TDR Targets

Basic information

Technical information

TDR Targets ID: 336965
Name: 1-(4-chlorophenyl)-3-[4-[(E)-3-(4-methoxyphen yl)prop-2-enoyl]phenyl]urea
MW: 406.862 | Formula: C23H19ClN2O3
H donors: 2 H acceptors: 2 LogP: 4.85 Rotable bonds: 8
Rule of 5 violations (Lipinski): 1
SMILES: COc1ccc(cc1)/C=C/C(=O)c1ccc(cc1)NC(=O)Nc1ccc(cc1)Cl
InChi: 1S/C23H19ClN2O3/c1-29-21-13-2-16(3-14-21)4-15-22(27)17-5-9-19(10-6-17)25-23(28)26-20-11-7-18(24)8-12-20/h2-15H,1H3,(H2,25,26,28)/b15-4+
InChiKey: JHFIDUJGWHGADP-SYZQJQIISA-N

Network

Hover on a compound node to display the structore

Target Layer

Model Organisms

Species	Viewmode
Arabidopsis thaliana
Caenorhabditis elegans
Dictyostelium discoideum
Drosophila melanogaster
Escherichia coli
Homo sapiens
Mus musculus
Oryza sativa
Saccharomyces cerevisiae
Schmidtea mediterranea
Other organisms

TDR Pathogens:

Species	Viewmode
Brugia malayi
Chlamydia trachomatis
Echinococcus granulosus
Entamoeba histolytica
Echinococcus multilocularis
Giardia lamblia
Leishmania major
Loa Loa (eye worm)
Mycobacterium leprae
Mycobacterium tuberculosis
Mycobacterium ulcerans
Onchocerca volvulus
Plasmodium falciparum
Plasmodium vivax
Schistosoma mansoni
Trypanosoma brucei
Trypanosoma cruzi
Toxoplasma gondii
Treponema pallidum
Trichomonas vaginalis
Wolbachia endosymbiont of Brugia malayi

Other Pathogens:

Species	Viewmode
Babesia bovis
Candida albicans
Cryptosporidium hominis
Cryptosporidium parvum
Leishmania braziliensis
Leishmania donovani
Leishmania infantum
Leishmania mexicana
Neospora caninum
Plasmodium berghei
Plasmodium knowlesi
Plasmodium yoelii
Schistosoma japonicum
Trypanosoma brucei gambiense
Trypanosoma congolense
Theileria parva

Compound Layer

This is a work in progress. Come back soon to try this features!

Clustering layers

This is a work in progress. Come back soon to try this features!

Synonyms

1-(4-chlorophenyl)-3-[4-[(E)-3-(4-methoxyphenyl)-1-oxoallyl]phenyl]urea
1-(4-chlorophenyl)-3-[4-[(E)-3-(4-methoxyphenyl)acryloyl]phenyl]urea
3-(4-chlorophenyl)-1-[4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenyl]urea
3-(4-chlorophenyl)-1-[4-[(E)-3-(4-methoxyphenyl)-1-oxoprop-2-enyl]phenyl]urea
3-(4-chlorophenyl)-1-[4-[(E)-3-(4-methoxyphenyl)acryloyl]phenyl]urea

Targets

Known targets for this compound

No curated genes were found associated with this compound

Predicted pathogen targets for this compound

By orthology

No druggable targets predicted by orthology data

By sequence similarity to non orthologous known druggable targets

No druggable targets predicted by sequence similarity

Ranking Plot

Putative Targets List

Species	Potential target	Raw	Global	Species
Echinococcus granulosus	neuropeptides capa receptor	0.123	0.5	0.5
Schistosoma mansoni	neuropeptide receptor	0.123	0.5	0.5
Echinococcus granulosus	peptide allatostatin:somatostatin	0.123	0.5	0.5
Loa Loa (eye worm)	G-protein-linked acetylcholine receptor protein 2	0.123	0.5	0.5
Loa Loa (eye worm)	unidentified vitellogenin-linked transcript protein 6	0.123	0.5	0.5
Schistosoma mansoni	biogenic amine (dopamine) receptor	0.123	0.5	0.5
Echinococcus multilocularis	serotonin receptor	0.123	0.5	0.5
Echinococcus multilocularis	G-protein coupled receptor, putative	0.123	0.5	0.5
Echinococcus granulosus	g-protein coupled receptor	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Echinococcus multilocularis	fmrfamide receptor	0.123	0.5	0.5
Echinococcus granulosus	g protein coupled receptor	0.123	0.5	0.5
Echinococcus multilocularis	tm gpcr rhodopsin gpcr rhodopsin superfamily	0.123	0.5	0.5
Schistosoma mansoni	rhodopsin-like orphan GPCR	0.123	0.5	0.5
Schistosoma mansoni	biogenic amine (dopamine) receptor	0.123	0.5	0.5
Schistosoma mansoni	biogenic amine (dopamine) receptor	0.123	0.5	0.5
Brugia malayi	Serotonin receptor	0.123	0.5	0.5
Schistosoma mansoni	rhodopsin-like orphan GPCR	0.123	0.5	0.5
Brugia malayi	neuropeptide F receptor	0.123	0.5	0.5
Echinococcus multilocularis	g protein linked acetylcholine receptor gar 2a	0.123	0.5	0.5
Brugia malayi	G-protein coupled receptor	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Echinococcus multilocularis	rhodopsin orphan GPCR	0.123	0.5	0.5
Mycobacterium tuberculosis	Secreted antigen 85-C FbpC (85C) (antigen 85 complex C) (AG58C) (mycolyl transferase 85C) (fibronectin-binding protein C)	0.122028	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Brugia malayi	Dopamine receptor protein 2	0.123	0.5	0.5
Brugia malayi	Dopamine receptor protein 1	0.123	0.5	0.5
Echinococcus granulosus	biogenic amine 5HT receptor	0.123	0.5	0.5
Echinococcus multilocularis	neuropeptide Y receptor	0.123	0.5	0.5
Echinococcus multilocularis	rhodopsin orphan GPCR	0.123	0.5	0.5
Schistosoma mansoni	neuropeptide F-like receptor	0.123	0.5	0.5
Brugia malayi	Unidentified vitellogenin-linked transcript protein 6, putative	0.123	0.5	0.5
Schistosoma mansoni	adenoreceptor	0.123	0.5	0.5
Echinococcus multilocularis	allatostatin A receptor	0.123	0.5	0.5
Echinococcus multilocularis	neuropeptide s receptor	0.123	0.5	0.5
Schistosoma mansoni	histamine-responsive GPCR (AAF21638)	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Onchocerca volvulus		0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Onchocerca volvulus		0.123	0.5	0.5
Echinococcus multilocularis	tm gpcr rhodopsin gpcr rhodopsin superfamily	0.123	0.5	0.5
Onchocerca volvulus		0.123	0.5	0.5
Schistosoma mansoni	peptide (allatostatin)-like receptor	0.123	0.5	0.5
Echinococcus multilocularis	thyrotropin releasing hormone receptor	0.123	0.5	0.5
Echinococcus granulosus	biogenic amine 5HT receptor	0.123	0.5	0.5
Echinococcus multilocularis	g protein coupled receptor	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Loa Loa (eye worm)	gonadotropin-releasing hormone receptor 2	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Schistosoma mansoni	neuropeptide receptor	0.123	0.5	0.5
Brugia malayi	ORL1-like opioid receptor	0.123	0.5	0.5
Brugia malayi	hypothetical protein	0.123	0.5	0.5
Echinococcus multilocularis	neuropeptide receptor	0.123	0.5	0.5
Brugia malayi	G protein-coupled receptor F59B2.13	0.123	0.5	0.5
Onchocerca volvulus		0.123	0.5	0.5
Brugia malayi	Serotonin/octopamine receptor family protein 7	0.123	0.5	0.5
Brugia malayi	putative neuropeptide receptor	0.123	0.5	0.5
Brugia malayi	G protein-coupled receptor	0.123	0.5	0.5
Brugia malayi	hypothetical protein	0.123	0.5	0.5
Echinococcus granulosus	fmrfamide receptor	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Brugia malayi	Serotonin receptor	0.123	0.5	0.5
Echinococcus granulosus	hypothetical protein	0.123	0.5	0.5
Echinococcus granulosus	neuropeptide s receptor	0.123	0.5	0.5
Echinococcus multilocularis	orexin receptor type 2	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Brugia malayi	hypothetical protein	0.123	0.5	0.5
Loa Loa (eye worm)	G-protein coupled receptor	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Echinococcus granulosus	G protein coupled 5 hydroxytryptamine receptor	0.123	0.5	0.5
Echinococcus multilocularis	tachykinin peptides receptor 99D	0.123	0.5	0.5
Brugia malayi	AKH receptor	0.123	0.5	0.5
Echinococcus granulosus	7tm_1 domain containing protein	0.123	0.5	0.5
Schistosoma mansoni	peptide (FMRFamide/neurokinin-3)-like receptor	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Brugia malayi	hypothetical protein	0.123	0.5	0.5
Schistosoma mansoni	neuropeptide F-like receptor	0.123	0.5	0.5
Onchocerca volvulus		0.123	0.5	0.5
Echinococcus multilocularis	g protein coupled receptor	0.123	0.5	0.5
Echinococcus multilocularis	neuropeptides capa receptor	0.123	0.5	0.5
Brugia malayi	G-protein coupled receptor	0.123	0.5	0.5
Echinococcus granulosus	neuropeptide receptor A26	0.123	0.5	0.5
Mycobacterium leprae	SECRETED ANTIGEN 85-C FBPC (85C) (ANTIGEN 85 COMPLEX C) (AG58C) (MYCOLYL TRANSFERASE 85C) (FIBRONECTIN-BINDING PROTEIN C)	0.122028	0.5	0.5
Brugia malayi	RE15519p	0.123	0.5	0.5
Echinococcus multilocularis	rhodopsin orphan GPCR	0.123	0.5	0.5
Schistosoma mansoni	ancient conserved domain protein 2 (cyclin m2)	0.123	0.5	0.5
Brugia malayi	follicle stimulating hormone receptor	0.123	0.5	0.5
Schistosoma mansoni	muscarinic acetylcholine (GAR) receptor	0.123	0.5	0.5
Echinococcus granulosus	tachykinin peptides receptor 99D	0.123	0.5	0.5
Onchocerca volvulus		0.123	0.5	0.5
Echinococcus multilocularis	somatostatin receptor	0.123	0.5	0.5
Schistosoma mansoni	biogenic amine receptor	0.123	0.5	0.5
Echinococcus granulosus	dro:myosuppressin receptor	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Echinococcus multilocularis	g-protein coupled receptor	0.123	0.5	0.5
Brugia malayi	putative neuropeptide receptor NPR1	0.123	0.5	0.5
Loa Loa (eye worm)	5-hydroxytryptamine 2C receptor	0.123	0.5	0.5
Schistosoma mansoni	histamine h1 receptor	0.123	0.5	0.5
Onchocerca volvulus		0.123	0.5	0.5
Schistosoma mansoni	peptide (allatostatin/somatostatin)-like receptor	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Echinococcus granulosus	neuropeptide receptor	0.123	0.5	0.5
Onchocerca volvulus	Neuropeptide F receptor homolog	0.123	0.5	0.5
Echinococcus granulosus	G protein coupled receptor 139	0.123	0.5	0.5
Echinococcus multilocularis	7TM GPCR, rhodopsin	0.123	0.5	0.5
Onchocerca volvulus		0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Echinococcus multilocularis	rhodopsin orphan GPCR	0.123	0.5	0.5
Echinococcus granulosus	tm gpcr rhodopsin	0.123	0.5	0.5
Echinococcus granulosus	neuropeptide Y receptor	0.123	0.5	0.5
Echinococcus multilocularis	g protein coupled receptor	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Echinococcus granulosus	rhodopsin orphan GPCR	0.123	0.5	0.5
Loa Loa (eye worm)	G-protein coupled receptor	0.123	0.5	0.5
Brugia malayi	neuropeptide F receptor	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Echinococcus multilocularis	G protein coupled 5 hydroxytryptamine receptor	0.123	0.5	0.5
Brugia malayi	hypothetical protein	0.123	0.5	0.5
Echinococcus granulosus	g protein coupled receptor	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Schistosoma mansoni	alpha-1 adrenergic receptor	0.123	0.5	0.5
Schistosoma mansoni	hypothetical protein	0.123	0.5	0.5
Onchocerca volvulus		0.123	0.5	0.5
Brugia malayi	hypothetical protein	0.123	0.5	0.5
Schistosoma mansoni	biogenic amine receptor	0.123	0.5	0.5
Loa Loa (eye worm)	melatonin receptor type 1A	0.123	0.5	0.5
Echinococcus granulosus	7TM GPCR rhodopsin	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Onchocerca volvulus	Dopamine\/Ecdysteroid receptor homolog	0.123	0.5	0.5
Brugia malayi	hypothetical protein	0.123	0.5	0.5
Echinococcus granulosus	rhodopsin orphan GPCR	0.123	0.5	0.5
Schistosoma mansoni	rhodopsin-like orphan GPCR	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Echinococcus multilocularis	neuropeptide receptor	0.123	0.5	0.5
Brugia malayi	Dopamine receptor	0.123	0.5	0.5
Schistosoma mansoni	amine GPCR	0.123	0.5	0.5
Schistosoma mansoni	thyrotropin-releasing hormone receptor	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Brugia malayi	GnHR receptor homolog	0.123	0.5	0.5
Schistosoma mansoni	amine GPCR	0.123	0.5	0.5
Schistosoma mansoni	peptide (FMRFamide/somatostatin)-like receptor	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Schistosoma mansoni	rhodopsin-like orphan GPCR	0.123	0.5	0.5
Echinococcus multilocularis	G protein coupled receptor 139	0.123	0.5	0.5
Echinococcus multilocularis	biogenic amine (5HT) receptor	0.123	0.5	0.5
Echinococcus multilocularis	pyroglutamylated rfamide peptide receptor	0.123	0.5	0.5
Schistosoma mansoni	hypothetical protein	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Schistosoma mansoni	rhodopsin-like orphan GPCR	0.123	0.5	0.5
Echinococcus multilocularis	dro:myosuppressin receptor	0.123	0.5	0.5
Onchocerca volvulus		0.123	0.5	0.5
Echinococcus multilocularis	rhodopsin orphan GPCR	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Echinococcus granulosus	orexin receptor type 2	0.123	0.5	0.5
Schistosoma mansoni	growth hormone secretagogue receptor	0.123	0.5	0.5
Echinococcus granulosus	sex peptide receptor	0.123	0.5	0.5
Schistosoma mansoni	rhodopsin-like orphan GPCR	0.123	0.5	0.5
Schistosoma mansoni	hypothetical protein	0.123	0.5	0.5
Echinococcus multilocularis	serotonin receptor	0.123	0.5	0.5
Echinococcus granulosus	rhodopsin orphan GPCR	0.123	0.5	0.5
Schistosoma mansoni	amine GPCR	0.123	0.5	0.5
Echinococcus granulosus	thyrotropin releasing hormone receptor	0.123	0.5	0.5
Schistosoma mansoni	biogenic amine (octopamine/dopamine) receptor	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Echinococcus granulosus	somatostatin receptor	0.123	0.5	0.5
Echinococcus granulosus	rhodopsin orphan GPCR	0.123	0.5	0.5
Echinococcus granulosus	tm gpcr rhodopsin	0.123	0.5	0.5
Echinococcus granulosus	rhodopsin orphan GPCR	0.123	0.5	0.5
Brugia malayi	Melatonin receptor type 1A	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Loa Loa (eye worm)	neuropeptide F receptor	0.123	0.5	0.5
Echinococcus multilocularis	neuropeptide receptor A26	0.123	0.5	0.5
Echinococcus granulosus	g protein linked acetylcholine receptor gar 2a	0.123	0.5	0.5
Schistosoma mansoni	hypothetical protein	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Echinococcus multilocularis	tm gpcr rhodopsin gpcr rhodopsin superfamily	0.123	0.5	0.5
Brugia malayi	Dopamine receptor protein 1, putative (partial)	0.123	0.5	0.5
Loa Loa (eye worm)	TYRA-2 protein	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Echinococcus granulosus	neuropeptide FF receptor 2	0.123	0.5	0.5
Schistosoma mansoni	amine GPCR	0.123	0.5	0.5
Onchocerca volvulus		0.123	0.5	0.5
Schistosoma mansoni	peptide (FMRFamide/somatostatin)-like receptor	0.123	0.5	0.5
Echinococcus multilocularis	g protein linked acetylcholine receptor gar 2a	0.123	0.5	0.5
Schistosoma mansoni	biogenic amine (5HT) receptor	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Echinococcus granulosus	serotonin receptor	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Brugia malayi	sulfakinin receptor protein	0.123	0.5	0.5
Schistosoma mansoni	neuropeptide receptor	0.123	0.5	0.5
Brugia malayi	hypothetical protein	0.123	0.5	0.5
Schistosoma mansoni	biogenic amine (5HT) receptor	0.123	0.5	0.5
Onchocerca volvulus		0.123	0.5	0.5
Schistosoma mansoni	opsin-like receptor	0.123	0.5	0.5
Echinococcus multilocularis	peptide (allatostatin:somatostatin)	0.123	0.5	0.5
Echinococcus multilocularis	neuropeptide Y receptor	0.123	0.5	0.5
Echinococcus granulosus	allatostatin A receptor	0.123	0.5	0.5
Schistosoma mansoni	amine GPCR	0.123	0.5	0.5
Echinococcus multilocularis	alpha 1A adrenergic receptor	0.123	0.5	0.5
Echinococcus granulosus	tm gpcr rhodopsin	0.123	0.5	0.5
Echinococcus multilocularis	rhodopsin orphan GPCR	0.123	0.5	0.5
Brugia malayi	G-protein-linked acetylcholine receptor protein 2, putative	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Echinococcus multilocularis	rhodopsin orphan GPCR	0.123	0.5	0.5
Echinococcus multilocularis	rhodopsin orphan GPCR	0.123	0.5	0.5
Echinococcus granulosus	rhodopsin orphan GPCR	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Schistosoma mansoni	neuropeptide receptor	0.123	0.5	0.5
Echinococcus granulosus	neuropeptides capa receptor	0.123	0.5	0.5
Echinococcus granulosus	g protein coupled receptor	0.123	0.5	0.5
Onchocerca volvulus		0.123	0.5	0.5
Echinococcus granulosus	alpha 1A adrenergic receptor	0.123	0.5	0.5
Echinococcus multilocularis	sex peptide receptor	0.123	0.5	0.5
Echinococcus multilocularis	neuropeptides capa receptor	0.123	0.5	0.5
Brugia malayi	gonadotropin-releasing hormone receptor 2	0.123	0.5	0.5
Schistosoma mansoni	rhodopsin-like orphan GPCR	0.123	0.5	0.5
Brugia malayi	Tachykinin-like peptides receptor 99D	0.123	0.5	0.5
Echinococcus granulosus	rhodopsin orphan GPCR	0.123	0.5	0.5
Schistosoma mansoni	rhodopsin-like orphan GPCR	0.123	0.5	0.5
Schistosoma mansoni	neuropeptide f receptor 76f	0.123	0.5	0.5
Loa Loa (eye worm)	neuropeptide F receptor	0.123	0.5	0.5
Onchocerca volvulus		0.123	0.5	0.5
Echinococcus granulosus	growth hormone secretagogue receptor type 1	0.123	0.5	0.5
Schistosoma mansoni	opsin-like receptor	0.123	0.5	0.5
Schistosoma mansoni	myosin xvIII	0.123	0.5	0.5
Mycobacterium ulcerans	secreted antigen 85-C FbpC	0.122028	0.5	0.5
Loa Loa (eye worm)	follicle stimulating hormone receptor	0.123	0.5	0.5
Schistosoma mansoni	rhodopsin-like orphan GPCR	0.123	0.5	0.5
Echinococcus multilocularis	neuropeptide FF receptor 2	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Schistosoma mansoni	opsin-like receptor	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Echinococcus granulosus	pyroglutamylated rfamide peptide receptor	0.123	0.5	0.5
Echinococcus multilocularis	fmrfamide receptor	0.123	0.5	0.5
Echinococcus multilocularis	growth hormone secretagogue receptor type 1	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Onchocerca volvulus		0.123	0.5	0.5
Echinococcus granulosus	neuropeptide receptor	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Echinococcus granulosus	neuropeptide Y receptor	0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Onchocerca volvulus		0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5
Schistosoma mansoni	biogenic amine receptor	0.123	0.5	0.5
Echinococcus granulosus	g protein linked acetylcholine receptor gar 2a	0.123	0.5	0.5
Brugia malayi	hypothetical protein	0.123	0.5	0.5
Brugia malayi	larval opioid receptor	0.123	0.5	0.5
Onchocerca volvulus		0.123	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.123	0.5	0.5

Activities

Activity type	Activity value	Assay description	Source	Reference
IC50 (functional)	> 10 uM	Inhibitory concentration of compound against Plasmodium falciparum	ChEMBL.	15887974
IC50 (functional)	> 10 uM	Inhibitory concentration of compound against Plasmodium falciparum	ChEMBL.	15887974
ID50 (functional)	= 31.05 umol/Kg	Antinociceptive activity against acetic acid-induced abdominal constrictions in ip dosed Swiss mouse pretreated 30 mins before acetic acid challenge	ChEMBL.	18722128
Inhibition (functional)	= 84.4 %	Antinociceptive activity against acetic acid-induced abdominal constrictions in Swiss mouse assessed as maximal inhibition at 10 mg/kg, ip pretreated 30 mins before acetic acid challenge	ChEMBL.	18722128

Phenotypes

Whole-cell/tissue/organism interactions

Species name	Source	Reference	Is orphan
Plasmodium falciparum		15887974

Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.

Annotated phenotypes:

We have no manually annotated phenotypes for this drug. What does this mean? / Care to help?

In TDR Targets, information about phenotypes that are caused by drugs, or by genetic manipulation of cells (e.g. gene knockouts or knockdowns) is manually curated from the literature. These descriptions help to describe the potential of the target for drug development. If no information is available for this gene or if the information is incomplete, this may mean that i) the papers containing this information either appeared after the curation effort for this organism was carried out or they were inadvertently missed by curators; or that ii) the curation effort for this organism has not yet started.

In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.

External resources for this compound

ChEMBL: CHEMBL191240
PubChem: 11361781

Bibliographic References

1 literature reference was collected for this gene.

If you have references for this compound, please enter them in a user comment (below) or Contact us.

Detailed information for compound 336965