Detailed information for compound 226045
Basic information
Technical information
- Name: Unnamed compound
- MW: 435.254 | Formula: C20H14Cl2F2N4O
-
H donors: 2
H acceptors: 2
LogP: 4.47
Rotable bonds: 4
Rule of 5 violations (Lipinski): 1 - SMILES: Fc1ccc(c(c1)F)CNc1ccc2c(n1)CNC(=O)N2c1c(Cl)cccc1Cl
- InChi: 1S/C20H14Cl2F2N4O/c21-13-2-1-3-14(22)19(13)28-17-6-7-18(27-16(17)10-26-20(28)29)25-9-11-4-5-12(23)8-15(11)24/h1-8H,9-10H2,(H,25,27)(H,26,29)
- InChiKey: CCQMLOFTVBGBMN-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | mitogen-activated protein kinase 14 | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Trypanosoma brucei | mitogen-activated protein kinase 5 | mitogen-activated protein kinase 14 | 360 aa | 336 aa | 33.3 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.027 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Onchocerca volvulus | 0.0121 | 0.2448 | 0.2448 | |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | thymidylate synthase | 0.0121 | 0.2448 | 0.1727 |
| Onchocerca volvulus | 0.027 | 1 | 1 | |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.027 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.027 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.027 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.027 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.027 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.027 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.027 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.027 | 1 | 1 |
| Plasmodium falciparum | bifunctional dihydrofolate reductase-thymidylate synthase | 0.017 | 0.4937 | 0.5 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.027 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Mycobacterium ulcerans | thymidylate synthase | 0.0121 | 0.2448 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.027 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.027 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.027 | 1 | 1 |
| Onchocerca volvulus | 0.027 | 1 | 1 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.027 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.027 | 1 | 1 |
| Onchocerca volvulus | 0.027 | 1 | 1 | |
| Schistosoma mansoni | opsin-like receptor | 0.027 | 1 | 1 |
| Echinococcus multilocularis | mitogen activated protein kinase 14 | 0.0152 | 0.4045 | 0.3384 |
| Onchocerca volvulus | 0.027 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.027 | 1 | 1 |
| Onchocerca volvulus | 0.027 | 1 | 1 | |
| Leishmania major | dihydrofolate reductase-thymidylate synthase | 0.017 | 0.4937 | 1 |
| Trypanosoma brucei | dihydrofolate reductase-thymidylate synthase | 0.017 | 0.4937 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.027 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.027 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.027 | 1 | 1 |
| Plasmodium vivax | bifunctional dihydrofolate reductase-thymidylate synthase, putative | 0.017 | 0.4937 | 0.5 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.027 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.027 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.027 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.027 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.027 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.027 | 1 | 1 |
| Onchocerca volvulus | 0.027 | 1 | 1 | |
| Echinococcus multilocularis | somatostatin receptor | 0.027 | 1 | 1 |
| Onchocerca volvulus | 0.027 | 1 | 1 | |
| Echinococcus granulosus | orexin receptor type 2 | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.027 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.027 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.027 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.027 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.027 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.027 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.027 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.027 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.027 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.027 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus granulosus | mitogen activated protein kinase 14 | 0.0152 | 0.4045 | 0.3384 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.027 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.027 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.027 | 1 | 1 |
| Onchocerca volvulus | 0.027 | 1 | 1 | |
| Onchocerca volvulus | 0.027 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.027 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.027 | 1 | 1 |
| Brugia malayi | thymidylate synthase | 0.0121 | 0.2448 | 0.2448 |
| Echinococcus multilocularis | g protein coupled receptor | 0.027 | 1 | 1 |
| Onchocerca volvulus | 0.027 | 1 | 1 | |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.027 | 1 | 1 |
| Schistosoma mansoni | bifunctional dihydrofolate reductase-thymidylate synthase | 0.0121 | 0.2448 | 0.2351 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.027 | 1 | 1 |
| Echinococcus multilocularis | thymidylate synthase | 0.0121 | 0.2448 | 0.161 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.027 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.027 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.027 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.027 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.027 | 1 | 1 |
| Onchocerca volvulus | 0.027 | 1 | 1 | |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.027 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.027 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.027 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.027 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.027 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.027 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.027 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Toxoplasma gondii | bifunctional dihydrofolate reductase-thymidylate synthase | 0.017 | 0.4937 | 0.5 |
| Brugia malayi | GnHR receptor homolog | 0.027 | 1 | 1 |
| Brugia malayi | P38 map kinase family protein 2 | 0.0152 | 0.4045 | 0.4045 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.027 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.027 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.027 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.027 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.027 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.027 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.027 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.027 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.027 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.027 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.027 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.027 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.027 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.027 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.027 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Onchocerca volvulus | 0.027 | 1 | 1 | |
| Echinococcus granulosus | neuropeptide s receptor | 0.027 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.027 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.027 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.027 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.027 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.027 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.027 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.027 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.027 | 1 | 1 |
| Trypanosoma cruzi | dihydrofolate reductase-thymidylate synthase | 0.017 | 0.4937 | 1 |
| Echinococcus granulosus | thymidylate synthase | 0.0121 | 0.2448 | 0.161 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.027 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.027 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.027 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.027 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.027 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.027 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.027 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.027 | 1 | 1 |
| Echinococcus multilocularis | mitogen activated protein kinase 14 | 0.0152 | 0.4045 | 0.3384 |
| Mycobacterium leprae | PROBABLE THYMIDYLATE SYNTHASE THYA (TS) (TSASE) | 0.0121 | 0.2448 | 0.5 |
| Schistosoma mansoni | biogenic amine receptor | 0.027 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.027 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.027 | 1 | 1 |
| Onchocerca volvulus | 0.027 | 1 | 1 | |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.027 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.027 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.027 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.027 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.027 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.027 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Onchocerca volvulus | 0.027 | 1 | 1 | |
| Schistosoma mansoni | biogenic amine receptor | 0.027 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.027 | 1 | 1 |
| Brugia malayi | bZIP transcription factor family protein | 0.0092 | 0.0999 | 0.0999 |
| Onchocerca volvulus | 0.027 | 1 | 1 | |
| Echinococcus multilocularis | fmrfamide receptor | 0.027 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.027 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.027 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.027 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.027 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.027 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.027 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.027 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.027 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.027 | 1 | 1 |
| Onchocerca volvulus | 0.027 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.027 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.027 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.027 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.027 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.027 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.027 | 1 | 1 |
| Brugia malayi | RE15519p | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | CMGC/MAPK/P38 protein kinase | 0.0152 | 0.4045 | 0.3476 |
| Echinococcus granulosus | mitogen activated protein kinase 11 | 0.0152 | 0.4045 | 0.3384 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.027 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.027 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus multilocularis | mitogen activated protein kinase 11 | 0.0152 | 0.4045 | 0.3384 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.027 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.027 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.027 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.027 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.027 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.027 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.027 | 1 | 1 |
| Mycobacterium tuberculosis | Probable thymidylate synthase ThyA (ts) (TSASE) | 0.0121 | 0.2448 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.027 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.027 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.027 | 1 | 1 |
| Onchocerca volvulus | 0.027 | 1 | 1 | |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.027 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.027 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.027 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.027 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.027 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.027 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.027 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.027 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.027 | 1 | 1 |
| Echinococcus multilocularis | mitogen activated protein kinase 11 | 0.0152 | 0.4045 | 0.3384 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.027 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.027 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.027 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.027 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.027 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.027 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.027 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.027 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.027 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.027 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.027 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 340 nM | Inhibitory activity against Mitogen-activated protein kinase p38 alpha | ChEMBL. | 14592489 |
| IC50 (binding) | = 340 nM | Inhibitory activity against Mitogen-activated protein kinase p38 alpha | ChEMBL. | 14592489 |
| Inhibition (binding) | = 42 % | Inhibition of Mitogen-activated protein kinase p38 beta by 1 uM. | ChEMBL. | 14592489 |
| Inhibition (binding) | = 42 % | Inhibition of Mitogen-activated protein kinase p38 beta by 1 uM. | ChEMBL. | 14592489 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL423517
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.