Detailed information for compound 218588
Basic information
Technical information
- TDR Targets ID: 218588
- Name: 7-fluoro-3-(4-methoxyphenyl)-5-propan-2-ylimi dazo[1,5-a]quinoxalin-4-one
- MW: 351.374 | Formula: C20H18FN3O2
-
H donors: 0
H acceptors: 2
LogP: 3.63
Rotable bonds: 3
Rule of 5 violations (Lipinski): 1 - SMILES: COc1ccc(cc1)c1ncn2c1c(=O)n(C(C)C)c1c2ccc(c1)F
- InChi: 1S/C20H18FN3O2/c1-12(2)24-17-10-14(21)6-9-16(17)23-11-22-18(19(23)20(24)25)13-4-7-15(26-3)8-5-13/h4-12H,1-3H3
- InChiKey: BGWZLGOWCXYYRI-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 7-fluoro-5-isopropyl-3-(4-methoxyphenyl)imidazo[1,5-a]quinoxalin-4-one
- 7-fluoro-5-isopropyl-3-(4-methoxyphenyl)-4-imidazo[1,5-a]quinoxalinone
- 7-fluoro-3-(4-methoxyphenyl)-5-propan-2-yl-imidazo[1,5-a]quinoxalin-4-one
- 7-fluoro-3-(4-methoxyphenyl)-5-propan-2-ylimidazo[5,1-c]quinoxalin-4-one
- 7-fluoro-5-isopropyl-3-(4-methoxyphenyl)imidazo[5,1-c]quinoxalin-4-one
- 7-fluoro-5-isopropyl-3-(4-methoxyphenyl)-4-imidazo[5,1-c]quinoxalinone
- 7-fluoro-3-(4-methoxyphenyl)-5-propan-2-yl-imidazo[5,1-c]quinoxalin-4-one
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Rattus norvegicus | GABA-A receptor; anion channel | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus granulosus | glycine receptor subunit beta | 0.0035 | 1 | 1 |
| Echinococcus granulosus | nicotinic acetylcholine receptor subunit type | 0.0035 | 1 | 1 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0031 | 0.6405 | 0.6405 |
| Brugia malayi | Cation transporter family protein | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Onchocerca volvulus | 0.0035 | 1 | 1 | |
| Brugia malayi | nicotinic acetylcholine receptor alpha subunit, putative | 0.0035 | 1 | 1 |
| Echinococcus multilocularis | tar DNA binding protein | 0.0031 | 0.6405 | 0.6405 |
| Echinococcus multilocularis | glycine receptor subunit alpha 1 | 0.0035 | 1 | 1 |
| Echinococcus multilocularis | acetylcholine receptor subunit beta 1 | 0.0035 | 1 | 1 |
| Echinococcus granulosus | glycine receptor subunit beta | 0.0035 | 1 | 1 |
| Brugia malayi | RNA binding protein | 0.0031 | 0.6405 | 0.6405 |
| Onchocerca volvulus | 0.0035 | 1 | 1 | |
| Schistosoma mansoni | nAChR subunit | 0.0035 | 1 | 1 |
| Schistosoma mansoni | nAChR subunit (ShAR1-beta-like) | 0.0035 | 1 | 1 |
| Echinococcus multilocularis | nicotinic acetylcholine receptor a11 subunit | 0.0035 | 1 | 1 |
| Brugia malayi | TAR-binding protein | 0.0031 | 0.6405 | 0.6405 |
| Echinococcus multilocularis | nicotinic acetylcholine receptor subunit alpha 8 | 0.0035 | 1 | 1 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0031 | 0.6405 | 0.6405 |
| Loa Loa (eye worm) | ACC-1 protein | 0.0035 | 1 | 1 |
| Echinococcus granulosus | glycine receptor subunit alpha 1 | 0.0035 | 1 | 1 |
| Brugia malayi | acetylcholine receptor, alpha-type subunit unc-38 precursor | 0.0035 | 1 | 1 |
| Brugia malayi | Neurotransmitter-gated ion-channel ligand binding domain containing protein | 0.0035 | 1 | 1 |
| Schistosoma mansoni | nAChR subunit | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Schistosoma mansoni | Cys-loop ligand gated ion channel subunit | 0.0035 | 1 | 1 |
| Echinococcus multilocularis | glycine receptor subunit beta | 0.0035 | 1 | 1 |
| Echinococcus multilocularis | neuronal acetylcholine receptor subunit alpha 4 | 0.0035 | 1 | 1 |
| Echinococcus multilocularis | glycine receptor subunit alpha 1 | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | glutamate-gated chloride channel alpha3A subunit | 0.0035 | 1 | 1 |
| Brugia malayi | Neurotransmitter-gated ion-channel transmembrane region family protein | 0.0035 | 1 | 1 |
| Onchocerca volvulus | 0.0035 | 1 | 1 | |
| Schistosoma mansoni | nAChR subunit | 0.0035 | 1 | 1 |
| Schistosoma mansoni | nAChR subunit | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | RNA recognition domain-containing protein domain-containing protein | 0.0031 | 0.6405 | 0.6405 |
| Echinococcus granulosus | nicotinic acetylcholine receptor beta 1 subunit | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Brugia malayi | Neurotransmitter-gated ion-channel ligand binding domain containing protein | 0.0035 | 1 | 1 |
| Brugia malayi | acetylcholine receptor alpha subunit precursor, putative | 0.0035 | 1 | 1 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0031 | 0.6405 | 0.6405 |
| Loa Loa (eye worm) | TAR-binding protein | 0.0031 | 0.6405 | 0.6405 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Brugia malayi | Cation transporter family protein | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Schistosoma mansoni | nAChR subunit | 0.0035 | 1 | 1 |
| Echinococcus multilocularis | glycine receptor subunit beta | 0.0035 | 1 | 1 |
| Brugia malayi | Neurotransmitter-gated ion-channel transmembrane region family protein | 0.0035 | 1 | 1 |
| Brugia malayi | gamma-aminobutyric-acid receptor beta subunit precursor | 0.0035 | 1 | 1 |
| Echinococcus granulosus | nAChR subunit | 0.0035 | 1 | 1 |
| Brugia malayi | RNA recognition motif domain containing protein | 0.0031 | 0.6405 | 0.6405 |
| Brugia malayi | Neurotransmitter-gated ion-channel ligand binding domain containing protein | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Brugia malayi | acetylcholine receptor protein, alpha-like chain, putative | 0.0035 | 1 | 1 |
| Brugia malayi | Hypothetical glycine receptor like protein T20B12.9 in chromosome III | 0.0035 | 1 | 1 |
| Schistosoma mansoni | nAChR subunit | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Echinococcus granulosus | tar DNA binding protein | 0.0031 | 0.6405 | 0.6405 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | nicotinic acetylcholine receptor non-alpha subunit | 0.0035 | 1 | 1 |
| Echinococcus granulosus | acetylcholine receptor subunit beta 1 | 0.0035 | 1 | 1 |
| Schistosoma mansoni | Cys-loop ligand gated ion channel subunit | 0.0035 | 1 | 1 |
| Echinococcus granulosus | nicotinic acetylcholine receptor subunit alpha 8 | 0.0035 | 1 | 1 |
| Schistosoma mansoni | Cys-loop ligand gated ion channel subunit | 0.0035 | 1 | 1 |
| Echinococcus granulosus | nicotinic acetylcholine receptor alpha subunit | 0.0035 | 1 | 1 |
| Schistosoma mansoni | nAChR subunit (ShAR1-beta2-like) | 0.0035 | 1 | 1 |
| Echinococcus multilocularis | Cys loop ligand gated ion channel subunit | 0.0035 | 1 | 1 |
| Echinococcus multilocularis | nicotinic acetylcholine receptor alpha subunit | 0.0035 | 1 | 1 |
| Onchocerca volvulus | Putative nachr subunit | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Onchocerca volvulus | 0.0035 | 1 | 1 | |
| Loa Loa (eye worm) | LGC-31 protein | 0.0035 | 1 | 1 |
| Echinococcus granulosus | nicotinic acetylcholine receptor a11 subunit | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | nicotinic acetylcholine receptor alpha subunit | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | ligand-Gated ion Channel family member | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Echinococcus granulosus | glycine receptor subunit alpha 1 | 0.0035 | 1 | 1 |
| Echinococcus granulosus | glycine receptor subunit alpha 1 | 0.0035 | 1 | 1 |
| Onchocerca volvulus | 0.0035 | 1 | 1 | |
| Brugia malayi | Neurotransmitter-gated ion-channel transmembrane region family protein | 0.0035 | 1 | 1 |
| Schistosoma mansoni | nAChR subunit (ShAR1-alpha-like) | 0.0035 | 1 | 1 |
| Echinococcus multilocularis | nicotinic acetylcholine receptor beta 1 subunit | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | RNA binding protein | 0.0031 | 0.6405 | 0.6405 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0031 | 0.6405 | 0.6405 |
| Echinococcus granulosus | Cys loop ligand gated ion channel subunit | 0.0035 | 1 | 1 |
| Brugia malayi | Neurotransmitter-gated ion-channel ligand binding domain containing protein | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | ACC-1 protein | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | excitatory GABA receptor EXP-1A | 0.0035 | 1 | 1 |
| Schistosoma mansoni | nAChR subunit | 0.0035 | 1 | 1 |
| Echinococcus granulosus | neuronal acetylcholine receptor subunit alpha 4 | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Echinococcus multilocularis | glycine receptor subunit alpha 1 | 0.0035 | 1 | 1 |
| Brugia malayi | Cation transporter family protein | 0.0035 | 1 | 1 |
| Brugia malayi | nicotinic acetylcholine receptor beta-1 chain precursor | 0.0035 | 1 | 1 |
| Onchocerca volvulus | 0.0035 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Brugia malayi | Neurotransmitter-gated ion-channel ligand binding domain containing protein | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Brugia malayi | Neurotransmitter-gated ion-channel ligand binding domain containing protein | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | acetylcholine receptor alpha subunit | 0.0035 | 1 | 1 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0031 | 0.6405 | 0.6405 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Echinococcus multilocularis | nAChR subunit | 0.0035 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Cl - current change (functional) | = 1.05 | In vitro efficacy calculated by chlorine current assay on alpha1-beta2-gamma2 (GABA-A) receptor subtype | ChEMBL. | 8809170 |
| Cl - current change (functional) | = 1.05 | In vitro efficacy calculated by chlorine current assay on alpha1-beta2-gamma2 (GABA-A) receptor subtype | ChEMBL. | 8809170 |
| ED50 (functional) | > 50 mg kg-1 | Ability to antagonize metrazole-induced seizures (clonic and tonic) in mice after intraperitoneal injection | ChEMBL. | 8809170 |
| ED50 (functional) | > 50 mg kg-1 | Ability to antagonize metrazole-induced seizures (clonic and tonic) in mice after intraperitoneal injection | ChEMBL. | 8809170 |
| Ki (binding) | = 81.5 nM | Binding affinity against benzodiazepine receptor (BzR) in rat cortical membranes determined by competition experiments with radiolabeled [3H]-flunitrazepam (Fnz) | ChEMBL. | 8809170 |
| Ki (binding) | = 81.5 nM | Binding affinity against benzodiazepine receptor (BzR) in rat cortical membranes determined by competition experiments with radiolabeled [3H]-flunitrazepam (Fnz) | ChEMBL. | 8809170 |
| TBPS shift (binding) | = 0.97 | In vitro efficacy by [35S]-t-butyl-bicyclophosphorothionate (TBPS) binding to the picrotoxin convulsant site on the GABA-A receptor chloride complex. | ChEMBL. | 8809170 |
| TBPS shift (binding) | = 0.97 | In vitro efficacy by [35S]-t-butyl-bicyclophosphorothionate (TBPS) binding to the picrotoxin convulsant site on the GABA-A receptor chloride complex. | ChEMBL. | 8809170 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL127455
- PubChem: 10569929
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.