Detailed information for compound 418403
Basic information
Technical information
- TDR Targets ID: 418403
- Name: (2R)-2-amino-N-(4-chloro-2-methylphenyl)-3-me thylbutanamide
- MW: 240.729 | Formula: C12H17ClN2O
-
H donors: 2
H acceptors: 1
LogP: 2.55
Rotable bonds: 4
Rule of 5 violations (Lipinski): 1 - SMILES: CC([C@H](C(=O)Nc1ccc(cc1C)Cl)N)C
- InChi: 1S/C12H17ClN2O/c1-7(2)11(14)12(16)15-10-5-4-9(13)6-8(10)3/h4-7,11H,14H2,1-3H3,(H,15,16)/t11-/m1/s1
- InChiKey: KPAWAOSKTFUKIP-LLVKDONJSA-N
Network
Hover on a compound node to display the structore
Synonyms
- (2R)-2-amino-N-(4-chloro-2-methyl-phenyl)-3-methyl-butanamide
- (2R)-2-azanyl-N-(4-chloro-2-methyl-phenyl)-3-methyl-butanamide
- (2R)-2-amino-N-(4-chloro-2-methyl-phenyl)-3-methyl-butyramide
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0194 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0194 | 1 | 1 |
| Trichomonas vaginalis | alpha-L-fucosidase, putative | 0.0111 | 0.3516 | 1 |
| Schistosoma mansoni | discoidin domain receptor | 0.0111 | 0.3516 | 0.3516 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0194 | 1 | 1 |
| Toxoplasma gondii | F5/8 type C domain-containing protein | 0.0111 | 0.3516 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0194 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0194 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0194 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0194 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0194 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0194 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0194 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0194 | 1 | 1 |
| Plasmodium falciparum | LCCL domain-containing protein | 0.0111 | 0.3516 | 0.5 |
| Echinococcus granulosus | discoidin domain containing receptor 2 | 0.0111 | 0.3516 | 0.3516 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0111 | 0.3516 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0194 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0111 | 0.3516 | 1 |
| Trichomonas vaginalis | hypothetical protein | 0.0111 | 0.3516 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0194 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0194 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0194 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0111 | 0.3516 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0194 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0194 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0194 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Plasmodium vivax | LCCL domain-containing protein | 0.0111 | 0.3516 | 0.5 |
| Schistosoma mansoni | opsin-like receptor | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0194 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0194 | 1 | 1 |
| Echinococcus granulosus | discoidin domain containing receptor 2 | 0.0111 | 0.3516 | 0.3516 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0194 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0111 | 0.3516 | 0.3516 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | Coagulation factor 5 8 type, C terminal | 0.0111 | 0.3516 | 0.3516 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0194 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0194 | 1 | 1 |
| Schistosoma mansoni | btb and poz domain-containing protein | 0.0111 | 0.3516 | 0.3516 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0194 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0194 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0194 | 1 | 1 |
| Toxoplasma gondii | F5/8 type C domain-containing protein | 0.0111 | 0.3516 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0194 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0194 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0194 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0194 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0111 | 0.3516 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0194 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0194 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0194 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0194 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Onchocerca volvulus | 0.0194 | 1 | 1 | |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0194 | 1 | 1 |
| Onchocerca volvulus | 0.0194 | 1 | 1 | |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0111 | 0.3516 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0194 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0194 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0194 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0111 | 0.3516 | 0.3516 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0194 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Schistosoma mansoni | dock | 0.0111 | 0.3516 | 0.3516 |
| Brugia malayi | hypothetical protein | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0194 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0194 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0194 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0194 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0194 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0194 | 1 | 1 |
| Plasmodium vivax | LCCL domain-containing protein | 0.0111 | 0.3516 | 0.5 |
| Brugia malayi | neuropeptide F receptor | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0194 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0194 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0194 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0111 | 0.3516 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0194 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0194 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0111 | 0.3516 | 1 |
| Brugia malayi | RE15519p | 0.0194 | 1 | 1 |
| Onchocerca volvulus | 0.0194 | 1 | 1 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0194 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0194 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0194 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0194 | 1 | 1 |
| Onchocerca volvulus | 0.0194 | 1 | 1 | |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0194 | 1 | 1 |
| Trypanosoma brucei | serine peptidase, clan SB, family S8-like protein | 0.0066 | 0 | 0.5 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0194 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0194 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0194 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 0.3516 | 0.3516 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0194 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0111 | 0.3516 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Onchocerca volvulus | 0.0194 | 1 | 1 | |
| Mycobacterium tuberculosis | Possible arabinofuranosyltransferase AftD | 0.0111 | 0.3516 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0194 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0194 | 1 | 1 |
| Onchocerca volvulus | 0.0194 | 1 | 1 | |
| Onchocerca volvulus | 0.0111 | 0.3516 | 0.3516 | |
| Schistosoma mansoni | biogenic amine receptor | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0194 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0194 | 1 | 1 |
| Onchocerca volvulus | 0.0194 | 1 | 1 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0194 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0194 | 1 | 1 |
| Onchocerca volvulus | 0.0194 | 1 | 1 | |
| Brugia malayi | hypothetical protein | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 0.3516 | 0.3516 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0194 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0194 | 1 | 1 |
| Trichomonas vaginalis | beta-hexosaminidase B, putative | 0.0111 | 0.3516 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0111 | 0.3516 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0194 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0194 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0194 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0194 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0194 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0194 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0194 | 1 | 1 |
| Schistosoma mansoni | discoidin domain receptor | 0.0111 | 0.3516 | 0.3516 |
| Schistosoma mansoni | hypothetical protein | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0194 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0194 | 1 | 1 |
| Onchocerca volvulus | 0.0194 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0194 | 1 | 1 |
| Schistosoma mansoni | septate junction protein | 0.0111 | 0.3516 | 0.3516 |
| Onchocerca volvulus | 0.0194 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0194 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0194 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0194 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0194 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0194 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0194 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | discoidin domain containing receptor 2 | 0.0111 | 0.3516 | 0.3516 |
| Toxoplasma gondii | PA14 domain-containing protein | 0.0111 | 0.3516 | 0.5 |
| Onchocerca volvulus | 0.0194 | 1 | 1 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0194 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0194 | 1 | 1 |
| Echinococcus granulosus | Coagulation factor 5 8 type C terminal | 0.0111 | 0.3516 | 0.3516 |
| Onchocerca volvulus | 0.0194 | 1 | 1 | |
| Mycobacterium leprae | PROBABLE CONSERVED TRANSMEMBRANE PROTEIN | 0.0111 | 0.3516 | 0.5 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0194 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0194 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0194 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0194 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | nuclear receptor 2C2 associated protein | 0.0111 | 0.3516 | 0.3516 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0194 | 1 | 1 |
| Onchocerca volvulus | 0.0194 | 1 | 1 | |
| Onchocerca volvulus | 0.0194 | 1 | 1 | |
| Echinococcus multilocularis | discoidin domain containing receptor 2 | 0.0111 | 0.3516 | 0.3516 |
| Trypanosoma cruzi | subtilisin-like serine peptidase, putative | 0.0066 | 0 | 0.5 |
| Trichomonas vaginalis | alpha-L-fucosidase, putative | 0.0111 | 0.3516 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0111 | 0.3516 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0194 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0194 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0194 | 1 | 1 |
| Onchocerca volvulus | 0.0194 | 1 | 1 | |
| Echinococcus granulosus | sex peptide receptor | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0194 | 1 | 1 |
| Plasmodium falciparum | LCCL domain-containing protein | 0.0111 | 0.3516 | 0.5 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0111 | 0.3516 | 1 |
| Brugia malayi | Serotonin receptor | 0.0194 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0194 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0194 | 1 | 1 |
| Onchocerca volvulus | 0.0194 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0176 | 0.8619 | 0.8619 |
| Onchocerca volvulus | 0.0194 | 1 | 1 | |
| Schistosoma mansoni | neuropeptide receptor | 0.0194 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0194 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | discoidin domain containing receptor 2 | 0.0111 | 0.3516 | 0.3516 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0111 | 0.3516 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0111 | 0.3516 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0194 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0194 | 1 | 1 |
| Trypanosoma cruzi | subtilisin-like serine peptidase, putative | 0.0066 | 0 | 0.5 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0194 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0194 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0194 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0194 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0194 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0194 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0111 | 0.3516 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0194 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0194 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0194 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0194 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0194 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0111 | 0.3516 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Echinococcus granulosus | discoidin domain containing receptor 2 | 0.0111 | 0.3516 | 0.3516 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0194 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0194 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0194 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0194 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0194 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0194 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0194 | 1 | 1 |
| Echinococcus granulosus | discoidin domain receptor | 0.0111 | 0.3516 | 0.3516 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0194 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0194 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0194 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0194 | 1 | 1 |
| Onchocerca volvulus | 0.0111 | 0.3516 | 0.3516 | |
| Toxoplasma gondii | F5/8 type C domain-containing protein | 0.0111 | 0.3516 | 0.5 |
| Echinococcus multilocularis | discoidin domain receptor | 0.0111 | 0.3516 | 0.3516 |
| Brugia malayi | hypothetical protein | 0.0194 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0194 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0194 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Activity (functional) | = 0.8 | Effect on motor coordination in Swiss Albino mouse assessed as number of falls from rota-rod at 30 mg/kg after 45 mins relative to CMC | ChEMBL. | 17373780 |
| Activity (functional) | = 1.3 | Effect on motor coordination in Swiss Albino mouse assessed as number of falls from rota-rod at 30 mg/kg after 30 mins relative to CMC | ChEMBL. | 17373780 |
| Activity (functional) | = 1.5 | Effect on motor coordination in Swiss Albino mouse assessed as number of falls from rota-rod at 30 mg/kg after 15 mins relative to CMC | ChEMBL. | 17373780 |
| Activity (functional) | = 26.4 s | Antinociceptive effect in atropine treated Swiss Albino mouse assessed as licking latency at 30 mg/kg, sc by hot-plate test | ChEMBL. | 17373780 |
| Activity (functional) | = 26.4 s | Antinociceptive effect in atropine treated Swiss Albino mouse assessed as licking latency at 30 mg/kg, sc by hot-plate test | ChEMBL. | 17373780 |
| Activity (functional) | = 27.9 s | Antinociceptive effect in Swiss Albino mouse assessed as licking latency at 30 mg/kg, sc after 15 mins by hot-plate test | ChEMBL. | 17373780 |
| Activity (functional) | = 27.9 s | Antinociceptive effect in Swiss Albino mouse assessed as licking latency at 30 mg/kg, sc after 15 mins by hot-plate test | ChEMBL. | 17373780 |
| ED50 (functional) | = 19.6 mg kg-1 | Antinociceptive activity in sc dosed Swiss Albino mouse by hot-plate test | ChEMBL. | 17373780 |
| ED50 (functional) | = 19.6 mg kg-1 | Antinociceptive activity in sc dosed Swiss Albino mouse by hot-plate test | ChEMBL. | 17373780 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL375091
- PubChem: 16202878
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.