Detailed information for compound 431776
Basic information
Technical information
- TDR Targets ID: 431776
- Name: 2-(1,3-benzodioxol-5-ylmethyl)-4-chloro-6-(4- imidazol-1-ylphenoxy)pyrimidine
- MW: 406.822 | Formula: C21H15ClN4O3
-
H donors: 0
H acceptors: 3
LogP: 4.55
Rotable bonds: 5
Rule of 5 violations (Lipinski): 1 - SMILES: Clc1cc(Oc2ccc(cc2)n2cncc2)nc(n1)Cc1ccc2c(c1)OCO2
- InChi: 1S/C21H15ClN4O3/c22-19-11-21(29-16-4-2-15(3-5-16)26-8-7-23-12-26)25-20(24-19)10-14-1-6-17-18(9-14)28-13-27-17/h1-9,11-12H,10,13H2
- InChiKey: UWYBYGPZJAMGQU-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 2-(1,3-benzodioxol-5-ylmethyl)-4-chloro-6-[4-(1-imidazolyl)phenoxy]pyrimidine
- 4-chloro-6-(4-imidazol-1-ylphenoxy)-2-piperonyl-pyrimidine
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | nitric oxide synthase 2, inducible | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Trichomonas vaginalis | annexin VII, putative | 0.0121 | 1 | 1 |
| Echinococcus granulosus | synaptotagmin | 0.0121 | 1 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Toxoplasma gondii | C2 domain-containing protein | 0.0121 | 1 | 0.5 |
| Entamoeba histolytica | C2 domain containing protein | 0.0121 | 1 | 0.5 |
| Echinococcus multilocularis | synaptotagmin 15 | 0.0121 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Trypanosoma brucei | synaptotagmin, putative | 0.0121 | 1 | 1 |
| Echinococcus granulosus | synaptotagmin | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | Protein kinase C, brain isozyme | 0.0121 | 1 | 1 |
| Echinococcus granulosus | C2 calcium lipid binding region CaLB | 0.0121 | 1 | 1 |
| Toxoplasma gondii | hypothetical protein | 0.0121 | 1 | 0.5 |
| Entamoeba histolytica | C2 domain containing protein | 0.0121 | 1 | 0.5 |
| Trichomonas vaginalis | synaptotagmin, putative | 0.0121 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein, conserved | 0.0121 | 1 | 0.5 |
| Plasmodium falciparum | ferlin, putative | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | synaptotagmin, putative | 0.0121 | 1 | 1 |
| Echinococcus granulosus | otoferlin | 0.0121 | 1 | 1 |
| Entamoeba histolytica | C2 domain containing protein | 0.0121 | 1 | 0.5 |
| Entamoeba histolytica | hypothetical protein, conserved | 0.0121 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Plasmodium vivax | double C2-like domain-containing protein, putative | 0.0121 | 1 | 1 |
| Schistosoma mansoni | unc-13 (munc13) | 0.0121 | 1 | 1 |
| Chlamydia trachomatis | sulfite reductase | 0.002 | 0 | 0.5 |
| Leishmania major | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Brugia malayi | Synapse defective protein 1 | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | Proline-rich protein, putative | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | NEDD4 E3 ubiquitin protein ligase WWP1 | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | C2 calcium lipid binding region, CaLB | 0.0121 | 1 | 1 |
| Echinococcus granulosus | protein kinase C gamma type | 0.0121 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Brugia malayi | LD23056p | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | phosphatidylinositol-specific phospholipase C | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Brugia malayi | Copine VIII | 0.0121 | 1 | 1 |
| Plasmodium vivax | NADPH-cytochrome p450 reductase, putative | 0.0032 | 0.1225 | 0.0399 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Echinococcus granulosus | C2 calcium dependent membrane targeting | 0.0121 | 1 | 1 |
| Brugia malayi | Phosphatidylinositol-specific phospholipase C, X domain containing protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | subfamily C1A unassigned peptidase (C01 family) | 0.0121 | 1 | 1 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | C2 calcium dependent membrane targeting | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | copine, putative | 0.0121 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Echinococcus granulosus | Immunoglobulin E set | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | splicing factor 3A subunit, putative | 0.0121 | 1 | 1 |
| Brugia malayi | Synaptotagmin protein 3 | 0.0121 | 1 | 1 |
| Echinococcus granulosus | protein kinase c epsilon type | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | variant SH3 domain-containing protein | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | NADPH dependent diflavin oxidoreductase 1 | 0.0032 | 0.1225 | 0.1225 |
| Echinococcus multilocularis | serine threonine protein kinase | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | unc 13 (munc13) | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | C2 calcium dependent membrane targeting | 0.0121 | 1 | 1 |
| Echinococcus granulosus | C2 calcium lipid binding region CaLB | 0.0121 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0121 | 1 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Trypanosoma brucei | predicted C2 domain protein | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | synaptotagmin | 0.0121 | 1 | 1 |
| Trypanosoma brucei | predicted C2 domain protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | synaptotagmin 1,2, putative | 0.0121 | 1 | 1 |
| Leishmania major | c2 domain protein, putative | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | synaptotagmin | 0.0121 | 1 | 1 |
| Schistosoma mansoni | rabphilin-3a | 0.0121 | 1 | 1 |
| Schistosoma mansoni | synaptotagmin | 0.0121 | 1 | 1 |
| Entamoeba histolytica | Rap/Ran GTPase activating protein, putative | 0.0121 | 1 | 0.5 |
| Trichomonas vaginalis | sulfite reductase, putative | 0.0032 | 0.1225 | 0.0399 |
| Brugia malayi | flavodoxin family protein | 0.0032 | 0.1225 | 0.1225 |
| Loa Loa (eye worm) | copine family protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Trypanosoma brucei | predicted C2 domain protein | 0.0121 | 1 | 1 |
| Echinococcus granulosus | protein piccolo | 0.0121 | 1 | 1 |
| Echinococcus granulosus | copine 9 | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | AGC/PKC/ETA protein kinase | 0.0121 | 1 | 1 |
| Onchocerca volvulus | Multiple C2 domain and transmembrane region protein homolog | 0.0121 | 1 | 0.5 |
| Trypanosoma brucei | C2 domain containing protein, putative | 0.0121 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Schistosoma mansoni | synaptotagmin 12 | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | synaptotagmin, putative | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | C2 domain-containing protein | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | extended synaptotagmin 2 | 0.0121 | 1 | 1 |
| Echinococcus granulosus | synaptotagmin 2 | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | calcium-dependent lipid-binding protein, putative | 0.0121 | 1 | 1 |
| Echinococcus granulosus | C2 calcium dependent membrane targeting | 0.0121 | 1 | 1 |
| Trypanosoma brucei | C2 domain containing protein, putative | 0.0121 | 1 | 1 |
| Onchocerca volvulus | Putative cc2d1b protein | 0.0121 | 1 | 0.5 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Plasmodium vivax | ferlin, putative | 0.0121 | 1 | 1 |
| Brugia malayi | Synapse defective protein 1 | 0.0121 | 1 | 1 |
| Brugia malayi | Copine family protein | 0.0121 | 1 | 1 |
| Toxoplasma gondii | Sma protein | 0.0121 | 1 | 0.5 |
| Brugia malayi | phospholipase C homolog | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | synaptotagmin, putative | 0.0121 | 1 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | FAD binding domain-containing protein | 0.0032 | 0.1225 | 0.1225 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | synaptotagmin 2 | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | C2 domain-containing protein | 0.0121 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0121 | 1 | 0.5 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | synaptotagmin 1,2, putative | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | Nedd4-PD | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | synaptotagmin 1, 3, C.elegans, putative | 0.0121 | 1 | 1 |
| Trypanosoma cruzi | C2 domain containing protein, putative | 0.0121 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0121 | 1 | 0.5 |
| Trypanosoma cruzi | synaptotagmin, putative | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | synaptotagmin-1 | 0.0121 | 1 | 1 |
| Brugia malayi | Synaptotagmin I | 0.0121 | 1 | 1 |
| Entamoeba histolytica | DENN domain protein | 0.0121 | 1 | 0.5 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | nedd-4-like E3 ubiquitin-protein ligase | 0.0121 | 1 | 1 |
| Toxoplasma gondii | ferlin family protein | 0.0121 | 1 | 0.5 |
| Schistosoma mansoni | protein kinase C | 0.0121 | 1 | 1 |
| Schistosoma mansoni | E3 ubiquitin-protein ligase nedd-4 | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | protein kinase c epsilon type | 0.0121 | 1 | 1 |
| Onchocerca volvulus | 0.0121 | 1 | 0.5 | |
| Echinococcus multilocularis | synaptotagmin | 0.0121 | 1 | 1 |
| Mycobacterium ulcerans | formate dehydrogenase H FdhF | 0.0032 | 0.1225 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | copine 9 | 0.0121 | 1 | 1 |
| Echinococcus granulosus | multiple C2 and transmembrane domain containing protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | unc-13 (munc13) | 0.0121 | 1 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | copine, putative | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | multiple C2 and transmembrane domain containing protein | 0.0121 | 1 | 1 |
| Onchocerca volvulus | 0.0121 | 1 | 0.5 | |
| Loa Loa (eye worm) | C2 domain-containing protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | phosphatidylinositol-45-bisphosphate 3-kinase catalytic subunit alpha PI3K | 0.0121 | 1 | 1 |
| Trypanosoma cruzi | C2 domain/Ankyrin repeats (3 copies), putative | 0.0121 | 1 | 1 |
| Plasmodium falciparum | double C2-like domain-containing protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0121 | 1 | 1 |
| Echinococcus granulosus | Protein kinase C brain isozyme | 0.0121 | 1 | 1 |
| Onchocerca volvulus | 0.0121 | 1 | 0.5 | |
| Schistosoma mansoni | synaptotagmin | 0.0121 | 1 | 1 |
| Toxoplasma gondii | hypothetical protein | 0.0121 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | synaptic ras gtpase activating protein syngap | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | ion channel nompc, putative | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | NADPH cytochrome P450 reductase | 0.0032 | 0.1225 | 0.1225 |
| Echinococcus granulosus | myoferlin | 0.0121 | 1 | 1 |
| Trypanosoma cruzi | phosphoinositide-specific phospholipase C, putative | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 0.1225 | 0.1225 |
| Trypanosoma brucei | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | C2 calcium dependent membrane targeting | 0.0121 | 1 | 1 |
| Echinococcus granulosus | NEDD4 E3 ubiquitin protein ligase WWP1 | 0.0121 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | synaptotagmin 1,2, putative | 0.0121 | 1 | 1 |
| Toxoplasma gondii | phosphoinositide phospholipase PIPLC | 0.0121 | 1 | 0.5 |
| Schistosoma mansoni | phospholipase C-like protein 2 plc-L2 | 0.0121 | 1 | 1 |
| Schistosoma mansoni | synaptotagmin | 0.0121 | 1 | 1 |
| Leishmania major | copine i-like protein | 0.0121 | 1 | 1 |
| Echinococcus granulosus | calpain 5 | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | neural cell expressed, developmentally | 0.0121 | 1 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | synaptotagmin | 0.0121 | 1 | 1 |
| Onchocerca volvulus | 0.0121 | 1 | 0.5 | |
| Echinococcus granulosus | neural cell expressed developmentally | 0.0121 | 1 | 1 |
| Schistosoma mansoni | synaptotagmin-like protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | synaptotagmin 1, 3, C.elegans, putative | 0.0121 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0121 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | copine, putative | 0.0121 | 1 | 1 |
| Trypanosoma brucei | C2 domain containing protein, putative | 0.0121 | 1 | 1 |
| Schistosoma mansoni | unc-13 (munc13) | 0.0121 | 1 | 1 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0121 | 1 | 1 |
| Echinococcus granulosus | synaptotagmin | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Giardia lamblia | Nitric oxide synthase, inducible | 0.0029 | 0.0861 | 0.5 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | ankyrin repeat-containing protein, putative | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | C2 calcium lipid binding region, CaLB | 0.0121 | 1 | 1 |
| Schistosoma mansoni | rho gtpase activating protein | 0.0121 | 1 | 1 |
| Onchocerca volvulus | 0.0121 | 1 | 0.5 | |
| Schistosoma mansoni | regulator of G protein signaling 3 rgs3 | 0.0121 | 1 | 1 |
| Schistosoma mansoni | synaptotagmin 12 | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | synaptotagmin, putative | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | Circumsporozoite protein precursor, putative | 0.0121 | 1 | 1 |
| Echinococcus granulosus | NADPH cytochrome P450 reductase | 0.0032 | 0.1225 | 0.1225 |
| Leishmania major | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | C2 calcium dependent membrane targeting | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Trypanosoma brucei | phosphoinositide-specific phospholipase C | 0.0121 | 1 | 1 |
| Entamoeba histolytica | C2 domain containing protein | 0.0121 | 1 | 0.5 |
| Entamoeba histolytica | hypothetical protein | 0.0121 | 1 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Toxoplasma gondii | hypothetical protein | 0.0121 | 1 | 0.5 |
| Trypanosoma brucei | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | C2 domain-containing protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | glut4 vesicle protein-related | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Trypanosoma cruzi | cytoskeleton associated protein, putative | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Leishmania major | p450 reductase, putative | 0.0032 | 0.1225 | 0.0399 |
| Echinococcus multilocularis | UNCoordinated family member (unc 13) | 0.0121 | 1 | 1 |
| Trypanosoma brucei | C2 domain containing protein, putative | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | synaptotagmin | 0.0121 | 1 | 1 |
| Trypanosoma brucei | Coiled-coil and C2 domain-containing protein | 0.0121 | 1 | 1 |
| Onchocerca volvulus | 0.0121 | 1 | 0.5 | |
| Echinococcus granulosus | C2 calcium dependent membrane targeting | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | myoferlin | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | active breakpoint cluster region | 0.0121 | 1 | 1 |
| Echinococcus granulosus | extended synaptotagmin 2 | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | copine, putative | 0.0121 | 1 | 1 |
| Schistosoma mansoni | Mername-AA248 (C02 family) | 0.0121 | 1 | 1 |
| Entamoeba histolytica | C2 domain containing protein | 0.0121 | 1 | 0.5 |
| Entamoeba histolytica | C2 domain protein, putative | 0.0121 | 1 | 0.5 |
| Brugia malayi | calpain 5 | 0.0121 | 1 | 1 |
| Echinococcus granulosus | synaptotagmin | 0.0121 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | calpain 5 | 0.0121 | 1 | 1 |
| Plasmodium falciparum | conserved Plasmodium protein, unknown function | 0.0121 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0121 | 1 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | synaptotagmin, putative | 0.0121 | 1 | 1 |
| Entamoeba histolytica | C2 domain containing protein | 0.0121 | 1 | 0.5 |
| Echinococcus granulosus | C2 calcium dependent membrane targeting | 0.0121 | 1 | 1 |
| Echinococcus granulosus | UNCoordinated family member unc 13 | 0.0121 | 1 | 1 |
| Trypanosoma cruzi | cytoskeleton associated protein, putative | 0.0121 | 1 | 1 |
| Schistosoma mansoni | synaptotagmin | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | synaptotagmin protein 4 | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | vab10 spectraplakin, putative | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Brugia malayi | FAD binding domain containing protein | 0.0032 | 0.1225 | 0.1225 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Echinococcus granulosus | multiple C2 and transmembrane domain containing protein | 0.0121 | 1 | 1 |
| Plasmodium vivax | ferlin, putative | 0.0121 | 1 | 1 |
| Brugia malayi | Phosphatidylinositol 3- and 4-kinase family protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | synaptotagmin | 0.0121 | 1 | 1 |
| Schistosoma mansoni | fer-1-related | 0.0121 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0121 | 1 | 1 |
| Trypanosoma brucei | cAMP binding protein, putative | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | copine, putative | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | C2 domain-containing protein | 0.0121 | 1 | 1 |
| Brugia malayi | Variant SH3 domain containing protein | 0.0121 | 1 | 1 |
| Entamoeba histolytica | C2 domain containing protein | 0.0121 | 1 | 0.5 |
| Leishmania major | phospholipase c-like protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | C2 domain-containing protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Echinococcus granulosus | synaptotagmin 15 | 0.0121 | 1 | 1 |
| Entamoeba histolytica | C2 domain containing protein | 0.0121 | 1 | 0.5 |
| Echinococcus granulosus | synaptotagmin protein 4 | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | synaptotagmin, putative | 0.0121 | 1 | 1 |
| Brugia malayi | NEDD4.2 | 0.0121 | 1 | 1 |
| Echinococcus granulosus | unc 13 munc13 | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Echinococcus granulosus | active breakpoint cluster region | 0.0121 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Onchocerca volvulus | 0.0121 | 1 | 0.5 | |
| Entamoeba histolytica | calcium-binding protein, putative | 0.0121 | 1 | 0.5 |
| Onchocerca volvulus | 0.0121 | 1 | 0.5 | |
| Leishmania major | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Schistosoma mansoni | cytochrome P450 reductase | 0.0032 | 0.1225 | 0.1225 |
| Brugia malayi | protein kinase C II. | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | intersectin 2 | 0.0121 | 1 | 1 |
| Echinococcus granulosus | copine 9 | 0.0121 | 1 | 1 |
| Trypanosoma brucei | C2 domain/Ankyrin repeats (3 copies), putative | 0.0121 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0121 | 1 | 0.5 |
| Echinococcus multilocularis | 1 phosphatidylinositol 4,5 bisphosphate | 0.0121 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0121 | 1 | 1 |
| Brugia malayi | WW domain containing protein | 0.0121 | 1 | 1 |
| Echinococcus granulosus | intersectin 2 | 0.0121 | 1 | 1 |
| Echinococcus granulosus | 1-Phosphatidylinositol-4,5-bisphosphate phosphodiesterase beta-4 | 0.0121 | 1 | 1 |
| Schistosoma mansoni | mctp-related | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Toxoplasma gondii | Elicitor-responsive protein, putative | 0.0121 | 1 | 0.5 |
| Plasmodium vivax | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Trypanosoma cruzi | Coiled-coil and C2 domain-containing protein | 0.0121 | 1 | 1 |
| Echinococcus granulosus | NADPH dependent diflavin oxidoreductase 1 | 0.0032 | 0.1225 | 0.1225 |
| Loa Loa (eye worm) | phosphatidylinositol 3-kinase catalytic subunit gamma | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Brugia malayi | Protein kinase c protein 2 | 0.0121 | 1 | 1 |
| Echinococcus granulosus | synaptotagmin | 0.0121 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0121 | 1 | 1 |
| Giardia lamblia | Hypothetical protein | 0.0029 | 0.0861 | 0.5 |
| Echinococcus multilocularis | 0.0121 | 1 | 1 | |
| Entamoeba histolytica | C2 domain containing protein | 0.0121 | 1 | 0.5 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | multiple C2 and transmembrane domain containing protein | 0.0121 | 1 | 1 |
| Trypanosoma cruzi | synaptotagmin, putative | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | rab3 interacting molecule (rim)-related | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | protein piccolo | 0.0121 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Schistosoma mansoni | copine | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | synaptotagmin | 0.0121 | 1 | 1 |
| Schistosoma mansoni | otoferlin | 0.0121 | 1 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | copine 9 | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Leishmania major | NADPH-cytochrome p450 reductase-like protein | 0.0032 | 0.1225 | 0.0399 |
| Trypanosoma cruzi | cAMP binding protein, putative | 0.0121 | 1 | 1 |
| Leishmania major | c2 domain protein, putative | 0.0121 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0121 | 1 | 0.5 |
| Loa Loa (eye worm) | AGC/PKC/ALPHA protein kinase | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Plasmodium falciparum | ferlin, putative | 0.0121 | 1 | 1 |
Activities
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- PubChem: 10158280
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.