Detailed information for compound 229706
Basic information
Technical information
- TDR Targets ID: 229706
- Name: 2'-[(3-chlorophenyl)methyl]spiro[pyrrolidine- 3,4'-pyrrolo[1,2-a]pyrazine]-1',2,3',5-tetron e
- MW: 357.748 | Formula: C17H12ClN3O4
-
H donors: 1
H acceptors: 4
LogP: 1.12
Rotable bonds: 2
Rule of 5 violations (Lipinski): 1 - SMILES: O=C1NC(=O)C2(C1)C(=O)N(Cc1cccc(c1)Cl)C(=O)c1n2ccc1
- InChi: 1S/C17H12ClN3O4/c18-11-4-1-3-10(7-11)9-20-14(23)12-5-2-6-21(12)17(16(20)25)8-13(22)19-15(17)24/h1-7H,8-9H2,(H,19,22,24)
- InChiKey: LQNQZMAILSVFMV-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 2'-(3-chlorobenzyl)spiro[pyrrolidine-3,4'-pyrrolo[1,2-a]pyrazine]-1',2,3',5-diquinone
- 2'-[(3-chlorophenyl)methyl]spiro[pyrrolidine-3,4'-pyrrolo[1,2-d]pyrazine]-1',2,3',5-tetrone
- 2'-(3-chlorobenzyl)spiro[pyrrolidine-3,4'-pyrrolo[1,2-d]pyrazine]-1',2,3',5-diquinone
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Sus scrofa | Aldose reductase | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Mycobacterium ulcerans | oxidoreductase | 0.0038 | 0.7727 | 0.5 |
| Onchocerca volvulus | 0.0038 | 0.7727 | 1 | |
| Leishmania major | prostaglandin f synthase, putative | 0.0038 | 0.7727 | 0.7727 |
| Entamoeba histolytica | aldose reductase, putative | 0.0038 | 0.7727 | 0.7727 |
| Trichomonas vaginalis | aldo/keto reductase, putative | 0.0038 | 0.7727 | 1 |
| Plasmodium falciparum | serine/threonine protein phosphatase 2B catalytic subunit A | 0.0041 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase | 0.0038 | 0.7727 | 0.7727 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0038 | 0.7727 | 0.7727 |
| Echinococcus multilocularis | aldo keto reductase | 0.0038 | 0.7727 | 0.7727 |
| Leishmania major | serine/threonine protein phosphatase 2B catalytic subunit A2, putative | 0.0041 | 1 | 1 |
| Trichomonas vaginalis | dihydrodiol dehydrogenase, putative | 0.0038 | 0.7727 | 1 |
| Echinococcus multilocularis | aldo keto reductase | 0.0038 | 0.7727 | 0.7727 |
| Echinococcus granulosus | aldo keto reductase | 0.0038 | 0.7727 | 0.7727 |
| Loa Loa (eye worm) | oxidoreductase | 0.0038 | 0.7727 | 0.7727 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.7727 | 1 |
| Trypanosoma cruzi | serine/threonine protein phosphatase, putative | 0.0041 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0038 | 0.7727 | 0.7727 |
| Leishmania major | aldo-keto reductase-like protein | 0.0038 | 0.7727 | 0.7727 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.7727 | 1 |
| Giardia lamblia | Aldose reductase | 0.0038 | 0.7727 | 1 |
| Echinococcus granulosus | serine:threonine protein phosphatase 2B | 0.0041 | 1 | 1 |
| Trichomonas vaginalis | dihydrodiol dehydrogenase, putative | 0.0038 | 0.7727 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0038 | 0.7727 | 0.7727 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0038 | 0.7727 | 0.7727 |
| Trypanosoma brucei | prostaglandin f synthase | 0.0038 | 0.7727 | 0.7727 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0038 | 0.7727 | 0.7727 |
| Echinococcus multilocularis | aldo keto reductase | 0.0038 | 0.7727 | 0.7727 |
| Leishmania major | aldehyde reductase, putative,oxidoreductase, putative | 0.0038 | 0.7727 | 0.7727 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0038 | 0.7727 | 0.7727 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0038 | 0.7727 | 0.7727 |
| Giardia lamblia | Aldose reductase | 0.0038 | 0.7727 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0038 | 0.7727 | 0.7727 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0038 | 0.7727 | 1 |
| Schistosoma mansoni | aldo-keto reductase | 0.0038 | 0.7727 | 0.7727 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0038 | 0.7727 | 0.7727 |
| Entamoeba histolytica | aldose reductase, putative | 0.0038 | 0.7727 | 0.7727 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.7727 | 1 |
| Mycobacterium leprae | PROBABLE OXIDOREDUCTASE | 0.0038 | 0.7727 | 0.5 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0038 | 0.7727 | 0.7727 |
| Toxoplasma gondii | protein phosphatase 2B catalytic subunit, calcineurin family phosphatse superfamily protein | 0.0041 | 1 | 1 |
| Onchocerca volvulus | 0.0038 | 0.7727 | 1 | |
| Schistosoma mansoni | protein phosphatase-2b | 0.0041 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.7727 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.7727 | 1 |
| Brugia malayi | oxidoreductase, aldo/keto reductase family protein | 0.0038 | 0.7727 | 0.7727 |
| Trypanosoma cruzi | serine/threonine protein phosphatase, putative | 0.0041 | 1 | 1 |
| Treponema pallidum | ATP-dependent RNA helicase | 0.0027 | 0 | 0.5 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0038 | 0.7727 | 0.7727 |
| Entamoeba histolytica | calcineurin catalytic subunit A, putative | 0.0041 | 1 | 1 |
| Echinococcus multilocularis | serine:threonine protein phosphatase 2B | 0.0041 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase | 0.0038 | 0.7727 | 0.7727 |
| Loa Loa (eye worm) | oxidoreductase | 0.0038 | 0.7727 | 0.7727 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0038 | 0.7727 | 0.7727 |
| Trichomonas vaginalis | dihydrodiol dehydrogenase, putative | 0.0038 | 0.7727 | 1 |
| Echinococcus granulosus | aldo keto reductase | 0.0038 | 0.7727 | 0.7727 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0038 | 0.7727 | 0.7727 |
| Schistosoma mansoni | pol-related | 0.0038 | 0.7727 | 0.7727 |
| Entamoeba histolytica | calcineurin catalytic subunit A, putative | 0.0041 | 1 | 1 |
| Schistosoma mansoni | protein phosphatase-2b | 0.0041 | 1 | 1 |
| Brugia malayi | oxidoreductase, aldo/keto reductase family protein | 0.0038 | 0.7727 | 0.7727 |
| Schistosoma mansoni | aldo-keto reductase | 0.0038 | 0.7727 | 0.7727 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.7727 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0038 | 0.7727 | 0.7727 |
| Echinococcus granulosus | serine:threonine protein phosphatase 2B | 0.0041 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.7727 | 1 |
| Trypanosoma brucei | protein phosphatase 2B, putative | 0.0041 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 1 | 1 |
| Trypanosoma cruzi | aldo-keto reductase | 0.0038 | 0.7727 | 0.7727 |
| Loa Loa (eye worm) | oxidoreductase | 0.0038 | 0.7727 | 0.7727 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.7727 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0038 | 0.7727 | 0.7727 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0038 | 0.7727 | 0.7727 |
| Trypanosoma brucei | aldo-keto reductase, putative | 0.0038 | 0.7727 | 0.7727 |
| Onchocerca volvulus | 0.0038 | 0.7727 | 1 | |
| Trypanosoma cruzi | aldo/keto reductase, putative | 0.0038 | 0.7727 | 0.7727 |
| Onchocerca volvulus | 0.0038 | 0.7727 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.7727 | 0.7727 |
| Toxoplasma gondii | aldose reductase, putative | 0.0038 | 0.7727 | 0.7727 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.7727 | 1 |
| Entamoeba histolytica | aldose reductase, putative | 0.0038 | 0.7727 | 0.7727 |
| Onchocerca volvulus | 0.0038 | 0.7727 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 0.9588 | 0.9588 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0038 | 0.7727 | 0.7727 |
| Entamoeba histolytica | Ser/Thr protein phosphatase, putative | 0.0041 | 1 | 1 |
| Trichomonas vaginalis | aldo/keto reductase, putative | 0.0038 | 0.7727 | 1 |
| Trichomonas vaginalis | aldo/keto reductase, putative | 0.0038 | 0.7727 | 1 |
| Leishmania major | prostaglandin f2-alpha synthase/D-arabinose dehydrogenase | 0.0038 | 0.7727 | 0.7727 |
| Leishmania major | serine/threonine protein phosphatase, putative | 0.0041 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.7727 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0038 | 0.7727 | 0.7727 |
| Brugia malayi | oxidoreductase, aldo/keto reductase family protein | 0.0038 | 0.7727 | 0.7727 |
| Entamoeba histolytica | calcineurin catalytic subunit A, putative | 0.0041 | 1 | 1 |
| Trypanosoma cruzi | serine/threonine protein phosphatase 2B catalytic subunit A2, putative | 0.0041 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.7727 | 1 |
| Echinococcus multilocularis | serine:threonine protein phosphatase 2B | 0.0041 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0038 | 0.7727 | 0.7727 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0038 | 0.7727 | 0.7727 |
| Entamoeba histolytica | Ser/Thr protein phosphatase, putative | 0.0041 | 1 | 1 |
| Entamoeba histolytica | calcineurin catalytic subunit A, putative | 0.0041 | 1 | 1 |
| Brugia malayi | oxidoreductase, aldo/keto reductase family protein | 0.0038 | 0.7727 | 0.7727 |
| Onchocerca volvulus | 0.0038 | 0.7727 | 1 | |
| Plasmodium vivax | serine/threonine protein phosphatase 2B catalytic subunit A, putative | 0.0041 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0038 | 0.7727 | 0.7727 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.7727 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0038 | 0.7727 | 0.7727 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0038 | 0.7727 | 0.7727 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| ED50 (functional) | = 3.8 mg kg-1 day-1 | Dose required for inhibition of sorbital accumulation in the sciatic nerve of streptozotocin- induced diabetic rat. | ChEMBL. | 9767647 |
| IC50 (binding) | = 0.035 uM | In vitro inhibitory activity against aldose reductase in porcine lens. | ChEMBL. | 9767647 |
| IC50 (binding) | = 0.035 uM | In vitro inhibitory activity against aldose reductase in porcine lens. | ChEMBL. | 9767647 |
| Inhibition (functional) | = 99.4 % | Tested in vivo for inhibition of sorbital accumulation in the sciatic nerve of streptozotocin- induced diabetic rat; % Inhibition at 30 mg/kg | ChEMBL. | 9767647 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL133475
- PubChem: 11792691
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.