Detailed information for compound 377293
Basic information
Technical information
- Name: Unnamed compound
- MW: 1363.57 | Formula: C65H94N20O13
-
H donors: 16
H acceptors: 13
LogP: -4.66
Rotable bonds: 47
Rule of 5 violations (Lipinski): 4 - SMILES: OCC(C(=O)C1CCCN1C(=O)NC(C(=O)NC(C(=O)O)CCCN=C(N)N)Cc1ccccc1)NC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)C1CCCN1C(=O)C1CCCN1C(=O)C(NC(=O)C(NC(=O)C(CCCN=C(N)N)N)Cc1ccccc1)CCCN=C(N)N
- InChi: 1S/C65H94N20O13/c66-42(22-10-28-73-62(67)68)54(89)80-46(35-40-18-6-2-7-19-40)56(91)78-43(23-11-29-74-63(69)70)59(94)84-32-15-27-51(84)60(95)83-31-14-26-50(83)58(93)76-37-52(87)77-45(34-39-16-4-1-5-17-39)55(90)81-48(38-86)53(88)49-25-13-33-85(49)65(98)82-47(36-41-20-8-3-9-21-41)57(92)79-44(61(96)97)24-12-30-75-64(71)72/h1-9,16-21,42-51,86H,10-15,22-38,66H2,(H,76,93)(H,77,87)(H,78,91)(H,79,92)(H,80,89)(H,81,90)(H,82,98)(H,96,97)(H4,67,68,73)(H4,69,70,74)(H4,71,72,75)
- InChiKey: COQNAUDJZKBTMO-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0883 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Onchocerca volvulus | 0.0883 | 1 | 0.5 | |
| Schistosoma mansoni | histamine h1 receptor | 0.0883 | 1 | 0.5 |
| Echinococcus granulosus | serotonin receptor | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0883 | 1 | 0.5 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0883 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0883 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0883 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0883 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0883 | 1 | 0.5 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0883 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0883 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0883 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0883 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0883 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0883 | 1 | 0.5 |
| Echinococcus granulosus | sex peptide receptor | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0883 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0883 | 1 | 1 |
| Onchocerca volvulus | 0.0883 | 1 | 0.5 | |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0883 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0883 | 1 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0883 | 1 | 0.5 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0883 | 1 | 0.5 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0883 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0883 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0883 | 1 | 0.5 |
| Echinococcus multilocularis | serotonin receptor | 0.0883 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0883 | 1 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0883 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0883 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0883 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0883 | 1 | 0.5 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0883 | 1 | 0.5 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0883 | 1 | 0.5 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0883 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Onchocerca volvulus | 0.0883 | 1 | 0.5 | |
| Echinococcus granulosus | neuropeptide receptor | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0883 | 1 | 0.5 |
| Onchocerca volvulus | 0.0883 | 1 | 0.5 | |
| Brugia malayi | larval opioid receptor | 0.0883 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0883 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Onchocerca volvulus | 0.0883 | 1 | 0.5 | |
| Mycobacterium tuberculosis | Secreted antigen 85-C FbpC (85C) (antigen 85 complex C) (AG58C) (mycolyl transferase 85C) (fibronectin-binding protein C) | 0.0867 | 0.9813 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0883 | 1 | 0.5 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0883 | 1 | 0.5 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0883 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0883 | 1 | 0.5 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0883 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0883 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0883 | 1 | 1 |
| Onchocerca volvulus | 0.0883 | 1 | 0.5 | |
| Echinococcus granulosus | g protein coupled receptor | 0.0883 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0883 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0883 | 1 | 0.5 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0883 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0883 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0883 | 1 | 0.5 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0883 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0883 | 1 | 0.5 |
| Schistosoma mansoni | biogenic amine receptor | 0.0883 | 1 | 0.5 |
| Onchocerca volvulus | 0.0883 | 1 | 0.5 | |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0883 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0883 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0883 | 1 | 0.5 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0883 | 1 | 1 |
| Onchocerca volvulus | 0.0883 | 1 | 0.5 | |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0883 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0883 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0883 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0883 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0883 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0883 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0883 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0883 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0883 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0883 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0883 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0883 | 1 | 1 |
| Onchocerca volvulus | 0.0883 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Onchocerca volvulus | 0.0883 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0883 | 1 | 0.5 | |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0883 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0883 | 1 | 0.5 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0883 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0883 | 1 | 0.5 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0883 | 1 | 1 |
| Onchocerca volvulus | 0.0883 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0883 | 1 | 0.5 | |
| Schistosoma mansoni | neuropeptide receptor | 0.0883 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0883 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0883 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0883 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0883 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0883 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0883 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0883 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0883 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Mycobacterium ulcerans | secreted antigen 85-C FbpC | 0.0867 | 0.9813 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0883 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0883 | 1 | 0.5 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0883 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0883 | 1 | 0.5 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0883 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0883 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0883 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0883 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0883 | 1 | 0.5 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0883 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0883 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0883 | 1 | 0.5 |
| Schistosoma mansoni | opsin-like receptor | 0.0883 | 1 | 0.5 |
| Echinococcus granulosus | g protein coupled receptor | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0883 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0883 | 1 | 0.5 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0883 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0883 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0883 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0883 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0883 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0883 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0883 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0883 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0883 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0883 | 1 | 0.5 |
| Schistosoma mansoni | neuropeptide receptor | 0.0883 | 1 | 0.5 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0883 | 1 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0883 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0883 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0883 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0883 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0883 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0883 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0883 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0883 | 1 | 0.5 |
| Onchocerca volvulus | 0.0883 | 1 | 0.5 | |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0883 | 1 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0883 | 1 | 0.5 |
| Onchocerca volvulus | 0.0883 | 1 | 0.5 | |
| Echinococcus granulosus | neuropeptide receptor | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Onchocerca volvulus | 0.0883 | 1 | 0.5 | |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0883 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0883 | 1 | 0.5 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0883 | 1 | 1 |
| Entamoeba histolytica | endo-1,4-beta-xylanase, putative | 0.0037 | 0 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Mycobacterium leprae | SECRETED ANTIGEN 85-C FBPC (85C) (ANTIGEN 85 COMPLEX C) (AG58C) (MYCOLYL TRANSFERASE 85C) (FIBRONECTIN-BINDING PROTEIN C) | 0.0867 | 0.9813 | 1 |
| Brugia malayi | RE15519p | 0.0883 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0883 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0883 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0883 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0883 | 1 | 0.5 |
| Onchocerca volvulus | 0.0883 | 1 | 0.5 | |
| Echinococcus multilocularis | somatostatin receptor | 0.0883 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0883 | 1 | 0.5 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0883 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0883 | 1 | 0.5 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0883 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0883 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0883 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0883 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0883 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0883 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Log Ki (binding) | = 7.45 | Binding affinity towards bradykinin receptor using [3H]-BK as radioligand in guinea pig ileum | ChEMBL. | 8691478 |
| Log Ki (binding) | = 7.9 | Binding affinity towards Bradykinin receptor B2 in human S34 clone cells | ChEMBL. | 8691478 |
| pA2 (functional) | = 5.13 | In vitro antagonistic activity against kinin-induced rabbit jugular vein contraction. | ChEMBL. | 8642569 |
| pA2 (functional) | = 7.29 | In vitro Bradykinin receptor B2 antagonist activity of the compound was determined by using rat uterus functional assay | ChEMBL. | 8691478 |
| pKb (functional) | = 5.16 | Antagonistic activity against bradykinin B2 receptor as human umbilical vein contraction | ChEMBL. | 8642569 |
| Recovery (functional) | = 100 % | Percent recovery was evaluated in rat | ChEMBL. | 8691478 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: 150774
Bibliographic References
2 literature references were collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.