Detailed information for compound 43578
Basic information
Technical information
- TDR Targets ID: 43578
- Name: 2-cyano-2-[5-fluoro-1-[(4-methylphenyl)methyl ]-2-oxo-3H-indol-3-yl]acetic acid
- MW: 338.332 | Formula: C19H15FN2O3
-
H donors: 1
H acceptors: 4
LogP: 2.43
Rotable bonds: 4
Rule of 5 violations (Lipinski): 1 - SMILES: N#CC(C1c2cc(F)ccc2N(C1=O)Cc1ccc(cc1)C)C(=O)O
- InChi: 1S/C19H15FN2O3/c1-11-2-4-12(5-3-11)10-22-16-7-6-13(20)8-14(16)17(18(22)23)15(9-21)19(24)25/h2-8,15,17H,10H2,1H3,(H,24,25)
- InChiKey: CUKXYRVTVMBQCR-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 2-cyano-2-[5-fluoro-2-oxo-1-(p-tolylmethyl)indolin-3-yl]acetic acid
- 2-cyano-2-[5-fluoro-2-oxo-1-(p-tolylmethyl)-3-indolinyl]acetic acid
- 2-cyano-2-[5-fluoro-1-[(4-methylphenyl)methyl]-2-oxo-3H-indol-3-yl]ethanoic acid
- 2-cyano-2-[5-fluoro-2-keto-1-(4-methylbenzyl)indolin-3-yl]acetic acid
- 2-cyano-2-[5-fluoro-1-[(4-methylphenyl)methyl]-2-oxo-indolin-3-yl]acetic acid
- 2-cyano-2-[5-fluoro-1-[(4-methylphenyl)methyl]-2-oxo-3-indolinyl]acetic acid
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Rattus norvegicus | Aldose reductase | Starlite/ChEMBL | References |
| Rattus norvegicus | Aldehyde reductase | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Giardia lamblia | Aldose reductase | 0.0077 | 1 | 0.5 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0077 | 1 | 1 |
| Entamoeba histolytica | aldose reductase, putative | 0.0077 | 1 | 0.5 |
| Mycobacterium ulcerans | oxidoreductase | 0.0077 | 1 | 0.5 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0077 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0077 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0077 | 1 | 0.5 |
| Schistosoma mansoni | aldo-keto reductase | 0.0077 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0077 | 1 | 0.5 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0077 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0077 | 1 | 1 |
| Toxoplasma gondii | aldose reductase, putative | 0.0077 | 1 | 0.5 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0077 | 1 | 0.5 |
| Entamoeba histolytica | aldose reductase, putative | 0.0077 | 1 | 0.5 |
| Mycobacterium leprae | PROBABLE OXIDOREDUCTASE | 0.0077 | 1 | 1 |
| Onchocerca volvulus | 0.0077 | 1 | 0.5 | |
| Giardia lamblia | Aldose reductase | 0.0077 | 1 | 0.5 |
| Onchocerca volvulus | 0.0077 | 1 | 0.5 | |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0077 | 1 | 0.5 |
| Leishmania major | aldehyde reductase, putative,oxidoreductase, putative | 0.0077 | 1 | 0.5 |
| Echinococcus multilocularis | aldo keto reductase | 0.0077 | 1 | 1 |
| Trypanosoma cruzi | aldo-keto reductase | 0.0077 | 1 | 0.5 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0077 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0077 | 1 | 0.5 |
| Echinococcus granulosus | aldo keto reductase | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase | 0.0077 | 1 | 1 |
| Entamoeba histolytica | aldose reductase, putative | 0.0077 | 1 | 0.5 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0077 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0077 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0077 | 1 | 0.5 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0077 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase | 0.0077 | 1 | 1 |
| Schistosoma mansoni | aldo-keto reductase | 0.0077 | 1 | 0.5 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0077 | 1 | 0.5 |
| Trichomonas vaginalis | aldo/keto reductase, putative | 0.0077 | 1 | 0.5 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0077 | 1 | 0.5 |
| Trypanosoma cruzi | aldo/keto reductase, putative | 0.0077 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0077 | 1 | 0.5 |
| Echinococcus granulosus | hypothetical protein | 0.0077 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0077 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0077 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, aldo/keto reductase family protein | 0.0077 | 1 | 0.5 |
| Leishmania major | aldo-keto reductase-like protein | 0.0077 | 1 | 0.5 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0077 | 1 | 1 |
| Leishmania major | prostaglandin f synthase, putative | 0.0077 | 1 | 0.5 |
| Onchocerca volvulus | 0.0077 | 1 | 0.5 | |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0077 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0077 | 1 | 0.5 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0077 | 1 | 1 |
| Onchocerca volvulus | 0.0077 | 1 | 0.5 | |
| Trichomonas vaginalis | dihydrodiol dehydrogenase, putative | 0.0077 | 1 | 0.5 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0077 | 1 | 1 |
| Brugia malayi | oxidoreductase, aldo/keto reductase family protein | 0.0077 | 1 | 0.5 |
| Trichomonas vaginalis | dihydrodiol dehydrogenase, putative | 0.0077 | 1 | 0.5 |
| Leishmania major | prostaglandin f2-alpha synthase/D-arabinose dehydrogenase | 0.0077 | 1 | 0.5 |
| Trichomonas vaginalis | aldo/keto reductase, putative | 0.0077 | 1 | 0.5 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0077 | 1 | 0.5 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase | 0.0077 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0077 | 1 | 0.5 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0077 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0077 | 1 | 0.5 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0077 | 1 | 0.5 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0077 | 1 | 0.5 |
| Trypanosoma brucei | aldo-keto reductase, putative | 0.0077 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, aldo/keto reductase family protein | 0.0077 | 1 | 0.5 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0077 | 1 | 1 |
| Trypanosoma brucei | prostaglandin f synthase | 0.0077 | 1 | 0.5 |
| Onchocerca volvulus | 0.0077 | 1 | 0.5 | |
| Schistosoma mansoni | pol-related | 0.0077 | 1 | 0.5 |
| Echinococcus multilocularis | aldo keto reductase | 0.0077 | 1 | 1 |
| Trichomonas vaginalis | aldo/keto reductase, putative | 0.0077 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0077 | 1 | 0.5 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0077 | 1 | 1 |
| Trichomonas vaginalis | dihydrodiol dehydrogenase, putative | 0.0077 | 1 | 0.5 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0077 | 1 | 0.5 |
| Onchocerca volvulus | 0.0077 | 1 | 0.5 | |
| Echinococcus granulosus | aldo keto reductase | 0.0077 | 1 | 1 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0077 | 1 | 0.5 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | uM | In vitro inhibitory activity against sorbitol dehydrogenase (SD) from sheep liver; Not active | ChEMBL. | 12672241 |
| IC50 (binding) | uM | In vitro inhibitory activity against glutathione reductase (GR) from bakers yeast; Not active | ChEMBL. | 12672241 |
| IC50 (binding) | 0 uM | In vitro inhibitory activity against sorbitol dehydrogenase (SD) from sheep liver; Not active | ChEMBL. | 12672241 |
| IC50 (binding) | 0 uM | In vitro inhibitory activity against glutathione reductase (GR) from bakers yeast; Not active | ChEMBL. | 12672241 |
| IC50 (binding) | = 0.042 uM | In vitro inhibitory activity against aldose reductase (ALR2) from rat lens extraction. | ChEMBL. | 12672241 |
| IC50 (binding) | = 0.042 uM | In vitro inhibitory activity against aldose reductase (ALR2) from rat lens extraction. | ChEMBL. | 12672241 |
| IC50 (binding) | = 0.075 uM | In vitro inhibitory activity against aldose reductase (ALR2) from rat lens extraction. | ChEMBL. | 12672241 |
| IC50 (binding) | = 0.075 uM | In vitro inhibitory activity against aldose reductase (ALR2) from rat lens extraction. | ChEMBL. | 12672241 |
| IC50 (binding) | = 0.69 uM | In vitro inhibitory activity against aldehyde reductase 1 (ALR1) from rat kidney. | ChEMBL. | 12672241 |
| IC50 (binding) | = 0.69 uM | In vitro inhibitory activity against aldehyde reductase 1 (ALR1) from rat kidney. | ChEMBL. | 12672241 |
| Nuclear cataract (functional) | = 0 % | Ability to prevent cataract development in severly galactosemic rat treated with 3 percent ophthalmic solution on day 11 | ChEMBL. | 12672241 |
| Nuclear cataract (functional) | = 0 % | Ability to prevent cataract development in severly galactosemic rat treated with 3 percent ophthalmic solution on day 12 | ChEMBL. | 12672241 |
| Nuclear cataract (functional) | = 0 % | Ability to prevent cataract development in severly galactosemic rat treated with 3 percent ophthalmic solution on day 13 | ChEMBL. | 12672241 |
| Nuclear cataract (functional) | = 18 % | Ability to prevent cataract development in severly galactosemic rat treated with 3 percent ophthalmic solution on day 14 | ChEMBL. | 12672241 |
| Nuclear cataract (functional) | = 43 % | Ability to prevent cataract development in severly galactosemic rat treated with 3 percent ophthalmic solution on day 15 | ChEMBL. | 12672241 |
| Nuclear cataract (functional) | = 57 % | Ability to prevent cataract development in severly galactosemic rat treated with 3 percent ophthalmic solution on day 16 | ChEMBL. | 12672241 |
| Nuclear cataract (functional) | = 57 % | Ability to prevent cataract development in severly galactosemic rat treated with 3 percent ophthalmic solution on day 17 | ChEMBL. | 12672241 |
| Nuclear cataract (functional) | = 72 % | Ability to prevent cataract development in severly galactosemic rat treated with 3 percent ophthalmic solution on day 18 | ChEMBL. | 12672241 |
| Nuclear cataract (functional) | = 84 % | Ability to prevent cataract development in severly galactosemic rat treated with 3 percent ophthalmic solution on day 19 | ChEMBL. | 12672241 |
| Nuclear cataract (functional) | = 96 % | Ability to prevent cataract development in severly galactosemic rat treated with 3 percent ophthalmic solution on day 20 | ChEMBL. | 12672241 |
| Nuclear cataract (functional) | = 100 % | Ability to prevent cataract development in severly galactosemic rat treated with 3 percent ophthalmic solution on day 21 | ChEMBL. | 12672241 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL30993
- PubChem: 10065711
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.