Detailed information for compound 341913
Basic information
Technical information
- TDR Targets ID: 341913
- Name: 2-amino-4-(3,5-dimethoxyphenyl)-7-methoxy-4H- chromene-3-carbonitrile
- MW: 338.357 | Formula: C19H18N2O4
-
H donors: 1
H acceptors: 1
LogP: 3.21
Rotable bonds: 4
Rule of 5 violations (Lipinski): 1 - SMILES: COc1ccc2c(c1)OC(=C(C2c1cc(OC)cc(c1)OC)C#N)N
- InChi: 1S/C19H18N2O4/c1-22-12-4-5-15-17(9-12)25-19(21)16(10-20)18(15)11-6-13(23-2)8-14(7-11)24-3/h4-9,18H,21H2,1-3H3
- InChiKey: FDNDSIRQZMJIDA-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 2-amino-4-(3,5-dimethoxyphenyl)-7-methoxy-4H-1-benzopyran-3-carbonitrile
- 2-azanyl-4-(3,5-dimethoxyphenyl)-7-methoxy-4H-chromene-3-carbonitrile
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.1366 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.1366 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.1366 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.1366 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Brugia malayi | GnHR receptor homolog | 0.1366 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.1366 | 1 | 1 |
| Mycobacterium leprae | SECRETED ANTIGEN 85-C FBPC (85C) (ANTIGEN 85 COMPLEX C) (AG58C) (MYCOLYL TRANSFERASE 85C) (FIBRONECTIN-BINDING PROTEIN C) | 0.0891 | 0.516 | 0.5 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.1366 | 1 | 1 |
| Leishmania major | C-8 sterol isomerase-like protein | 0.0384 | 0 | 0.5 |
| Schistosoma mansoni | neuropeptide receptor | 0.1366 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.1366 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Schistosoma mansoni | amine GPCR | 0.1366 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.1366 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | norepinephrine transporter | 0.0478 | 0.0958 | 0.0958 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Mycobacterium ulcerans | secreted antigen 85-C FbpC | 0.0891 | 0.516 | 0.5 |
| Trypanosoma brucei | C-8 sterol isomerase, putative | 0.0384 | 0 | 0.5 |
| Echinococcus multilocularis | serotonin receptor | 0.1366 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.1366 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.1366 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.1366 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.1366 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.1366 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.1366 | 1 | 1 |
| Brugia malayi | Sodium:neurotransmitter symporter family protein | 0.0478 | 0.0958 | 0.0958 |
| Schistosoma mansoni | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.1366 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.1366 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Mycobacterium tuberculosis | Secreted antigen 85-C FbpC (85C) (antigen 85 complex C) (AG58C) (mycolyl transferase 85C) (fibronectin-binding protein C) | 0.0891 | 0.516 | 0.5 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Schistosoma mansoni | opsin-like receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.1366 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.1366 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.1366 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | solute carrier family 6 member 4 | 0.0478 | 0.0958 | 0.0958 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Trypanosoma cruzi | C-8 sterol isomerase, putative | 0.0384 | 0 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.1366 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.1366 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.1366 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Brugia malayi | RE15519p | 0.1366 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.1366 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.1366 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0478 | 0.0958 | 0.0958 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.1366 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Treponema pallidum | sodium- and chloride- dependent transporter | 0.0478 | 0.0958 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0478 | 0.0958 | 0.0958 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | serotonin transporter b | 0.0478 | 0.0958 | 0.0958 |
| Brugia malayi | follicle stimulating hormone receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.1366 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.1366 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.1366 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.1366 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.1366 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.1366 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.1366 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.1366 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.1366 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.1366 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0478 | 0.0958 | 0.0958 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| EC50 (functional) | = 1.824 | Induction of apoptosis in human T47D cells | ChEMBL. | 17870538 |
| EC50 (functional) | = 0.015 uM | Effective concentration against human breast cancer T47D cell line apoptosis inducing activity was measured by using cell and caspase-based HTS assay | ChEMBL. | 16143530 |
| EC50 (functional) | = 0.015 uM | Effective concentration against human breast cancer T47D cell line apoptosis inducing activity was measured by using cell and caspase-based HTS assay | ChEMBL. | 16143530 |
| EC50 (functional) | = 0.032 uM | Effective concentration against human non-small cell lung cancer H1299 cells inducing apoptosis, activity was measured by cell and caspase-based HTS assay | ChEMBL. | 16143530 |
| EC50 (functional) | = 0.032 uM | Effective concentration against human non-small cell lung cancer H1299 cells inducing apoptosis, activity was measured by cell and caspase-based HTS assay | ChEMBL. | 16143530 |
| GI50 (functional) | = 0.014 uM | Growth inhibition of human T47D cells after 48 hrs by sulforhodamine B assay | ChEMBL. | 24997684 |
| Log (1/C) (functional) | = 7.82 | Induction of apoptosis in human HL60 B cells | ChEMBL. | 17658263 |
| log(1/EC50) (functional) | = 1.824 | Induction of apoptosis in human T47D cells | ChEMBL. | 17870538 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Homo sapiens | ChEMBL23 | 16143530 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- PubChem: 9923922
Bibliographic References
3 literature references were collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.