Detailed information for compound 341005
Basic information
Technical information
- TDR Targets ID: 341005
- Name: 3-chloro-N-[[(5S)-2-oxo-3-[4-(3-oxomorpholin- 4-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]benza mide
- MW: 429.854 | Formula: C21H20ClN3O5
-
H donors: 1
H acceptors: 3
LogP: 2.14
Rotable bonds: 6
Rule of 5 violations (Lipinski): 1 - SMILES: Clc1cccc(c1)C(=O)NC[C@@H]1OC(=O)N(C1)c1ccc(cc1)N1CCOCC1=O
- InChi: 1S/C21H20ClN3O5/c22-15-3-1-2-14(10-15)20(27)23-11-18-12-25(21(28)30-18)17-6-4-16(5-7-17)24-8-9-29-13-19(24)26/h1-7,10,18H,8-9,11-13H2,(H,23,27)/t18-/m0/s1
- InChiKey: AHUTXLKOPODYFZ-SFHVURJKSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 3-chloro-N-[[(5S)-2-oxo-3-[4-(3-oxomorpholin-4-yl)phenyl]oxazolidin-5-yl]methyl]benzamide
- 3-chloro-N-[[(5S)-2-oxo-3-[4-(3-oxo-4-morpholinyl)phenyl]-5-oxazolidinyl]methyl]benzamide
- 3-chloro-N-[[(5S)-2-keto-3-[4-(3-ketomorpholino)phenyl]oxazolidin-5-yl]methyl]benzamide
- 3-chloro-N-[[(5S)-2-keto-3-[4-(3-ketomorpholin-4-yl)phenyl]oxazolidin-5-yl]methyl]benzamide
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | coagulation factor X | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.1085 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.1085 | 1 | 0.5 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.1085 | 1 | 0.5 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Brugia malayi | hypothetical protein | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.1085 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.1085 | 1 | 0.5 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.1085 | 1 | 0.5 |
| Brugia malayi | putative neuropeptide receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.1085 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.1085 | 1 | 0.5 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Brugia malayi | sulfakinin receptor protein | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.1085 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.1085 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1085 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.1085 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.1085 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.1085 | 1 | 0.5 |
| Echinococcus granulosus | somatostatin receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.1085 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.1085 | 1 | 0.5 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.1085 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.1085 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.1085 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.1085 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.1085 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.1085 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1085 | 1 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1085 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.1085 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.1085 | 1 | 1 |
| Mycobacterium tuberculosis | Secreted antigen 85-C FbpC (85C) (antigen 85 complex C) (AG58C) (mycolyl transferase 85C) (fibronectin-binding protein C) | 0.0825 | 0.7521 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.1085 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.1085 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.1085 | 1 | 0.5 |
| Brugia malayi | AKH receptor | 0.1085 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.1085 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Schistosoma mansoni | opsin-like receptor | 0.1085 | 1 | 0.5 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.1085 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.1085 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.1085 | 1 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.1085 | 1 | 0.5 |
| Echinococcus granulosus | g protein coupled receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.1085 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.1085 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.1085 | 1 | 0.5 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.1085 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.1085 | 1 | 0.5 |
| Echinococcus multilocularis | allatostatin A receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.1085 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.1085 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.1085 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.1085 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.1085 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.1085 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Mycobacterium ulcerans | secreted antigen 85-C FbpC | 0.0825 | 0.7521 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.1085 | 1 | 0.5 |
| Brugia malayi | Serotonin receptor | 0.1085 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.1085 | 1 | 0.5 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.1085 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.1085 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.1085 | 1 | 0.5 |
| Echinococcus granulosus | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.1085 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.1085 | 1 | 0.5 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.1085 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.1085 | 1 | 1 |
| Brugia malayi | RE15519p | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.1085 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.1085 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.1085 | 1 | 0.5 |
| Echinococcus multilocularis | neuropeptide receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.1085 | 1 | 1 |
| Entamoeba histolytica | endo-1,4-beta-xylanase, putative | 0.0035 | 0 | 0.5 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.1085 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.1085 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.1085 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.1085 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.1085 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1085 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.1085 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.1085 | 1 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1085 | 1 | 0.5 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.1085 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.1085 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.1085 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.1085 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.1085 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.1085 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.1085 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.1085 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.1085 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptide receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1085 | 1 | 0.5 |
| Brugia malayi | Dopamine receptor | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.1085 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.1085 | 1 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.1085 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.1085 | 1 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.1085 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.1085 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.1085 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.1085 | 1 | 0.5 |
| Brugia malayi | Melatonin receptor type 1A | 0.1085 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.1085 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.1085 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1085 | 1 | 0.5 |
| Brugia malayi | follicle stimulating hormone receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.1085 | 1 | 0.5 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.1085 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.1085 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.1085 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.1085 | 1 | 0.5 |
| Mycobacterium leprae | SECRETED ANTIGEN 85-C FBPC (85C) (ANTIGEN 85 COMPLEX C) (AG58C) (MYCOLYL TRANSFERASE 85C) (FIBRONECTIN-BINDING PROTEIN C) | 0.0825 | 0.7521 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.1085 | 1 | 0.5 |
| Schistosoma mansoni | histamine h1 receptor | 0.1085 | 1 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1085 | 1 | 0.5 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.1085 | 1 | 0.5 |
| Echinococcus granulosus | sex peptide receptor | 0.1085 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1085 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.1085 | 1 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.1085 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.1085 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.1085 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.1085 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.1085 | 1 | 0.5 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.1085 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1085 | 1 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Brugia malayi | ORL1-like opioid receptor | 0.1085 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 0.000000325 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 0.000000336 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 0.000000352 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 0.000000366 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 0.000000368 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 0.000000409 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 0.000000426 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 0.000000428 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 0.000000437 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 0.000000441 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 0.000000447 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 0.00000048 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 1170 nM | In vitro inhibition of human coagulation factor Xa after incubation for 10 min at 25 degree C | ChEMBL. | 16161994 |
| IC50 (binding) | = 1170 nM | In vitro inhibition of human coagulation factor Xa after incubation for 10 min at 25 degree C | ChEMBL. | 16161994 |
| Kd (binding) | = 0.000000311 M | Recombinant Factor Xa was immobilized on a Biacore CM5 chip at 25 degrees C with a flow rate of 10 uL/min using amine coupling 10 mM NaPP, pH 7,4, according to Biacore standard protocol | K4DD. | No reference |
| kon (binding) | = 169500 Ms-1 | Recombinant Factor Xa was immobilized on a Biacore CM5 chip at 25 degrees C with a flow rate of 10 uL/min using amine coupling 10 mM NaPP, pH 7,4, according to Biacore standard protocol | K4DD. | No reference |
| k_off (binding) | = 0.05235 s-1 | Recombinant Factor Xa was immobilized on a Biacore CM5 chip at 25 degrees C with a flow rate of 10 uL/min using amine coupling 10 mM NaPP, pH 7,4, according to Biacore standard protocol | K4DD. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL372568
- PubChem: 11517577
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.