Detailed information for compound 435018
Basic information
Technical information
- Name: Unnamed compound
- MW: 436.914 | Formula: C22H17ClN4O2S
-
H donors: 1
H acceptors: 3
LogP: 7.54
Rotable bonds: 6
Rule of 5 violations (Lipinski): 1 - SMILES: [O-][N+](=O)c1ccc(cc1)/C=C/c1sc(n[n+]1c1ccccc1)Nc1ccccc1.[Cl-]
- InChi: 1S/C22H17N4O2S.ClH/c27-26(28)20-14-11-17(12-15-20)13-16-21-25(19-9-5-2-6-10-19)24-22(29-21)23-18-7-3-1-4-8-18;/h1-16H,(H,23,24);1H/q+1;/p-1/b16-13+;
- InChiKey: MNQXCJLZMYMTSC-ZUQRMPMESA-M
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Leishmania infantum | trypanothione reductase | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Plasmodium falciparum | dihydrolipoyl dehydrogenase, apicoplast | trypanothione reductase | 491 aa | 555 aa | 23.8 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus granulosus | dihydrolipoamide dehydrogenase | 0.0026 | 0.1881 | 0.1881 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0052 | 0.6096 | 0.5192 |
| Schistosoma mansoni | inositol monophosphatase | 0.0042 | 0.4456 | 0.3172 |
| Trypanosoma cruzi | myo-inositol-1(or 4)-monophosphatase 1, putative | 0.0042 | 0.4456 | 0.3172 |
| Echinococcus granulosus | guanine nucleotide binding protein Gs subunit | 0.0052 | 0.6096 | 0.6096 |
| Schistosoma mansoni | intermediate filament proteins | 0.0031 | 0.2599 | 0.0885 |
| Toxoplasma gondii | inositol(myo)-1(or 4)-monophosphatase 2, putative | 0.0042 | 0.4456 | 0.3172 |
| Echinococcus multilocularis | lamin dm0 | 0.0031 | 0.2599 | 0.2599 |
| Loa Loa (eye worm) | thioredoxin reductase | 0.0076 | 1 | 1 |
| Trypanosoma cruzi | myo-inositol-1(or 4)-monophosphatase 1, putative | 0.0042 | 0.4456 | 0.3172 |
| Echinococcus multilocularis | musashi | 0.0031 | 0.2599 | 0.2599 |
| Trichomonas vaginalis | inositol monophosphatase, putative | 0.0042 | 0.4456 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 0.2599 | 0.2599 |
| Echinococcus multilocularis | thioredoxin glutathione reductase | 0.0076 | 1 | 1 |
| Leishmania major | trypanothione reductase | 0.0076 | 1 | 1 |
| Brugia malayi | Inositol-1 | 0.0042 | 0.4456 | 0.4304 |
| Brugia malayi | dihydrolipoyl dehydrogenase, mitochondrial precursor, putative | 0.0026 | 0.1881 | 0.1659 |
| Trichomonas vaginalis | myo inositol monophosphatase, putative | 0.0042 | 0.4456 | 1 |
| Loa Loa (eye worm) | intermediate filament protein | 0.0031 | 0.2599 | 0.2599 |
| Brugia malayi | Pyridine nucleotide-disulphide oxidoreductase, dimerisation domain containing protein | 0.0019 | 0.0738 | 0.0484 |
| Echinococcus multilocularis | lamin | 0.0031 | 0.2599 | 0.2599 |
| Treponema pallidum | NADH oxidase | 0.0026 | 0.1881 | 0.5 |
| Chlamydia trachomatis | dihydrolipoyl dehydrogenase | 0.0026 | 0.1881 | 0.5 |
| Echinococcus granulosus | lamin dm0 | 0.0031 | 0.2599 | 0.2599 |
| Brugia malayi | Thioredoxin reductase | 0.0076 | 1 | 1 |
| Mycobacterium ulcerans | extragenic suppressor protein SuhB | 0.0042 | 0.4456 | 1 |
| Entamoeba histolytica | myo-inositol monophosphatase, putative | 0.0042 | 0.4456 | 0.5 |
| Onchocerca volvulus | 0.0031 | 0.2599 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.003 | 0.2507 | 0.2507 |
| Brugia malayi | Intermediate filament tail domain containing protein | 0.0031 | 0.2599 | 0.2396 |
| Giardia lamblia | NADH oxidase lateral transfer candidate | 0.0026 | 0.1881 | 0.5 |
| Loa Loa (eye worm) | inositol-1 | 0.0042 | 0.4456 | 0.4456 |
| Echinococcus multilocularis | inositol monophosphatase 1 | 0.0042 | 0.4456 | 0.4456 |
| Mycobacterium leprae | possible inositol monophosphatase SubH (IMPase) (inositol-1-phosphatase) (I-1-Pase ). | 0.0038 | 0.3735 | 1 |
| Wolbachia endosymbiont of Brugia malayi | fructose-1,6-bisphosphatase | 0.0042 | 0.4456 | 1 |
| Plasmodium falciparum | thioredoxin reductase | 0.0076 | 1 | 1 |
| Plasmodium vivax | thioredoxin reductase, putative | 0.0076 | 1 | 1 |
| Leishmania major | myo-inositol-1(or 4)-monophosphatase 1, putative | 0.0042 | 0.4456 | 0.3172 |
| Echinococcus granulosus | guanine nucleotide binding protein Gs subunit | 0.0052 | 0.6096 | 0.6096 |
| Loa Loa (eye worm) | cytoplasmic intermediate filament protein | 0.0016 | 0.0267 | 0.0267 |
| Trypanosoma cruzi | trypanothione reductase, putative | 0.0076 | 1 | 1 |
| Echinococcus granulosus | thioredoxin glutathione reductase | 0.0076 | 1 | 1 |
| Echinococcus multilocularis | dihydrolipoamide dehydrogenase | 0.0026 | 0.1881 | 0.1881 |
| Trypanosoma brucei | inositol-1(or 4)-monophosphatase 1, putative | 0.0042 | 0.4456 | 0.3172 |
| Echinococcus granulosus | intermediate filament protein | 0.0031 | 0.2599 | 0.2599 |
| Plasmodium falciparum | glutathione reductase | 0.0076 | 1 | 1 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0052 | 0.6096 | 0.5192 |
| Brugia malayi | GTP-binding regulatory protein Gs alpha-S chain, putative | 0.0052 | 0.6096 | 0.599 |
| Mycobacterium tuberculosis | Inositol-1-monophosphatase SuhB | 0.0038 | 0.3735 | 0.2283 |
| Loa Loa (eye worm) | intermediate filament tail domain-containing protein | 0.0031 | 0.2599 | 0.2599 |
| Plasmodium vivax | glutathione reductase, putative | 0.0076 | 1 | 1 |
| Schistosoma mansoni | lamin | 0.0031 | 0.2599 | 0.0885 |
| Brugia malayi | intermediate filament protein | 0.0031 | 0.2599 | 0.2396 |
| Echinococcus granulosus | lamin | 0.0031 | 0.2599 | 0.2599 |
| Loa Loa (eye worm) | glutathione reductase | 0.0076 | 1 | 1 |
| Trypanosoma brucei | trypanothione reductase | 0.0076 | 1 | 1 |
| Toxoplasma gondii | thioredoxin reductase | 0.0076 | 1 | 1 |
| Echinococcus multilocularis | guanine nucleotide binding protein G(s) subunit | 0.0052 | 0.6096 | 0.6096 |
| Mycobacterium tuberculosis | NADPH-dependent mycothiol reductase Mtr | 0.0076 | 1 | 1 |
| Trichomonas vaginalis | myo inositol monophosphatase, putative | 0.0042 | 0.4456 | 1 |
| Loa Loa (eye worm) | GTP-binding regulatory protein Gs alpha-S chain | 0.0052 | 0.6096 | 0.6096 |
| Schistosoma mansoni | lamin | 0.0031 | 0.2599 | 0.0885 |
| Echinococcus granulosus | inositol monophosphatase 1 | 0.0042 | 0.4456 | 0.4456 |
| Schistosoma mansoni | inositol monophosphatase | 0.0042 | 0.4456 | 0.3172 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0052 | 0.6096 | 0.5192 |
| Echinococcus multilocularis | guanine nucleotide binding protein G(s) subunit | 0.0052 | 0.6096 | 0.6096 |
| Brugia malayi | alpha keto acid dehydrogenase complex, E3 component, lipoamide dehydrogenase | 0.0019 | 0.0738 | 0.0484 |
| Onchocerca volvulus | 0.0031 | 0.2599 | 0.5 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| ED50 (functional) | = 22.83 uM | Antileishmanial activity against Leishmania chagasi MCAN/BR/97/P142 proamastigotes | ChEMBL. | 17367894 |
| ED50 (functional) | = 70.77 uM | Antileishmanial activity against Leishmania braziliensis MCAN/BR/98/R619 proamastigotes | ChEMBL. | 17367894 |
| ED50 (functional) | = 70.77 uM | Antileishmanial activity against Leishmania braziliensis MCAN/BR/98/R619 proamastigotes | ChEMBL. | 17367894 |
| IC50 (binding) | = 1.63 uM | Non-competitive inhibition of recombinant Leishmania infantum MHOM/MA67ITMAP263 trypanothione reductase assessed as inhibition of NADPH consumption using trypanothione disulfide as substrate at 1 uM by Michaelis-Menten and Lineweaver-Burk plot analysis | ChEMBL. | 22304847 |
| Inhibition (binding) | = 69 % | Inhibition of recombinant Trypanosoma cruzi Y trypanothione reductase assessed as inhibition of NADPH consumption using trypanothione disulfide as substrate at 1 uM after 60 secs by spectrophotometer | ChEMBL. | 22304847 |
| Inhibition (binding) | = 70 % | Inhibition of trypanothione reductase in promastigotes of Leishmania infantum MHOM/MA67ITMAP263 extracts assessed as NADPH consumption using trypanothione disulfide as substrate at 1 uM after 5 sec by spectrophotometer | ChEMBL. | 22304847 |
| Inhibition (binding) | = 76 % | Inhibition of recombinant Leishmania infantum MHOM/MA67ITMAP263 trypanothione reductase assessed as inhibition of NADPH consumption using trypanothione disulfide as substrate at 1 uM after 60 secs by spectrophotometer | ChEMBL. | 22304847 |
| Inhibition (binding) | = 76 % | Inhibition of trypanothione reductase in Leishmania amazonensis MHOM/BR/LTB0016 extracts assessed as NADPH consumption using trypanothione disulfide as substrate at 1 uM after 5 sec by spectrophotometer | ChEMBL. | 22304847 |
| Inhibition (binding) | = 83 % | Inhibition of trypanothione reductase epimastigotes of Trypanosoma cruzi Y extracts assessed as NADPH consumption using trypanothione disulfide as substrate at 1 uM after 5 sec by spectrophotometer | ChEMBL. | 22304847 |
| TD50 (ADMET) | = 5.49 uM | Cytotoxicity against BALB/c mouse peritoneal macrophages assessed as cell viability after 24 hrs by MTT assay | ChEMBL. | 17367894 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL242165
Bibliographic References
2 literature references were collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.