Detailed information for compound 341005
Basic information
Technical information
- TDR Targets ID: 341005
- Name: 3-chloro-N-[[(5S)-2-oxo-3-[4-(3-oxomorpholin- 4-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]benza mide
- MW: 429.854 | Formula: C21H20ClN3O5
-
H donors: 1
H acceptors: 3
LogP: 2.14
Rotable bonds: 6
Rule of 5 violations (Lipinski): 1 - SMILES: Clc1cccc(c1)C(=O)NC[C@@H]1OC(=O)N(C1)c1ccc(cc1)N1CCOCC1=O
- InChi: 1S/C21H20ClN3O5/c22-15-3-1-2-14(10-15)20(27)23-11-18-12-25(21(28)30-18)17-6-4-16(5-7-17)24-8-9-29-13-19(24)26/h1-7,10,18H,8-9,11-13H2,(H,23,27)/t18-/m0/s1
- InChiKey: AHUTXLKOPODYFZ-SFHVURJKSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 3-chloro-N-[[(5S)-2-oxo-3-[4-(3-oxomorpholin-4-yl)phenyl]oxazolidin-5-yl]methyl]benzamide
- 3-chloro-N-[[(5S)-2-oxo-3-[4-(3-oxo-4-morpholinyl)phenyl]-5-oxazolidinyl]methyl]benzamide
- 3-chloro-N-[[(5S)-2-keto-3-[4-(3-ketomorpholino)phenyl]oxazolidin-5-yl]methyl]benzamide
- 3-chloro-N-[[(5S)-2-keto-3-[4-(3-ketomorpholin-4-yl)phenyl]oxazolidin-5-yl]methyl]benzamide
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | coagulation factor X | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus multilocularis | neuropeptide receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.1085 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.1085 | 1 | 0.5 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.1085 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.1085 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.1085 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Schistosoma mansoni | histamine h1 receptor | 0.1085 | 1 | 0.5 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.1085 | 1 | 0.5 |
| Schistosoma mansoni | opsin-like receptor | 0.1085 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1085 | 1 | 0.5 |
| Echinococcus multilocularis | g protein coupled receptor | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.1085 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.1085 | 1 | 0.5 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.1085 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.1085 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.1085 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.1085 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.1085 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.1085 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.1085 | 1 | 0.5 |
| Brugia malayi | G-protein coupled receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.1085 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.1085 | 1 | 0.5 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.1085 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.1085 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.1085 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.1085 | 1 | 0.5 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1085 | 1 | 0.5 |
| Echinococcus multilocularis | serotonin receptor | 0.1085 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.1085 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.1085 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.1085 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.1085 | 1 | 0.5 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.1085 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.1085 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Echinococcus multilocularis | somatostatin receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.1085 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.1085 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.1085 | 1 | 0.5 |
| Schistosoma mansoni | biogenic amine receptor | 0.1085 | 1 | 0.5 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.1085 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.1085 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.1085 | 1 | 0.5 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.1085 | 1 | 0.5 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.1085 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.1085 | 1 | 0.5 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.1085 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.1085 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.1085 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.1085 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.1085 | 1 | 0.5 |
| Brugia malayi | Serotonin receptor | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.1085 | 1 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.1085 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.1085 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Echinococcus multilocularis | g protein coupled receptor | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.1085 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1085 | 1 | 0.5 |
| Schistosoma mansoni | opsin-like receptor | 0.1085 | 1 | 0.5 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.1085 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.1085 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.1085 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.1085 | 1 | 0.5 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.1085 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.1085 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.1085 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.1085 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.1085 | 1 | 0.5 |
| Brugia malayi | Dopamine receptor protein 1 | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Echinococcus multilocularis | g protein coupled receptor | 0.1085 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.1085 | 1 | 1 |
| Mycobacterium ulcerans | secreted antigen 85-C FbpC | 0.0825 | 0.7521 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.1085 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.1085 | 1 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.1085 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Brugia malayi | RE15519p | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.1085 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.1085 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.1085 | 1 | 0.5 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Brugia malayi | Serotonin receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.1085 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.1085 | 1 | 0.5 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1085 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.1085 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.1085 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Mycobacterium leprae | SECRETED ANTIGEN 85-C FBPC (85C) (ANTIGEN 85 COMPLEX C) (AG58C) (MYCOLYL TRANSFERASE 85C) (FIBRONECTIN-BINDING PROTEIN C) | 0.0825 | 0.7521 | 1 |
| Brugia malayi | larval opioid receptor | 0.1085 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.1085 | 1 | 1 |
| Mycobacterium tuberculosis | Secreted antigen 85-C FbpC (85C) (antigen 85 complex C) (AG58C) (mycolyl transferase 85C) (fibronectin-binding protein C) | 0.0825 | 0.7521 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1085 | 1 | 0.5 |
| Brugia malayi | Melatonin receptor type 1A | 0.1085 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.1085 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.1085 | 1 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Schistosoma mansoni | hypothetical protein | 0.1085 | 1 | 0.5 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.1085 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1085 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.1085 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.1085 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.1085 | 1 | 0.5 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Echinococcus multilocularis | sex peptide receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.1085 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.1085 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1085 | 1 | 0.5 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.1085 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.1085 | 1 | 0.5 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.1085 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.1085 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.1085 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.1085 | 1 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1085 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.1085 | 1 | 0.5 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.1085 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.1085 | 1 | 0.5 |
| Brugia malayi | Dopamine receptor | 0.1085 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.1085 | 1 | 0.5 |
| Entamoeba histolytica | endo-1,4-beta-xylanase, putative | 0.0035 | 0 | 0.5 |
| Echinococcus granulosus | g protein coupled receptor | 0.1085 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1085 | 1 | 0.5 |
| Brugia malayi | follicle stimulating hormone receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.1085 | 1 | 1 |
| Onchocerca volvulus | 0.1085 | 1 | 0.5 | |
| Echinococcus granulosus | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.1085 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.1085 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1085 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.1085 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1085 | 1 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1085 | 1 | 0.5 |
| Echinococcus multilocularis | allatostatin A receptor | 0.1085 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.1085 | 1 | 0.5 |
| Schistosoma mansoni | amine GPCR | 0.1085 | 1 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1085 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 0.000000325 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 0.000000336 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 0.000000352 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 0.000000366 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 0.000000368 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 0.000000409 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 0.000000426 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 0.000000428 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 0.000000437 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 0.000000441 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 0.000000447 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 0.00000048 M | Biochemical assay using fluorogenic peptide substrate | K4DD. | No reference |
| IC50 (binding) | = 1170 nM | In vitro inhibition of human coagulation factor Xa after incubation for 10 min at 25 degree C | ChEMBL. | 16161994 |
| IC50 (binding) | = 1170 nM | In vitro inhibition of human coagulation factor Xa after incubation for 10 min at 25 degree C | ChEMBL. | 16161994 |
| Kd (binding) | = 0.000000311 M | Recombinant Factor Xa was immobilized on a Biacore CM5 chip at 25 degrees C with a flow rate of 10 uL/min using amine coupling 10 mM NaPP, pH 7,4, according to Biacore standard protocol | K4DD. | No reference |
| kon (binding) | = 169500 Ms-1 | Recombinant Factor Xa was immobilized on a Biacore CM5 chip at 25 degrees C with a flow rate of 10 uL/min using amine coupling 10 mM NaPP, pH 7,4, according to Biacore standard protocol | K4DD. | No reference |
| k_off (binding) | = 0.05235 s-1 | Recombinant Factor Xa was immobilized on a Biacore CM5 chip at 25 degrees C with a flow rate of 10 uL/min using amine coupling 10 mM NaPP, pH 7,4, according to Biacore standard protocol | K4DD. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL372568
- PubChem: 11517577
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.