peptide(1-40) aggregation by thioflavin T-based fluorometric assay | ChEMBL. | 16279781 |
| IC50 (binding) | = 32 uM | Inhibition of human AchE | ChEMBL. | 18181565 |
| IC50 (binding) | > 1000 uM | Tested for the binding of [3H]-dizocilpine to NMDA receptor in rat brain membranes in the presence of 500 microM spermidine | ChEMBL. | No reference |
| Increase (functional) | = 97.6 % | Tested for the increase in [Ca2+] produced by 30 microM of the compound | ChEMBL. | No reference |
| Inhibition (functional) | = 46 % | Inhibition of beta amyloid protein 40 aggregation at 100 uM by thioflavin T-based fluorometric assay | ChEMBL. | 16279781 |
| Kd (binding) | = 1150 min-1 | Tested for the dissociation of [3H]-dizocilpine binding at a concentration 30 microM | ChEMBL. | No reference |
| Kd (binding) | = 1880 min-1 | Tested for the dissociation of [3H]-dizocilpine binding at a concentration 3 microM | ChEMBL. | No reference |
| Kd (binding) | = 1.1 uM | Dissociation constant of the compound towards Acetylcholinesterase in mouse | ChEMBL. | 15214773 |
| Ki (binding) | = 7140 nM | Competitive inhibition constant for Acetylcholinesterase | ChEMBL. | 15633997 |
| Potency (functional) | 0.8877 uM | PubChem BioAssay. qHTS Assay for Compounds Blocking the Interaction Between CBF-beta and RUNX1 for the Treatment of Acute Myeloid Leukemia: Hit Validation with Orthogonal Assay. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 1.1175 uM | PUBCHEM_BIOASSAY: qHTS Assay for Compounds Blocking the Interaction Between CBF-beta and RUNX1 for the Treatment of Acute Myeloid Leukemia: Hit Validation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID1477, AID1484] | ChEMBL. | No reference |
| Potency (functional) | = 1.2589 um | PUBCHEM_BIOASSAY: Counterscreen qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. This assay monitors tau fibrillation by fluorescence polarization (FP) of Alexa 594-labeled K18 P301L, which does not fibrillize readily but incorporates into growing filaments of unlabeled tau. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | ChEMBL. | No reference |
| Potency (binding) | = 1.2589 um | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Thioflavin T Binding. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | ChEMBL. | No reference |
| Potency (ADMET) | = 1.5849 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors and Substrates of Cytochrome P450 2C19. (Class of assay: confirmatory) [Related pubchem assays: 410 ] | ChEMBL. | No reference |
| Potency (functional) | = 2.5119 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Human Jumonji Domain Containing 2E (JMJD2E). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 2.5119 um | PUBCHEM_BIOASSAY: qHTS Assay for Allosteric/Competitive Inhibitors of Caspase-7. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 2.5119 um | PUBCHEM_BIOASSAY: VP16 counterscreen qHTS for inhibitors of ROR gamma transcriptional activity. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 2.5119 um | PUBCHEM_BIOASSAY: qHTS Assay for Allosteric/Competitive Inhibitors of Caspase-1. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 2.8184 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors Targeting the Menin-MLL Interaction in MLL Related Leukemias: Competition With Fluorescein Labeled MLL-derived Peptide. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 3.1623 um | PUBCHEM_BIOASSAY: qHTS for inhibitors of ROR gamma transcriptional activity. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 4.2284 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Polymerase Kappa. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588638] | ChEMBL. | No reference |
| Potency (functional) | = 5.0119 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Bloom's syndrome helicase (BLM). (Class of assay: confirmatory) [Related pubchem assays: 593 (Fluorescein region spectral profiling screen), 2386 (Probe Development Summary for Inhibitors of Bloom's syndrome helicase (BLM)), 594 (Rhodamine region spectral profiling screen), 2364 (qHTS Validation Assay for Inhibitors of Bloom's syndrome helicase (BLM))] | ChEMBL. | No reference |
| Potency (functional) | 5.0119 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Histone Lysine Methyltransferase G9a. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504404] | ChEMBL. | No reference |
| Potency (functional) | = 6.3096 um | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | ChEMBL. | No reference |
| Potency (ADMET) | = 6.3096 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors and Substrates of Cytochrome P450 2D6. (Class of assay: confirmatory) [Related pubchem assays: 410 ] | ChEMBL. | No reference |
| Potency (functional) | 6.3096 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Polymerase Kappa. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588638] | ChEMBL. | No reference |
| Potency (functional) | 7.9433 uM | PUBCHEM_BIOASSAY: Inhibitors of USP1/UAF1: Pilot qHTS. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504878] | ChEMBL. | No reference |
| Potency (functional) | 8.9125 uM | PUBCHEM_BIOASSAY: Inhibitors of the vitamin D receptor (VDR): qHTS. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504855] | ChEMBL. | No reference |
| Potency (functional) | = 11.2202 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of RecQ-Like Dna Helicase 1 (RECQ1). (Class of assay: confirmatory) [Related pubchem assays: 594 (Rhodamine region spectral profiling screen), 593 (Fluorescein region spectral profiling screen), 2367 (Probe Development Summary for Inhibitors of RecQ-Like Dna Helicase 1 (RECQ1)), 2353 (qHTS Validation Assay for Inhibitors of RecQ-Like Dna Helicase 1 (RECQ1))] | ChEMBL. | No reference |
| Potency (functional) | 11.2202 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of GCN5L2. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504398] | ChEMBL. | No reference |
| Potency (functional) | 11.2202 uM | PubChem BioAssay. qHTS for Inhibitors of ATXN expression. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 11.2202 uM | PubChem BioAssay. qHTS Assay for Inhibitors of the Human Apurinic/apyrimidinic Endonuclease 1 (APE1). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 12.5893 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors Targeting the Menin-MLL Interaction in MLL Related Leukemias: Competition With Texas Red Labeled MLL-derived Mutant Peptide. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (ADMET) | = 12.5893 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors and Substrates of Cytochrome P450 2C9. (Class of assay: confirmatory) [Related pubchem assays: 885, 884, 410 ] | ChEMBL. | No reference |
| Potency (functional) | = 15.8489 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of HPGD (15-Hydroxyprostaglandin Dehydrogenase). (Class of assay: confirmatory) [Related pubchem assays: 2429 (Confirmation qHTS Assay for Inhibitors of HPGD (15-Hydroxyprostaglandin Dehydrogenase)), 2407 (Probe Development Summary for Inhibitors of HPGD (15-Hydroxyprostaglandin Dehydrogenase)), 2427 (Thermal Shift Assay for Inhibitors of HPGD (15-Hydroxyprostaglandin Dehydrogenase))] | ChEMBL. | No reference |
| Potency (ADMET) | = 15.8489 um | PUBCHEM_BIOASSAY: qHTS Assay for Activators of Cytochrome P450 3A4. (Class of assay: confirmatory) [Related pubchem assays: 410 ] | ChEMBL. | No reference |
| Potency (ADMET) | = 15.8489 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors and Substrates of Cytochrome P450 3A4. (Class of assay: confirmatory) [Related pubchem assays: 410 ] | ChEMBL. | No reference |
| Potency (functional) | = 17.7828 um | PUBCHEM_BIOASSAY: Total Fluorescence Counterscreen for Inhibitors of the Interaction of Thyroid Hormone Receptor and Steroid Receptor Coregulator 2. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 25.1189 um | PUBCHEM_BIOASSAY: qHTS for Inhibitors of the Interaction of Thyroid Hormone Receptor and Steroid Receptor Coregulator 2. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 25.1189 uM | PubChem BioAssay. qHTS Assay for Inhibitors of the Human Apurinic/apyrimidinic Endonuclease 1 (APE1). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 28.1838 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Bacillus subtilis Sfp phosphopantetheinyl transferase (PPTase). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 28.1838 um | PUBCHEM_BIOASSAY: qHTS Assay for Identifying the Cell-Membrane Permeable IMPase Inhibitors: Potentiation with Lithium. (Class of assay: confirmatory) [Related pubchem assays: 901 ] | ChEMBL. | No reference |
| Potency (functional) | = 35.4813 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of RecQ-Like Dna Helicase 1 (RECQ1). (Class of assay: confirmatory) [Related pubchem assays: 594 (Rhodamine region spectral profiling screen), 593 (Fluorescein region spectral profiling screen), 2367 (Probe Development Summary for Inhibitors of RecQ-Like Dna Helicase 1 (RECQ1)), 2353 (qHTS Validation Assay for Inhibitors of RecQ-Like Dna Helicase 1 (RECQ1))] | ChEMBL. | No reference |
| Potency (functional) | = 44.6684 um | PUBCHEM_BIOASSAY: qHTS for Inhibitors of the Interaction of Thyroid Hormone Receptor and Steroid Receptor Coregulator 2. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 50.1187 um | PUBCHEM_BIOASSAY: Total Fluorescence Counterscreen for Inhibitors of the Interaction of Thyroid Hormone Receptor and Steroid Receptor Coregulator 2. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 50.1187 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Bacillus subtilis Sfp phosphopantetheinyl transferase (PPTase). (Class of assay: confirmatory) | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL332935
- DrugBank: DB02166
- PubChem: 4939
Bibliographic References
4 literature references were collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.