Detailed information for compound 403958
Basic information
Technical information
- Name: Unnamed compound
- MW: 1275.48 | Formula: C58H86N18O13S
-
H donors: 14
H acceptors: 13
LogP: -6.22
Rotable bonds: 37
Rule of 5 violations (Lipinski): 4 - SMILES: OC[C@H](C(=O)N1Cc2ccccc2CC1C(=O)N1C[C@H]2[C@@H]([C@@H]1C(=O)[C@H](C(=O)O)CCN=C(N)N)CCCC2)NC(=O)[C@H](Cc1cccs1)NC(=O)CNC(=O)[C@@H]1CC(CN1C(=O)[C@@H]1CCCN1C(=O)[C@H](NC(=O)[C@H](CCCN=C(N)N)N)CCCN=C(N)N)O
- InChi: 1S/C58H86N18O13S/c59-38(14-5-18-66-56(60)61)48(81)71-39(15-6-19-67-57(62)63)51(84)73-21-7-16-42(73)53(86)75-29-34(78)24-43(75)50(83)69-26-45(79)70-40(25-35-12-8-22-90-35)49(82)72-41(30-77)52(85)74-27-32-10-2-1-9-31(32)23-44(74)54(87)76-28-33-11-3-4-13-36(33)46(76)47(80)37(55(88)89)17-20-68-58(64)65/h1-2,8-10,12,22,33-34,36-44,46,77-78H,3-7,11,13-21,23-30,59H2,(H,69,83)(H,70,79)(H,71,81)(H,72,82)(H,88,89)(H4,60,61,66)(H4,62,63,67)(H4,64,65,68)/t33-,34?,36-,37-,38-,39+,40+,41+,42+,43+,44?,46-/m1/s1
- InChiKey: JWJJCARKIBBMEC-FKQDGPNCSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Onchocerca volvulus | 0.0856 | 1 | 1 | |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0856 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0856 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0856 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0856 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0856 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0856 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0856 | 1 | 1 |
| Trypanosoma brucei | S-adenosylhomocysteine hydrolase, putative | 0.0426 | 0.2739 | 0.5 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0856 | 1 | 1 |
| Trichomonas vaginalis | adenosylhomocysteinase, putative | 0.0426 | 0.2739 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0856 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0856 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0856 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0856 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Entamoeba histolytica | adenosylhomocysteinase, putative | 0.0426 | 0.2739 | 1 |
| Plasmodium falciparum | adenosylhomocysteinase | 0.0426 | 0.2739 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0856 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0856 | 1 | 1 |
| Onchocerca volvulus | 0.0856 | 1 | 1 | |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0856 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0856 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0856 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0856 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0856 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0856 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Onchocerca volvulus | 0.0856 | 1 | 1 | |
| Echinococcus granulosus | fmrfamide receptor | 0.0856 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0856 | 1 | 1 |
| Onchocerca volvulus | 0.0856 | 1 | 1 | |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0856 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0856 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0856 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0856 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0856 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0856 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0856 | 1 | 1 |
| Onchocerca volvulus | 0.0856 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0856 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0856 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0856 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | adenosylhomocysteinase | 0.0426 | 0.2739 | 0.2476 |
| Mycobacterium ulcerans | S-adenosyl-L-homocysteine hydrolase | 0.0426 | 0.2739 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Toxoplasma gondii | adenosylhomocysteinase, putative | 0.0426 | 0.2739 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0856 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0856 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0856 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0856 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0856 | 1 | 1 |
| Onchocerca volvulus | 0.0856 | 1 | 1 | |
| Schistosoma mansoni | hypothetical protein | 0.0856 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0856 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0856 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Onchocerca volvulus | 0.0856 | 1 | 1 | |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0856 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0856 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0856 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0856 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0856 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0856 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0856 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0856 | 1 | 1 |
| Brugia malayi | Adenosylhomocysteinase | 0.0426 | 0.2739 | 0.2476 |
| Brugia malayi | G-protein coupled receptor | 0.0856 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0856 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0856 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0856 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0856 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0856 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0856 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0856 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | adenosylhomocysteinase | 0.0426 | 0.2739 | 0.2476 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0856 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0856 | 1 | 1 |
| Schistosoma mansoni | adenosine deaminase | 0.0284 | 0.0349 | 0.0349 |
| Onchocerca volvulus | 0.0856 | 1 | 1 | |
| Schistosoma mansoni | amine GPCR | 0.0856 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0856 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0856 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0856 | 1 | 1 |
| Onchocerca volvulus | 0.0856 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0856 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0856 | 1 | 1 |
| Trypanosoma cruzi | S-adenosylhomocysteine hydrolase, putative | 0.0426 | 0.2739 | 0.5 |
| Brugia malayi | Melatonin receptor type 1A | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Toxoplasma gondii | S-Adenosyl homocysteine hydrolase | 0.0426 | 0.2739 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0856 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0856 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0856 | 1 | 1 |
| Onchocerca volvulus | 0.0856 | 1 | 1 | |
| Schistosoma mansoni | biogenic amine receptor | 0.0856 | 1 | 1 |
| Onchocerca volvulus | 0.0856 | 1 | 1 | |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0856 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0856 | 1 | 1 |
| Onchocerca volvulus | 0.0856 | 1 | 1 | |
| Echinococcus granulosus | adenosylhomocysteinase | 0.0426 | 0.2739 | 0.2476 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0856 | 1 | 1 |
| Plasmodium vivax | adenosylhomocysteinase(S-adenosyl-L-homocystein e hydrolase), putative | 0.0426 | 0.2739 | 1 |
| Onchocerca volvulus | 0.0856 | 1 | 1 | |
| Schistosoma mansoni | adenosylhomocysteinase | 0.0426 | 0.2739 | 0.2739 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Trypanosoma cruzi | S-adenosylhomocysteine hydrolase, putative | 0.0426 | 0.2739 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.0856 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0856 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0856 | 1 | 1 |
| Onchocerca volvulus | 0.0856 | 1 | 1 | |
| Schistosoma mansoni | neuropeptide receptor | 0.0856 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0856 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0856 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0856 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0856 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0856 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0856 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0856 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0856 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0856 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0856 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0856 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0856 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0856 | 1 | 1 |
| Mycobacterium tuberculosis | Probable adenosylhomocysteinase SahH (S-adenosyl-L-homocysteine hydrolase) (adohcyase) | 0.0426 | 0.2739 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0856 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0856 | 1 | 1 |
| Onchocerca volvulus | 0.0856 | 1 | 1 | |
| Onchocerca volvulus | 0.0856 | 1 | 1 | |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0856 | 1 | 1 |
| Trichomonas vaginalis | adenosylhomocysteinase, putative | 0.0426 | 0.2739 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0856 | 1 | 1 |
| Treponema pallidum | adenosine deaminase | 0.0284 | 0.0349 | 0.5 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0856 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0856 | 1 | 1 |
| Schistosoma mansoni | adenosine deaminase-related | 0.0284 | 0.0349 | 0.0349 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0856 | 1 | 1 |
| Onchocerca volvulus | 0.0856 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0856 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0856 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0856 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0856 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0856 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0856 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0856 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0856 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0856 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Mycobacterium leprae | putative S-adenosyl-L-homocysteine hydrolase SahH | 0.0426 | 0.2739 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0856 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0856 | 1 | 1 |
| Leishmania major | S-adenosylhomocysteine hydrolase | 0.0426 | 0.2739 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0856 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0856 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0856 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0856 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0856 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0856 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0856 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0856 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0856 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0856 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0856 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0856 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0856 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0856 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0856 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Ki (binding) | = 0.06 nM | Binding affinity towards human cloned Bradykinin receptor B2 expressed in CHO cells by [3H]-bradykinin displacement. | ChEMBL. | 10514289 |
| pA2 (functional) | = 8.2 | Ability of Compound(Agonist) to contract isolated human umbilical vein in presence of inhibitor. | ChEMBL. | 10514289 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: 321734
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.