Detailed information for compound 341914
Basic information
Technical information
- TDR Targets ID: 341914
- Name: 2-amino-7-methoxy-4-(3-methoxyphenyl)-4H-chro mene-3-carbonitrile
- MW: 308.331 | Formula: C18H16N2O3
-
H donors: 1
H acceptors: 1
LogP: 3.24
Rotable bonds: 3
Rule of 5 violations (Lipinski): 1 - SMILES: COc1ccc2c(c1)OC(=C(C2c1cccc(c1)OC)C#N)N
- InChi: 1S/C18H16N2O3/c1-21-12-5-3-4-11(8-12)17-14-7-6-13(22-2)9-16(14)23-18(20)15(17)10-19/h3-9,17H,20H2,1-2H3
- InChiKey: WKLKYONGSSJYLW-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 2-amino-7-methoxy-4-(3-methoxyphenyl)-4H-1-benzopyran-3-carbonitrile
- 2-azanyl-7-methoxy-4-(3-methoxyphenyl)-4H-chromene-3-carbonitrile
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Brugia malayi | RE15519p | 0.1366 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.1366 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.1366 | 1 | 1 |
| Mycobacterium ulcerans | secreted antigen 85-C FbpC | 0.0891 | 0.516 | 0.5 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.1366 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Echinococcus multilocularis | neuropeptide receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.1366 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.1366 | 1 | 1 |
| Trypanosoma brucei | C-8 sterol isomerase, putative | 0.0384 | 0 | 0.5 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.1366 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Echinococcus multilocularis | somatostatin receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.1366 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.1366 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.1366 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.1366 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.1366 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.1366 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.1366 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.1366 | 1 | 1 |
| Mycobacterium leprae | SECRETED ANTIGEN 85-C FBPC (85C) (ANTIGEN 85 COMPLEX C) (AG58C) (MYCOLYL TRANSFERASE 85C) (FIBRONECTIN-BINDING PROTEIN C) | 0.0891 | 0.516 | 0.5 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | norepinephrine transporter | 0.0478 | 0.0958 | 0.0958 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.1366 | 1 | 1 |
| Leishmania major | C-8 sterol isomerase-like protein | 0.0384 | 0 | 0.5 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0478 | 0.0958 | 0.0958 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0478 | 0.0958 | 0.0958 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.1366 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.1366 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.1366 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.1366 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.1366 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.1366 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.1366 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Mycobacterium tuberculosis | Secreted antigen 85-C FbpC (85C) (antigen 85 complex C) (AG58C) (mycolyl transferase 85C) (fibronectin-binding protein C) | 0.0891 | 0.516 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0478 | 0.0958 | 0.0958 |
| Schistosoma mansoni | hypothetical protein | 0.1366 | 1 | 1 |
| Trypanosoma cruzi | C-8 sterol isomerase, putative | 0.0384 | 0 | 0.5 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.1366 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.1366 | 1 | 1 |
| Brugia malayi | Sodium:neurotransmitter symporter family protein | 0.0478 | 0.0958 | 0.0958 |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Loa Loa (eye worm) | TYRA-2 protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.1366 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.1366 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.1366 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.1366 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.1366 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.1366 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.1366 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | solute carrier family 6 member 4 | 0.0478 | 0.0958 | 0.0958 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.1366 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | serotonin transporter b | 0.0478 | 0.0958 | 0.0958 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.1366 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.1366 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Brugia malayi | Melatonin receptor type 1A | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.1366 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.1366 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.1366 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.1366 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.1366 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.1366 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.1366 | 1 | 1 |
| Treponema pallidum | sodium- and chloride- dependent transporter | 0.0478 | 0.0958 | 0.5 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.1366 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.1366 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Echinococcus granulosus | neuropeptides capa receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.1366 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| EC50 (functional) | = 1.284 | Induction of apoptosis in human T47D cells | ChEMBL. | 17870538 |
| EC50 (functional) | = 0.052 uM | Effective concentration against human breast cancer T47D cell line apoptosis inducing activity was measured by using cell and caspase-based HTS assay | ChEMBL. | 16143530 |
| EC50 (functional) | = 0.052 uM | Effective concentration against human breast cancer T47D cell line apoptosis inducing activity was measured by using cell and caspase-based HTS assay | ChEMBL. | 16143530 |
| EC50 (functional) | = 0.089 uM | Effective concentration against human non-small cell lung cancer H1299 cells inducing apoptosis, activity was measured by cell and caspase-based HTS assay | ChEMBL. | 16143530 |
| EC50 (functional) | = 0.089 uM | Effective concentration against human non-small cell lung cancer H1299 cells inducing apoptosis, activity was measured by cell and caspase-based HTS assay | ChEMBL. | 16143530 |
| GI50 (functional) | = 31.2 nM | Growth inhibition of human CCRF-CEM cells after 48 hrs by sulforhodamine B assay | ChEMBL. | 24997684 |
| Log (1/C) (functional) | = 7.28 | Induction of apoptosis in human HL60 B cells | ChEMBL. | 17658263 |
| log(1/EC50) (functional) | = 1.284 | Induction of apoptosis in human T47D cells | ChEMBL. | 17870538 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Homo sapiens | ChEMBL23 | 16143530 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- PubChem: 9879649
Bibliographic References
3 literature references were collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.