Detailed information for compound 29435
Basic information
Technical information
- Name: Unnamed compound
- MW: 488.378 | Formula: C22H26BrN5O3
-
H donors: 0
H acceptors: 2
LogP: 3.49
Rotable bonds: 6
Rule of 5 violations (Lipinski): 1 - SMILES: CCOc1nc2c(n1Cc1ccc(c(c1)Br)OC)c(=O)n(c1=N[C@H]3[C@@H](n21)CCC3)CC
- InChi: 1S/C22H26BrN5O3/c1-4-26-20(29)18-19(28-16-8-6-7-15(16)24-21(26)28)25-22(31-5-2)27(18)12-13-9-10-17(30-3)14(23)11-13/h9-11,15-16H,4-8,12H2,1-3H3/t15-,16+/m1/s1
- InChiKey: LUSMKVRUULITST-CVEARBPZSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | phosphodiesterase 5A, cGMP-specific | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | matrixin family protein | 0.0415 | 0.0369 | 0.3984 |
| Echinococcus multilocularis | endothelin converting enzyme 1 | 0.0192 | 0.0128 | 0.1949 |
| Trichomonas vaginalis | high-affinity cGMP-specific 3,5-cyclic phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Trichomonas vaginalis | cone cGMP-specific 3,5-cyclic phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Trichomonas vaginalis | high-affinity cGMP-specific 3,5-cyclic phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Loa Loa (eye worm) | matrixin family protein | 0.0452 | 0.0409 | 0.445 |
| Loa Loa (eye worm) | hypothetical protein | 0.0145 | 0.0077 | 0.0624 |
| Trichomonas vaginalis | cGMP-specific 3,5-cyclic phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0228 | 0.0167 | 0.1654 |
| Trichomonas vaginalis | rod cGMP-specific 3,5-cyclic phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Onchocerca volvulus | Matrix metalloproteinase homolog | 0.0415 | 0.0369 | 1 |
| Mycobacterium leprae | PROBABLE HYDROLASE | 0.0228 | 0.0167 | 0.0039 |
| Schistosoma mansoni | ADAM17 peptidase (M12 family) | 0.0427 | 0.0382 | 1 |
| Loa Loa (eye worm) | peptidase family M13 containing protein | 0.0142 | 0.0074 | 0.0582 |
| Schistosoma mansoni | adam (A disintegrin and metalloprotease | 0.0074 | 0.0001 | 0.0017 |
| Loa Loa (eye worm) | hypothetical protein | 0.0187 | 0.0122 | 0.1146 |
| Trichomonas vaginalis | calcium/calmodulin-dependent 3,5-cyclic nucleotide phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0145 | 0.0077 | 0.0624 |
| Echinococcus granulosus | a disintegrin and metalloproteinase with | 0.0202 | 0.0138 | 0.2112 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 0.0074 | 0.0582 |
| Trichomonas vaginalis | cGMP-specific 3,5-cyclic phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Brugia malayi | Peptidase family M13 containing protein | 0.0192 | 0.0128 | 0.3111 |
| Echinococcus multilocularis | adam | 0.0074 | 0.0001 | 0.001 |
| Trichomonas vaginalis | rod cGMP-specific 3,5-cyclic phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0192 | 0.0128 | 0.1206 |
| Trichomonas vaginalis | calcium/calmodulin-dependent 3,5-cyclic nucleotide phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Plasmodium vivax | peptide deformylase, putative | 0.9329 | 1 | 0.5 |
| Trypanosoma cruzi | Peptide deformylase 2, putative | 0.356 | 0.3767 | 1 |
| Schistosoma mansoni | ADAMTS5 peptidase (M12 family) | 0.0202 | 0.0138 | 0.3622 |
| Schistosoma mansoni | matrix metallopeptidase-9 (M10 family) | 0.0144 | 0.0076 | 0.1994 |
| Brugia malayi | Matrix metalloprotease, N-terminal domain containing protein | 0.0228 | 0.0167 | 0.4062 |
| Trichomonas vaginalis | cAMP/cGMP cyclic nucleotide phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.0265 | 0.0207 | 0.5417 |
| Trichomonas vaginalis | cyclic nucleotide phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Mycobacterium tuberculosis | Probable peptidoglycan hydrolase | 0.0228 | 0.0167 | 0.0039 |
| Toxoplasma gondii | hypothetical protein | 0.9329 | 1 | 1 |
| Mycobacterium ulcerans | peptide deformylase | 0.9329 | 1 | 1 |
| Trichomonas vaginalis | calcium/calmodulin-dependent 3,5-cyclic nucleotide phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Trichomonas vaginalis | calcium/calmodulin-dependent 3,5-cyclic nucleotide phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Trichomonas vaginalis | cGMP-inhibited 3,5-cyclic phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Trichomonas vaginalis | high-affinity cGMP-specific 3,5-cyclic phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Trichomonas vaginalis | cGMP-dependent 3,5-cyclic phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Brugia malayi | Matrixin family protein | 0.0187 | 0.0122 | 0.2983 |
| Loa Loa (eye worm) | hypothetical protein | 0.0145 | 0.0077 | 0.0624 |
| Schistosoma mansoni | family M13 unassigned peptidase (M13 family) | 0.0097 | 0.0025 | 0.0654 |
| Brugia malayi | Matrixin family protein | 0.0187 | 0.0122 | 0.2983 |
| Trypanosoma cruzi | polypeptide deformylase-like protein, putative | 0.356 | 0.3767 | 1 |
| Schistosoma mansoni | family M13 unassigned peptidase (M13 family) | 0.0192 | 0.0128 | 0.3343 |
| Schistosoma mansoni | family M13 non-peptidase homologue (M13 family) | 0.0097 | 0.0025 | 0.0654 |
| Loa Loa (eye worm) | hypothetical protein | 0.0145 | 0.0077 | 0.0624 |
| Brugia malayi | Matrixin family protein | 0.0187 | 0.0122 | 0.2983 |
| Mycobacterium tuberculosis | Possible exported protein | 0.1564 | 0.161 | 0.1502 |
| Loa Loa (eye worm) | hypothetical protein | 0.0187 | 0.0122 | 0.1146 |
| Trichomonas vaginalis | rod cGMP-specific 3,5-cyclic phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Trypanosoma brucei | Polypeptide deformylase 1 | 0.356 | 0.3767 | 1 |
| Schistosoma mansoni | matrix metallopeptidase-7 (M10 family) | 0.0187 | 0.0122 | 0.3206 |
| Trichomonas vaginalis | cAMP-specific 3,5-cyclic phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Trichomonas vaginalis | cAMP-specific phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Echinococcus granulosus | adam | 0.0074 | 0.0001 | 0.001 |
| Trichomonas vaginalis | cyclic nucleotide phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Echinococcus multilocularis | matrix metallopeptidase 7 (M10 family) | 0.068 | 0.0655 | 1 |
| Loa Loa (eye worm) | matrix metalloproteinase | 0.0187 | 0.0122 | 0.1146 |
| Mycobacterium tuberculosis | Probable polypeptide deformylase Def (PDF) (formylmethionine deformylase) | 0.9329 | 1 | 1 |
| Plasmodium falciparum | peptide deformylase | 0.9329 | 1 | 0.5 |
| Onchocerca volvulus | Matrilysin homolog | 0.0415 | 0.0369 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 0.0074 | 0.0582 |
| Onchocerca volvulus | 0.0265 | 0.0207 | 0.5321 | |
| Brugia malayi | Hemopexin family protein | 0.0265 | 0.0207 | 0.5052 |
| Loa Loa (eye worm) | hypothetical protein | 0.0192 | 0.0128 | 0.1206 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 0.0074 | 0.0582 |
| Loa Loa (eye worm) | peptidase family M13 containing protein | 0.0142 | 0.0074 | 0.0582 |
| Loa Loa (eye worm) | hypothetical protein | 0.0898 | 0.089 | 1 |
| Echinococcus granulosus | matrix metallopeptidase 7 M10 family | 0.068 | 0.0655 | 1 |
| Trichomonas vaginalis | high-affinity cGMP-specific 3,5-cyclic phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Echinococcus multilocularis | adam 17 protease | 0.0427 | 0.0382 | 0.5831 |
| Schistosoma mansoni | family M13 unassigned peptidase (M13 family) | 0.0097 | 0.0025 | 0.0654 |
| Trichomonas vaginalis | cGMP-specific 3,5-cyclic phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Schistosoma mansoni | neprilysin-2 (M13 family) | 0.0097 | 0.0025 | 0.0654 |
| Leishmania major | polypeptide deformylase-like protein, putative | 0.356 | 0.3767 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 0.0074 | 0.0582 |
| Loa Loa (eye worm) | hypothetical protein | 0.0192 | 0.0128 | 0.1206 |
| Schistosoma mansoni | Nep2 peptidase (M13 family) | 0.0097 | 0.0025 | 0.0654 |
| Trypanosoma cruzi | polypeptide deformylase-like protein, putative | 0.356 | 0.3767 | 1 |
| Mycobacterium leprae | PROBABLE POLYPEPTIDE DEFORMYLASE DEF (PDF) (FORMYLMETHIONINE DEFORMYLASE) | 0.9329 | 1 | 1 |
| Echinococcus granulosus | Blood coagulation inhibitor Disintegrin | 0.0268 | 0.021 | 0.3206 |
| Loa Loa (eye worm) | hypothetical protein | 0.0145 | 0.0077 | 0.0624 |
| Trichomonas vaginalis | cGMP-dependent 3,5-cyclic phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Brugia malayi | Matrixin family protein | 0.0452 | 0.0409 | 1 |
| Echinococcus granulosus | adam 17 protease | 0.047 | 0.0428 | 0.6533 |
| Mycobacterium ulcerans | hydrolase | 0.0228 | 0.0167 | 0.0039 |
| Treponema pallidum | polypeptide deformylase (def) | 0.9329 | 1 | 0.5 |
| Onchocerca volvulus | 0.0187 | 0.0122 | 0.2876 | |
| Echinococcus multilocularis | Blood coagulation inhibitor, Disintegrin | 0.0268 | 0.021 | 0.3206 |
| Trichomonas vaginalis | cone cGMP-specific 3,5-cyclic phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Echinococcus multilocularis | a disintegrin and metalloproteinase with | 0.0202 | 0.0138 | 0.2112 |
| Trichomonas vaginalis | cAMP-specific 3,5-cyclic phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0187 | 0.0122 | 0.1146 |
| Echinococcus granulosus | endothelin converting enzyme 1 | 0.0192 | 0.0128 | 0.1949 |
| Loa Loa (eye worm) | hypothetical protein | 0.0145 | 0.0077 | 0.0624 |
| Trypanosoma brucei | Peptide deformylase 2 | 0.356 | 0.3767 | 1 |
| Brugia malayi | Hypothetical zinc metalloproteinase T16A9.4 | 0.0192 | 0.0128 | 0.3111 |
| Brugia malayi | metalloprotease disintegrin 16 with thrombospondin type I motif | 0.0202 | 0.0138 | 0.3373 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0074 | 0 | 0.5 |
| Trichomonas vaginalis | cyclic nucleotide phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Trichomonas vaginalis | calcium/calmodulin-dependent 3,5-cyclic nucleotide phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Trypanosoma cruzi | Peptide deformylase 2, putative | 0.356 | 0.3767 | 1 |
| Wolbachia endosymbiont of Brugia malayi | peptide deformylase | 0.9329 | 1 | 0.5 |
| Brugia malayi | Matrixin family protein | 0.0187 | 0.0122 | 0.2983 |
| Trichomonas vaginalis | cAMP-specific phosphodiesterase, putative | 0.0074 | 0 | 0.5 |
| Onchocerca volvulus | Matrilysin homolog | 0.0187 | 0.0122 | 0.2876 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 8.27 | Inhibition of PDE5 | ChEMBL. | 18045743 |
| IC50 (binding) | = 5.4 nM | Inhibitory concentration against human phosphodiesterase 5 (PDE5) enzyme | ChEMBL. | 14980684 |
| IC50 (binding) | = 5.4 nM | Inhibitory concentration against human phosphodiesterase 5 (PDE5) enzyme | ChEMBL. | 14980684 |
| Selectivity (binding) | = 11 | Selectivity determined as ratio of IC50 of PDE6 against that of PDE5 | ChEMBL. | 14980684 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL441223
Bibliographic References
2 literature references were collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.