Detailed information for compound 29181
Basic information
Technical information
- TDR Targets ID: 29181
- Name: 6-[[2-methoxy-5-(trifluoromethyl)anilino]meth yl]-5-methylpyrido[2,3-d]pyrimidine-2,4-diami ne
- MW: 378.352 | Formula: C17H17F3N6O
-
H donors: 3
H acceptors: 3
LogP: 2.81
Rotable bonds: 5
Rule of 5 violations (Lipinski): 1 - SMILES: COc1ccc(cc1NCc1cnc2c(c1C)c(N)nc(n2)N)C(F)(F)F
- InChi: 1S/C17H17F3N6O/c1-8-9(7-24-15-13(8)14(21)25-16(22)26-15)6-23-11-5-10(17(18,19)20)3-4-12(11)27-2/h3-5,7,23H,6H2,1-2H3,(H4,21,22,24,25,26)
- InChiKey: XNEOAXKYJADVSI-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 6-[[2-methoxy-5-(trifluoromethyl)anilino]methyl]-5-methyl-pyrido[2,3-d]pyrimidine-2,4-diamine
- 6-[[[2-methoxy-5-(trifluoromethyl)phenyl]amino]methyl]-5-methyl-pyrido[2,3-d]pyrimidine-2,4-diamine
- (2,4-diamino-5-methyl-pyrido[2,3-d]pyrimidin-6-yl)methyl-[2-methoxy-5-(trifluoromethyl)phenyl]amine
- SoRI 8897
- 6-[[[2-methoxy-5-(trifluoromethyl)phenyl]amino]methyl]-5-methylpyrido[3,2-e]pyrimidine-2,4-diamine
- 6-[[[2-methoxy-5-(trifluoromethyl)phenyl]amino]methyl]-5-methyl-pyrido[3,2-e]pyrimidine-2,4-diamine
- (2,4-diamino-5-methyl-pyrido[5,6-e]pyrimidin-6-yl)methyl-[2-methoxy-5-(trifluoromethyl)phenyl]amine
- 174654-98-9
- 6-[(2-Methoxy-5-trifluoromethylphenylamino)methyl]-2,4-diamino-5-methylpyrido[2,3-d]pyrimidine
- AIDS-010316
- AIDS010316
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Toxoplasma gondii | bifunctional dihydrofolate reductase-thymidylate synthase | Starlite/ChEMBL | References |
| Mycobacterium tuberculosis | Dihydrofolate reductase DfrA (DHFR) (tetrahydrofolate dehydrogenase) | Curated by TDR Targets | References |
| Mycobacterium avium | Dihydrofolate reductase | Starlite/ChEMBL | References |
| Mycobacterium leprae | DIHYDROFOLATE REDUCTASE DFRA (DHFR) (TETRAHYDROFOLATE DEHYDROGENASE) | Curated by TDR Targets | References |
| Rattus norvegicus | Dihydrofolate reductase | Starlite/ChEMBL | References |
| Pneumocystis carinii | Dihydrofolate reductase | Starlite/ChEMBL | References |
| Homo sapiens | dihydrofolate reductase | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Plasmodium vivax | bifunctional dihydrofolate reductase-thymidylate synthase, putative | 0.0659 | 0.4297 | 0.5 |
| Onchocerca volvulus | 0.0177 | 0 | 0.5 | |
| Trypanosoma brucei | dihydrofolate reductase-thymidylate synthase | 0.0659 | 0.4297 | 0.5 |
| Schistosoma mansoni | dihydrofolate reductase | 0.1298 | 1 | 1 |
| Plasmodium falciparum | bifunctional dihydrofolate reductase-thymidylate synthase | 0.0659 | 0.4297 | 0.5 |
| Onchocerca volvulus | 0.0177 | 0 | 0.5 | |
| Onchocerca volvulus | 0.0177 | 0 | 0.5 | |
| Mycobacterium ulcerans | dihydrofolate reductase DfrA | 0.1298 | 1 | 0.5 |
| Onchocerca volvulus | 0.0177 | 0 | 0.5 | |
| Mycobacterium leprae | DIHYDROFOLATE REDUCTASE DFRA (DHFR) (TETRAHYDROFOLATE DEHYDROGENASE) | 0.1298 | 1 | 0.5 |
| Loa Loa (eye worm) | dihydrofolate reductase | 0.1298 | 1 | 1 |
| Mycobacterium tuberculosis | Dihydrofolate reductase DfrA (DHFR) (tetrahydrofolate dehydrogenase) | 0.1298 | 1 | 0.5 |
| Chlamydia trachomatis | dihydrofolate reductase | 0.1298 | 1 | 0.5 |
| Onchocerca volvulus | 0.0177 | 0 | 0.5 | |
| Onchocerca volvulus | 0.0177 | 0 | 0.5 | |
| Echinococcus granulosus | dihydrofolate reductase | 0.1298 | 1 | 1 |
| Onchocerca volvulus | 0.0177 | 0 | 0.5 | |
| Onchocerca volvulus | 0.0177 | 0 | 0.5 | |
| Onchocerca volvulus | 0.0177 | 0 | 0.5 | |
| Echinococcus multilocularis | dihydrofolate reductase | 0.1298 | 1 | 1 |
| Onchocerca volvulus | 0.0177 | 0 | 0.5 | |
| Onchocerca volvulus | 0.0177 | 0 | 0.5 | |
| Leishmania major | dihydrofolate reductase-thymidylate synthase | 0.0659 | 0.4297 | 0.5 |
| Onchocerca volvulus | 0.0177 | 0 | 0.5 | |
| Brugia malayi | Dihydrofolate reductase | 0.1298 | 1 | 1 |
| Onchocerca volvulus | 0.0177 | 0 | 0.5 | |
| Onchocerca volvulus | 0.0177 | 0 | 0.5 | |
| Trypanosoma cruzi | dihydrofolate reductase-thymidylate synthase | 0.0659 | 0.4297 | 0.5 |
| Onchocerca volvulus | 0.0177 | 0 | 0.5 | |
| Toxoplasma gondii | bifunctional dihydrofolate reductase-thymidylate synthase | 0.0659 | 0.4297 | 0.5 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0177 | 0 | 0.5 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0177 | 0 | 0.5 |
| Onchocerca volvulus | 0.0177 | 0 | 0.5 | |
| Onchocerca volvulus | 0.0177 | 0 | 0.5 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Activity scale (binding) | < 10 nM | Antimycobacterial activity scale was evaluated and found to be highly active against MAC Dihydrofolate reductase | ChEMBL. | 11754578 |
| Activity scale (binding) | < 10 nM | Antimycobacterial activity scale was evaluated and found to be highly active against MAC Dihydrofolate reductase | ChEMBL. | 11754578 |
| Activity scale (binding) | < 100 nM | Antimycobacterial activity scale found to be highly active against human dihydrofolate reductase. | ChEMBL. | 11754578 |
| Activity scale (binding) | < 100 nM | Antimycobacterial activity scale found to be highly active against human dihydrofolate reductase. | ChEMBL. | 11754578 |
| IC50 (binding) | = 0.66 nM | Antimycobacterial activity against Mycobacterium avium complex diihydrofolate reductase (MAC DHFR) | ChEMBL. | 11754578 |
| IC50 (binding) | = 0.66 nM | Antimycobacterial activity against Mycobacterium avium complex diihydrofolate reductase (MAC DHFR) | ChEMBL. | 11754578 |
| IC50 (binding) | = 2.7 nM | Antimycobacterial activity against human dihydrofolate reductase (hDHFR) | ChEMBL. | 11754578 |
| IC50 (binding) | = 2.7 nM | Antimycobacterial activity against human dihydrofolate reductase (hDHFR) | ChEMBL. | 11754578 |
| IC50 (binding) | = 0.02 uM | Inhibitory activity of the compound against rat liver dihydrofolate reductase | ChEMBL. | 8632434 |
| IC50 (functional) | = 0.02 uM | Inhibition of Toxoplasma gondii cell growth | ChEMBL. | 8632434 |
| IC50 (binding) | = 0.02 uM | Inhibitory activity of the compound against rat liver dihydrofolate reductase | ChEMBL. | 8632434 |
| IC50 (functional) | = 0.02 uM | Inhibition of Toxoplasma gondii cell growth | ChEMBL. | 8632434 |
| IC50 (binding) | = 0.022 uM | Inhibitory activity against Toxoplasma gondii dihydrofolate reductase | ChEMBL. | 8632434 |
| IC50 (binding) | = 0.022 uM | Inhibitory activity against Toxoplasma gondii dihydrofolate reductase | ChEMBL. | 8632434 |
| IC50 (binding) | = 0.044 uM | Inhibitory activity against Pneumocystis carinii dihydrofolate reductase | ChEMBL. | 8632434 |
| IC50 (binding) | = 0.044 uM | Inhibitory activity against Pneumocystis carinii dihydrofolate reductase | ChEMBL. | 8632434 |
| Selectivity (binding) | = 0.5 | Ratio of IC50 rat liver DHFR vs IC50 of P. carinii DHFR | ChEMBL. | 8632434 |
| Selectivity (binding) | = 1 | Ratio of IC50 rat liver DHFR vs IC50 of T. gondii DHFR | ChEMBL. | 8632434 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Toxoplasma gondii | ChEMBL23 | 8632434 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- Search by CAS
- Search by CAS
- ChEMBL: CHEMBL281648
- PubChem: 72509
Bibliographic References
21 literature references were collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.