Detailed information for compound 346561
Basic information
Technical information
- TDR Targets ID: 346561
- Name: 477-31-6
- MW: 315.364 | Formula: C18H21NO4
-
H donors: 2
H acceptors: 1
LogP: 2.39
Rotable bonds: 3
Rule of 5 violations (Lipinski): 1 - SMILES: COc1c(OC)c(OC)cc2c1c1ccc(cc1[C@H](CC2)N)O
- InChi: 1S/C18H21NO4/c1-21-15-8-10-4-7-14(19)13-9-11(20)5-6-12(13)16(10)18(23-3)17(15)22-2/h5-6,8-9,14,20H,4,7,19H2,1-3H3/t14-/m0/s1
- InChiKey: HSDSUBIABLFGDX-AWEZNQCLSA-N
Network
Hover on a compound node to display the structore
Synonyms
- (S)-5-Amino-6,7-dihydro-9,10,11-trimethoxy-5H-dibenzo(a,c)cyclohepten-3-ol
- 5H-Dibenzo(a,c)cyclohepten-3-ol, 5-amino-6,7-dihydro-9,10,11-trimethoxy-, (S)-
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | tubulin, beta 2B class IIb | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Plasmodium falciparum | tubulin gamma chain | tubulin, beta 2B class IIb | 445 aa | 438 aa | 32.9 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | beta-tubulin | 0.003 | 0.0105 | 0.0105 |
| Leishmania major | beta tubulin | 0.003 | 0.0105 | 1 |
| Loa Loa (eye worm) | tubulin beta-4 chain | 0.003 | 0.0105 | 0.0105 |
| Brugia malayi | proprotein convertase 2 | 0.0191 | 0.5924 | 0.5924 |
| Loa Loa (eye worm) | nuclear hormone receptor-like 1 | 0.0267 | 0.8651 | 0.8651 |
| Trypanosoma cruzi | beta tubulin, putative | 0.003 | 0.0105 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0059 | 0.1153 | 0.1873 |
| Brugia malayi | Tubulin beta-1 chain | 0.003 | 0.0105 | 0.0105 |
| Giardia lamblia | High cysteine membrane protein Group 2 | 0.0113 | 0.3107 | 1 |
| Trichomonas vaginalis | Clan SB, family S8, subtilisin-like serine peptidase | 0.0072 | 0.1621 | 0.2712 |
| Loa Loa (eye worm) | endoprotease bli-4 | 0.0304 | 1 | 1 |
| Trypanosoma brucei | beta tubulin | 0.003 | 0.0105 | 0.0146 |
| Trichomonas vaginalis | neuroendocrine convertase 2 precursor, putative | 0.0059 | 0.1153 | 0.1873 |
| Leishmania major | beta tubulin | 0.003 | 0.0105 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0059 | 0.1153 | 0.1873 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0059 | 0.1153 | 0.1873 |
| Brugia malayi | beta-tubulin, identical | 0.003 | 0.0105 | 0.0105 |
| Echinococcus granulosus | furin | 0.0304 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0267 | 0.8651 | 0.8651 |
| Loa Loa (eye worm) | hypothetical protein | 0.0119 | 0.3333 | 0.3333 |
| Leishmania major | beta tubulin | 0.003 | 0.0105 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0059 | 0.1153 | 0.1873 |
| Echinococcus multilocularis | 0.0246 | 0.7878 | 1 | |
| Loa Loa (eye worm) | tubulin beta-1 chain | 0.003 | 0.0105 | 0.0105 |
| Trypanosoma brucei | RNA helicase, putative | 0.0227 | 0.7201 | 1 |
| Trypanosoma brucei | beta tubulin | 0.003 | 0.0105 | 0.0146 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0059 | 0.1153 | 0.1873 |
| Entamoeba histolytica | tubulin family protein | 0.003 | 0.0105 | 0.5 |
| Leishmania major | beta tubulin | 0.003 | 0.0105 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0304 | 1 | 1 |
| Toxoplasma gondii | beta-1 tubulin, putative | 0.003 | 0.0105 | 1 |
| Leishmania major | beta tubulin | 0.003 | 0.0105 | 1 |
| Echinococcus multilocularis | Furin 1 | 0.0072 | 0.1621 | 0.1951 |
| Trichomonas vaginalis | hypothetical protein | 0.0059 | 0.1153 | 0.1873 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0267 | 0.8651 | 0.8651 |
| Schistosoma mansoni | hypothetical protein | 0.0059 | 0.1153 | 0.1059 |
| Leishmania major | beta tubulin | 0.003 | 0.0105 | 1 |
| Brugia malayi | neuroendocrine convertase 1 precursor | 0.0191 | 0.5924 | 0.5924 |
| Trichomonas vaginalis | Clan SB, family S8, subtilisin-like serine peptidase | 0.0072 | 0.1621 | 0.2712 |
| Leishmania major | beta tubulin | 0.003 | 0.0105 | 1 |
| Schistosoma mansoni | furin-1 (S08 family) | 0.0132 | 0.3802 | 0.3736 |
| Trichomonas vaginalis | leucine-rich repeat protein, BspA family | 0.0059 | 0.1153 | 0.1873 |
| Echinococcus granulosus | proprotein convertase subtilisin:kexin type 5 | 0.0185 | 0.5697 | 0.5652 |
| Trichomonas vaginalis | Clan SB, family S8, subtilisin-like serine peptidase | 0.0185 | 0.5697 | 1 |
| Loa Loa (eye worm) | BEN-1 protein | 0.003 | 0.0105 | 0.0105 |
| Leishmania major | beta tubulin | 0.003 | 0.0105 | 1 |
| Loa Loa (eye worm) | BEN-1 protein | 0.003 | 0.0105 | 0.0105 |
| Echinococcus multilocularis | proprotein convertase subtilisin:kexin type 5 | 0.0185 | 0.5697 | 0.7195 |
| Leishmania major | beta tubulin | 0.003 | 0.0105 | 1 |
| Trichomonas vaginalis | Clan SB, family S8, subtilisin-like serine peptidase | 0.0072 | 0.1621 | 0.2712 |
| Schistosoma mansoni | subfamily S8B unassigned peptidase (S08 family) | 0.0304 | 1 | 1 |
| Leishmania major | beta tubulin | 0.003 | 0.0105 | 1 |
| Toxoplasma gondii | beta-tubulin, putative | 0.003 | 0.0105 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0227 | 0.7201 | 0.7171 |
| Loa Loa (eye worm) | proprotein convertase 2 | 0.0072 | 0.1621 | 0.1621 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0059 | 0.1153 | 0.1873 |
| Trypanosoma brucei | beta tubulin | 0.003 | 0.0105 | 0.0146 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0059 | 0.1153 | 0.1873 |
| Trypanosoma brucei | beta tubulin | 0.003 | 0.0105 | 0.0146 |
| Schistosoma mansoni | subfamily S8B non-peptidase homologue (S08 family) | 0.0072 | 0.1621 | 0.1533 |
| Leishmania major | beta tubulin | 0.003 | 0.0105 | 1 |
| Trichomonas vaginalis | proprotein convertase subtilisin/kexin type, putative | 0.0059 | 0.1153 | 0.1873 |
| Toxoplasma gondii | beta tubulin | 0.003 | 0.0105 | 1 |
| Echinococcus granulosus | neuroendocrine convertase 2 | 0.0191 | 0.5924 | 0.5881 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0272 | 0.8839 | 0.8839 |
| Plasmodium falciparum | tubulin beta chain | 0.003 | 0.0105 | 1 |
| Plasmodium vivax | tubulin beta chain, putative | 0.003 | 0.0105 | 1 |
| Trichomonas vaginalis | Clan SB, family S8, subtilisin-like serine peptidase | 0.0072 | 0.1621 | 0.2712 |
| Echinococcus granulosus | Furin 1 | 0.0072 | 0.1621 | 0.1533 |
| Trichomonas vaginalis | Clan SB, family S8, subtilisin-like serine peptidase | 0.0185 | 0.5697 | 1 |
| Leishmania major | beta tubulin | 0.003 | 0.0105 | 1 |
| Giardia lamblia | Furin precursor putative serine protease | 0.0059 | 0.1153 | 0.349 |
| Leishmania major | beta tubulin | 0.003 | 0.0105 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0059 | 0.1153 | 0.1873 |
| Leishmania major | beta tubulin | 0.003 | 0.0105 | 1 |
| Leishmania major | beta tubulin | 0.003 | 0.0105 | 1 |
| Leishmania major | beta tubulin | 0.003 | 0.0105 | 1 |
| Entamoeba histolytica | tubulin family protein | 0.003 | 0.0105 | 0.5 |
| Trichomonas vaginalis | Clan SB, family S8, subtilisin-like serine peptidase | 0.0072 | 0.1621 | 0.2712 |
| Brugia malayi | celfurPC protein | 0.0246 | 0.7878 | 0.7878 |
| Loa Loa (eye worm) | tubulin beta chain | 0.003 | 0.0105 | 0.0105 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0059 | 0.1153 | 0.1873 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0059 | 0.1153 | 0.1873 |
| Leishmania major | beta tubulin | 0.003 | 0.0105 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0266 | 0.8629 | 0.8629 |
| Echinococcus multilocularis | neuroendocrine convertase 2 | 0.0191 | 0.5924 | 0.7486 |
| Loa Loa (eye worm) | tubulin beta-2A chain | 0.003 | 0.0105 | 0.0105 |
| Leishmania major | beta tubulin | 0.003 | 0.0105 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0059 | 0.1153 | 0.1873 |
| Trichomonas vaginalis | Clan SB, family S8, subtilisin-like serine peptidase | 0.0072 | 0.1621 | 0.2712 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| EC50 (functional) | = 0.0435 uM | Cell cycle arrest in A431 cells by accumulation at G2/M phase cell | ChEMBL. | 16198562 |
| EC50 (functional) | = 0.0435 uM | Cell cycle arrest in A431 cells by accumulation at G2/M phase cell | ChEMBL. | 16198562 |
| Ki (binding) | = 1.85 uM | Displacement of [3H]colchicine from tubulin | ChEMBL. | 16198562 |
| Ki (binding) | = 1.85 uM | Displacement of [3H]colchicine from tubulin | ChEMBL. | 16198562 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Homo sapiens | ChEMBL23 | 16198562 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- PubChem: 164612
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.