Detailed information for compound 349699
Basic information
Technical information
- TDR Targets ID: 349699
- Name: (2S)-1-[2-[[4-(1,3-dihydroisoindol-2-yl)-2-me thyl-4-oxobutan-2-yl]amino]acetyl]pyrrolidine -2-carbonitrile
- MW: 354.446 | Formula: C20H26N4O2
-
H donors: 1
H acceptors: 3
LogP: 0.75
Rotable bonds: 7
Rule of 5 violations (Lipinski): 1 - SMILES: N#C[C@@H]1CCCN1C(=O)CNC(CC(=O)N1Cc2c(C1)cccc2)(C)C
- InChi: 1S/C20H26N4O2/c1-20(2,22-12-19(26)24-9-5-8-17(24)11-21)10-18(25)23-13-15-6-3-4-7-16(15)14-23/h3-4,6-7,17,22H,5,8-10,12-14H2,1-2H3/t17-/m0/s1
- InChiKey: BXAZNJCLCXBVJT-KRWDZBQOSA-N
Network
Hover on a compound node to display the structore
Synonyms
- (2S)-1-[2-[(3-isoindolin-2-yl-1,1-dimethyl-3-oxo-propyl)amino]acetyl]pyrrolidine-2-carbonitrile
- (2S)-1-[2-[[3-(2-isoindolinyl)-1,1-dimethyl-3-oxopropyl]amino]-1-oxoethyl]-2-pyrrolidinecarbonitrile
- (2S)-1-[2-[[4-(1,3-dihydroisoindol-2-yl)-2-methyl-4-oxo-butan-2-yl]amino]ethanoyl]pyrrolidine-2-carbonitrile
- (2S)-1-[2-[(3-isoindolin-2-yl-3-keto-1,1-dimethyl-propyl)amino]acetyl]pyrrolidine-2-carbonitrile
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | dipeptidyl-peptidase 4 | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Schistosoma mansoni | photoreceptor-specific nuclear receptor related | 0.0325 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-14 | 0.0325 | 1 | 1 |
| Onchocerca volvulus | Dipeptidyl peptidase family member 1 homolog | 0.0209 | 0.3272 | 0.3272 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0325 | 1 | 1 |
| Echinococcus multilocularis | COUP TF:Svp nuclear hormone receptor | 0.0325 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-41 | 0.0325 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0325 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0325 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0325 | 1 | 1 |
| Echinococcus granulosus | FTZ F1 nuclear receptor protein | 0.0325 | 1 | 1 |
| Brugia malayi | steroid hormone receptor | 0.0325 | 1 | 1 |
| Schistosoma mansoni | steroid hormone receptor ad4bp | 0.0325 | 1 | 1 |
| Loa Loa (eye worm) | prolyl oligopeptidase | 0.0209 | 0.3272 | 0.3272 |
| Onchocerca volvulus | 0.0325 | 1 | 1 | |
| Schistosoma mansoni | ecdysone-induced protein 78c (dr-78) | 0.0171 | 0.1071 | 0.1071 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0325 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0325 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0325 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0171 | 0.1071 | 0.1071 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0325 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0325 | 1 | 1 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0171 | 0.1071 | 0.1071 |
| Brugia malayi | nuclear receptor RXR | 0.0171 | 0.1071 | 0.1071 |
| Echinococcus multilocularis | FTZ F1 alpha | 0.0325 | 1 | 1 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0325 | 1 | 1 |
| Echinococcus multilocularis | thyroid hormone receptor alpha | 0.0325 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0325 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0325 | 1 | 1 |
| Echinococcus multilocularis | nuclear receptor subfamily 1 group D | 0.0171 | 0.1071 | 0.1071 |
| Echinococcus multilocularis | FTZ F1 nuclear receptor protein | 0.0325 | 1 | 1 |
| Brugia malayi | prolyl oligopeptidase family protein | 0.0209 | 0.3272 | 0.3272 |
| Loa Loa (eye worm) | hypothetical protein | 0.0171 | 0.1071 | 0.1071 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0325 | 1 | 1 |
| Onchocerca volvulus | Steroid hormone receptor family member cnr14 homolog | 0.0325 | 1 | 1 |
| Echinococcus multilocularis | dipeptidyl aminopeptidaseprotein | 0.0209 | 0.3272 | 0.3272 |
| Echinococcus granulosus | FTZ F1 alpha | 0.0325 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-49 | 0.0325 | 1 | 1 |
| Schistosoma mansoni | nuclear receptor 2DBD-gamma | 0.0325 | 1 | 1 |
| Schistosoma mansoni | RAR-like nuclear receptor | 0.0325 | 1 | 1 |
| Echinococcus multilocularis | hepatocyte nuclear factor 4 alpha | 0.0325 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-1 | 0.0325 | 1 | 1 |
| Echinococcus granulosus | retinoic acid receptor rxr beta a | 0.0325 | 1 | 1 |
| Echinococcus granulosus | COUP TF:Svp nuclear hormone receptor | 0.0325 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-41 | 0.0325 | 1 | 1 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0325 | 1 | 1 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0325 | 1 | 1 |
| Schistosoma mansoni | retinoic acid receptor RXR | 0.0325 | 1 | 1 |
| Onchocerca volvulus | Protein ultraspiracle homolog | 0.0325 | 1 | 1 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0325 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0171 | 0.1071 | 0.1071 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0325 | 1 | 1 |
| Onchocerca volvulus | Bile acid receptor homolog | 0.0325 | 1 | 1 |
| Brugia malayi | nuclear hormone receptor | 0.0325 | 1 | 1 |
| Echinococcus granulosus | dipeptidyl aminopeptidaseprotein | 0.0209 | 0.3272 | 0.3272 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0171 | 0.1071 | 0.1071 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0325 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-31 | 0.0325 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-40 | 0.0325 | 1 | 1 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0325 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0171 | 0.1071 | 0.1071 |
| Echinococcus multilocularis | Nuclear hormone receptor family member nhr 41 | 0.0325 | 1 | 1 |
| Brugia malayi | Steroid receptor seven-up type 2 | 0.0325 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0171 | 0.1071 | 0.1071 |
| Loa Loa (eye worm) | steroid hormone receptor | 0.0325 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0171 | 0.1071 | 0.1071 |
| Loa Loa (eye worm) | hypothetical protein | 0.0325 | 1 | 1 |
| Echinococcus multilocularis | ecdysone induced protein 78C | 0.0325 | 1 | 1 |
| Schistosoma mansoni | nuclear hormone receptor nor-1/nor-2 | 0.0325 | 1 | 1 |
| Echinococcus granulosus | nuclear receptor subfamily 1 group D | 0.0171 | 0.1071 | 0.1071 |
| Echinococcus granulosus | hepatocyte nuclear factor 4 alpha | 0.0325 | 1 | 1 |
| Brugia malayi | nuclear receptor NHR-88 | 0.0325 | 1 | 1 |
| Loa Loa (eye worm) | nuclear Hormone Receptor family member | 0.0325 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-3 | 0.0325 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-1 | 0.0325 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-31 | 0.0325 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-40 | 0.0325 | 1 | 1 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0325 | 1 | 1 |
| Echinococcus granulosus | Nuclear hormone receptor family member nhr 41 | 0.0325 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-49 | 0.0325 | 1 | 1 |
| Schistosoma mansoni | subfamily S9B unassigned peptidase (S09 family) | 0.0209 | 0.3272 | 0.3272 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0325 | 1 | 1 |
| Schistosoma mansoni | coup transcription factor | 0.0325 | 1 | 1 |
| Schistosoma mansoni | FTZ-F1 nuclear receptor-like protein | 0.0325 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-14 | 0.0325 | 1 | 1 |
| Echinococcus granulosus | ecdysone induced protein 78C | 0.0325 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0325 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0171 | 0.1071 | 0.1071 |
| Loa Loa (eye worm) | hypothetical protein | 0.0171 | 0.1071 | 0.1071 |
| Loa Loa (eye worm) | nuclear hormone receptor-like 1 | 0.0171 | 0.1071 | 0.1071 |
| Schistosoma mansoni | Tr4/Tr2 (homologue) | 0.0325 | 1 | 1 |
| Brugia malayi | photoreceptor-specific nuclear receptor | 0.0325 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 15 nM | Inhibitory activity against DPP4 | ChEMBL. | 16392822 |
| IC50 (binding) | = 15 nM | Inhibitory activity against DPP4 | ChEMBL. | 16392822 |
| IC50 (binding) | > 100000 nM | Inhibitory activity against DPP8 | ChEMBL. | 16392822 |
| IC50 (binding) | > 100000 nM | Inhibitory activity against DPP2 | ChEMBL. | 16392822 |
| IC50 (binding) | > 100000 nM | Inhibitory activity against DPP8 | ChEMBL. | 16392822 |
| IC50 (binding) | > 100000 nM | Inhibitory activity against DPP2 | ChEMBL. | 16392822 |
| IC50 (binding) | = 0.015 uM | Inhibition of DPP4 | ChEMBL. | 16581245 |
| IC50 (binding) | = 0.015 uM | Inhibition of DPP4 | ChEMBL. | 16581245 |
| IC50 (binding) | = 0.015 uM | Inhibition of DPP4 | ChEMBL. | 20483603 |
| IC50 (binding) | > 20 uM | Inhibition of DPP8 | ChEMBL. | 16581245 |
| IC50 (binding) | > 20 uM | Inhibition of DPP2 | ChEMBL. | 16581245 |
| IC50 (binding) | > 20 uM | Inhibition of FAP | ChEMBL. | 16581245 |
| IC50 (binding) | > 20 uM | Inhibition of DPP8 | ChEMBL. | 16581245 |
| IC50 (binding) | > 20 uM | Inhibition of DPP2 | ChEMBL. | 16581245 |
| IC50 (binding) | > 20 uM | Inhibition of FAP | ChEMBL. | 16581245 |
| IC50 (binding) | > 100 uM | Inhibition of FAP | ChEMBL. | 20483603 |
| IC50 (binding) | > 100 uM | Inhibition of DPP2 | ChEMBL. | 20483603 |
| IC50 (binding) | > 100 uM | Inhibition of DPP9 | ChEMBL. | 20483603 |
| IC50 (binding) | > 100 uM | Inhibition of DPP8 | ChEMBL. | 20483603 |
| Inhibition (binding) | > 80 % | Inhibition of plasma DPP4 in BALB/c mice 30 min after administration of 18 mg/kg, po | ChEMBL. | 16392822 |
| Inhibition (binding) | > 80 % | Inhibition of plasma DPP4 in BALB/c mice 30 min after administration of 18 mg/kg, po | ChEMBL. | 16392822 |
| Inhibition (functional) | > 80 % | Ex vivo inhibition of DPP4 mouse plasma at 18 mg/kg, po after 4 hrs | ChEMBL. | 20483603 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL201644
- PubChem: 10383508
Bibliographic References
3 literature references were collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.