Detailed information for compound 335671

Basic information

Technical information
  • TDR Targets ID: 335671
  • Name: N-[4-amino-1-(2-chloroethyl)naphthalen-2-yl]- 5,6,7-trimethoxy-1H-indole-2-carboxamide
  • MW: 453.918 | Formula: C24H24ClN3O4
  • H donors: 3 H acceptors: 1 LogP: 4.55 Rotable bonds: 8
    Rule of 5 violations (Lipinski): 1
  • SMILES: ClCCc1c(NC(=O)c2cc3c([nH]2)c(OC)c(c(c3)OC)OC)cc(c2c1cccc2)N
  • InChi: 1S/C24H24ClN3O4/c1-30-20-11-13-10-19(27-21(13)23(32-3)22(20)31-2)24(29)28-18-12-17(26)15-7-5-4-6-14(15)16(18)8-9-25/h4-7,10-12,27H,8-9,26H2,1-3H3,(H,28,29)
  • InChiKey: MNFPZBOQEWMBOK-UHFFFAOYSA-N  


Substructure search Similarity search

Network

Hover on a compound node to display the structore

Synonyms

  • N-[4-amino-1-(2-chloroethyl)-2-naphthyl]-5,6,7-trimethoxy-1H-indole-2-carboxamide
  • N-[4-azanyl-1-(2-chloroethyl)naphthalen-2-yl]-5,6,7-trimethoxy-1H-indole-2-carboxamide

Targets

Known targets for this compound

No curated genes were found associated with this compound

Predicted pathogen targets for this compound

By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model

Ranking Plot

Putative Targets List

Species Potential target Raw Global Species
Loa Loa (eye worm) nuclear Hormone Receptor family member 0.00300897 0.5 0.5
Brugia malayi Ligand-binding domain of nuclear hormone receptor family protein 0.003 0.5 0.5
Echinococcus multilocularis FTZ F1 alpha 0.00300897 0.5 0.5
Brugia malayi Ligand-binding domain of nuclear hormone receptor family protein 0.003 0.5 0.5
Brugia malayi Steroid receptor seven-up type 2 0.00300897 0.5 0.5
Echinococcus granulosus ecdysone induced protein 78C 0.00300897 0.5 0.5
Loa Loa (eye worm) nuclear hormone receptor family member nhr-40 0.00300897 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.00300897 0.5 0.5
Brugia malayi Nuclear hormone receptor family member nhr-25 0.003 0.5 0.5
Onchocerca volvulus Protein ultraspiracle homolog 0.003 0.5 0.5
Loa Loa (eye worm) nuclear hormone receptor family member nhr-1 0.003 0.5 0.5
Brugia malayi Nuclear hormone receptor family member nhr-3 0.003 0.5 0.5
Schistosoma mansoni retinoid-x-receptor (RXR) 0.00300897 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.00300897 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.003 0.5 0.5
Brugia malayi ecdysteroid receptor 0.00300897 0.5 0.5
Echinococcus multilocularis nuclear receptor 2DBD gamma 0.00300897 0.5 0.5
Loa Loa (eye worm) nuclear hormone receptor family member nhr-49 0.003 0.5 0.5
Onchocerca volvulus Steroid hormone receptor family member cnr14 homolog 0.003 0.5 0.5
Brugia malayi Nuclear hormone receptor family member nhr-25 0.00300897 0.5 0.5
Brugia malayi photoreceptor-specific nuclear receptor 0.00300897 0.5 0.5
Schistosoma mansoni RAR-like nuclear receptor 0.003 0.5 0.5
Schistosoma mansoni nuclear receptor 2DBD-gamma 0.003 0.5 0.5
Loa Loa (eye worm) nuclear hormone receptor family member nhr-31 0.00300897 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.003 0.5 0.5
Echinococcus multilocularis nuclear receptor 2DBD gamma 0.003 0.5 0.5
Echinococcus multilocularis ecdysone induced protein 78C 0.00300897 0.5 0.5
Schistosoma mansoni nuclear hormone receptor nor-1/nor-2 0.003 0.5 0.5
Brugia malayi nuclear hormone receptor 0.00300897 0.5 0.5
Onchocerca volvulus 0.003 0.5 0.5
Echinococcus granulosus ecdysone induced protein 78C 0.003 0.5 0.5
Schistosoma mansoni coup transcription factor 0.003 0.5 0.5
Loa Loa (eye worm) nuclear Hormone Receptor family member 0.003 0.5 0.5
Onchocerca volvulus Bile acid receptor homolog 0.003 0.5 0.5
Brugia malayi nuclear hormone receptor 0.003 0.5 0.5
Schistosoma mansoni retinoic acid receptor RXR 0.00300897 0.5 0.5
Echinococcus multilocularis ecdysone induced protein 78C 0.003 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.003 0.5 0.5
Brugia malayi Nuclear hormone receptor family member nhr-41 0.00300897 0.5 0.5
Onchocerca volvulus Bile acid receptor homolog 0.00300897 0.5 0.5
Echinococcus multilocularis nuclear receptor 2DBD gamma 0.003 0.5 0.5
Schistosoma mansoni thyroid hormone receptor 0.00300897 0.5 0.5
Echinococcus granulosus nuclear receptor 2DBD gamma 0.003 0.5 0.5
Brugia malayi Ligand-binding domain of nuclear hormone receptor family protein 0.00300897 0.5 0.5
Echinococcus granulosus FTZ F1 alpha 0.00300897 0.5 0.5
Brugia malayi Nuclear hormone receptor family member nhr-31 0.00300897 0.5 0.5
Echinococcus multilocularis FTZ F1 alpha 0.003 0.5 0.5
Brugia malayi nuclear receptor NHR-88 0.00300897 0.5 0.5
Echinococcus granulosus nuclear receptor 2DBD gamma 0.00300897 0.5 0.5
Schistosoma mansoni coup transcription factor 0.00300897 0.5 0.5
Brugia malayi steroid hormone receptor 0.00300897 0.5 0.5
Loa Loa (eye worm) nuclear hormone receptor family member nhr-14 0.00300897 0.5 0.5
Brugia malayi Nuclear hormone receptor family member nhr-19 0.00300897 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.00300897 0.5 0.5
Loa Loa (eye worm) nuclear hormone receptor family member nhr-31 0.003 0.5 0.5
Schistosoma mansoni thyroid hormone receptor 0.003 0.5 0.5
Echinococcus multilocularis hepatocyte nuclear factor 4 alpha 0.003 0.5 0.5
Echinococcus granulosus COUP TF:Svp nuclear hormone receptor 0.00300897 0.5 0.5
Echinococcus granulosus hepatocyte nuclear factor 4 alpha 0.003 0.5 0.5
Echinococcus granulosus retinoic acid receptor rxr beta a 0.003 0.5 0.5
Echinococcus granulosus hepatocyte nuclear factor 4 alpha 0.00300897 0.5 0.5
Brugia malayi Nuclear hormone receptor family member nhr-3 0.00300897 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.00300897 0.5 0.5
Schistosoma mansoni steroid hormone receptor ad4bp 0.003 0.5 0.5
Echinococcus multilocularis nuclear receptor 2DBD gamma 0.00300897 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.00300897 0.5 0.5
Brugia malayi Nuclear hormone receptor-like 1 0.003 0.5 0.5
Brugia malayi steroid hormone receptor 0.003 0.5 0.5
Echinococcus granulosus Nuclear hormone receptor family member nhr 41 0.003 0.5 0.5
Schistosoma mansoni FTZ-F1 nuclear receptor-like protein 0.00300897 0.5 0.5
Loa Loa (eye worm) nuclear hormone receptor family member nhr-40 0.003 0.5 0.5
Brugia malayi Ligand-binding domain of nuclear hormone receptor family protein 0.00300897 0.5 0.5
Brugia malayi Nuclear hormone receptor family member nhr-19 0.003 0.5 0.5
Schistosoma mansoni thyroid hormone receptor 0.003 0.5 0.5
Schistosoma mansoni retinoid-x-receptor (RXR) 0.003 0.5 0.5
Onchocerca volvulus Protein ultraspiracle homolog 0.00300897 0.5 0.5
Echinococcus multilocularis Nuclear hormone receptor family member nhr 41 0.003 0.5 0.5
Brugia malayi Nuclear hormone receptor family member nhr-25 0.00300897 0.5 0.5
Brugia malayi photoreceptor-specific nuclear receptor 0.003 0.5 0.5
Echinococcus multilocularis FTZ F1 nuclear receptor protein 0.00300897 0.5 0.5
Schistosoma mansoni RAR-like nuclear receptor 0.00300897 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.003 0.5 0.5
Schistosoma mansoni Tr4/Tr2 (homologue) 0.003 0.5 0.5
Schistosoma mansoni thyroid hormone receptor 0.00300897 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.00300897 0.5 0.5
Brugia malayi Nuclear hormone receptor family member nhr-49 0.00300897 0.5 0.5
Schistosoma mansoni FTZ-F1 nuclear receptor-like protein 0.003 0.5 0.5
Schistosoma mansoni retinoic acid receptor RXR 0.003 0.5 0.5
Echinococcus granulosus nuclear receptor 2DBD gamma 0.003 0.5 0.5
Brugia malayi Nuclear hormone receptor family member nhr-1 0.003 0.5 0.5
Schistosoma mansoni photoreceptor-specific nuclear receptor related 0.003 0.5 0.5
Brugia malayi Nuclear hormone receptor family member nhr-40 0.003 0.5 0.5
Schistosoma mansoni nuclear hormone receptor 0.003 0.5 0.5
Loa Loa (eye worm) nuclear hormone receptor family member nhr-49 0.00300897 0.5 0.5
Loa Loa (eye worm) nuclear hormone receptor family member nhr-41 0.003 0.5 0.5
Echinococcus multilocularis Nuclear hormone receptor family member nhr 41 0.00300897 0.5 0.5
Schistosoma mansoni photoreceptor-specific nuclear receptor related 0.00300897 0.5 0.5
Onchocerca volvulus 0.00300897 0.5 0.5
Brugia malayi Steroid receptor seven-up type 2 0.003 0.5 0.5
Echinococcus multilocularis COUP TF:Svp nuclear hormone receptor 0.003 0.5 0.5
Echinococcus multilocularis FTZ F1 nuclear receptor protein 0.003 0.5 0.5
Schistosoma mansoni nuclear hormone receptor nor-1/nor-2 0.00300897 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.003 0.5 0.5
Echinococcus granulosus retinoic acid receptor rxr beta a 0.00300897 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.003 0.5 0.5
Brugia malayi Nuclear hormone receptor family member nhr-41 0.003 0.5 0.5
Brugia malayi Nuclear hormone receptor family member nhr-40 0.00300897 0.5 0.5
Brugia malayi Nuclear hormone receptor family member nhr-1 0.00300897 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.00300897 0.5 0.5
Loa Loa (eye worm) steroid hormone receptor 0.00300897 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.003 0.5 0.5
Brugia malayi Nuclear hormone receptor family member nhr-49 0.003 0.5 0.5
Loa Loa (eye worm) nuclear hormone receptor family member nhr-41 0.00300897 0.5 0.5
Echinococcus multilocularis thyroid hormone receptor alpha 0.00300897 0.5 0.5
Brugia malayi Nuclear hormone receptor family member nhr-19 0.00300897 0.5 0.5
Echinococcus multilocularis thyroid hormone receptor alpha 0.003 0.5 0.5
Echinococcus granulosus COUP TF:Svp nuclear hormone receptor 0.003 0.5 0.5
Brugia malayi Nuclear hormone receptor family member nhr-14 0.00300897 0.5 0.5
Echinococcus granulosus FTZ F1 nuclear receptor protein 0.00300897 0.5 0.5
Brugia malayi Nuclear hormone receptor family member nhr-25 0.003 0.5 0.5
Schistosoma mansoni steroid hormone receptor ad4bp 0.00300897 0.5 0.5
Loa Loa (eye worm) nuclear hormone receptor family member nhr-1 0.00300897 0.5 0.5
Schistosoma mansoni Tr4/Tr2 (homologue) 0.00300897 0.5 0.5
Brugia malayi Nuclear hormone receptor-like 1 0.00300897 0.5 0.5
Brugia malayi Nuclear hormone receptor family member nhr-14 0.003 0.5 0.5
Brugia malayi Nuclear hormone receptor family member nhr-31 0.003 0.5 0.5
Brugia malayi nuclear receptor NHR-88 0.003 0.5 0.5
Schistosoma mansoni nuclear hormone receptor 0.00300897 0.5 0.5
Echinococcus multilocularis COUP TF:Svp nuclear hormone receptor 0.00300897 0.5 0.5
Echinococcus granulosus FTZ F1 nuclear receptor protein 0.003 0.5 0.5
Loa Loa (eye worm) steroid hormone receptor 0.003 0.5 0.5
Loa Loa (eye worm) nuclear hormone receptor family member nhr-14 0.003 0.5 0.5
Echinococcus granulosus nuclear receptor 2DBD gamma 0.00300897 0.5 0.5
Onchocerca volvulus Steroid hormone receptor family member cnr14 homolog 0.00300897 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.003 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.00300897 0.5 0.5
Echinococcus multilocularis hepatocyte nuclear factor 4 alpha 0.00300897 0.5 0.5
Schistosoma mansoni nuclear receptor 2DBD-gamma 0.00300897 0.5 0.5
Echinococcus granulosus Nuclear hormone receptor family member nhr 41 0.00300897 0.5 0.5
Echinococcus granulosus FTZ F1 alpha 0.003 0.5 0.5
Brugia malayi Nuclear hormone receptor family member nhr-19 0.003 0.5 0.5

Activities

Activity type Activity value Assay description Source Reference
Activity (functional) = 99 % Antimalarial activity against Plasmodium berghei infected in mosquitoes assessed as reduction in number of sporozoites ChEMBL. 23075290
ED50 (functional) = 1.5 mg kg-1 Antimalarial activity against Plasmodium chabaudi infected rat malaria model ChEMBL. 23075290
IC50 (functional) = 1.8 nM Antimicrobial activity against Plasmodium falciparum infected in human erythrocytes assessed as growth inhibition ChEMBL. 20579889
IC50 (functional) = 1.8 nM Antimalarial activity against Plasmodium falciparum gametocytes ChEMBL. 23075290
IC50 (functional) = 1.9 nM Antimicrobial activity against procyclic form of Trypanosoma brucei 427 assessed as inhibition of cell proliferation after 72 hrs by alamar blue assay ChEMBL. 20579889
IC50 (functional) = 13 nM Antimicrobial activity against promastigotes of Leishmania donovani assessed as inhibition of cell proliferation after 72 hrs by alamar blue assay ChEMBL. 20579889
IC50 (functional) = 55 nM Cytotoxicity against mouse L1210 cells after 3 days by MTT assay ChEMBL. 20579889
IC50 (functional) = 1024 nM Antimicrobial activity against promastigotes of Leishmania mexicana assessed as inhibition of cell proliferation after 72 hrs by alamar blue assay ChEMBL. 20579889
IC50 (functional) = 0.045 uM The concentration required for inhibiting the growth of the human K562 chronic myeloid leukemia cells by 50% ChEMBL. 15916443
IC50 (functional) = 0.045 uM The concentration required for inhibiting the growth of the human K562 chronic myeloid leukemia cells by 50% ChEMBL. 15916443
IC50 (functional) = 0.068 uM The concentration required for inhibiting the growth of the murine P815 mastocytoma cells by 50% ChEMBL. 15916443
IC50 (ADMET) = 0.068 uM Cytotoxicity against mouse P815 cells after 3 days ChEMBL. 16919946
IC50 (functional) = 0.068 uM The concentration required for inhibiting the growth of the murine P815 mastocytoma cells by 50% ChEMBL. 15916443
IC50 (ADMET) = 0.068 uM Cytotoxicity against mouse P815 cells after 3 days ChEMBL. 16919946
IC50 (functional) = 0.15 uM The concentration required for inhibiting the growth of the murine B16-F0 melanoma cells by 50% ChEMBL. 15916443
IC50 (functional) = 0.18 uM The concentration required for inhibiting the growth of the murine L1210 leukemia cells by 50% ChEMBL. 15916443
IC50 (functional) = 0.18 uM The concentration required for inhibiting the growth of the murine L1210 leukemia cells by 50% ChEMBL. 15916443
Log 10 LC50 (functional) = -6.86 Concentration of the compound required to kill 50% of human RXF 393 renal cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) = -6.74 Concentration of the compound required to kill 50% of human SK-MEL-2 melanoma cells ChEMBL. 15916443
Log 10 LC50 (functional) = -6.65 Concentration of the compound required to kill 50% of human HCC-2998 colon cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) = -6.49 Concentration of the compound required to kill 50% of human UACC-62 melanoma cells ChEMBL. 15916443
Log 10 LC50 (functional) = -5.78 Concentration of the compound required to kill 50% of human SNB-75 CNS cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) = -5.76 Concentration of the compound required to kill 50% of human BT-549 breast cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) = -5.65 Concentration of the compound required to kill 50% of human SN12C renal cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) = -5.53 Concentration of the compound required to kill 50% of human NCI-H522 non-small cell lung cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) = -5.21 Concentration of the compound required to kill 50% of human U-251 CNS cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) = -5.07 Concentration of the compound required to kill 50% of human NCI-H23 non-small cell lung cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) = -4.85 Concentration of the compound required to kill 50% of human SK-MEL-5 melanoma cells ChEMBL. 15916443
Log 10 LC50 (functional) = -4.81 Concentration of the compound required to kill 50% of human NCI-H460 non-small cell lung cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) = -4.81 Concentration of the compound required to kill 50% of human PC-3 prostate cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) = -4.75 Concentration of the compound required to kill 50% of human LOX IMVI melanoma cells ChEMBL. 15916443
Log 10 LC50 (functional) = -4.73 Concentration of the compound required to kill 50% of human EKVX non-small cell lung cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) = -4.69 Concentration of the compound required to kill 50% of human COLO 205 colon cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) = -4.69 Concentration of the compound required to kill 50% of human OVCAR-8 ovarian cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) = -4.67 Concentration of the compound required to kill 50% of human HCT-116 colon cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) = -4.58 Concentration of the compound required to kill 50% of human 786-0 renal cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) = -4.58 Concentration of the compound required to kill 50% of human MDA-MB-231/ATCC breast cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) = -4.54 Concentration of the compound required to kill 50% of human MCF-7 breast cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) = -4.43 Concentration of the compound required to kill 50% of human OVCAR-5 ovarian cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) = -4.42 Concentration of the compound required to kill 50% of human HOP-92 non-small cell lung cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) = -4.41 Concentration of the compound required to kill 50% of human HT-29 colon cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) = -4.33 Concentration of the compound required to kill 50% of human TK-10 renal cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) = -4.33 Concentration of the compound required to kill 50% of human NCI/ADR-RES breast cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human HOP-62 non-small cell lung cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human NCI-H226 non-small cell lung cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human NCI-H322M non-small cell lung cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human HCT-15 colon cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human KM12 colon cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human SW-620 colon cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human SF-268 CNS cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human SF-295 CNS cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human SF-539 CNS cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human SNB-19 CNS cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human MALME-3M melanoma cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human SK-MEL-28 melanoma cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human IGROV1 ovarian cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human OVCAR-3 ovarian cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human OVCAR-4 ovarian cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human SK-OV-3 ovarian cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human A-498 renal cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human ACHN renal cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human CAKI-1 renal cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human HL-60 leukemia cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human UO-31 renal cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human DU-145 prostate cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human Hs 578.T breast cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human MDA-N breast cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human T-47D breast cancer cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human K-562 leukemia cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human MOLT-4 leukemia cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human RPMI-8226 leukemia cells ChEMBL. 15916443
Log 10 LC50 (functional) > -4.3 Concentration of the compound required to kill 50% of human A549/ATCC non-small cell lung cancer cells ChEMBL. 15916443

Phenotypes

Whole-cell/tissue/organism interactions

Species name Source Reference Is orphan
Plasmodium falciparum ChEMBL23 20579889
Homo sapiens ChEMBL23 15916443
Leishmania donovani ChEMBL23 20579889
Leishmania mexicana ChEMBL23 20579889
Trypanosoma brucei gambiense 20579889
Trypanosoma brucei ChEMBL23 20579889
Mus musculus ChEMBL23 15916443

Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.

Annotated phenotypes:

We have no manually annotated phenotypes for this drug. What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by drugs, or by genetic manipulation of cells (e.g. gene knockouts or knockdowns) is manually curated from the literature. These descriptions help to describe the potential of the target for drug development. If no information is available for this gene or if the information is incomplete, this may mean that i) the papers containing this information either appeared after the curation effort for this organism was carried out or they were inadvertently missed by curators; or that ii) the curation effort for this organism has not yet started.
 
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.

External resources for this compound

Bibliographic References

2 literature references were collected for this gene.

If you have references for this compound, please enter them in a user comment (below) or Contact us.